first commit

node_modules/karma/node_modules/ansi-styles/index.d.ts

@@ -0,0 +1,345 @@
+declare type CSSColor =
+	| 'aliceblue'
+	| 'antiquewhite'
+	| 'aqua'
+	| 'aquamarine'
+	| 'azure'
+	| 'beige'
+	| 'bisque'
+	| 'black'
+	| 'blanchedalmond'
+	| 'blue'
+	| 'blueviolet'
+	| 'brown'
+	| 'burlywood'
+	| 'cadetblue'
+	| 'chartreuse'
+	| 'chocolate'
+	| 'coral'
+	| 'cornflowerblue'
+	| 'cornsilk'
+	| 'crimson'
+	| 'cyan'
+	| 'darkblue'
+	| 'darkcyan'
+	| 'darkgoldenrod'
+	| 'darkgray'
+	| 'darkgreen'
+	| 'darkgrey'
+	| 'darkkhaki'
+	| 'darkmagenta'
+	| 'darkolivegreen'
+	| 'darkorange'
+	| 'darkorchid'
+	| 'darkred'
+	| 'darksalmon'
+	| 'darkseagreen'
+	| 'darkslateblue'
+	| 'darkslategray'
+	| 'darkslategrey'
+	| 'darkturquoise'
+	| 'darkviolet'
+	| 'deeppink'
+	| 'deepskyblue'
+	| 'dimgray'
+	| 'dimgrey'
+	| 'dodgerblue'
+	| 'firebrick'
+	| 'floralwhite'
+	| 'forestgreen'
+	| 'fuchsia'
+	| 'gainsboro'
+	| 'ghostwhite'
+	| 'gold'
+	| 'goldenrod'
+	| 'gray'
+	| 'green'
+	| 'greenyellow'
+	| 'grey'
+	| 'honeydew'
+	| 'hotpink'
+	| 'indianred'
+	| 'indigo'
+	| 'ivory'
+	| 'khaki'
+	| 'lavender'
+	| 'lavenderblush'
+	| 'lawngreen'
+	| 'lemonchiffon'
+	| 'lightblue'
+	| 'lightcoral'
+	| 'lightcyan'
+	| 'lightgoldenrodyellow'
+	| 'lightgray'
+	| 'lightgreen'
+	| 'lightgrey'
+	| 'lightpink'
+	| 'lightsalmon'
+	| 'lightseagreen'
+	| 'lightskyblue'
+	| 'lightslategray'
+	| 'lightslategrey'
+	| 'lightsteelblue'
+	| 'lightyellow'
+	| 'lime'
+	| 'limegreen'
+	| 'linen'
+	| 'magenta'
+	| 'maroon'
+	| 'mediumaquamarine'
+	| 'mediumblue'
+	| 'mediumorchid'
+	| 'mediumpurple'
+	| 'mediumseagreen'
+	| 'mediumslateblue'
+	| 'mediumspringgreen'
+	| 'mediumturquoise'
+	| 'mediumvioletred'
+	| 'midnightblue'
+	| 'mintcream'
+	| 'mistyrose'
+	| 'moccasin'
+	| 'navajowhite'
+	| 'navy'
+	| 'oldlace'
+	| 'olive'
+	| 'olivedrab'
+	| 'orange'
+	| 'orangered'
+	| 'orchid'
+	| 'palegoldenrod'
+	| 'palegreen'
+	| 'paleturquoise'
+	| 'palevioletred'
+	| 'papayawhip'
+	| 'peachpuff'
+	| 'peru'
+	| 'pink'
+	| 'plum'
+	| 'powderblue'
+	| 'purple'
+	| 'rebeccapurple'
+	| 'red'
+	| 'rosybrown'
+	| 'royalblue'
+	| 'saddlebrown'
+	| 'salmon'
+	| 'sandybrown'
+	| 'seagreen'
+	| 'seashell'
+	| 'sienna'
+	| 'silver'
+	| 'skyblue'
+	| 'slateblue'
+	| 'slategray'
+	| 'slategrey'
+	| 'snow'
+	| 'springgreen'
+	| 'steelblue'
+	| 'tan'
+	| 'teal'
+	| 'thistle'
+	| 'tomato'
+	| 'turquoise'
+	| 'violet'
+	| 'wheat'
+	| 'white'
+	| 'whitesmoke'
+	| 'yellow'
+	| 'yellowgreen';
+
+declare namespace ansiStyles {
+	interface ColorConvert {
+		/**
+		The RGB color space.
+
+		@param red - (`0`-`255`)
+		@param green - (`0`-`255`)
+		@param blue - (`0`-`255`)
+		*/
+		rgb(red: number, green: number, blue: number): string;
+
+		/**
+		The RGB HEX color space.
+
+		@param hex - A hexadecimal string containing RGB data.
+		*/
+		hex(hex: string): string;
+
+		/**
+		@param keyword - A CSS color name.
+		*/
+		keyword(keyword: CSSColor): string;
+
+		/**
+		The HSL color space.
+
+		@param hue - (`0`-`360`)
+		@param saturation - (`0`-`100`)
+		@param lightness - (`0`-`100`)
+		*/
+		hsl(hue: number, saturation: number, lightness: number): string;
+
+		/**
+		The HSV color space.
+
+		@param hue - (`0`-`360`)
+		@param saturation - (`0`-`100`)
+		@param value - (`0`-`100`)
+		*/
+		hsv(hue: number, saturation: number, value: number): string;
+
+		/**
+		The HSV color space.
+
+		@param hue - (`0`-`360`)
+		@param whiteness - (`0`-`100`)
+		@param blackness - (`0`-`100`)
+		*/
+		hwb(hue: number, whiteness: number, blackness: number): string;
+
+		/**
+		Use a [4-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#3/4-bit) to set text color.
+		*/
+		ansi(ansi: number): string;
+
+		/**
+		Use an [8-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#8-bit) to set text color.
+		*/
+		ansi256(ansi: number): string;
+	}
+
+	interface CSPair {
+		/**
+		The ANSI terminal control sequence for starting this style.
+		*/
+		readonly open: string;
+
+		/**
+		The ANSI terminal control sequence for ending this style.
+		*/
+		readonly close: string;
+	}
+
+	interface ColorBase {
+		readonly ansi: ColorConvert;
+		readonly ansi256: ColorConvert;
+		readonly ansi16m: ColorConvert;
+
+		/**
+		The ANSI terminal control sequence for ending this color.
+		*/
+		readonly close: string;
+	}
+
+	interface Modifier {
+		/**
+		Resets the current color chain.
+		*/
+		readonly reset: CSPair;
+
+		/**
+		Make text bold.
+		*/
+		readonly bold: CSPair;
+
+		/**
+		Emitting only a small amount of light.
+		*/
+		readonly dim: CSPair;
+
+		/**
+		Make text italic. (Not widely supported)
+		*/
+		readonly italic: CSPair;
+
+		/**
+		Make text underline. (Not widely supported)
+		*/
+		readonly underline: CSPair;
+
+		/**
+		Inverse background and foreground colors.
+		*/
+		readonly inverse: CSPair;
+
+		/**
+		Prints the text, but makes it invisible.
+		*/
+		readonly hidden: CSPair;
+
+		/**
+		Puts a horizontal line through the center of the text. (Not widely supported)
+		*/
+		readonly strikethrough: CSPair;
+	}
+
+	interface ForegroundColor {
+		readonly black: CSPair;
+		readonly red: CSPair;
+		readonly green: CSPair;
+		readonly yellow: CSPair;
+		readonly blue: CSPair;
+		readonly cyan: CSPair;
+		readonly magenta: CSPair;
+		readonly white: CSPair;
+
+		/**
+		Alias for `blackBright`.
+		*/
+		readonly gray: CSPair;
+
+		/**
+		Alias for `blackBright`.
+		*/
+		readonly grey: CSPair;
+
+		readonly blackBright: CSPair;
+		readonly redBright: CSPair;
+		readonly greenBright: CSPair;
+		readonly yellowBright: CSPair;
+		readonly blueBright: CSPair;
+		readonly cyanBright: CSPair;
+		readonly magentaBright: CSPair;
+		readonly whiteBright: CSPair;
+	}
+
+	interface BackgroundColor {
+		readonly bgBlack: CSPair;
+		readonly bgRed: CSPair;
+		readonly bgGreen: CSPair;
+		readonly bgYellow: CSPair;
+		readonly bgBlue: CSPair;
+		readonly bgCyan: CSPair;
+		readonly bgMagenta: CSPair;
+		readonly bgWhite: CSPair;
+
+		/**
+		Alias for `bgBlackBright`.
+		*/
+		readonly bgGray: CSPair;
+
+		/**
+		Alias for `bgBlackBright`.
+		*/
+		readonly bgGrey: CSPair;
+
+		readonly bgBlackBright: CSPair;
+		readonly bgRedBright: CSPair;
+		readonly bgGreenBright: CSPair;
+		readonly bgYellowBright: CSPair;
+		readonly bgBlueBright: CSPair;
+		readonly bgCyanBright: CSPair;
+		readonly bgMagentaBright: CSPair;
+		readonly bgWhiteBright: CSPair;
+	}
+}
+
+declare const ansiStyles: {
+	readonly modifier: ansiStyles.Modifier;
+	readonly color: ansiStyles.ForegroundColor & ansiStyles.ColorBase;
+	readonly bgColor: ansiStyles.BackgroundColor & ansiStyles.ColorBase;
+	readonly codes: ReadonlyMap<number, number>;
+} & ansiStyles.BackgroundColor & ansiStyles.ForegroundColor & ansiStyles.Modifier;
+
+export = ansiStyles;

node_modules/karma/node_modules/ansi-styles/index.js

@@ -0,0 +1,163 @@
+'use strict';
+
+const wrapAnsi16 = (fn, offset) => (...args) => {
+	const code = fn(...args);
+	return `\u001B[${code + offset}m`;
+};
+
+const wrapAnsi256 = (fn, offset) => (...args) => {
+	const code = fn(...args);
+	return `\u001B[${38 + offset};5;${code}m`;
+};
+
+const wrapAnsi16m = (fn, offset) => (...args) => {
+	const rgb = fn(...args);
+	return `\u001B[${38 + offset};2;${rgb[0]};${rgb[1]};${rgb[2]}m`;
+};
+
+const ansi2ansi = n => n;
+const rgb2rgb = (r, g, b) => [r, g, b];
+
+const setLazyProperty = (object, property, get) => {
+	Object.defineProperty(object, property, {
+		get: () => {
+			const value = get();
+
+			Object.defineProperty(object, property, {
+				value,
+				enumerable: true,
+				configurable: true
+			});
+
+			return value;
+		},
+		enumerable: true,
+		configurable: true
+	});
+};
+
+/** @type {typeof import('color-convert')} */
+let colorConvert;
+const makeDynamicStyles = (wrap, targetSpace, identity, isBackground) => {
+	if (colorConvert === undefined) {
+		colorConvert = require('color-convert');
+	}
+
+	const offset = isBackground ? 10 : 0;
+	const styles = {};
+
+	for (const [sourceSpace, suite] of Object.entries(colorConvert)) {
+		const name = sourceSpace === 'ansi16' ? 'ansi' : sourceSpace;
+		if (sourceSpace === targetSpace) {
+			styles[name] = wrap(identity, offset);
+		} else if (typeof suite === 'object') {
+			styles[name] = wrap(suite[targetSpace], offset);
+		}
+	}
+
+	return styles;
+};
+
+function assembleStyles() {
+	const codes = new Map();
+	const styles = {
+		modifier: {
+			reset: [0, 0],
+			// 21 isn't widely supported and 22 does the same thing
+			bold: [1, 22],
+			dim: [2, 22],
+			italic: [3, 23],
+			underline: [4, 24],
+			inverse: [7, 27],
+			hidden: [8, 28],
+			strikethrough: [9, 29]
+		},
+		color: {
+			black: [30, 39],
+			red: [31, 39],
+			green: [32, 39],
+			yellow: [33, 39],
+			blue: [34, 39],
+			magenta: [35, 39],
+			cyan: [36, 39],
+			white: [37, 39],
+
+			// Bright color
+			blackBright: [90, 39],
+			redBright: [91, 39],
+			greenBright: [92, 39],
+			yellowBright: [93, 39],
+			blueBright: [94, 39],
+			magentaBright: [95, 39],
+			cyanBright: [96, 39],
+			whiteBright: [97, 39]
+		},
+		bgColor: {
+			bgBlack: [40, 49],
+			bgRed: [41, 49],
+			bgGreen: [42, 49],
+			bgYellow: [43, 49],
+			bgBlue: [44, 49],
+			bgMagenta: [45, 49],
+			bgCyan: [46, 49],
+			bgWhite: [47, 49],
+
+			// Bright color
+			bgBlackBright: [100, 49],
+			bgRedBright: [101, 49],
+			bgGreenBright: [102, 49],
+			bgYellowBright: [103, 49],
+			bgBlueBright: [104, 49],
+			bgMagentaBright: [105, 49],
+			bgCyanBright: [106, 49],
+			bgWhiteBright: [107, 49]
+		}
+	};
+
+	// Alias bright black as gray (and grey)
+	styles.color.gray = styles.color.blackBright;
+	styles.bgColor.bgGray = styles.bgColor.bgBlackBright;
+	styles.color.grey = styles.color.blackBright;
+	styles.bgColor.bgGrey = styles.bgColor.bgBlackBright;
+
+	for (const [groupName, group] of Object.entries(styles)) {
+		for (const [styleName, style] of Object.entries(group)) {
+			styles[styleName] = {
+				open: `\u001B[${style[0]}m`,
+				close: `\u001B[${style[1]}m`
+			};
+
+			group[styleName] = styles[styleName];
+
+			codes.set(style[0], style[1]);
+		}
+
+		Object.defineProperty(styles, groupName, {
+			value: group,
+			enumerable: false
+		});
+	}
+
+	Object.defineProperty(styles, 'codes', {
+		value: codes,
+		enumerable: false
+	});
+
+	styles.color.close = '\u001B[39m';
+	styles.bgColor.close = '\u001B[49m';
+
+	setLazyProperty(styles.color, 'ansi', () => makeDynamicStyles(wrapAnsi16, 'ansi16', ansi2ansi, false));
+	setLazyProperty(styles.color, 'ansi256', () => makeDynamicStyles(wrapAnsi256, 'ansi256', ansi2ansi, false));
+	setLazyProperty(styles.color, 'ansi16m', () => makeDynamicStyles(wrapAnsi16m, 'rgb', rgb2rgb, false));
+	setLazyProperty(styles.bgColor, 'ansi', () => makeDynamicStyles(wrapAnsi16, 'ansi16', ansi2ansi, true));
+	setLazyProperty(styles.bgColor, 'ansi256', () => makeDynamicStyles(wrapAnsi256, 'ansi256', ansi2ansi, true));
+	setLazyProperty(styles.bgColor, 'ansi16m', () => makeDynamicStyles(wrapAnsi16m, 'rgb', rgb2rgb, true));
+
+	return styles;
+}
+
+// Make the export immutable
+Object.defineProperty(module, 'exports', {
+	enumerable: true,
+	get: assembleStyles
+});

node_modules/karma/node_modules/ansi-styles/license

@@ -0,0 +1,9 @@
+MIT License
+
+Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

node_modules/karma/node_modules/ansi-styles/package.json

@@ -0,0 +1,56 @@
+{
+	"name": "ansi-styles",
+	"version": "4.3.0",
+	"description": "ANSI escape codes for styling strings in the terminal",
+	"license": "MIT",
+	"repository": "chalk/ansi-styles",
+	"funding": "https://github.com/chalk/ansi-styles?sponsor=1",
+	"author": {
+		"name": "Sindre Sorhus",
+		"email": "sindresorhus@gmail.com",
+		"url": "sindresorhus.com"
+	},
+	"engines": {
+		"node": ">=8"
+	},
+	"scripts": {
+		"test": "xo && ava && tsd",
+		"screenshot": "svg-term --command='node screenshot' --out=screenshot.svg --padding=3 --width=55 --height=3 --at=1000 --no-cursor"
+	},
+	"files": [
+		"index.js",
+		"index.d.ts"
+	],
+	"keywords": [
+		"ansi",
+		"styles",
+		"color",
+		"colour",
+		"colors",
+		"terminal",
+		"console",
+		"cli",
+		"string",
+		"tty",
+		"escape",
+		"formatting",
+		"rgb",
+		"256",
+		"shell",
+		"xterm",
+		"log",
+		"logging",
+		"command-line",
+		"text"
+	],
+	"dependencies": {
+		"color-convert": "^2.0.1"
+	},
+	"devDependencies": {
+		"@types/color-convert": "^1.9.0",
+		"ava": "^2.3.0",
+		"svg-term-cli": "^2.1.1",
+		"tsd": "^0.11.0",
+		"xo": "^0.25.3"
+	}
+}

node_modules/karma/node_modules/ansi-styles/readme.md

@@ -0,0 +1,152 @@
+# ansi-styles [![Build Status](https://travis-ci.org/chalk/ansi-styles.svg?branch=master)](https://travis-ci.org/chalk/ansi-styles)
+
+> [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code#Colors_and_Styles) for styling strings in the terminal
+
+You probably want the higher-level [chalk](https://github.com/chalk/chalk) module for styling your strings.
+
+<img src="screenshot.svg" width="900">
+
+## Install
+
+```
+$ npm install ansi-styles
+```
+
+## Usage
+
+```js
+const style = require('ansi-styles');
+
+console.log(`${style.green.open}Hello world!${style.green.close}`);
+
+
+// Color conversion between 16/256/truecolor
+// NOTE: If conversion goes to 16 colors or 256 colors, the original color
+//       may be degraded to fit that color palette. This means terminals
+//       that do not support 16 million colors will best-match the
+//       original color.
+console.log(style.bgColor.ansi.hsl(120, 80, 72) + 'Hello world!' + style.bgColor.close);
+console.log(style.color.ansi256.rgb(199, 20, 250) + 'Hello world!' + style.color.close);
+console.log(style.color.ansi16m.hex('#abcdef') + 'Hello world!' + style.color.close);
+```
+
+## API
+
+Each style has an `open` and `close` property.
+
+## Styles
+
+### Modifiers
+
+- `reset`
+- `bold`
+- `dim`
+- `italic` *(Not widely supported)*
+- `underline`
+- `inverse`
+- `hidden`
+- `strikethrough` *(Not widely supported)*
+
+### Colors
+
+- `black`
+- `red`
+- `green`
+- `yellow`
+- `blue`
+- `magenta`
+- `cyan`
+- `white`
+- `blackBright` (alias: `gray`, `grey`)
+- `redBright`
+- `greenBright`
+- `yellowBright`
+- `blueBright`
+- `magentaBright`
+- `cyanBright`
+- `whiteBright`
+
+### Background colors
+
+- `bgBlack`
+- `bgRed`
+- `bgGreen`
+- `bgYellow`
+- `bgBlue`
+- `bgMagenta`
+- `bgCyan`
+- `bgWhite`
+- `bgBlackBright` (alias: `bgGray`, `bgGrey`)
+- `bgRedBright`
+- `bgGreenBright`
+- `bgYellowBright`
+- `bgBlueBright`
+- `bgMagentaBright`
+- `bgCyanBright`
+- `bgWhiteBright`
+
+## Advanced usage
+
+By default, you get a map of styles, but the styles are also available as groups. They are non-enumerable so they don't show up unless you access them explicitly. This makes it easier to expose only a subset in a higher-level module.
+
+- `style.modifier`
+- `style.color`
+- `style.bgColor`
+
+###### Example
+
+```js
+console.log(style.color.green.open);
+```
+
+Raw escape codes (i.e. without the CSI escape prefix `\u001B[` and render mode postfix `m`) are available under `style.codes`, which returns a `Map` with the open codes as keys and close codes as values.
+
+###### Example
+
+```js
+console.log(style.codes.get(36));
+//=> 39
+```
+
+## [256 / 16 million (TrueColor) support](https://gist.github.com/XVilka/8346728)
+
+`ansi-styles` uses the [`color-convert`](https://github.com/Qix-/color-convert) package to allow for converting between various colors and ANSI escapes, with support for 256 and 16 million colors.
+
+The following color spaces from `color-convert` are supported:
+
+- `rgb`
+- `hex`
+- `keyword`
+- `hsl`
+- `hsv`
+- `hwb`
+- `ansi`
+- `ansi256`
+
+To use these, call the associated conversion function with the intended output, for example:
+
+```js
+style.color.ansi.rgb(100, 200, 15); // RGB to 16 color ansi foreground code
+style.bgColor.ansi.rgb(100, 200, 15); // RGB to 16 color ansi background code
+
+style.color.ansi256.hsl(120, 100, 60); // HSL to 256 color ansi foreground code
+style.bgColor.ansi256.hsl(120, 100, 60); // HSL to 256 color ansi foreground code
+
+style.color.ansi16m.hex('#C0FFEE'); // Hex (RGB) to 16 million color foreground code
+style.bgColor.ansi16m.hex('#C0FFEE'); // Hex (RGB) to 16 million color background code
+```
+
+## Related
+
+- [ansi-escapes](https://github.com/sindresorhus/ansi-escapes) - ANSI escape codes for manipulating the terminal
+
+## Maintainers
+
+- [Sindre Sorhus](https://github.com/sindresorhus)
+- [Josh Junon](https://github.com/qix-)
+
+## For enterprise
+
+Available as part of the Tidelift Subscription.
+
+The maintainers of `ansi-styles` and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-ansi-styles?utm_source=npm-ansi-styles&utm_medium=referral&utm_campaign=enterprise&utm_term=repo)

node_modules/karma/node_modules/cliui/CHANGELOG.md

@@ -0,0 +1,121 @@
+# Change Log
+
+All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines.
+
+### [7.0.4](https://www.github.com/yargs/cliui/compare/v7.0.3...v7.0.4) (2020-11-08)
+
+
+### Bug Fixes
+
+* **deno:** import UIOptions from definitions ([#97](https://www.github.com/yargs/cliui/issues/97)) ([f04f343](https://www.github.com/yargs/cliui/commit/f04f3439bc78114c7e90f82ff56f5acf16268ea8))
+
+### [7.0.3](https://www.github.com/yargs/cliui/compare/v7.0.2...v7.0.3) (2020-10-16)
+
+
+### Bug Fixes
+
+* **exports:** node 13.0 and 13.1 require the dotted object form _with_ a string fallback ([#93](https://www.github.com/yargs/cliui/issues/93)) ([eca16fc](https://www.github.com/yargs/cliui/commit/eca16fc05d26255df3280906c36d7f0e5b05c6e9))
+
+### [7.0.2](https://www.github.com/yargs/cliui/compare/v7.0.1...v7.0.2) (2020-10-14)
+
+
+### Bug Fixes
+
+* **exports:** node 13.0-13.6 require a string fallback ([#91](https://www.github.com/yargs/cliui/issues/91)) ([b529d7e](https://www.github.com/yargs/cliui/commit/b529d7e432901af1af7848b23ed6cf634497d961))
+
+### [7.0.1](https://www.github.com/yargs/cliui/compare/v7.0.0...v7.0.1) (2020-08-16)
+
+
+### Bug Fixes
+
+* **build:** main should be build/index.cjs ([dc29a3c](https://www.github.com/yargs/cliui/commit/dc29a3cc617a410aa850e06337b5954b04f2cb4d))
+
+## [7.0.0](https://www.github.com/yargs/cliui/compare/v6.0.0...v7.0.0) (2020-08-16)
+
+
+### ⚠ BREAKING CHANGES
+
+* tsc/ESM/Deno support (#82)
+* modernize deps and build (#80)
+
+### Build System
+
+* modernize deps and build ([#80](https://www.github.com/yargs/cliui/issues/80)) ([339d08d](https://www.github.com/yargs/cliui/commit/339d08dc71b15a3928aeab09042af94db2f43743))
+
+
+### Code Refactoring
+
+* tsc/ESM/Deno support ([#82](https://www.github.com/yargs/cliui/issues/82)) ([4b777a5](https://www.github.com/yargs/cliui/commit/4b777a5fe01c5d8958c6708695d6aab7dbe5706c))
+
+## [6.0.0](https://www.github.com/yargs/cliui/compare/v5.0.0...v6.0.0) (2019-11-10)
+
+
+### ⚠ BREAKING CHANGES
+
+* update deps, drop Node 6
+
+### Code Refactoring
+
+* update deps, drop Node 6 ([62056df](https://www.github.com/yargs/cliui/commit/62056df))
+
+## [5.0.0](https://github.com/yargs/cliui/compare/v4.1.0...v5.0.0) (2019-04-10)
+
+
+### Bug Fixes
+
+* Update wrap-ansi to fix compatibility with latest versions of chalk. ([#60](https://github.com/yargs/cliui/issues/60)) ([7bf79ae](https://github.com/yargs/cliui/commit/7bf79ae))
+
+
+### BREAKING CHANGES
+
+* Drop support for node < 6.
+
+
+
+<a name="4.1.0"></a>
+## [4.1.0](https://github.com/yargs/cliui/compare/v4.0.0...v4.1.0) (2018-04-23)
+
+
+### Features
+
+* add resetOutput method ([#57](https://github.com/yargs/cliui/issues/57)) ([7246902](https://github.com/yargs/cliui/commit/7246902))
+
+
+
+<a name="4.0.0"></a>
+## [4.0.0](https://github.com/yargs/cliui/compare/v3.2.0...v4.0.0) (2017-12-18)
+
+
+### Bug Fixes
+
+* downgrades strip-ansi to version 3.0.1 ([#54](https://github.com/yargs/cliui/issues/54)) ([5764c46](https://github.com/yargs/cliui/commit/5764c46))
+* set env variable FORCE_COLOR. ([#56](https://github.com/yargs/cliui/issues/56)) ([7350e36](https://github.com/yargs/cliui/commit/7350e36))
+
+
+### Chores
+
+* drop support for node < 4 ([#53](https://github.com/yargs/cliui/issues/53)) ([b105376](https://github.com/yargs/cliui/commit/b105376))
+
+
+### Features
+
+* add fallback for window width ([#45](https://github.com/yargs/cliui/issues/45)) ([d064922](https://github.com/yargs/cliui/commit/d064922))
+
+
+### BREAKING CHANGES
+
+* officially drop support for Node < 4
+
+
+
+<a name="3.2.0"></a>
+## [3.2.0](https://github.com/yargs/cliui/compare/v3.1.2...v3.2.0) (2016-04-11)
+
+
+### Bug Fixes
+
+* reduces tarball size ([acc6c33](https://github.com/yargs/cliui/commit/acc6c33))
+
+### Features
+
+* adds standard-version for release management ([ff84e32](https://github.com/yargs/cliui/commit/ff84e32))

node_modules/karma/node_modules/cliui/LICENSE.txt

@@ -0,0 +1,14 @@
+Copyright (c) 2015, Contributors
+
+Permission to use, copy, modify, and/or distribute this software
+for any purpose with or without fee is hereby granted, provided
+that the above copyright notice and this permission notice
+appear in all copies.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES
+OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE
+LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES
+OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS,
+WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION,
+ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.

node_modules/karma/node_modules/cliui/README.md

@@ -0,0 +1,141 @@
+# cliui
+
+![ci](https://github.com/yargs/cliui/workflows/ci/badge.svg)
+[![NPM version](https://img.shields.io/npm/v/cliui.svg)](https://www.npmjs.com/package/cliui)
+[![Conventional Commits](https://img.shields.io/badge/Conventional%20Commits-1.0.0-yellow.svg)](https://conventionalcommits.org)
+![nycrc config on GitHub](https://img.shields.io/nycrc/yargs/cliui)
+
+easily create complex multi-column command-line-interfaces.
+
+## Example
+
+```js
+const ui = require('cliui')()
+
+ui.div('Usage: $0 [command] [options]')
+
+ui.div({
+  text: 'Options:',
+  padding: [2, 0, 1, 0]
+})
+
+ui.div(
+  {
+    text: "-f, --file",
+    width: 20,
+    padding: [0, 4, 0, 4]
+  },
+  {
+    text: "the file to load." +
+      chalk.green("(if this description is long it wraps).")
+    ,
+    width: 20
+  },
+  {
+    text: chalk.red("[required]"),
+    align: 'right'
+  }
+)
+
+console.log(ui.toString())
+```
+
+## Deno/ESM Support
+
+As of `v7` `cliui` supports [Deno](https://github.com/denoland/deno) and
+[ESM](https://nodejs.org/api/esm.html#esm_ecmascript_modules):
+
+```typescript
+import cliui from "https://deno.land/x/cliui/deno.ts";
+
+const ui = cliui({})
+
+ui.div('Usage: $0 [command] [options]')
+
+ui.div({
+  text: 'Options:',
+  padding: [2, 0, 1, 0]
+})
+
+ui.div({
+  text: "-f, --file",
+  width: 20,
+  padding: [0, 4, 0, 4]
+})
+
+console.log(ui.toString())
+```
+
+<img width="500" src="screenshot.png">
+
+## Layout DSL
+
+cliui exposes a simple layout DSL:
+
+If you create a single `ui.div`, passing a string rather than an
+object:
+
+* `\n`: characters will be interpreted as new rows.
+* `\t`: characters will be interpreted as new columns.
+* `\s`: characters will be interpreted as padding.
+
+**as an example...**
+
+```js
+var ui = require('./')({
+  width: 60
+})
+
+ui.div(
+  'Usage: node ./bin/foo.js\n' +
+  '  <regex>\t  provide a regex\n' +
+  '  <glob>\t  provide a glob\t [required]'
+)
+
+console.log(ui.toString())
+```
+
+**will output:**
+
+```shell
+Usage: node ./bin/foo.js
+  <regex>  provide a regex
+  <glob>   provide a glob          [required]
+```
+
+## Methods
+
+```js
+cliui = require('cliui')
+```
+
+### cliui({width: integer})
+
+Specify the maximum width of the UI being generated.
+If no width is provided, cliui will try to get the current window's width and use it, and if that doesn't work, width will be set to `80`.
+
+### cliui({wrap: boolean})
+
+Enable or disable the wrapping of text in a column.
+
+### cliui.div(column, column, column)
+
+Create a row with any number of columns, a column
+can either be a string, or an object with the following
+options:
+
+* **text:** some text to place in the column.
+* **width:** the width of a column.
+* **align:** alignment, `right` or `center`.
+* **padding:** `[top, right, bottom, left]`.
+* **border:** should a border be placed around the div?
+
+### cliui.span(column, column, column)
+
+Similar to `div`, except the next row will be appended without
+a new line being created.
+
+### cliui.resetOutput()
+
+Resets the UI elements of the current cliui instance, maintaining the values
+set for `width` and `wrap`.

node_modules/karma/node_modules/cliui/build/index.cjs

@@ -0,0 +1,302 @@
+'use strict';
+
+const align = {
+    right: alignRight,
+    center: alignCenter
+};
+const top = 0;
+const right = 1;
+const bottom = 2;
+const left = 3;
+class UI {
+    constructor(opts) {
+        var _a;
+        this.width = opts.width;
+        this.wrap = (_a = opts.wrap) !== null && _a !== void 0 ? _a : true;
+        this.rows = [];
+    }
+    span(...args) {
+        const cols = this.div(...args);
+        cols.span = true;
+    }
+    resetOutput() {
+        this.rows = [];
+    }
+    div(...args) {
+        if (args.length === 0) {
+            this.div('');
+        }
+        if (this.wrap && this.shouldApplyLayoutDSL(...args) && typeof args[0] === 'string') {
+            return this.applyLayoutDSL(args[0]);
+        }
+        const cols = args.map(arg => {
+            if (typeof arg === 'string') {
+                return this.colFromString(arg);
+            }
+            return arg;
+        });
+        this.rows.push(cols);
+        return cols;
+    }
+    shouldApplyLayoutDSL(...args) {
+        return args.length === 1 && typeof args[0] === 'string' &&
+            /[\t\n]/.test(args[0]);
+    }
+    applyLayoutDSL(str) {
+        const rows = str.split('\n').map(row => row.split('\t'));
+        let leftColumnWidth = 0;
+        // simple heuristic for layout, make sure the
+        // second column lines up along the left-hand.
+        // don't allow the first column to take up more
+        // than 50% of the screen.
+        rows.forEach(columns => {
+            if (columns.length > 1 && mixin.stringWidth(columns[0]) > leftColumnWidth) {
+                leftColumnWidth = Math.min(Math.floor(this.width * 0.5), mixin.stringWidth(columns[0]));
+            }
+        });
+        // generate a table:
+        //  replacing ' ' with padding calculations.
+        //  using the algorithmically generated width.
+        rows.forEach(columns => {
+            this.div(...columns.map((r, i) => {
+                return {
+                    text: r.trim(),
+                    padding: this.measurePadding(r),
+                    width: (i === 0 && columns.length > 1) ? leftColumnWidth : undefined
+                };
+            }));
+        });
+        return this.rows[this.rows.length - 1];
+    }
+    colFromString(text) {
+        return {
+            text,
+            padding: this.measurePadding(text)
+        };
+    }
+    measurePadding(str) {
+        // measure padding without ansi escape codes
+        const noAnsi = mixin.stripAnsi(str);
+        return [0, noAnsi.match(/\s*$/)[0].length, 0, noAnsi.match(/^\s*/)[0].length];
+    }
+    toString() {
+        const lines = [];
+        this.rows.forEach(row => {
+            this.rowToString(row, lines);
+        });
+        // don't display any lines with the
+        // hidden flag set.
+        return lines
+            .filter(line => !line.hidden)
+            .map(line => line.text)
+            .join('\n');
+    }
+    rowToString(row, lines) {
+        this.rasterize(row).forEach((rrow, r) => {
+            let str = '';
+            rrow.forEach((col, c) => {
+                const { width } = row[c]; // the width with padding.
+                const wrapWidth = this.negatePadding(row[c]); // the width without padding.
+                let ts = col; // temporary string used during alignment/padding.
+                if (wrapWidth > mixin.stringWidth(col)) {
+                    ts += ' '.repeat(wrapWidth - mixin.stringWidth(col));
+                }
+                // align the string within its column.
+                if (row[c].align && row[c].align !== 'left' && this.wrap) {
+                    const fn = align[row[c].align];
+                    ts = fn(ts, wrapWidth);
+                    if (mixin.stringWidth(ts) < wrapWidth) {
+                        ts += ' '.repeat((width || 0) - mixin.stringWidth(ts) - 1);
+                    }
+                }
+                // apply border and padding to string.
+                const padding = row[c].padding || [0, 0, 0, 0];
+                if (padding[left]) {
+                    str += ' '.repeat(padding[left]);
+                }
+                str += addBorder(row[c], ts, '| ');
+                str += ts;
+                str += addBorder(row[c], ts, ' |');
+                if (padding[right]) {
+                    str += ' '.repeat(padding[right]);
+                }
+                // if prior row is span, try to render the
+                // current row on the prior line.
+                if (r === 0 && lines.length > 0) {
+                    str = this.renderInline(str, lines[lines.length - 1]);
+                }
+            });
+            // remove trailing whitespace.
+            lines.push({
+                text: str.replace(/ +$/, ''),
+                span: row.span
+            });
+        });
+        return lines;
+    }
+    // if the full 'source' can render in
+    // the target line, do so.
+    renderInline(source, previousLine) {
+        const match = source.match(/^ */);
+        const leadingWhitespace = match ? match[0].length : 0;
+        const target = previousLine.text;
+        const targetTextWidth = mixin.stringWidth(target.trimRight());
+        if (!previousLine.span) {
+            return source;
+        }
+        // if we're not applying wrapping logic,
+        // just always append to the span.
+        if (!this.wrap) {
+            previousLine.hidden = true;
+            return target + source;
+        }
+        if (leadingWhitespace < targetTextWidth) {
+            return source;
+        }
+        previousLine.hidden = true;
+        return target.trimRight() + ' '.repeat(leadingWhitespace - targetTextWidth) + source.trimLeft();
+    }
+    rasterize(row) {
+        const rrows = [];
+        const widths = this.columnWidths(row);
+        let wrapped;
+        // word wrap all columns, and create
+        // a data-structure that is easy to rasterize.
+        row.forEach((col, c) => {
+            // leave room for left and right padding.
+            col.width = widths[c];
+            if (this.wrap) {
+                wrapped = mixin.wrap(col.text, this.negatePadding(col), { hard: true }).split('\n');
+            }
+            else {
+                wrapped = col.text.split('\n');
+            }
+            if (col.border) {
+                wrapped.unshift('.' + '-'.repeat(this.negatePadding(col) + 2) + '.');
+                wrapped.push("'" + '-'.repeat(this.negatePadding(col) + 2) + "'");
+            }
+            // add top and bottom padding.
+            if (col.padding) {
+                wrapped.unshift(...new Array(col.padding[top] || 0).fill(''));
+                wrapped.push(...new Array(col.padding[bottom] || 0).fill(''));
+            }
+            wrapped.forEach((str, r) => {
+                if (!rrows[r]) {
+                    rrows.push([]);
+                }
+                const rrow = rrows[r];
+                for (let i = 0; i < c; i++) {
+                    if (rrow[i] === undefined) {
+                        rrow.push('');
+                    }
+                }
+                rrow.push(str);
+            });
+        });
+        return rrows;
+    }
+    negatePadding(col) {
+        let wrapWidth = col.width || 0;
+        if (col.padding) {
+            wrapWidth -= (col.padding[left] || 0) + (col.padding[right] || 0);
+        }
+        if (col.border) {
+            wrapWidth -= 4;
+        }
+        return wrapWidth;
+    }
+    columnWidths(row) {
+        if (!this.wrap) {
+            return row.map(col => {
+                return col.width || mixin.stringWidth(col.text);
+            });
+        }
+        let unset = row.length;
+        let remainingWidth = this.width;
+        // column widths can be set in config.
+        const widths = row.map(col => {
+            if (col.width) {
+                unset--;
+                remainingWidth -= col.width;
+                return col.width;
+            }
+            return undefined;
+        });
+        // any unset widths should be calculated.
+        const unsetWidth = unset ? Math.floor(remainingWidth / unset) : 0;
+        return widths.map((w, i) => {
+            if (w === undefined) {
+                return Math.max(unsetWidth, _minWidth(row[i]));
+            }
+            return w;
+        });
+    }
+}
+function addBorder(col, ts, style) {
+    if (col.border) {
+        if (/[.']-+[.']/.test(ts)) {
+            return '';
+        }
+        if (ts.trim().length !== 0) {
+            return style;
+        }
+        return '  ';
+    }
+    return '';
+}
+// calculates the minimum width of
+// a column, based on padding preferences.
+function _minWidth(col) {
+    const padding = col.padding || [];
+    const minWidth = 1 + (padding[left] || 0) + (padding[right] || 0);
+    if (col.border) {
+        return minWidth + 4;
+    }
+    return minWidth;
+}
+function getWindowWidth() {
+    /* istanbul ignore next: depends on terminal */
+    if (typeof process === 'object' && process.stdout && process.stdout.columns) {
+        return process.stdout.columns;
+    }
+    return 80;
+}
+function alignRight(str, width) {
+    str = str.trim();
+    const strWidth = mixin.stringWidth(str);
+    if (strWidth < width) {
+        return ' '.repeat(width - strWidth) + str;
+    }
+    return str;
+}
+function alignCenter(str, width) {
+    str = str.trim();
+    const strWidth = mixin.stringWidth(str);
+    /* istanbul ignore next */
+    if (strWidth >= width) {
+        return str;
+    }
+    return ' '.repeat((width - strWidth) >> 1) + str;
+}
+let mixin;
+function cliui(opts, _mixin) {
+    mixin = _mixin;
+    return new UI({
+        width: (opts === null || opts === void 0 ? void 0 : opts.width) || getWindowWidth(),
+        wrap: opts === null || opts === void 0 ? void 0 : opts.wrap
+    });
+}
+
+// Bootstrap cliui with CommonJS dependencies:
+const stringWidth = require('string-width');
+const stripAnsi = require('strip-ansi');
+const wrap = require('wrap-ansi');
+function ui(opts) {
+    return cliui(opts, {
+        stringWidth,
+        stripAnsi,
+        wrap
+    });
+}
+
+module.exports = ui;

node_modules/karma/node_modules/cliui/build/lib/index.js

@@ -0,0 +1,287 @@
+'use strict';
+const align = {
+    right: alignRight,
+    center: alignCenter
+};
+const top = 0;
+const right = 1;
+const bottom = 2;
+const left = 3;
+export class UI {
+    constructor(opts) {
+        var _a;
+        this.width = opts.width;
+        this.wrap = (_a = opts.wrap) !== null && _a !== void 0 ? _a : true;
+        this.rows = [];
+    }
+    span(...args) {
+        const cols = this.div(...args);
+        cols.span = true;
+    }
+    resetOutput() {
+        this.rows = [];
+    }
+    div(...args) {
+        if (args.length === 0) {
+            this.div('');
+        }
+        if (this.wrap && this.shouldApplyLayoutDSL(...args) && typeof args[0] === 'string') {
+            return this.applyLayoutDSL(args[0]);
+        }
+        const cols = args.map(arg => {
+            if (typeof arg === 'string') {
+                return this.colFromString(arg);
+            }
+            return arg;
+        });
+        this.rows.push(cols);
+        return cols;
+    }
+    shouldApplyLayoutDSL(...args) {
+        return args.length === 1 && typeof args[0] === 'string' &&
+            /[\t\n]/.test(args[0]);
+    }
+    applyLayoutDSL(str) {
+        const rows = str.split('\n').map(row => row.split('\t'));
+        let leftColumnWidth = 0;
+        // simple heuristic for layout, make sure the
+        // second column lines up along the left-hand.
+        // don't allow the first column to take up more
+        // than 50% of the screen.
+        rows.forEach(columns => {
+            if (columns.length > 1 && mixin.stringWidth(columns[0]) > leftColumnWidth) {
+                leftColumnWidth = Math.min(Math.floor(this.width * 0.5), mixin.stringWidth(columns[0]));
+            }
+        });
+        // generate a table:
+        //  replacing ' ' with padding calculations.
+        //  using the algorithmically generated width.
+        rows.forEach(columns => {
+            this.div(...columns.map((r, i) => {
+                return {
+                    text: r.trim(),
+                    padding: this.measurePadding(r),
+                    width: (i === 0 && columns.length > 1) ? leftColumnWidth : undefined
+                };
+            }));
+        });
+        return this.rows[this.rows.length - 1];
+    }
+    colFromString(text) {
+        return {
+            text,
+            padding: this.measurePadding(text)
+        };
+    }
+    measurePadding(str) {
+        // measure padding without ansi escape codes
+        const noAnsi = mixin.stripAnsi(str);
+        return [0, noAnsi.match(/\s*$/)[0].length, 0, noAnsi.match(/^\s*/)[0].length];
+    }
+    toString() {
+        const lines = [];
+        this.rows.forEach(row => {
+            this.rowToString(row, lines);
+        });
+        // don't display any lines with the
+        // hidden flag set.
+        return lines
+            .filter(line => !line.hidden)
+            .map(line => line.text)
+            .join('\n');
+    }
+    rowToString(row, lines) {
+        this.rasterize(row).forEach((rrow, r) => {
+            let str = '';
+            rrow.forEach((col, c) => {
+                const { width } = row[c]; // the width with padding.
+                const wrapWidth = this.negatePadding(row[c]); // the width without padding.
+                let ts = col; // temporary string used during alignment/padding.
+                if (wrapWidth > mixin.stringWidth(col)) {
+                    ts += ' '.repeat(wrapWidth - mixin.stringWidth(col));
+                }
+                // align the string within its column.
+                if (row[c].align && row[c].align !== 'left' && this.wrap) {
+                    const fn = align[row[c].align];
+                    ts = fn(ts, wrapWidth);
+                    if (mixin.stringWidth(ts) < wrapWidth) {
+                        ts += ' '.repeat((width || 0) - mixin.stringWidth(ts) - 1);
+                    }
+                }
+                // apply border and padding to string.
+                const padding = row[c].padding || [0, 0, 0, 0];
+                if (padding[left]) {
+                    str += ' '.repeat(padding[left]);
+                }
+                str += addBorder(row[c], ts, '| ');
+                str += ts;
+                str += addBorder(row[c], ts, ' |');
+                if (padding[right]) {
+                    str += ' '.repeat(padding[right]);
+                }
+                // if prior row is span, try to render the
+                // current row on the prior line.
+                if (r === 0 && lines.length > 0) {
+                    str = this.renderInline(str, lines[lines.length - 1]);
+                }
+            });
+            // remove trailing whitespace.
+            lines.push({
+                text: str.replace(/ +$/, ''),
+                span: row.span
+            });
+        });
+        return lines;
+    }
+    // if the full 'source' can render in
+    // the target line, do so.
+    renderInline(source, previousLine) {
+        const match = source.match(/^ */);
+        const leadingWhitespace = match ? match[0].length : 0;
+        const target = previousLine.text;
+        const targetTextWidth = mixin.stringWidth(target.trimRight());
+        if (!previousLine.span) {
+            return source;
+        }
+        // if we're not applying wrapping logic,
+        // just always append to the span.
+        if (!this.wrap) {
+            previousLine.hidden = true;
+            return target + source;
+        }
+        if (leadingWhitespace < targetTextWidth) {
+            return source;
+        }
+        previousLine.hidden = true;
+        return target.trimRight() + ' '.repeat(leadingWhitespace - targetTextWidth) + source.trimLeft();
+    }
+    rasterize(row) {
+        const rrows = [];
+        const widths = this.columnWidths(row);
+        let wrapped;
+        // word wrap all columns, and create
+        // a data-structure that is easy to rasterize.
+        row.forEach((col, c) => {
+            // leave room for left and right padding.
+            col.width = widths[c];
+            if (this.wrap) {
+                wrapped = mixin.wrap(col.text, this.negatePadding(col), { hard: true }).split('\n');
+            }
+            else {
+                wrapped = col.text.split('\n');
+            }
+            if (col.border) {
+                wrapped.unshift('.' + '-'.repeat(this.negatePadding(col) + 2) + '.');
+                wrapped.push("'" + '-'.repeat(this.negatePadding(col) + 2) + "'");
+            }
+            // add top and bottom padding.
+            if (col.padding) {
+                wrapped.unshift(...new Array(col.padding[top] || 0).fill(''));
+                wrapped.push(...new Array(col.padding[bottom] || 0).fill(''));
+            }
+            wrapped.forEach((str, r) => {
+                if (!rrows[r]) {
+                    rrows.push([]);
+                }
+                const rrow = rrows[r];
+                for (let i = 0; i < c; i++) {
+                    if (rrow[i] === undefined) {
+                        rrow.push('');
+                    }
+                }
+                rrow.push(str);
+            });
+        });
+        return rrows;
+    }
+    negatePadding(col) {
+        let wrapWidth = col.width || 0;
+        if (col.padding) {
+            wrapWidth -= (col.padding[left] || 0) + (col.padding[right] || 0);
+        }
+        if (col.border) {
+            wrapWidth -= 4;
+        }
+        return wrapWidth;
+    }
+    columnWidths(row) {
+        if (!this.wrap) {
+            return row.map(col => {
+                return col.width || mixin.stringWidth(col.text);
+            });
+        }
+        let unset = row.length;
+        let remainingWidth = this.width;
+        // column widths can be set in config.
+        const widths = row.map(col => {
+            if (col.width) {
+                unset--;
+                remainingWidth -= col.width;
+                return col.width;
+            }
+            return undefined;
+        });
+        // any unset widths should be calculated.
+        const unsetWidth = unset ? Math.floor(remainingWidth / unset) : 0;
+        return widths.map((w, i) => {
+            if (w === undefined) {
+                return Math.max(unsetWidth, _minWidth(row[i]));
+            }
+            return w;
+        });
+    }
+}
+function addBorder(col, ts, style) {
+    if (col.border) {
+        if (/[.']-+[.']/.test(ts)) {
+            return '';
+        }
+        if (ts.trim().length !== 0) {
+            return style;
+        }
+        return '  ';
+    }
+    return '';
+}
+// calculates the minimum width of
+// a column, based on padding preferences.
+function _minWidth(col) {
+    const padding = col.padding || [];
+    const minWidth = 1 + (padding[left] || 0) + (padding[right] || 0);
+    if (col.border) {
+        return minWidth + 4;
+    }
+    return minWidth;
+}
+function getWindowWidth() {
+    /* istanbul ignore next: depends on terminal */
+    if (typeof process === 'object' && process.stdout && process.stdout.columns) {
+        return process.stdout.columns;
+    }
+    return 80;
+}
+function alignRight(str, width) {
+    str = str.trim();
+    const strWidth = mixin.stringWidth(str);
+    if (strWidth < width) {
+        return ' '.repeat(width - strWidth) + str;
+    }
+    return str;
+}
+function alignCenter(str, width) {
+    str = str.trim();
+    const strWidth = mixin.stringWidth(str);
+    /* istanbul ignore next */
+    if (strWidth >= width) {
+        return str;
+    }
+    return ' '.repeat((width - strWidth) >> 1) + str;
+}
+let mixin;
+export function cliui(opts, _mixin) {
+    mixin = _mixin;
+    return new UI({
+        width: (opts === null || opts === void 0 ? void 0 : opts.width) || getWindowWidth(),
+        wrap: opts === null || opts === void 0 ? void 0 : opts.wrap
+    });
+}

node_modules/karma/node_modules/cliui/build/lib/string-utils.js

@@ -0,0 +1,27 @@
+// Minimal replacement for ansi string helpers "wrap-ansi" and "strip-ansi".
+// to facilitate ESM and Deno modules.
+// TODO: look at porting https://www.npmjs.com/package/wrap-ansi to ESM.
+// The npm application
+// Copyright (c) npm, Inc. and Contributors
+// Licensed on the terms of The Artistic License 2.0
+// See: https://github.com/npm/cli/blob/4c65cd952bc8627811735bea76b9b110cc4fc80e/lib/utils/ansi-trim.js
+const ansi = new RegExp('\x1b(?:\\[(?:\\d+[ABCDEFGJKSTm]|\\d+;\\d+[Hfm]|' +
+    '\\d+;\\d+;\\d+m|6n|s|u|\\?25[lh])|\\w)', 'g');
+export function stripAnsi(str) {
+    return str.replace(ansi, '');
+}
+export function wrap(str, width) {
+    const [start, end] = str.match(ansi) || ['', ''];
+    str = stripAnsi(str);
+    let wrapped = '';
+    for (let i = 0; i < str.length; i++) {
+        if (i !== 0 && (i % width) === 0) {
+            wrapped += '\n';
+        }
+        wrapped += str.charAt(i);
+    }
+    if (start && end) {
+        wrapped = `${start}${wrapped}${end}`;
+    }
+    return wrapped;
+}

node_modules/karma/node_modules/cliui/index.mjs

@@ -0,0 +1,13 @@
+// Bootstrap cliui with CommonJS dependencies:
+import { cliui } from './build/lib/index.js'
+import { wrap, stripAnsi } from './build/lib/string-utils.js'
+
+export default function ui (opts) {
+  return cliui(opts, {
+    stringWidth: (str) => {
+      return [...str].length
+    },
+    stripAnsi,
+    wrap
+  })
+}

node_modules/karma/node_modules/cliui/package.json

@@ -0,0 +1,83 @@
+{
+  "name": "cliui",
+  "version": "7.0.4",
+  "description": "easily create complex multi-column command-line-interfaces",
+  "main": "build/index.cjs",
+  "exports": {
+    ".": [
+      {
+        "import": "./index.mjs",
+        "require": "./build/index.cjs"
+      },
+      "./build/index.cjs"
+    ]
+  },
+  "type": "module",
+  "module": "./index.mjs",
+  "scripts": {
+    "check": "standardx '**/*.ts' && standardx '**/*.js' && standardx '**/*.cjs'",
+    "fix": "standardx --fix '**/*.ts' && standardx --fix '**/*.js' && standardx --fix '**/*.cjs'",
+    "pretest": "rimraf build && tsc -p tsconfig.test.json && cross-env NODE_ENV=test npm run build:cjs",
+    "test": "c8 mocha ./test/*.cjs",
+    "test:esm": "c8 mocha ./test/esm/cliui-test.mjs",
+    "postest": "check",
+    "coverage": "c8 report --check-coverage",
+    "precompile": "rimraf build",
+    "compile": "tsc",
+    "postcompile": "npm run build:cjs",
+    "build:cjs": "rollup -c",
+    "prepare": "npm run compile"
+  },
+  "repository": "yargs/cliui",
+  "standard": {
+    "ignore": [
+      "**/example/**"
+    ],
+    "globals": [
+      "it"
+    ]
+  },
+  "keywords": [
+    "cli",
+    "command-line",
+    "layout",
+    "design",
+    "console",
+    "wrap",
+    "table"
+  ],
+  "author": "Ben Coe <ben@npmjs.com>",
+  "license": "ISC",
+  "dependencies": {
+    "string-width": "^4.2.0",
+    "strip-ansi": "^6.0.0",
+    "wrap-ansi": "^7.0.0"
+  },
+  "devDependencies": {
+    "@types/node": "^14.0.27",
+    "@typescript-eslint/eslint-plugin": "^4.0.0",
+    "@typescript-eslint/parser": "^4.0.0",
+    "@wessberg/rollup-plugin-ts": "^1.3.2",
+    "c8": "^7.3.0",
+    "chai": "^4.2.0",
+    "chalk": "^4.1.0",
+    "cross-env": "^7.0.2",
+    "eslint": "^7.6.0",
+    "eslint-plugin-import": "^2.22.0",
+    "eslint-plugin-node": "^11.1.0",
+    "gts": "^3.0.0",
+    "mocha": "^8.1.1",
+    "rimraf": "^3.0.2",
+    "rollup": "^2.23.1",
+    "standardx": "^7.0.0",
+    "typescript": "^4.0.0"
+  },
+  "files": [
+    "build",
+    "index.mjs",
+    "!*.d.ts"
+  ],
+  "engine": {
+    "node": ">=10"
+  }
+}

node_modules/karma/node_modules/color-convert/CHANGELOG.md

@@ -0,0 +1,54 @@
+# 1.0.0 - 2016-01-07
+
+- Removed: unused speed test
+- Added: Automatic routing between previously unsupported conversions
+([#27](https://github.com/Qix-/color-convert/pull/27))
+- Removed: `xxx2xxx()` and `xxx2xxxRaw()` functions
+([#27](https://github.com/Qix-/color-convert/pull/27))
+- Removed: `convert()` class
+([#27](https://github.com/Qix-/color-convert/pull/27))
+- Changed: all functions to lookup dictionary
+([#27](https://github.com/Qix-/color-convert/pull/27))
+- Changed: `ansi` to `ansi256`
+([#27](https://github.com/Qix-/color-convert/pull/27))
+- Fixed: argument grouping for functions requiring only one argument
+([#27](https://github.com/Qix-/color-convert/pull/27))
+
+# 0.6.0 - 2015-07-23
+
+- Added: methods to handle
+[ANSI](https://en.wikipedia.org/wiki/ANSI_escape_code#Colors) 16/256 colors:
+  - rgb2ansi16
+  - rgb2ansi
+  - hsl2ansi16
+  - hsl2ansi
+  - hsv2ansi16
+  - hsv2ansi
+  - hwb2ansi16
+  - hwb2ansi
+  - cmyk2ansi16
+  - cmyk2ansi
+  - keyword2ansi16
+  - keyword2ansi
+  - ansi162rgb
+  - ansi162hsl
+  - ansi162hsv
+  - ansi162hwb
+  - ansi162cmyk
+  - ansi162keyword
+  - ansi2rgb
+  - ansi2hsl
+  - ansi2hsv
+  - ansi2hwb
+  - ansi2cmyk
+  - ansi2keyword
+([#18](https://github.com/harthur/color-convert/pull/18))
+
+# 0.5.3 - 2015-06-02
+
+- Fixed: hsl2hsv does not return `NaN` anymore when using `[0,0,0]`
+([#15](https://github.com/harthur/color-convert/issues/15))
+
+---
+
+Check out commit logs for older releases

node_modules/karma/node_modules/color-convert/LICENSE

@@ -0,0 +1,21 @@
+Copyright (c) 2011-2016 Heather Arthur <fayearthur@gmail.com>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+

node_modules/karma/node_modules/color-convert/README.md

@@ -0,0 +1,68 @@
+# color-convert
+
+[![Build Status](https://travis-ci.org/Qix-/color-convert.svg?branch=master)](https://travis-ci.org/Qix-/color-convert)
+
+Color-convert is a color conversion library for JavaScript and node.
+It converts all ways between `rgb`, `hsl`, `hsv`, `hwb`, `cmyk`, `ansi`, `ansi16`, `hex` strings, and CSS `keyword`s (will round to closest):
+
+```js
+var convert = require('color-convert');
+
+convert.rgb.hsl(140, 200, 100);             // [96, 48, 59]
+convert.keyword.rgb('blue');                // [0, 0, 255]
+
+var rgbChannels = convert.rgb.channels;     // 3
+var cmykChannels = convert.cmyk.channels;   // 4
+var ansiChannels = convert.ansi16.channels; // 1
+```
+
+# Install
+
+```console
+$ npm install color-convert
+```
+
+# API
+
+Simply get the property of the _from_ and _to_ conversion that you're looking for.
+
+All functions have a rounded and unrounded variant. By default, return values are rounded. To get the unrounded (raw) results, simply tack on `.raw` to the function.
+
+All 'from' functions have a hidden property called `.channels` that indicates the number of channels the function expects (not including alpha).
+
+```js
+var convert = require('color-convert');
+
+// Hex to LAB
+convert.hex.lab('DEADBF');         // [ 76, 21, -2 ]
+convert.hex.lab.raw('DEADBF');     // [ 75.56213190997677, 20.653827952644754, -2.290532499330533 ]
+
+// RGB to CMYK
+convert.rgb.cmyk(167, 255, 4);     // [ 35, 0, 98, 0 ]
+convert.rgb.cmyk.raw(167, 255, 4); // [ 34.509803921568626, 0, 98.43137254901961, 0 ]
+```
+
+### Arrays
+All functions that accept multiple arguments also support passing an array.
+
+Note that this does **not** apply to functions that convert from a color that only requires one value (e.g. `keyword`, `ansi256`, `hex`, etc.)
+
+```js
+var convert = require('color-convert');
+
+convert.rgb.hex(123, 45, 67);      // '7B2D43'
+convert.rgb.hex([123, 45, 67]);    // '7B2D43'
+```
+
+## Routing
+
+Conversions that don't have an _explicitly_ defined conversion (in [conversions.js](conversions.js)), but can be converted by means of sub-conversions (e.g. XYZ -> **RGB** -> CMYK), are automatically routed together. This allows just about any color model supported by `color-convert` to be converted to any other model, so long as a sub-conversion path exists. This is also true for conversions requiring more than one step in between (e.g. LCH -> **LAB** -> **XYZ** -> **RGB** -> Hex).
+
+Keep in mind that extensive conversions _may_ result in a loss of precision, and exist only to be complete. For a list of "direct" (single-step) conversions, see [conversions.js](conversions.js).
+
+# Contribute
+
+If there is a new model you would like to support, or want to add a direct conversion between two existing models, please send us a pull request.
+
+# License
+Copyright © 2011-2016, Heather Arthur and Josh Junon. Licensed under the [MIT License](LICENSE).

node_modules/karma/node_modules/color-convert/conversions.js

@@ -0,0 +1,839 @@
+/* MIT license */
+/* eslint-disable no-mixed-operators */
+const cssKeywords = require('color-name');
+
+// NOTE: conversions should only return primitive values (i.e. arrays, or
+//       values that give correct `typeof` results).
+//       do not use box values types (i.e. Number(), String(), etc.)
+
+const reverseKeywords = {};
+for (const key of Object.keys(cssKeywords)) {
+	reverseKeywords[cssKeywords[key]] = key;
+}
+
+const convert = {
+	rgb: {channels: 3, labels: 'rgb'},
+	hsl: {channels: 3, labels: 'hsl'},
+	hsv: {channels: 3, labels: 'hsv'},
+	hwb: {channels: 3, labels: 'hwb'},
+	cmyk: {channels: 4, labels: 'cmyk'},
+	xyz: {channels: 3, labels: 'xyz'},
+	lab: {channels: 3, labels: 'lab'},
+	lch: {channels: 3, labels: 'lch'},
+	hex: {channels: 1, labels: ['hex']},
+	keyword: {channels: 1, labels: ['keyword']},
+	ansi16: {channels: 1, labels: ['ansi16']},
+	ansi256: {channels: 1, labels: ['ansi256']},
+	hcg: {channels: 3, labels: ['h', 'c', 'g']},
+	apple: {channels: 3, labels: ['r16', 'g16', 'b16']},
+	gray: {channels: 1, labels: ['gray']}
+};
+
+module.exports = convert;
+
+// Hide .channels and .labels properties
+for (const model of Object.keys(convert)) {
+	if (!('channels' in convert[model])) {
+		throw new Error('missing channels property: ' + model);
+	}
+
+	if (!('labels' in convert[model])) {
+		throw new Error('missing channel labels property: ' + model);
+	}
+
+	if (convert[model].labels.length !== convert[model].channels) {
+		throw new Error('channel and label counts mismatch: ' + model);
+	}
+
+	const {channels, labels} = convert[model];
+	delete convert[model].channels;
+	delete convert[model].labels;
+	Object.defineProperty(convert[model], 'channels', {value: channels});
+	Object.defineProperty(convert[model], 'labels', {value: labels});
+}
+
+convert.rgb.hsl = function (rgb) {
+	const r = rgb[0] / 255;
+	const g = rgb[1] / 255;
+	const b = rgb[2] / 255;
+	const min = Math.min(r, g, b);
+	const max = Math.max(r, g, b);
+	const delta = max - min;
+	let h;
+	let s;
+
+	if (max === min) {
+		h = 0;
+	} else if (r === max) {
+		h = (g - b) / delta;
+	} else if (g === max) {
+		h = 2 + (b - r) / delta;
+	} else if (b === max) {
+		h = 4 + (r - g) / delta;
+	}
+
+	h = Math.min(h * 60, 360);
+
+	if (h < 0) {
+		h += 360;
+	}
+
+	const l = (min + max) / 2;
+
+	if (max === min) {
+		s = 0;
+	} else if (l <= 0.5) {
+		s = delta / (max + min);
+	} else {
+		s = delta / (2 - max - min);
+	}
+
+	return [h, s * 100, l * 100];
+};
+
+convert.rgb.hsv = function (rgb) {
+	let rdif;
+	let gdif;
+	let bdif;
+	let h;
+	let s;
+
+	const r = rgb[0] / 255;
+	const g = rgb[1] / 255;
+	const b = rgb[2] / 255;
+	const v = Math.max(r, g, b);
+	const diff = v - Math.min(r, g, b);
+	const diffc = function (c) {
+		return (v - c) / 6 / diff + 1 / 2;
+	};
+
+	if (diff === 0) {
+		h = 0;
+		s = 0;
+	} else {
+		s = diff / v;
+		rdif = diffc(r);
+		gdif = diffc(g);
+		bdif = diffc(b);
+
+		if (r === v) {
+			h = bdif - gdif;
+		} else if (g === v) {
+			h = (1 / 3) + rdif - bdif;
+		} else if (b === v) {
+			h = (2 / 3) + gdif - rdif;
+		}
+
+		if (h < 0) {
+			h += 1;
+		} else if (h > 1) {
+			h -= 1;
+		}
+	}
+
+	return [
+		h * 360,
+		s * 100,
+		v * 100
+	];
+};
+
+convert.rgb.hwb = function (rgb) {
+	const r = rgb[0];
+	const g = rgb[1];
+	let b = rgb[2];
+	const h = convert.rgb.hsl(rgb)[0];
+	const w = 1 / 255 * Math.min(r, Math.min(g, b));
+
+	b = 1 - 1 / 255 * Math.max(r, Math.max(g, b));
+
+	return [h, w * 100, b * 100];
+};
+
+convert.rgb.cmyk = function (rgb) {
+	const r = rgb[0] / 255;
+	const g = rgb[1] / 255;
+	const b = rgb[2] / 255;
+
+	const k = Math.min(1 - r, 1 - g, 1 - b);
+	const c = (1 - r - k) / (1 - k) || 0;
+	const m = (1 - g - k) / (1 - k) || 0;
+	const y = (1 - b - k) / (1 - k) || 0;
+
+	return [c * 100, m * 100, y * 100, k * 100];
+};
+
+function comparativeDistance(x, y) {
+	/*
+		See https://en.m.wikipedia.org/wiki/Euclidean_distance#Squared_Euclidean_distance
+	*/
+	return (
+		((x[0] - y[0]) ** 2) +
+		((x[1] - y[1]) ** 2) +
+		((x[2] - y[2]) ** 2)
+	);
+}
+
+convert.rgb.keyword = function (rgb) {
+	const reversed = reverseKeywords[rgb];
+	if (reversed) {
+		return reversed;
+	}
+
+	let currentClosestDistance = Infinity;
+	let currentClosestKeyword;
+
+	for (const keyword of Object.keys(cssKeywords)) {
+		const value = cssKeywords[keyword];
+
+		// Compute comparative distance
+		const distance = comparativeDistance(rgb, value);
+
+		// Check if its less, if so set as closest
+		if (distance < currentClosestDistance) {
+			currentClosestDistance = distance;
+			currentClosestKeyword = keyword;
+		}
+	}
+
+	return currentClosestKeyword;
+};
+
+convert.keyword.rgb = function (keyword) {
+	return cssKeywords[keyword];
+};
+
+convert.rgb.xyz = function (rgb) {
+	let r = rgb[0] / 255;
+	let g = rgb[1] / 255;
+	let b = rgb[2] / 255;
+
+	// Assume sRGB
+	r = r > 0.04045 ? (((r + 0.055) / 1.055) ** 2.4) : (r / 12.92);
+	g = g > 0.04045 ? (((g + 0.055) / 1.055) ** 2.4) : (g / 12.92);
+	b = b > 0.04045 ? (((b + 0.055) / 1.055) ** 2.4) : (b / 12.92);
+
+	const x = (r * 0.4124) + (g * 0.3576) + (b * 0.1805);
+	const y = (r * 0.2126) + (g * 0.7152) + (b * 0.0722);
+	const z = (r * 0.0193) + (g * 0.1192) + (b * 0.9505);
+
+	return [x * 100, y * 100, z * 100];
+};
+
+convert.rgb.lab = function (rgb) {
+	const xyz = convert.rgb.xyz(rgb);
+	let x = xyz[0];
+	let y = xyz[1];
+	let z = xyz[2];
+
+	x /= 95.047;
+	y /= 100;
+	z /= 108.883;
+
+	x = x > 0.008856 ? (x ** (1 / 3)) : (7.787 * x) + (16 / 116);
+	y = y > 0.008856 ? (y ** (1 / 3)) : (7.787 * y) + (16 / 116);
+	z = z > 0.008856 ? (z ** (1 / 3)) : (7.787 * z) + (16 / 116);
+
+	const l = (116 * y) - 16;
+	const a = 500 * (x - y);
+	const b = 200 * (y - z);
+
+	return [l, a, b];
+};
+
+convert.hsl.rgb = function (hsl) {
+	const h = hsl[0] / 360;
+	const s = hsl[1] / 100;
+	const l = hsl[2] / 100;
+	let t2;
+	let t3;
+	let val;
+
+	if (s === 0) {
+		val = l * 255;
+		return [val, val, val];
+	}
+
+	if (l < 0.5) {
+		t2 = l * (1 + s);
+	} else {
+		t2 = l + s - l * s;
+	}
+
+	const t1 = 2 * l - t2;
+
+	const rgb = [0, 0, 0];
+	for (let i = 0; i < 3; i++) {
+		t3 = h + 1 / 3 * -(i - 1);
+		if (t3 < 0) {
+			t3++;
+		}
+
+		if (t3 > 1) {
+			t3--;
+		}
+
+		if (6 * t3 < 1) {
+			val = t1 + (t2 - t1) * 6 * t3;
+		} else if (2 * t3 < 1) {
+			val = t2;
+		} else if (3 * t3 < 2) {
+			val = t1 + (t2 - t1) * (2 / 3 - t3) * 6;
+		} else {
+			val = t1;
+		}
+
+		rgb[i] = val * 255;
+	}
+
+	return rgb;
+};
+
+convert.hsl.hsv = function (hsl) {
+	const h = hsl[0];
+	let s = hsl[1] / 100;
+	let l = hsl[2] / 100;
+	let smin = s;
+	const lmin = Math.max(l, 0.01);
+
+	l *= 2;
+	s *= (l <= 1) ? l : 2 - l;
+	smin *= lmin <= 1 ? lmin : 2 - lmin;
+	const v = (l + s) / 2;
+	const sv = l === 0 ? (2 * smin) / (lmin + smin) : (2 * s) / (l + s);
+
+	return [h, sv * 100, v * 100];
+};
+
+convert.hsv.rgb = function (hsv) {
+	const h = hsv[0] / 60;
+	const s = hsv[1] / 100;
+	let v = hsv[2] / 100;
+	const hi = Math.floor(h) % 6;
+
+	const f = h - Math.floor(h);
+	const p = 255 * v * (1 - s);
+	const q = 255 * v * (1 - (s * f));
+	const t = 255 * v * (1 - (s * (1 - f)));
+	v *= 255;
+
+	switch (hi) {
+		case 0:
+			return [v, t, p];
+		case 1:
+			return [q, v, p];
+		case 2:
+			return [p, v, t];
+		case 3:
+			return [p, q, v];
+		case 4:
+			return [t, p, v];
+		case 5:
+			return [v, p, q];
+	}
+};
+
+convert.hsv.hsl = function (hsv) {
+	const h = hsv[0];
+	const s = hsv[1] / 100;
+	const v = hsv[2] / 100;
+	const vmin = Math.max(v, 0.01);
+	let sl;
+	let l;
+
+	l = (2 - s) * v;
+	const lmin = (2 - s) * vmin;
+	sl = s * vmin;
+	sl /= (lmin <= 1) ? lmin : 2 - lmin;
+	sl = sl || 0;
+	l /= 2;
+
+	return [h, sl * 100, l * 100];
+};
+
+// http://dev.w3.org/csswg/css-color/#hwb-to-rgb
+convert.hwb.rgb = function (hwb) {
+	const h = hwb[0] / 360;
+	let wh = hwb[1] / 100;
+	let bl = hwb[2] / 100;
+	const ratio = wh + bl;
+	let f;
+
+	// Wh + bl cant be > 1
+	if (ratio > 1) {
+		wh /= ratio;
+		bl /= ratio;
+	}
+
+	const i = Math.floor(6 * h);
+	const v = 1 - bl;
+	f = 6 * h - i;
+
+	if ((i & 0x01) !== 0) {
+		f = 1 - f;
+	}
+
+	const n = wh + f * (v - wh); // Linear interpolation
+
+	let r;
+	let g;
+	let b;
+	/* eslint-disable max-statements-per-line,no-multi-spaces */
+	switch (i) {
+		default:
+		case 6:
+		case 0: r = v;  g = n;  b = wh; break;
+		case 1: r = n;  g = v;  b = wh; break;
+		case 2: r = wh; g = v;  b = n; break;
+		case 3: r = wh; g = n;  b = v; break;
+		case 4: r = n;  g = wh; b = v; break;
+		case 5: r = v;  g = wh; b = n; break;
+	}
+	/* eslint-enable max-statements-per-line,no-multi-spaces */
+
+	return [r * 255, g * 255, b * 255];
+};
+
+convert.cmyk.rgb = function (cmyk) {
+	const c = cmyk[0] / 100;
+	const m = cmyk[1] / 100;
+	const y = cmyk[2] / 100;
+	const k = cmyk[3] / 100;
+
+	const r = 1 - Math.min(1, c * (1 - k) + k);
+	const g = 1 - Math.min(1, m * (1 - k) + k);
+	const b = 1 - Math.min(1, y * (1 - k) + k);
+
+	return [r * 255, g * 255, b * 255];
+};
+
+convert.xyz.rgb = function (xyz) {
+	const x = xyz[0] / 100;
+	const y = xyz[1] / 100;
+	const z = xyz[2] / 100;
+	let r;
+	let g;
+	let b;
+
+	r = (x * 3.2406) + (y * -1.5372) + (z * -0.4986);
+	g = (x * -0.9689) + (y * 1.8758) + (z * 0.0415);
+	b = (x * 0.0557) + (y * -0.2040) + (z * 1.0570);
+
+	// Assume sRGB
+	r = r > 0.0031308
+		? ((1.055 * (r ** (1.0 / 2.4))) - 0.055)
+		: r * 12.92;
+
+	g = g > 0.0031308
+		? ((1.055 * (g ** (1.0 / 2.4))) - 0.055)
+		: g * 12.92;
+
+	b = b > 0.0031308
+		? ((1.055 * (b ** (1.0 / 2.4))) - 0.055)
+		: b * 12.92;
+
+	r = Math.min(Math.max(0, r), 1);
+	g = Math.min(Math.max(0, g), 1);
+	b = Math.min(Math.max(0, b), 1);
+
+	return [r * 255, g * 255, b * 255];
+};
+
+convert.xyz.lab = function (xyz) {
+	let x = xyz[0];
+	let y = xyz[1];
+	let z = xyz[2];
+
+	x /= 95.047;
+	y /= 100;
+	z /= 108.883;
+
+	x = x > 0.008856 ? (x ** (1 / 3)) : (7.787 * x) + (16 / 116);
+	y = y > 0.008856 ? (y ** (1 / 3)) : (7.787 * y) + (16 / 116);
+	z = z > 0.008856 ? (z ** (1 / 3)) : (7.787 * z) + (16 / 116);
+
+	const l = (116 * y) - 16;
+	const a = 500 * (x - y);
+	const b = 200 * (y - z);
+
+	return [l, a, b];
+};
+
+convert.lab.xyz = function (lab) {
+	const l = lab[0];
+	const a = lab[1];
+	const b = lab[2];
+	let x;
+	let y;
+	let z;
+
+	y = (l + 16) / 116;
+	x = a / 500 + y;
+	z = y - b / 200;
+
+	const y2 = y ** 3;
+	const x2 = x ** 3;
+	const z2 = z ** 3;
+	y = y2 > 0.008856 ? y2 : (y - 16 / 116) / 7.787;
+	x = x2 > 0.008856 ? x2 : (x - 16 / 116) / 7.787;
+	z = z2 > 0.008856 ? z2 : (z - 16 / 116) / 7.787;
+
+	x *= 95.047;
+	y *= 100;
+	z *= 108.883;
+
+	return [x, y, z];
+};
+
+convert.lab.lch = function (lab) {
+	const l = lab[0];
+	const a = lab[1];
+	const b = lab[2];
+	let h;
+
+	const hr = Math.atan2(b, a);
+	h = hr * 360 / 2 / Math.PI;
+
+	if (h < 0) {
+		h += 360;
+	}
+
+	const c = Math.sqrt(a * a + b * b);
+
+	return [l, c, h];
+};
+
+convert.lch.lab = function (lch) {
+	const l = lch[0];
+	const c = lch[1];
+	const h = lch[2];
+
+	const hr = h / 360 * 2 * Math.PI;
+	const a = c * Math.cos(hr);
+	const b = c * Math.sin(hr);
+
+	return [l, a, b];
+};
+
+convert.rgb.ansi16 = function (args, saturation = null) {
+	const [r, g, b] = args;
+	let value = saturation === null ? convert.rgb.hsv(args)[2] : saturation; // Hsv -> ansi16 optimization
+
+	value = Math.round(value / 50);
+
+	if (value === 0) {
+		return 30;
+	}
+
+	let ansi = 30
+		+ ((Math.round(b / 255) << 2)
+		| (Math.round(g / 255) << 1)
+		| Math.round(r / 255));
+
+	if (value === 2) {
+		ansi += 60;
+	}
+
+	return ansi;
+};
+
+convert.hsv.ansi16 = function (args) {
+	// Optimization here; we already know the value and don't need to get
+	// it converted for us.
+	return convert.rgb.ansi16(convert.hsv.rgb(args), args[2]);
+};
+
+convert.rgb.ansi256 = function (args) {
+	const r = args[0];
+	const g = args[1];
+	const b = args[2];
+
+	// We use the extended greyscale palette here, with the exception of
+	// black and white. normal palette only has 4 greyscale shades.
+	if (r === g && g === b) {
+		if (r < 8) {
+			return 16;
+		}
+
+		if (r > 248) {
+			return 231;
+		}
+
+		return Math.round(((r - 8) / 247) * 24) + 232;
+	}
+
+	const ansi = 16
+		+ (36 * Math.round(r / 255 * 5))
+		+ (6 * Math.round(g / 255 * 5))
+		+ Math.round(b / 255 * 5);
+
+	return ansi;
+};
+
+convert.ansi16.rgb = function (args) {
+	let color = args % 10;
+
+	// Handle greyscale
+	if (color === 0 || color === 7) {
+		if (args > 50) {
+			color += 3.5;
+		}
+
+		color = color / 10.5 * 255;
+
+		return [color, color, color];
+	}
+
+	const mult = (~~(args > 50) + 1) * 0.5;
+	const r = ((color & 1) * mult) * 255;
+	const g = (((color >> 1) & 1) * mult) * 255;
+	const b = (((color >> 2) & 1) * mult) * 255;
+
+	return [r, g, b];
+};
+
+convert.ansi256.rgb = function (args) {
+	// Handle greyscale
+	if (args >= 232) {
+		const c = (args - 232) * 10 + 8;
+		return [c, c, c];
+	}
+
+	args -= 16;
+
+	let rem;
+	const r = Math.floor(args / 36) / 5 * 255;
+	const g = Math.floor((rem = args % 36) / 6) / 5 * 255;
+	const b = (rem % 6) / 5 * 255;
+
+	return [r, g, b];
+};
+
+convert.rgb.hex = function (args) {
+	const integer = ((Math.round(args[0]) & 0xFF) << 16)
+		+ ((Math.round(args[1]) & 0xFF) << 8)
+		+ (Math.round(args[2]) & 0xFF);
+
+	const string = integer.toString(16).toUpperCase();
+	return '000000'.substring(string.length) + string;
+};
+
+convert.hex.rgb = function (args) {
+	const match = args.toString(16).match(/[a-f0-9]{6}|[a-f0-9]{3}/i);
+	if (!match) {
+		return [0, 0, 0];
+	}
+
+	let colorString = match[0];
+
+	if (match[0].length === 3) {
+		colorString = colorString.split('').map(char => {
+			return char + char;
+		}).join('');
+	}
+
+	const integer = parseInt(colorString, 16);
+	const r = (integer >> 16) & 0xFF;
+	const g = (integer >> 8) & 0xFF;
+	const b = integer & 0xFF;
+
+	return [r, g, b];
+};
+
+convert.rgb.hcg = function (rgb) {
+	const r = rgb[0] / 255;
+	const g = rgb[1] / 255;
+	const b = rgb[2] / 255;
+	const max = Math.max(Math.max(r, g), b);
+	const min = Math.min(Math.min(r, g), b);
+	const chroma = (max - min);
+	let grayscale;
+	let hue;
+
+	if (chroma < 1) {
+		grayscale = min / (1 - chroma);
+	} else {
+		grayscale = 0;
+	}
+
+	if (chroma <= 0) {
+		hue = 0;
+	} else
+	if (max === r) {
+		hue = ((g - b) / chroma) % 6;
+	} else
+	if (max === g) {
+		hue = 2 + (b - r) / chroma;
+	} else {
+		hue = 4 + (r - g) / chroma;
+	}
+
+	hue /= 6;
+	hue %= 1;
+
+	return [hue * 360, chroma * 100, grayscale * 100];
+};
+
+convert.hsl.hcg = function (hsl) {
+	const s = hsl[1] / 100;
+	const l = hsl[2] / 100;
+
+	const c = l < 0.5 ? (2.0 * s * l) : (2.0 * s * (1.0 - l));
+
+	let f = 0;
+	if (c < 1.0) {
+		f = (l - 0.5 * c) / (1.0 - c);
+	}
+
+	return [hsl[0], c * 100, f * 100];
+};
+
+convert.hsv.hcg = function (hsv) {
+	const s = hsv[1] / 100;
+	const v = hsv[2] / 100;
+
+	const c = s * v;
+	let f = 0;
+
+	if (c < 1.0) {
+		f = (v - c) / (1 - c);
+	}
+
+	return [hsv[0], c * 100, f * 100];
+};
+
+convert.hcg.rgb = function (hcg) {
+	const h = hcg[0] / 360;
+	const c = hcg[1] / 100;
+	const g = hcg[2] / 100;
+
+	if (c === 0.0) {
+		return [g * 255, g * 255, g * 255];
+	}
+
+	const pure = [0, 0, 0];
+	const hi = (h % 1) * 6;
+	const v = hi % 1;
+	const w = 1 - v;
+	let mg = 0;
+
+	/* eslint-disable max-statements-per-line */
+	switch (Math.floor(hi)) {
+		case 0:
+			pure[0] = 1; pure[1] = v; pure[2] = 0; break;
+		case 1:
+			pure[0] = w; pure[1] = 1; pure[2] = 0; break;
+		case 2:
+			pure[0] = 0; pure[1] = 1; pure[2] = v; break;
+		case 3:
+			pure[0] = 0; pure[1] = w; pure[2] = 1; break;
+		case 4:
+			pure[0] = v; pure[1] = 0; pure[2] = 1; break;
+		default:
+			pure[0] = 1; pure[1] = 0; pure[2] = w;
+	}
+	/* eslint-enable max-statements-per-line */
+
+	mg = (1.0 - c) * g;
+
+	return [
+		(c * pure[0] + mg) * 255,
+		(c * pure[1] + mg) * 255,
+		(c * pure[2] + mg) * 255
+	];
+};
+
+convert.hcg.hsv = function (hcg) {
+	const c = hcg[1] / 100;
+	const g = hcg[2] / 100;
+
+	const v = c + g * (1.0 - c);
+	let f = 0;
+
+	if (v > 0.0) {
+		f = c / v;
+	}
+
+	return [hcg[0], f * 100, v * 100];
+};
+
+convert.hcg.hsl = function (hcg) {
+	const c = hcg[1] / 100;
+	const g = hcg[2] / 100;
+
+	const l = g * (1.0 - c) + 0.5 * c;
+	let s = 0;
+
+	if (l > 0.0 && l < 0.5) {
+		s = c / (2 * l);
+	} else
+	if (l >= 0.5 && l < 1.0) {
+		s = c / (2 * (1 - l));
+	}
+
+	return [hcg[0], s * 100, l * 100];
+};
+
+convert.hcg.hwb = function (hcg) {
+	const c = hcg[1] / 100;
+	const g = hcg[2] / 100;
+	const v = c + g * (1.0 - c);
+	return [hcg[0], (v - c) * 100, (1 - v) * 100];
+};
+
+convert.hwb.hcg = function (hwb) {
+	const w = hwb[1] / 100;
+	const b = hwb[2] / 100;
+	const v = 1 - b;
+	const c = v - w;
+	let g = 0;
+
+	if (c < 1) {
+		g = (v - c) / (1 - c);
+	}
+
+	return [hwb[0], c * 100, g * 100];
+};
+
+convert.apple.rgb = function (apple) {
+	return [(apple[0] / 65535) * 255, (apple[1] / 65535) * 255, (apple[2] / 65535) * 255];
+};
+
+convert.rgb.apple = function (rgb) {
+	return [(rgb[0] / 255) * 65535, (rgb[1] / 255) * 65535, (rgb[2] / 255) * 65535];
+};
+
+convert.gray.rgb = function (args) {
+	return [args[0] / 100 * 255, args[0] / 100 * 255, args[0] / 100 * 255];
+};
+
+convert.gray.hsl = function (args) {
+	return [0, 0, args[0]];
+};
+
+convert.gray.hsv = convert.gray.hsl;
+
+convert.gray.hwb = function (gray) {
+	return [0, 100, gray[0]];
+};
+
+convert.gray.cmyk = function (gray) {
+	return [0, 0, 0, gray[0]];
+};
+
+convert.gray.lab = function (gray) {
+	return [gray[0], 0, 0];
+};
+
+convert.gray.hex = function (gray) {
+	const val = Math.round(gray[0] / 100 * 255) & 0xFF;
+	const integer = (val << 16) + (val << 8) + val;
+
+	const string = integer.toString(16).toUpperCase();
+	return '000000'.substring(string.length) + string;
+};
+
+convert.rgb.gray = function (rgb) {
+	const val = (rgb[0] + rgb[1] + rgb[2]) / 3;
+	return [val / 255 * 100];
+};

node_modules/karma/node_modules/color-convert/index.js

@@ -0,0 +1,81 @@
+const conversions = require('./conversions');
+const route = require('./route');
+
+const convert = {};
+
+const models = Object.keys(conversions);
+
+function wrapRaw(fn) {
+	const wrappedFn = function (...args) {
+		const arg0 = args[0];
+		if (arg0 === undefined || arg0 === null) {
+			return arg0;
+		}
+
+		if (arg0.length > 1) {
+			args = arg0;
+		}
+
+		return fn(args);
+	};
+
+	// Preserve .conversion property if there is one
+	if ('conversion' in fn) {
+		wrappedFn.conversion = fn.conversion;
+	}
+
+	return wrappedFn;
+}
+
+function wrapRounded(fn) {
+	const wrappedFn = function (...args) {
+		const arg0 = args[0];
+
+		if (arg0 === undefined || arg0 === null) {
+			return arg0;
+		}
+
+		if (arg0.length > 1) {
+			args = arg0;
+		}
+
+		const result = fn(args);
+
+		// We're assuming the result is an array here.
+		// see notice in conversions.js; don't use box types
+		// in conversion functions.
+		if (typeof result === 'object') {
+			for (let len = result.length, i = 0; i < len; i++) {
+				result[i] = Math.round(result[i]);
+			}
+		}
+
+		return result;
+	};
+
+	// Preserve .conversion property if there is one
+	if ('conversion' in fn) {
+		wrappedFn.conversion = fn.conversion;
+	}
+
+	return wrappedFn;
+}
+
+models.forEach(fromModel => {
+	convert[fromModel] = {};
+
+	Object.defineProperty(convert[fromModel], 'channels', {value: conversions[fromModel].channels});
+	Object.defineProperty(convert[fromModel], 'labels', {value: conversions[fromModel].labels});
+
+	const routes = route(fromModel);
+	const routeModels = Object.keys(routes);
+
+	routeModels.forEach(toModel => {
+		const fn = routes[toModel];
+
+		convert[fromModel][toModel] = wrapRounded(fn);
+		convert[fromModel][toModel].raw = wrapRaw(fn);
+	});
+});
+
+module.exports = convert;

node_modules/karma/node_modules/color-convert/package.json

@@ -0,0 +1,48 @@
+{
+  "name": "color-convert",
+  "description": "Plain color conversion functions",
+  "version": "2.0.1",
+  "author": "Heather Arthur <fayearthur@gmail.com>",
+  "license": "MIT",
+  "repository": "Qix-/color-convert",
+  "scripts": {
+    "pretest": "xo",
+    "test": "node test/basic.js"
+  },
+  "engines": {
+    "node": ">=7.0.0"
+  },
+  "keywords": [
+    "color",
+    "colour",
+    "convert",
+    "converter",
+    "conversion",
+    "rgb",
+    "hsl",
+    "hsv",
+    "hwb",
+    "cmyk",
+    "ansi",
+    "ansi16"
+  ],
+  "files": [
+    "index.js",
+    "conversions.js",
+    "route.js"
+  ],
+  "xo": {
+    "rules": {
+      "default-case": 0,
+      "no-inline-comments": 0,
+      "operator-linebreak": 0
+    }
+  },
+  "devDependencies": {
+    "chalk": "^2.4.2",
+    "xo": "^0.24.0"
+  },
+  "dependencies": {
+    "color-name": "~1.1.4"
+  }
+}

node_modules/karma/node_modules/color-convert/route.js

@@ -0,0 +1,97 @@
+const conversions = require('./conversions');
+
+/*
+	This function routes a model to all other models.
+
+	all functions that are routed have a property `.conversion` attached
+	to the returned synthetic function. This property is an array
+	of strings, each with the steps in between the 'from' and 'to'
+	color models (inclusive).
+
+	conversions that are not possible simply are not included.
+*/
+
+function buildGraph() {
+	const graph = {};
+	// https://jsperf.com/object-keys-vs-for-in-with-closure/3
+	const models = Object.keys(conversions);
+
+	for (let len = models.length, i = 0; i < len; i++) {
+		graph[models[i]] = {
+			// http://jsperf.com/1-vs-infinity
+			// micro-opt, but this is simple.
+			distance: -1,
+			parent: null
+		};
+	}
+
+	return graph;
+}
+
+// https://en.wikipedia.org/wiki/Breadth-first_search
+function deriveBFS(fromModel) {
+	const graph = buildGraph();
+	const queue = [fromModel]; // Unshift -> queue -> pop
+
+	graph[fromModel].distance = 0;
+
+	while (queue.length) {
+		const current = queue.pop();
+		const adjacents = Object.keys(conversions[current]);
+
+		for (let len = adjacents.length, i = 0; i < len; i++) {
+			const adjacent = adjacents[i];
+			const node = graph[adjacent];
+
+			if (node.distance === -1) {
+				node.distance = graph[current].distance + 1;
+				node.parent = current;
+				queue.unshift(adjacent);
+			}
+		}
+	}
+
+	return graph;
+}
+
+function link(from, to) {
+	return function (args) {
+		return to(from(args));
+	};
+}
+
+function wrapConversion(toModel, graph) {
+	const path = [graph[toModel].parent, toModel];
+	let fn = conversions[graph[toModel].parent][toModel];
+
+	let cur = graph[toModel].parent;
+	while (graph[cur].parent) {
+		path.unshift(graph[cur].parent);
+		fn = link(conversions[graph[cur].parent][cur], fn);
+		cur = graph[cur].parent;
+	}
+
+	fn.conversion = path;
+	return fn;
+}
+
+module.exports = function (fromModel) {
+	const graph = deriveBFS(fromModel);
+	const conversion = {};
+
+	const models = Object.keys(graph);
+	for (let len = models.length, i = 0; i < len; i++) {
+		const toModel = models[i];
+		const node = graph[toModel];
+
+		if (node.parent === null) {
+			// No possible conversion, or this node is the source model.
+			continue;
+		}
+
+		conversion[toModel] = wrapConversion(toModel, graph);
+	}
+
+	return conversion;
+};
+

node_modules/karma/node_modules/color-name/LICENSE

@@ -0,0 +1,8 @@
+The MIT License (MIT)
+Copyright (c) 2015 Dmitry Ivanov
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

node_modules/karma/node_modules/color-name/README.md

@@ -0,0 +1,11 @@
+A JSON with color names and its values. Based on http://dev.w3.org/csswg/css-color/#named-colors.
+
+[![NPM](https://nodei.co/npm/color-name.png?mini=true)](https://nodei.co/npm/color-name/)
+
+
+```js
+var colors = require('color-name');
+colors.red //[255,0,0]
+```
+
+<a href="LICENSE"><img src="https://upload.wikimedia.org/wikipedia/commons/0/0c/MIT_logo.svg" width="120"/></a>

node_modules/karma/node_modules/color-name/index.js

@@ -0,0 +1,152 @@
+'use strict'
+
+module.exports = {
+	"aliceblue": [240, 248, 255],
+	"antiquewhite": [250, 235, 215],
+	"aqua": [0, 255, 255],
+	"aquamarine": [127, 255, 212],
+	"azure": [240, 255, 255],
+	"beige": [245, 245, 220],
+	"bisque": [255, 228, 196],
+	"black": [0, 0, 0],
+	"blanchedalmond": [255, 235, 205],
+	"blue": [0, 0, 255],
+	"blueviolet": [138, 43, 226],
+	"brown": [165, 42, 42],
+	"burlywood": [222, 184, 135],
+	"cadetblue": [95, 158, 160],
+	"chartreuse": [127, 255, 0],
+	"chocolate": [210, 105, 30],
+	"coral": [255, 127, 80],
+	"cornflowerblue": [100, 149, 237],
+	"cornsilk": [255, 248, 220],
+	"crimson": [220, 20, 60],
+	"cyan": [0, 255, 255],
+	"darkblue": [0, 0, 139],
+	"darkcyan": [0, 139, 139],
+	"darkgoldenrod": [184, 134, 11],
+	"darkgray": [169, 169, 169],
+	"darkgreen": [0, 100, 0],
+	"darkgrey": [169, 169, 169],
+	"darkkhaki": [189, 183, 107],
+	"darkmagenta": [139, 0, 139],
+	"darkolivegreen": [85, 107, 47],
+	"darkorange": [255, 140, 0],
+	"darkorchid": [153, 50, 204],
+	"darkred": [139, 0, 0],
+	"darksalmon": [233, 150, 122],
+	"darkseagreen": [143, 188, 143],
+	"darkslateblue": [72, 61, 139],
+	"darkslategray": [47, 79, 79],
+	"darkslategrey": [47, 79, 79],
+	"darkturquoise": [0, 206, 209],
+	"darkviolet": [148, 0, 211],
+	"deeppink": [255, 20, 147],
+	"deepskyblue": [0, 191, 255],
+	"dimgray": [105, 105, 105],
+	"dimgrey": [105, 105, 105],
+	"dodgerblue": [30, 144, 255],
+	"firebrick": [178, 34, 34],
+	"floralwhite": [255, 250, 240],
+	"forestgreen": [34, 139, 34],
+	"fuchsia": [255, 0, 255],
+	"gainsboro": [220, 220, 220],
+	"ghostwhite": [248, 248, 255],
+	"gold": [255, 215, 0],
+	"goldenrod": [218, 165, 32],
+	"gray": [128, 128, 128],
+	"green": [0, 128, 0],
+	"greenyellow": [173, 255, 47],
+	"grey": [128, 128, 128],
+	"honeydew": [240, 255, 240],
+	"hotpink": [255, 105, 180],
+	"indianred": [205, 92, 92],
+	"indigo": [75, 0, 130],
+	"ivory": [255, 255, 240],
+	"khaki": [240, 230, 140],
+	"lavender": [230, 230, 250],
+	"lavenderblush": [255, 240, 245],
+	"lawngreen": [124, 252, 0],
+	"lemonchiffon": [255, 250, 205],
+	"lightblue": [173, 216, 230],
+	"lightcoral": [240, 128, 128],
+	"lightcyan": [224, 255, 255],
+	"lightgoldenrodyellow": [250, 250, 210],
+	"lightgray": [211, 211, 211],
+	"lightgreen": [144, 238, 144],
+	"lightgrey": [211, 211, 211],
+	"lightpink": [255, 182, 193],
+	"lightsalmon": [255, 160, 122],
+	"lightseagreen": [32, 178, 170],
+	"lightskyblue": [135, 206, 250],
+	"lightslategray": [119, 136, 153],
+	"lightslategrey": [119, 136, 153],
+	"lightsteelblue": [176, 196, 222],
+	"lightyellow": [255, 255, 224],
+	"lime": [0, 255, 0],
+	"limegreen": [50, 205, 50],
+	"linen": [250, 240, 230],
+	"magenta": [255, 0, 255],
+	"maroon": [128, 0, 0],
+	"mediumaquamarine": [102, 205, 170],
+	"mediumblue": [0, 0, 205],
+	"mediumorchid": [186, 85, 211],
+	"mediumpurple": [147, 112, 219],
+	"mediumseagreen": [60, 179, 113],
+	"mediumslateblue": [123, 104, 238],
+	"mediumspringgreen": [0, 250, 154],
+	"mediumturquoise": [72, 209, 204],
+	"mediumvioletred": [199, 21, 133],
+	"midnightblue": [25, 25, 112],
+	"mintcream": [245, 255, 250],
+	"mistyrose": [255, 228, 225],
+	"moccasin": [255, 228, 181],
+	"navajowhite": [255, 222, 173],
+	"navy": [0, 0, 128],
+	"oldlace": [253, 245, 230],
+	"olive": [128, 128, 0],
+	"olivedrab": [107, 142, 35],
+	"orange": [255, 165, 0],
+	"orangered": [255, 69, 0],
+	"orchid": [218, 112, 214],
+	"palegoldenrod": [238, 232, 170],
+	"palegreen": [152, 251, 152],
+	"paleturquoise": [175, 238, 238],
+	"palevioletred": [219, 112, 147],
+	"papayawhip": [255, 239, 213],
+	"peachpuff": [255, 218, 185],
+	"peru": [205, 133, 63],
+	"pink": [255, 192, 203],
+	"plum": [221, 160, 221],
+	"powderblue": [176, 224, 230],
+	"purple": [128, 0, 128],
+	"rebeccapurple": [102, 51, 153],
+	"red": [255, 0, 0],
+	"rosybrown": [188, 143, 143],
+	"royalblue": [65, 105, 225],
+	"saddlebrown": [139, 69, 19],
+	"salmon": [250, 128, 114],
+	"sandybrown": [244, 164, 96],
+	"seagreen": [46, 139, 87],
+	"seashell": [255, 245, 238],
+	"sienna": [160, 82, 45],
+	"silver": [192, 192, 192],
+	"skyblue": [135, 206, 235],
+	"slateblue": [106, 90, 205],
+	"slategray": [112, 128, 144],
+	"slategrey": [112, 128, 144],
+	"snow": [255, 250, 250],
+	"springgreen": [0, 255, 127],
+	"steelblue": [70, 130, 180],
+	"tan": [210, 180, 140],
+	"teal": [0, 128, 128],
+	"thistle": [216, 191, 216],
+	"tomato": [255, 99, 71],
+	"turquoise": [64, 224, 208],
+	"violet": [238, 130, 238],
+	"wheat": [245, 222, 179],
+	"white": [255, 255, 255],
+	"whitesmoke": [245, 245, 245],
+	"yellow": [255, 255, 0],
+	"yellowgreen": [154, 205, 50]
+};

node_modules/karma/node_modules/color-name/package.json

@@ -0,0 +1,28 @@
+{
+  "name": "color-name",
+  "version": "1.1.4",
+  "description": "A list of color names and its values",
+  "main": "index.js",
+  "files": [
+    "index.js"
+  ],
+  "scripts": {
+    "test": "node test.js"
+  },
+  "repository": {
+    "type": "git",
+    "url": "git@github.com:colorjs/color-name.git"
+  },
+  "keywords": [
+    "color-name",
+    "color",
+    "color-keyword",
+    "keyword"
+  ],
+  "author": "DY <dfcreative@gmail.com>",
+  "license": "MIT",
+  "bugs": {
+    "url": "https://github.com/colorjs/color-name/issues"
+  },
+  "homepage": "https://github.com/colorjs/color-name"
+}

node_modules/karma/node_modules/connect/LICENSE

@@ -0,0 +1,25 @@
+(The MIT License)
+
+Copyright (c) 2010 Sencha Inc.
+Copyright (c) 2011 LearnBoost
+Copyright (c) 2011-2014 TJ Holowaychuk
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

node_modules/karma/node_modules/connect/README.md

@@ -0,0 +1,295 @@
+<div align="center">
+
+<img src="logo/horizontal.png" alt="connect logo" width="450px">
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+</div>
+
+  Connect is an extensible HTTP server framework for [node](http://nodejs.org) using "plugins" known as _middleware_.
+
+```js
+var connect = require('connect');
+var http = require('http');
+
+var app = connect();
+
+// gzip/deflate outgoing responses
+var compression = require('compression');
+app.use(compression());
+
+// store session state in browser cookie
+var cookieSession = require('cookie-session');
+app.use(cookieSession({
+    keys: ['secret1', 'secret2']
+}));
+
+// parse urlencoded request bodies into req.body
+var bodyParser = require('body-parser');
+app.use(bodyParser.urlencoded({extended: false}));
+
+// respond to all requests
+app.use(function(req, res){
+  res.end('Hello from Connect!\n');
+});
+
+//create node.js http server and listen on port
+http.createServer(app).listen(3000);
+```
+
+## Getting Started
+
+Connect is a simple framework to glue together various "middleware" to handle requests.
+
+### Install Connect
+
+```sh
+$ npm install connect
+```
+
+### Create an app
+
+The main component is a Connect "app". This will store all the middleware
+added and is, itself, a function.
+
+```js
+var app = connect();
+```
+
+### Use middleware
+
+The core of Connect is "using" middleware. Middleware are added as a "stack"
+where incoming requests will execute each middleware one-by-one until a middleware
+does not call `next()` within it.
+
+```js
+app.use(function middleware1(req, res, next) {
+  // middleware 1
+  next();
+});
+app.use(function middleware2(req, res, next) {
+  // middleware 2
+  next();
+});
+```
+
+### Mount middleware
+
+The `.use()` method also takes an optional path string that is matched against
+the beginning of the incoming request URL. This allows for basic routing.
+
+```js
+app.use('/foo', function fooMiddleware(req, res, next) {
+  // req.url starts with "/foo"
+  next();
+});
+app.use('/bar', function barMiddleware(req, res, next) {
+  // req.url starts with "/bar"
+  next();
+});
+```
+
+### Error middleware
+
+There are special cases of "error-handling" middleware. There are middleware
+where the function takes exactly 4 arguments. When a middleware passes an error
+to `next`, the app will proceed to look for the error middleware that was declared
+after that middleware and invoke it, skipping any error middleware above that
+middleware and any non-error middleware below.
+
+```js
+// regular middleware
+app.use(function (req, res, next) {
+  // i had an error
+  next(new Error('boom!'));
+});
+
+// error middleware for errors that occurred in middleware
+// declared before this
+app.use(function onerror(err, req, res, next) {
+  // an error occurred!
+});
+```
+
+### Create a server from the app
+
+The last step is to actually use the Connect app in a server. The `.listen()` method
+is a convenience to start a HTTP server (and is identical to the `http.Server`'s `listen`
+method in the version of Node.js you are running).
+
+```js
+var server = app.listen(port);
+```
+
+The app itself is really just a function with three arguments, so it can also be handed
+to `.createServer()` in Node.js.
+
+```js
+var server = http.createServer(app);
+```
+
+## Middleware
+
+These middleware and libraries are officially supported by the Connect/Express team:
+
+  - [body-parser](https://www.npmjs.com/package/body-parser) - previous `bodyParser`, `json`, and `urlencoded`. You may also be interested in:
+    - [body](https://www.npmjs.com/package/body)
+    - [co-body](https://www.npmjs.com/package/co-body)
+    - [raw-body](https://www.npmjs.com/package/raw-body)
+  - [compression](https://www.npmjs.com/package/compression) - previously `compress`
+  - [connect-timeout](https://www.npmjs.com/package/connect-timeout) - previously `timeout`
+  - [cookie-parser](https://www.npmjs.com/package/cookie-parser) - previously `cookieParser`
+  - [cookie-session](https://www.npmjs.com/package/cookie-session) - previously `cookieSession`
+  - [csurf](https://www.npmjs.com/package/csurf) - previously `csrf`
+  - [errorhandler](https://www.npmjs.com/package/errorhandler) - previously `error-handler`
+  - [express-session](https://www.npmjs.com/package/express-session) - previously `session`
+  - [method-override](https://www.npmjs.com/package/method-override) - previously `method-override`
+  - [morgan](https://www.npmjs.com/package/morgan) - previously `logger`
+  - [response-time](https://www.npmjs.com/package/response-time) - previously `response-time`
+  - [serve-favicon](https://www.npmjs.com/package/serve-favicon) - previously `favicon`
+  - [serve-index](https://www.npmjs.com/package/serve-index) - previously `directory`
+  - [serve-static](https://www.npmjs.com/package/serve-static) - previously `static`
+  - [vhost](https://www.npmjs.com/package/vhost) - previously `vhost`
+
+Most of these are exact ports of their Connect 2.x equivalents. The primary exception is `cookie-session`.
+
+Some middleware previously included with Connect are no longer supported by the Connect/Express team, are replaced by an alternative module, or should be superseded by a better module. Use one of these alternatives instead:
+
+  - `cookieParser`
+    - [cookies](https://www.npmjs.com/package/cookies) and [keygrip](https://www.npmjs.com/package/keygrip)
+  - `limit`
+    - [raw-body](https://www.npmjs.com/package/raw-body)
+  - `multipart`
+    - [connect-multiparty](https://www.npmjs.com/package/connect-multiparty)
+    - [connect-busboy](https://www.npmjs.com/package/connect-busboy)
+  - `query`
+    - [qs](https://www.npmjs.com/package/qs)
+  - `staticCache`
+    - [st](https://www.npmjs.com/package/st)
+    - [connect-static](https://www.npmjs.com/package/connect-static)
+
+Checkout [http-framework](https://github.com/Raynos/http-framework/wiki/Modules) for many other compatible middleware!
+
+## API
+
+The Connect API is very minimalist, enough to create an app and add a chain
+of middleware.
+
+When the `connect` module is required, a function is returned that will construct
+a new app when called.
+
+```js
+// require module
+var connect = require('connect')
+
+// create app
+var app = connect()
+```
+
+### app(req, res[, next])
+
+The `app` itself is a function. This is just an alias to `app.handle`.
+
+### app.handle(req, res[, out])
+
+Calling the function will run the middleware stack against the given Node.js
+http request (`req`) and response (`res`) objects. An optional function `out`
+can be provided that will be called if the request (or error) was not handled
+by the middleware stack.
+
+### app.listen([...])
+
+Start the app listening for requests. This method will internally create a Node.js
+HTTP server and call `.listen()` on it.
+
+This is an alias to the `server.listen()` method in the version of Node.js running,
+so consult the Node.js documentation for all the different variations. The most
+common signature is [`app.listen(port)`](https://nodejs.org/dist/latest-v6.x/docs/api/http.html#http_server_listen_port_hostname_backlog_callback).
+
+### app.use(fn)
+
+Use a function on the app, where the function represents a middleware. The function
+will be invoked for every request in the order that `app.use` is called. The function
+is called with three arguments:
+
+```js
+app.use(function (req, res, next) {
+  // req is the Node.js http request object
+  // res is the Node.js http response object
+  // next is a function to call to invoke the next middleware
+})
+```
+
+In addition to a plan function, the `fn` argument can also be a Node.js HTTP server
+instance or another Connect app instance.
+
+### app.use(route, fn)
+
+Use a function on the app, where the function represents a middleware. The function
+will be invoked for every request in which the URL (`req.url` property) starts with
+the given `route` string in the order that `app.use` is called. The function is
+called with three arguments:
+
+```js
+app.use('/foo', function (req, res, next) {
+  // req is the Node.js http request object
+  // res is the Node.js http response object
+  // next is a function to call to invoke the next middleware
+})
+```
+
+In addition to a plan function, the `fn` argument can also be a Node.js HTTP server
+instance or another Connect app instance.
+
+The `route` is always terminated at a path separator (`/`) or a dot (`.`) character.
+This means the given routes `/foo/` and `/foo` are the same and both will match requests
+with the URLs `/foo`, `/foo/`, `/foo/bar`, and `/foo.bar`, but not match a request with
+the URL `/foobar`.
+
+The `route` is matched in a case-insensitive manor.
+
+In order to make middleware easier to write to be agnostic of the `route`, when the
+`fn` is invoked, the `req.url` will be altered to remove the `route` part (and the
+original will be available as `req.originalUrl`). For example, if `fn` is used at the
+route `/foo`, the request for `/foo/bar` will invoke `fn` with `req.url === '/bar'`
+and `req.originalUrl === '/foo/bar'`.
+
+## Running Tests
+
+```bash
+npm install
+npm test
+```
+
+## People
+
+The Connect project would not be the same without all the people involved.
+
+The original author of Connect is [TJ Holowaychuk](https://github.com/tj)
+
+The current lead maintainer is [Douglas Christopher Wilson](https://github.com/dougwilson)
+
+[List of all contributors](https://github.com/senchalabs/connect/graphs/contributors)
+
+## Node Compatibility
+
+  - Connect `< 1.x` - node `0.2`
+  - Connect `1.x` - node `0.4`
+  - Connect `< 2.8` - node `0.6`
+  - Connect `>= 2.8 < 3` - node `0.8`
+  - Connect `>= 3` - node `0.10`, `0.12`, `4.x`, `5.x`, `6.x`, `7.x`, `8.x`, `9.x`, `10.x`, `11.x`, `12.x`; io.js `1.x`, `2.x`, `3.x`
+
+## License
+
+[MIT](LICENSE)
+
+[coveralls-image]: https://badgen.net/coveralls/c/github/senchalabs/connect/master
+[coveralls-url]: https://coveralls.io/r/senchalabs/connect?branch=master
+[npm-downloads-image]: https://badgen.net/npm/dm/connect
+[npm-url]: https://npmjs.org/package/connect
+[npm-version-image]: https://badgen.net/npm/v/connect
+[travis-image]: https://badgen.net/travis/senchalabs/connect/master
+[travis-url]: https://travis-ci.org/senchalabs/connect

node_modules/karma/node_modules/connect/SECURITY.md

@@ -0,0 +1,43 @@
+# Security Policies and Procedures
+
+This document outlines security procedures and general policies for the Connect
+project.
+
+  * [Reporting a Bug](#reporting-a-bug)
+  * [Disclosure Policy](#disclosure-policy)
+  * [Comments on this Policy](#comments-on-this-policy)
+
+## Reporting a Bug
+
+The Connect team and community take all security bugs in Connect seriously.
+Thank you for improving the security of Connect. We appreciate your efforts and
+responsible disclosure and will make every effort to acknowledge your
+contributions.
+
+Report security bugs by emailing the lead maintainer in the README.md file.
+
+The lead maintainer will acknowledge your email within 48 hours, and will send a
+more detailed response within 48 hours indicating the next steps in handling
+your report. After the initial reply to your report, the security team will
+endeavor to keep you informed of the progress towards a fix and full
+announcement, and may ask for additional information or guidance.
+
+Report security bugs in third-party modules to the person or team maintaining
+the module. You can also report a vulnerability through the
+[Node Security Project](https://nodesecurity.io/report).
+
+## Disclosure Policy
+
+When the security team receives a security bug report, they will assign it to a
+primary handler. This person will coordinate the fix and release process,
+involving the following steps:
+
+  * Confirm the problem and determine the affected versions.
+  * Audit code to find any potential similar problems.
+  * Prepare fixes for all releases still under maintenance. These fixes will be
+    released as fast as possible to npm.
+
+## Comments on this Policy
+
+If you have suggestions on how this process could be improved please submit a
+pull request.

node_modules/karma/node_modules/connect/index.js

@@ -0,0 +1,279 @@
+/*!
+ * connect
+ * Copyright(c) 2010 Sencha Inc.
+ * Copyright(c) 2011 TJ Holowaychuk
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var debug = require('debug')('connect:dispatcher');
+var EventEmitter = require('events').EventEmitter;
+var finalhandler = require('finalhandler');
+var http = require('http');
+var merge = require('utils-merge');
+var parseUrl = require('parseurl');
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = createServer;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var env = process.env.NODE_ENV || 'development';
+var proto = {};
+
+/* istanbul ignore next */
+var defer = typeof setImmediate === 'function'
+  ? setImmediate
+  : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) }
+
+/**
+ * Create a new connect server.
+ *
+ * @return {function}
+ * @public
+ */
+
+function createServer() {
+  function app(req, res, next){ app.handle(req, res, next); }
+  merge(app, proto);
+  merge(app, EventEmitter.prototype);
+  app.route = '/';
+  app.stack = [];
+  return app;
+}
+
+/**
+ * Utilize the given middleware `handle` to the given `route`,
+ * defaulting to _/_. This "route" is the mount-point for the
+ * middleware, when given a value other than _/_ the middleware
+ * is only effective when that segment is present in the request's
+ * pathname.
+ *
+ * For example if we were to mount a function at _/admin_, it would
+ * be invoked on _/admin_, and _/admin/settings_, however it would
+ * not be invoked for _/_, or _/posts_.
+ *
+ * @param {String|Function|Server} route, callback or server
+ * @param {Function|Server} callback or server
+ * @return {Server} for chaining
+ * @public
+ */
+
+proto.use = function use(route, fn) {
+  var handle = fn;
+  var path = route;
+
+  // default route to '/'
+  if (typeof route !== 'string') {
+    handle = route;
+    path = '/';
+  }
+
+  // wrap sub-apps
+  if (typeof handle.handle === 'function') {
+    var server = handle;
+    server.route = path;
+    handle = function (req, res, next) {
+      server.handle(req, res, next);
+    };
+  }
+
+  // wrap vanilla http.Servers
+  if (handle instanceof http.Server) {
+    handle = handle.listeners('request')[0];
+  }
+
+  // strip trailing slash
+  if (path[path.length - 1] === '/') {
+    path = path.slice(0, -1);
+  }
+
+  // add the middleware
+  debug('use %s %s', path || '/', handle.name || 'anonymous');
+  this.stack.push({ route: path, handle: handle });
+
+  return this;
+};
+
+/**
+ * Handle server requests, punting them down
+ * the middleware stack.
+ *
+ * @private
+ */
+
+proto.handle = function handle(req, res, out) {
+  var index = 0;
+  var protohost = getProtohost(req.url) || '';
+  var removed = '';
+  var slashAdded = false;
+  var stack = this.stack;
+
+  // final function handler
+  var done = out || finalhandler(req, res, {
+    env: env,
+    onerror: logerror
+  });
+
+  // store the original URL
+  req.originalUrl = req.originalUrl || req.url;
+
+  function next(err) {
+    if (slashAdded) {
+      req.url = req.url.substr(1);
+      slashAdded = false;
+    }
+
+    if (removed.length !== 0) {
+      req.url = protohost + removed + req.url.substr(protohost.length);
+      removed = '';
+    }
+
+    // next callback
+    var layer = stack[index++];
+
+    // all done
+    if (!layer) {
+      defer(done, err);
+      return;
+    }
+
+    // route data
+    var path = parseUrl(req).pathname || '/';
+    var route = layer.route;
+
+    // skip this layer if the route doesn't match
+    if (path.toLowerCase().substr(0, route.length) !== route.toLowerCase()) {
+      return next(err);
+    }
+
+    // skip if route match does not border "/", ".", or end
+    var c = path.length > route.length && path[route.length];
+    if (c && c !== '/' && c !== '.') {
+      return next(err);
+    }
+
+    // trim off the part of the url that matches the route
+    if (route.length !== 0 && route !== '/') {
+      removed = route;
+      req.url = protohost + req.url.substr(protohost.length + removed.length);
+
+      // ensure leading slash
+      if (!protohost && req.url[0] !== '/') {
+        req.url = '/' + req.url;
+        slashAdded = true;
+      }
+    }
+
+    // call the layer handle
+    call(layer.handle, route, err, req, res, next);
+  }
+
+  next();
+};
+
+/**
+ * Listen for connections.
+ *
+ * This method takes the same arguments
+ * as node's `http.Server#listen()`.
+ *
+ * HTTP and HTTPS:
+ *
+ * If you run your application both as HTTP
+ * and HTTPS you may wrap them individually,
+ * since your Connect "server" is really just
+ * a JavaScript `Function`.
+ *
+ *      var connect = require('connect')
+ *        , http = require('http')
+ *        , https = require('https');
+ *
+ *      var app = connect();
+ *
+ *      http.createServer(app).listen(80);
+ *      https.createServer(options, app).listen(443);
+ *
+ * @return {http.Server}
+ * @api public
+ */
+
+proto.listen = function listen() {
+  var server = http.createServer(this);
+  return server.listen.apply(server, arguments);
+};
+
+/**
+ * Invoke a route handle.
+ * @private
+ */
+
+function call(handle, route, err, req, res, next) {
+  var arity = handle.length;
+  var error = err;
+  var hasError = Boolean(err);
+
+  debug('%s %s : %s', handle.name || '<anonymous>', route, req.originalUrl);
+
+  try {
+    if (hasError && arity === 4) {
+      // error-handling middleware
+      handle(err, req, res, next);
+      return;
+    } else if (!hasError && arity < 4) {
+      // request-handling middleware
+      handle(req, res, next);
+      return;
+    }
+  } catch (e) {
+    // replace the error
+    error = e;
+  }
+
+  // continue
+  next(error);
+}
+
+/**
+ * Log error using console.error.
+ *
+ * @param {Error} err
+ * @private
+ */
+
+function logerror(err) {
+  if (env !== 'test') console.error(err.stack || err.toString());
+}
+
+/**
+ * Get get protocol + host for a URL.
+ *
+ * @param {string} url
+ * @private
+ */
+
+function getProtohost(url) {
+  if (url.length === 0 || url[0] === '/') {
+    return undefined;
+  }
+
+  var fqdnIndex = url.indexOf('://')
+
+  return fqdnIndex !== -1 && url.lastIndexOf('?', fqdnIndex) === -1
+    ? url.substr(0, url.indexOf('/', 3 + fqdnIndex))
+    : undefined;
+}

node_modules/karma/node_modules/connect/package.json

@@ -0,0 +1,48 @@
+{
+  "name": "connect",
+  "description": "High performance middleware framework",
+  "version": "3.7.0",
+  "author": "TJ Holowaychuk <tj@vision-media.ca> (http://tjholowaychuk.com)",
+  "contributors": [
+    "Douglas Christopher Wilson <doug@somethingdoug.com>",
+    "Jonathan Ong <me@jongleberry.com>",
+    "Tim Caswell <tim@creationix.com>"
+  ],
+  "keywords": [
+    "framework",
+    "web",
+    "middleware",
+    "connect",
+    "rack"
+  ],
+  "repository": "senchalabs/connect",
+  "dependencies": {
+    "debug": "2.6.9",
+    "finalhandler": "1.1.2",
+    "parseurl": "~1.3.3",
+    "utils-merge": "1.0.1"
+  },
+  "devDependencies": {
+    "eslint": "4.19.1",
+    "mocha": "6.1.4",
+    "nyc": "14.1.1",
+    "supertest": "4.0.2"
+  },
+  "license": "MIT",
+  "files": [
+    "LICENSE",
+    "HISTORY.md",
+    "README.md",
+    "SECURITY.md",
+    "index.js"
+  ],
+  "engines": {
+    "node": ">= 0.10.0"
+  },
+  "scripts": {
+    "lint": "eslint .",
+    "test": "mocha --require test/support/env --reporter spec --bail --check-leaks test/",
+    "test-cov": "nyc --reporter=html --reporter=text npm test",
+    "test-travis": "nyc --reporter=text npm test"
+  }
+}

node_modules/karma/node_modules/debug/.coveralls.yml

@@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve

node_modules/karma/node_modules/debug/.eslintrc

@@ -0,0 +1,11 @@
+{
+  "env": {
+    "browser": true,
+    "node": true
+  },
+  "rules": {
+    "no-console": 0,
+    "no-empty": [1, { "allowEmptyCatch": true }]
+  },
+  "extends": "eslint:recommended"
+}

node_modules/karma/node_modules/debug/.npmignore

@@ -0,0 +1,9 @@
+support
+test
+examples
+example
+*.sock
+dist
+yarn.lock
+coverage
+bower.json

node_modules/karma/node_modules/debug/.travis.yml

@@ -0,0 +1,14 @@
+
+language: node_js
+node_js:
+  - "6"
+  - "5"
+  - "4"
+
+install:
+  - make node_modules
+
+script:
+  - make lint
+  - make test
+  - make coveralls

node_modules/karma/node_modules/debug/CHANGELOG.md

@@ -0,0 +1,362 @@
+
+2.6.9 / 2017-09-22
+==================
+
+  * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+  * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+  * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+  * Fix: Inline extend function in node implementation (#452, @dougwilson)
+  * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+  
+  * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+  * Misc: clean up browser reference checks (#447, @thebigredgeek)
+  * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+  * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+  * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+  * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+  * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+  * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+  * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+  * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+  * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+  * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+  * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+  * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+  * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+  * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+  * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+  * Docs: fixed README typo (#391, @lurch)
+  * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+  * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+  * Fix: wrong reference in bower file (@thebigredgeek)
+  * Fix: webworker compatibility (@thebigredgeek)
+  * Fix: output formatting issue (#388, @kribblo)
+  * Fix: babel-loader compatibility (#383, @escwald)
+  * Misc: removed built asset from repo and publications (@thebigredgeek)
+  * Misc: moved source files to /src (#378, @yamikuronue)
+  * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+  * Test: coveralls integration (#378, @yamikuronue)
+  * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+  * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+  * Fix: custom log function (#379, @hsiliev)
+  * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+  * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+  * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+  * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+  * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+  * Fix: browser colors (#367, @tootallnate)
+  * Misc: travis ci integration (@thebigredgeek)
+  * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+  * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+  * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+  * Fix: revert "handle regex special characters" (@tootallnate)
+  * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+  * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+  * Improvement: allow colors in workers (#335, @botverse)
+  * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+  * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+  * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+  * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+  * Fix: be super-safe in index.js as well (@TooTallNate)
+  * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+  * Fix: Added electron compatibility (#324, @paulcbetts)
+  * Improvement: Added performance optimizations (@tootallnate)
+  * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+  * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+  * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+  * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+  * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+  * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+  * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+  * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+  * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+  * Readme: fix USE_COLORS to DEBUG_COLORS
+  * Readme: Doc fixes for format string sugar (#269, @mlucool)
+  * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+  * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+  * Readme: better docs for browser support (#224, @matthewmueller)
+  * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+  * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+  * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+  * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+  * package: update "ms" to v0.7.1 (#202, @dougwilson)
+  * README: add logging to file example (#193, @DanielOchoa)
+  * README: fixed a typo (#191, @amir-s)
+  * browser: expose `storage` (#190, @stephenmathieson)
+  * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+  * Updated stdout/stderr example (#186)
+  * Updated example/stdout.js to match debug current behaviour
+  * Renamed example/stderr.js to stdout.js
+  * Update Readme.md (#184)
+  * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+  * dist: recompile
+  * update "ms" to v0.7.0
+  * package: update "browserify" to v9.0.3
+  * component: fix "ms.js" repo location
+  * changed bower package name
+  * updated documentation about using debug in a browser
+  * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+  * browser: use `typeof` to check for `console` existence
+  * browser: check for `console.log` truthiness (fix IE 8/9)
+  * browser: add support for Chrome apps
+  * Readme: added Windows usage remarks
+  * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+  * node: implement `DEBUG_FD` env variable support
+  * package: update "browserify" to v6.1.0
+  * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+  * package: update "browserify" to v5.11.0
+  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+  * dist: recompile
+  * example: remove `console.info()` log usage
+  * example: add "Content-Type" UTF-8 header to browser example
+  * browser: place %c marker after the space character
+  * browser: reset the "content" color via `color: inherit`
+  * browser: add colors support for Firefox >= v31
+  * debug: prefer an instance `log()` function over the global one (#119)
+  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+  * Add support for multiple wildcards in namespaces (#122, @seegno)
+  * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+  * browser: update color palette (#113, @gscottolson)
+  * common: make console logging function configurable (#108, @timoxley)
+  * node: fix %o colors on old node <= 0.8.x
+  * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+  * browser: use `removeItem()` to clear localStorage
+  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+  * package: add "contributors" section
+  * node: fix comment typo
+  * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+  * make ms diff be global, not be scope
+  * debug: ignore empty strings in enable()
+  * node: make DEBUG_COLORS able to disable coloring
+  * *: export the `colors` array
+  * npmignore: don't publish the `dist` dir
+  * Makefile: refactor to use browserify
+  * package: add "browserify" as a dev dependency
+  * Readme: add Web Inspector Colors section
+  * node: reset terminal color for the debug content
+  * node: map "%o" to `util.inspect()`
+  * browser: map "%j" to `JSON.stringify()`
+  * debug: add custom "formatters"
+  * debug: use "ms" module for humanizing the diff
+  * Readme: add "bash" syntax highlighting
+  * browser: add Firebug color support
+  * browser: add colors for WebKit browsers
+  * node: apply log to `console`
+  * rewrite: abstract common logic for Node & browsers
+  * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+  * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+  * add `enable()` method for nodejs. Closes #27
+  * change from stderr to stdout
+  * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+  * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+  * fix: catch localStorage security error when cookies are blocked (Chrome)
+  * add debug(err) support. Closes #46
+  * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+  * fix package.json
+  * fix: Mobile Safari (private mode) is broken with debug
+  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+  * add repository URL to package.json
+  * add DEBUG_COLORED to force colored output
+  * add browserify support
+  * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+  * Added .component to package.json
+  * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+  * Added support for "-" prefix in DEBUG [Vinay Pulim]
+  * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+  * Added: humanize diffs. Closes #8
+  * Added `debug.disable()` to the CS variant
+  * Removed padding. Closes #10
+  * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+  * Added browser variant support for older browsers [TooTallNate]
+  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+  * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+  * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+  * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+  * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+  * Initial release

node_modules/karma/node_modules/debug/LICENSE

@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software 
+and associated documentation files (the 'Software'), to deal in the Software without restriction, 
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, 
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial 
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT 
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. 
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, 
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE 
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+

node_modules/karma/node_modules/debug/Makefile

@@ -0,0 +1,50 @@
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
+# applications
+NODE ?= $(shell which node)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+.FORCE:
+
+install: node_modules
+
+node_modules: package.json
+	@NODE_ENV= $(PKG) install
+	@touch node_modules
+
+lint: .FORCE
+	eslint browser.js debug.js index.js node.js
+
+test-node: .FORCE
+	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+
+test-browser: .FORCE
+	mkdir -p dist
+
+	@$(BROWSERIFY) \
+		--standalone debug \
+		. > dist/debug.js
+
+	karma start --single-run
+	rimraf dist
+
+test: .FORCE
+	concurrently \
+		"make test-node" \
+		"make test-browser"
+
+coveralls:
+	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+.PHONY: all install clean distclean

node_modules/karma/node_modules/debug/README.md

@@ -0,0 +1,312 @@
+# debug
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
+
+
+
+A tiny node.js debugging utility modelled after node core's debugging technique.
+
+**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+  , http = require('http')
+  , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+  debug(req.method + ' ' + req.url);
+  res.end('hello\n');
+}).listen(3000, function(){
+  debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+  debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+
+  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+ Note that PowerShell uses different syntax to set environment variables.
+
+ ```cmd
+ $env:DEBUG = "*,-not_this"
+  ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+
+  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
+
+## Conventions
+
+  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Environment Variables
+
+  When running through Node.js, you can set a few environment variables that will
+  change the behavior of the debug logging:
+
+| Name      | Purpose                                         |
+|-----------|-------------------------------------------------|
+| `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+  __Note:__ The environment variables beginning with `DEBUG_` end up being
+  converted into an Options object that gets used with `%o`/`%O` formatters.
+  See the Node.js documentation for
+  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+  for the complete list.
+
+## Formatters
+
+
+  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O`      | Pretty-print an Object on multiple lines. |
+| `%o`      | Pretty-print an Object all on a single line. |
+| `%s`      | String. |
+| `%d`      | Number (both integer and float). |
+| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%`      | Single percent sign ('%'). This does not consume an argument. |
+
+### Custom formatters
+
+  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+  return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+## Browser support
+  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+  if you don't want to build it yourself.
+
+  Debug's enable state is currently persisted by `localStorage`.
+  Consider the situation shown below where you have `worker:a` and `worker:b`,
+  and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+  a('doing some work');
+}, 1000);
+
+setInterval(function(){
+  b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+  option. These are WebKit web inspectors, Firefox ([since version
+  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+  and the Firebug plugin for Firefox (any version).
+
+  Colored output looks something like:
+
+  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
+
+
+## Output streams
+
+  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+ 
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

node_modules/karma/node_modules/debug/component.json

@@ -0,0 +1,19 @@
+{
+  "name": "debug",
+  "repo": "visionmedia/debug",
+  "description": "small debugging utility",
+  "version": "2.6.9",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "main": "src/browser.js",
+  "scripts": [
+    "src/browser.js",
+    "src/debug.js"
+  ],
+  "dependencies": {
+    "rauchg/ms.js": "0.7.1"
+  }
+}

node_modules/karma/node_modules/debug/karma.conf.js

@@ -0,0 +1,70 @@
+// Karma configuration
+// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC)
+
+module.exports = function(config) {
+  config.set({
+
+    // base path that will be used to resolve all patterns (eg. files, exclude)
+    basePath: '',
+
+
+    // frameworks to use
+    // available frameworks: https://npmjs.org/browse/keyword/karma-adapter
+    frameworks: ['mocha', 'chai', 'sinon'],
+
+
+    // list of files / patterns to load in the browser
+    files: [
+      'dist/debug.js',
+      'test/*spec.js'
+    ],
+
+
+    // list of files to exclude
+    exclude: [
+      'src/node.js'
+    ],
+
+
+    // preprocess matching files before serving them to the browser
+    // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor
+    preprocessors: {
+    },
+
+    // test results reporter to use
+    // possible values: 'dots', 'progress'
+    // available reporters: https://npmjs.org/browse/keyword/karma-reporter
+    reporters: ['progress'],
+
+
+    // web server port
+    port: 9876,
+
+
+    // enable / disable colors in the output (reporters and logs)
+    colors: true,
+
+
+    // level of logging
+    // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG
+    logLevel: config.LOG_INFO,
+
+
+    // enable / disable watching file and executing tests whenever any file changes
+    autoWatch: true,
+
+
+    // start these browsers
+    // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher
+    browsers: ['PhantomJS'],
+
+
+    // Continuous Integration mode
+    // if true, Karma captures browsers, runs the tests and exits
+    singleRun: false,
+
+    // Concurrency level
+    // how many browser should be started simultaneous
+    concurrency: Infinity
+  })
+}

node_modules/karma/node_modules/debug/node.js

@@ -0,0 +1 @@
+module.exports = require('./src/node');

node_modules/karma/node_modules/debug/package.json

@@ -0,0 +1,49 @@
+{
+  "name": "debug",
+  "version": "2.6.9",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/visionmedia/debug.git"
+  },
+  "description": "small debugging utility",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "author": "TJ Holowaychuk <tj@vision-media.ca>",
+  "contributors": [
+    "Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)",
+    "Andrew Rhyne <rhyneandrew@gmail.com>"
+  ],
+  "license": "MIT",
+  "dependencies": {
+    "ms": "2.0.0"
+  },
+  "devDependencies": {
+    "browserify": "9.0.3",
+    "chai": "^3.5.0",
+    "concurrently": "^3.1.0",
+    "coveralls": "^2.11.15",
+    "eslint": "^3.12.1",
+    "istanbul": "^0.4.5",
+    "karma": "^1.3.0",
+    "karma-chai": "^0.1.0",
+    "karma-mocha": "^1.3.0",
+    "karma-phantomjs-launcher": "^1.0.2",
+    "karma-sinon": "^1.0.5",
+    "mocha": "^3.2.0",
+    "mocha-lcov-reporter": "^1.2.0",
+    "rimraf": "^2.5.4",
+    "sinon": "^1.17.6",
+    "sinon-chai": "^2.8.0"
+  },
+  "main": "./src/index.js",
+  "browser": "./src/browser.js",
+  "component": {
+    "scripts": {
+      "debug/index.js": "browser.js",
+      "debug/debug.js": "debug.js"
+    }
+  }
+}

node_modules/karma/node_modules/debug/src/browser.js

@@ -0,0 +1,185 @@
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = 'undefined' != typeof chrome
+               && 'undefined' != typeof chrome.storage
+                  ? chrome.storage.local
+                  : localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+  'lightseagreen',
+  'forestgreen',
+  'goldenrod',
+  'dodgerblue',
+  'darkorchid',
+  'crimson'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+  // NB: In an Electron preload script, document will be defined but not fully
+  // initialized. Since we know we're in Chrome, we'll just detect this case
+  // explicitly
+  if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') {
+    return true;
+  }
+
+  // is webkit? http://stackoverflow.com/a/16459606/376773
+  // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+  return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
+    // is firebug? http://stackoverflow.com/a/398120/376773
+    (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
+    // is firefox >= v31?
+    // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+    (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) ||
+    // double check webkit in userAgent just in case we are in a worker
+    (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+  try {
+    return JSON.stringify(v);
+  } catch (err) {
+    return '[UnexpectedJSONParseError]: ' + err.message;
+  }
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+  var useColors = this.useColors;
+
+  args[0] = (useColors ? '%c' : '')
+    + this.namespace
+    + (useColors ? ' %c' : ' ')
+    + args[0]
+    + (useColors ? '%c ' : ' ')
+    + '+' + exports.humanize(this.diff);
+
+  if (!useColors) return;
+
+  var c = 'color: ' + this.color;
+  args.splice(1, 0, c, 'color: inherit')
+
+  // the final "%c" is somewhat tricky, because there could be other
+  // arguments passed either before or after the %c, so we need to
+  // figure out the correct index to insert the CSS into
+  var index = 0;
+  var lastC = 0;
+  args[0].replace(/%[a-zA-Z%]/g, function(match) {
+    if ('%%' === match) return;
+    index++;
+    if ('%c' === match) {
+      // we only are interested in the *last* %c
+      // (the user may have provided their own)
+      lastC = index;
+    }
+  });
+
+  args.splice(lastC, 0, c);
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+  // this hackery is required for IE8/9, where
+  // the `console.log` function doesn't have 'apply'
+  return 'object' === typeof console
+    && console.log
+    && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+  try {
+    if (null == namespaces) {
+      exports.storage.removeItem('debug');
+    } else {
+      exports.storage.debug = namespaces;
+    }
+  } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+  var r;
+  try {
+    r = exports.storage.debug;
+  } catch(e) {}
+
+  // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+  if (!r && typeof process !== 'undefined' && 'env' in process) {
+    r = process.env.DEBUG;
+  }
+
+  return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage() {
+  try {
+    return window.localStorage;
+  } catch (e) {}
+}

node_modules/karma/node_modules/debug/src/debug.js

@@ -0,0 +1,202 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = createDebug.debug = createDebug['default'] = createDebug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+ */
+
+exports.formatters = {};
+
+/**
+ * Previous log timestamp.
+ */
+
+var prevTime;
+
+/**
+ * Select a color.
+ * @param {String} namespace
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor(namespace) {
+  var hash = 0, i;
+
+  for (i in namespace) {
+    hash  = ((hash << 5) - hash) + namespace.charCodeAt(i);
+    hash |= 0; // Convert to 32bit integer
+  }
+
+  return exports.colors[Math.abs(hash) % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function createDebug(namespace) {
+
+  function debug() {
+    // disabled?
+    if (!debug.enabled) return;
+
+    var self = debug;
+
+    // set `diff` timestamp
+    var curr = +new Date();
+    var ms = curr - (prevTime || curr);
+    self.diff = ms;
+    self.prev = prevTime;
+    self.curr = curr;
+    prevTime = curr;
+
+    // turn the `arguments` into a proper Array
+    var args = new Array(arguments.length);
+    for (var i = 0; i < args.length; i++) {
+      args[i] = arguments[i];
+    }
+
+    args[0] = exports.coerce(args[0]);
+
+    if ('string' !== typeof args[0]) {
+      // anything else let's inspect with %O
+      args.unshift('%O');
+    }
+
+    // apply any `formatters` transformations
+    var index = 0;
+    args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) {
+      // if we encounter an escaped % then don't increase the array index
+      if (match === '%%') return match;
+      index++;
+      var formatter = exports.formatters[format];
+      if ('function' === typeof formatter) {
+        var val = args[index];
+        match = formatter.call(self, val);
+
+        // now we need to remove `args[index]` since it's inlined in the `format`
+        args.splice(index, 1);
+        index--;
+      }
+      return match;
+    });
+
+    // apply env-specific formatting (colors, etc.)
+    exports.formatArgs.call(self, args);
+
+    var logFn = debug.log || exports.log || console.log.bind(console);
+    logFn.apply(self, args);
+  }
+
+  debug.namespace = namespace;
+  debug.enabled = exports.enabled(namespace);
+  debug.useColors = exports.useColors();
+  debug.color = selectColor(namespace);
+
+  // env-specific initialization logic for debug instances
+  if ('function' === typeof exports.init) {
+    exports.init(debug);
+  }
+
+  return debug;
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+  exports.save(namespaces);
+
+  exports.names = [];
+  exports.skips = [];
+
+  var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+  var len = split.length;
+
+  for (var i = 0; i < len; i++) {
+    if (!split[i]) continue; // ignore empty strings
+    namespaces = split[i].replace(/\*/g, '.*?');
+    if (namespaces[0] === '-') {
+      exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+    } else {
+      exports.names.push(new RegExp('^' + namespaces + '$'));
+    }
+  }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+  exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+  var i, len;
+  for (i = 0, len = exports.skips.length; i < len; i++) {
+    if (exports.skips[i].test(name)) {
+      return false;
+    }
+  }
+  for (i = 0, len = exports.names.length; i < len; i++) {
+    if (exports.names[i].test(name)) {
+      return true;
+    }
+  }
+  return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+  if (val instanceof Error) return val.stack || val.message;
+  return val;
+}

node_modules/karma/node_modules/debug/src/index.js

@@ -0,0 +1,10 @@
+/**
+ * Detect Electron renderer process, which is node, but we should
+ * treat as a browser.
+ */
+
+if (typeof process !== 'undefined' && process.type === 'renderer') {
+  module.exports = require('./browser.js');
+} else {
+  module.exports = require('./node.js');
+}

node_modules/karma/node_modules/debug/src/inspector-log.js

@@ -0,0 +1,15 @@
+module.exports = inspectorLog;
+
+// black hole
+const nullStream = new (require('stream').Writable)();
+nullStream._write = () => {};
+
+/**
+ * Outputs a `console.log()` to the Node.js Inspector console *only*.
+ */
+function inspectorLog() {
+  const stdout = console._stdout;
+  console._stdout = nullStream;
+  console.log.apply(console, arguments);
+  console._stdout = stdout;
+}

node_modules/karma/node_modules/debug/src/node.js

@@ -0,0 +1,248 @@
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ *   $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+exports.inspectOpts = Object.keys(process.env).filter(function (key) {
+  return /^debug_/i.test(key);
+}).reduce(function (obj, key) {
+  // camel-case
+  var prop = key
+    .substring(6)
+    .toLowerCase()
+    .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() });
+
+  // coerce string value into JS value
+  var val = process.env[key];
+  if (/^(yes|on|true|enabled)$/i.test(val)) val = true;
+  else if (/^(no|off|false|disabled)$/i.test(val)) val = false;
+  else if (val === 'null') val = null;
+  else val = Number(val);
+
+  obj[prop] = val;
+  return obj;
+}, {});
+
+/**
+ * The file descriptor to write the `debug()` calls to.
+ * Set the `DEBUG_FD` env variable to override with another value. i.e.:
+ *
+ *   $ DEBUG_FD=3 node script.js 3>debug.log
+ */
+
+var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
+
+if (1 !== fd && 2 !== fd) {
+  util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')()
+}
+
+var stream = 1 === fd ? process.stdout :
+             2 === fd ? process.stderr :
+             createWritableStdioStream(fd);
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+  return 'colors' in exports.inspectOpts
+    ? Boolean(exports.inspectOpts.colors)
+    : tty.isatty(fd);
+}
+
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+exports.formatters.o = function(v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts)
+    .split('\n').map(function(str) {
+      return str.trim()
+    }).join(' ');
+};
+
+/**
+ * Map %o to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+exports.formatters.O = function(v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts);
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+  var name = this.namespace;
+  var useColors = this.useColors;
+
+  if (useColors) {
+    var c = this.color;
+    var prefix = '  \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m';
+
+    args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+    args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m');
+  } else {
+    args[0] = new Date().toUTCString()
+      + ' ' + name + ' ' + args[0];
+  }
+}
+
+/**
+ * Invokes `util.format()` with the specified arguments and writes to `stream`.
+ */
+
+function log() {
+  return stream.write(util.format.apply(util, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+  if (null == namespaces) {
+    // If you set a process.env field to null or undefined, it gets cast to the
+    // string 'null' or 'undefined'. Just delete instead.
+    delete process.env.DEBUG;
+  } else {
+    process.env.DEBUG = namespaces;
+  }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+  return process.env.DEBUG;
+}
+
+/**
+ * Copied from `node/src/node.js`.
+ *
+ * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
+ * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
+ */
+
+function createWritableStdioStream (fd) {
+  var stream;
+  var tty_wrap = process.binding('tty_wrap');
+
+  // Note stream._type is used for test-module-load-list.js
+
+  switch (tty_wrap.guessHandleType(fd)) {
+    case 'TTY':
+      stream = new tty.WriteStream(fd);
+      stream._type = 'tty';
+
+      // Hack to have stream not keep the event loop alive.
+      // See https://github.com/joyent/node/issues/1726
+      if (stream._handle && stream._handle.unref) {
+        stream._handle.unref();
+      }
+      break;
+
+    case 'FILE':
+      var fs = require('fs');
+      stream = new fs.SyncWriteStream(fd, { autoClose: false });
+      stream._type = 'fs';
+      break;
+
+    case 'PIPE':
+    case 'TCP':
+      var net = require('net');
+      stream = new net.Socket({
+        fd: fd,
+        readable: false,
+        writable: true
+      });
+
+      // FIXME Should probably have an option in net.Socket to create a
+      // stream from an existing fd which is writable only. But for now
+      // we'll just add this hack and set the `readable` member to false.
+      // Test: ./node test/fixtures/echo.js < /etc/passwd
+      stream.readable = false;
+      stream.read = null;
+      stream._type = 'pipe';
+
+      // FIXME Hack to have stream not keep the event loop alive.
+      // See https://github.com/joyent/node/issues/1726
+      if (stream._handle && stream._handle.unref) {
+        stream._handle.unref();
+      }
+      break;
+
+    default:
+      // Probably an error on in uv_guess_handle()
+      throw new Error('Implement me. Unknown stream file type!');
+  }
+
+  // For supporting legacy API we put the FD here.
+  stream.fd = fd;
+
+  stream._isStdio = true;
+
+  return stream;
+}
+
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+function init (debug) {
+  debug.inspectOpts = {};
+
+  var keys = Object.keys(exports.inspectOpts);
+  for (var i = 0; i < keys.length; i++) {
+    debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+  }
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());

node_modules/karma/node_modules/finalhandler/HISTORY.md

@@ -0,0 +1,187 @@
+1.1.2 / 2019-05-09
+==================
+
+  * Set stricter `Content-Security-Policy` header
+  * deps: parseurl@~1.3.3
+  * deps: statuses@~1.5.0
+
+1.1.1 / 2018-03-06
+==================
+
+  * Fix 404 output for bad / missing pathnames
+  * deps: encodeurl@~1.0.2
+    - Fix encoding `%` as last character
+  * deps: statuses@~1.4.0
+
+1.1.0 / 2017-09-24
+==================
+
+  * Use `res.headersSent` when available
+
+1.0.6 / 2017-09-22
+==================
+
+  * deps: debug@2.6.9
+
+1.0.5 / 2017-09-15
+==================
+
+  * deps: parseurl@~1.3.2
+    - perf: reduce overhead for full URLs
+    - perf: unroll the "fast-path" `RegExp`
+
+1.0.4 / 2017-08-03
+==================
+
+  * deps: debug@2.6.8
+
+1.0.3 / 2017-05-16
+==================
+
+  * deps: debug@2.6.7
+    - deps: ms@2.0.0
+
+1.0.2 / 2017-04-22
+==================
+
+  * deps: debug@2.6.4
+    - deps: ms@0.7.3
+
+1.0.1 / 2017-03-21
+==================
+
+  * Fix missing `</html>` in HTML document
+  * deps: debug@2.6.3
+    - Fix: `DEBUG_MAX_ARRAY_LENGTH`
+
+1.0.0 / 2017-02-15
+==================
+
+  * Fix exception when `err` cannot be converted to a string
+  * Fully URL-encode the pathname in the 404 message
+  * Only include the pathname in the 404 message
+  * Send complete HTML document
+  * Set `Content-Security-Policy: default-src 'self'` header
+  * deps: debug@2.6.1
+    - Allow colors in workers
+    - Deprecated `DEBUG_FD` environment variable set to `3` or higher
+    - Fix error when running under React Native
+    - Use same color for same namespace
+    - deps: ms@0.7.2
+
+0.5.1 / 2016-11-12
+==================
+
+  * Fix exception when `err.headers` is not an object
+  * deps: statuses@~1.3.1
+  * perf: hoist regular expressions
+  * perf: remove duplicate validation path
+
+0.5.0 / 2016-06-15
+==================
+
+  * Change invalid or non-numeric status code to 500
+  * Overwrite status message to match set status code
+  * Prefer `err.statusCode` if `err.status` is invalid
+  * Set response headers from `err.headers` object
+  * Use `statuses` instead of `http` module for status messages
+    - Includes all defined status messages
+
+0.4.1 / 2015-12-02
+==================
+
+  * deps: escape-html@~1.0.3
+    - perf: enable strict mode
+    - perf: optimize string replacement
+    - perf: use faster string coercion
+
+0.4.0 / 2015-06-14
+==================
+
+  * Fix a false-positive when unpiping in Node.js 0.8
+  * Support `statusCode` property on `Error` objects
+  * Use `unpipe` module for unpiping requests
+  * deps: escape-html@1.0.2
+  * deps: on-finished@~2.3.0
+    - Add defined behavior for HTTP `CONNECT` requests
+    - Add defined behavior for HTTP `Upgrade` requests
+    - deps: ee-first@1.1.1
+  * perf: enable strict mode
+  * perf: remove argument reassignment
+
+0.3.6 / 2015-05-11
+==================
+
+  * deps: debug@~2.2.0
+    - deps: ms@0.7.1
+
+0.3.5 / 2015-04-22
+==================
+
+  * deps: on-finished@~2.2.1
+    - Fix `isFinished(req)` when data buffered
+
+0.3.4 / 2015-03-15
+==================
+
+  * deps: debug@~2.1.3
+    - Fix high intensity foreground color for bold
+    - deps: ms@0.7.0
+
+0.3.3 / 2015-01-01
+==================
+
+  * deps: debug@~2.1.1
+  * deps: on-finished@~2.2.0
+
+0.3.2 / 2014-10-22
+==================
+
+  * deps: on-finished@~2.1.1
+    - Fix handling of pipelined requests
+
+0.3.1 / 2014-10-16
+==================
+
+  * deps: debug@~2.1.0
+    - Implement `DEBUG_FD` env variable support
+
+0.3.0 / 2014-09-17
+==================
+
+  * Terminate in progress response only on error
+  * Use `on-finished` to determine request status
+
+0.2.0 / 2014-09-03
+==================
+
+  * Set `X-Content-Type-Options: nosniff` header
+  * deps: debug@~2.0.0
+
+0.1.0 / 2014-07-16
+==================
+
+  * Respond after request fully read
+    - prevents hung responses and socket hang ups
+  * deps: debug@1.0.4
+
+0.0.3 / 2014-07-11
+==================
+
+  * deps: debug@1.0.3
+    - Add support for multiple wildcards in namespaces
+
+0.0.2 / 2014-06-19
+==================
+
+  * Handle invalid status codes
+
+0.0.1 / 2014-06-05
+==================
+
+  * deps: debug@1.0.2
+
+0.0.0 / 2014-06-05
+==================
+
+  * Extracted from connect/express

node_modules/karma/node_modules/finalhandler/LICENSE

@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2017 Douglas Christopher Wilson <doug@somethingdoug.com>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

node_modules/karma/node_modules/finalhandler/README.md

@@ -0,0 +1,148 @@
+# finalhandler
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-image]][node-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Node.js function to invoke as the final step to respond to HTTP request.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install finalhandler
+```
+
+## API
+
+<!-- eslint-disable no-unused-vars -->
+
+```js
+var finalhandler = require('finalhandler')
+```
+
+### finalhandler(req, res, [options])
+
+Returns function to be invoked as the final step for the given `req` and `res`.
+This function is to be invoked as `fn(err)`. If `err` is falsy, the handler will
+write out a 404 response to the `res`. If it is truthy, an error response will
+be written out to the `res`.
+
+When an error is written, the following information is added to the response:
+
+  * The `res.statusCode` is set from `err.status` (or `err.statusCode`). If
+    this value is outside the 4xx or 5xx range, it will be set to 500.
+  * The `res.statusMessage` is set according to the status code.
+  * The body will be the HTML of the status code message if `env` is
+    `'production'`, otherwise will be `err.stack`.
+  * Any headers specified in an `err.headers` object.
+
+The final handler will also unpipe anything from `req` when it is invoked.
+
+#### options.env
+
+By default, the environment is determined by `NODE_ENV` variable, but it can be
+overridden by this option.
+
+#### options.onerror
+
+Provide a function to be called with the `err` when it exists. Can be used for
+writing errors to a central location without excessive function generation. Called
+as `onerror(err, req, res)`.
+
+## Examples
+
+### always 404
+
+```js
+var finalhandler = require('finalhandler')
+var http = require('http')
+
+var server = http.createServer(function (req, res) {
+  var done = finalhandler(req, res)
+  done()
+})
+
+server.listen(3000)
+```
+
+### perform simple action
+
+```js
+var finalhandler = require('finalhandler')
+var fs = require('fs')
+var http = require('http')
+
+var server = http.createServer(function (req, res) {
+  var done = finalhandler(req, res)
+
+  fs.readFile('index.html', function (err, buf) {
+    if (err) return done(err)
+    res.setHeader('Content-Type', 'text/html')
+    res.end(buf)
+  })
+})
+
+server.listen(3000)
+```
+
+### use with middleware-style functions
+
+```js
+var finalhandler = require('finalhandler')
+var http = require('http')
+var serveStatic = require('serve-static')
+
+var serve = serveStatic('public')
+
+var server = http.createServer(function (req, res) {
+  var done = finalhandler(req, res)
+  serve(req, res, done)
+})
+
+server.listen(3000)
+```
+
+### keep log of all errors
+
+```js
+var finalhandler = require('finalhandler')
+var fs = require('fs')
+var http = require('http')
+
+var server = http.createServer(function (req, res) {
+  var done = finalhandler(req, res, { onerror: logerror })
+
+  fs.readFile('index.html', function (err, buf) {
+    if (err) return done(err)
+    res.setHeader('Content-Type', 'text/html')
+    res.end(buf)
+  })
+})
+
+server.listen(3000)
+
+function logerror (err) {
+  console.error(err.stack || err.toString())
+}
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/finalhandler.svg
+[npm-url]: https://npmjs.org/package/finalhandler
+[node-image]: https://img.shields.io/node/v/finalhandler.svg
+[node-url]: https://nodejs.org/en/download
+[travis-image]: https://img.shields.io/travis/pillarjs/finalhandler.svg
+[travis-url]: https://travis-ci.org/pillarjs/finalhandler
+[coveralls-image]: https://img.shields.io/coveralls/pillarjs/finalhandler.svg
+[coveralls-url]: https://coveralls.io/r/pillarjs/finalhandler?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/finalhandler.svg
+[downloads-url]: https://npmjs.org/package/finalhandler

node_modules/karma/node_modules/finalhandler/index.js

@@ -0,0 +1,331 @@
+/*!
+ * finalhandler
+ * Copyright(c) 2014-2017 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var debug = require('debug')('finalhandler')
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+var onFinished = require('on-finished')
+var parseUrl = require('parseurl')
+var statuses = require('statuses')
+var unpipe = require('unpipe')
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var DOUBLE_SPACE_REGEXP = /\x20{2}/g
+var NEWLINE_REGEXP = /\n/g
+
+/* istanbul ignore next */
+var defer = typeof setImmediate === 'function'
+  ? setImmediate
+  : function (fn) { process.nextTick(fn.bind.apply(fn, arguments)) }
+var isFinished = onFinished.isFinished
+
+/**
+ * Create a minimal HTML document.
+ *
+ * @param {string} message
+ * @private
+ */
+
+function createHtmlDocument (message) {
+  var body = escapeHtml(message)
+    .replace(NEWLINE_REGEXP, '<br>')
+    .replace(DOUBLE_SPACE_REGEXP, ' &nbsp;')
+
+  return '<!DOCTYPE html>\n' +
+    '<html lang="en">\n' +
+    '<head>\n' +
+    '<meta charset="utf-8">\n' +
+    '<title>Error</title>\n' +
+    '</head>\n' +
+    '<body>\n' +
+    '<pre>' + body + '</pre>\n' +
+    '</body>\n' +
+    '</html>\n'
+}
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = finalhandler
+
+/**
+ * Create a function to handle the final response.
+ *
+ * @param {Request} req
+ * @param {Response} res
+ * @param {Object} [options]
+ * @return {Function}
+ * @public
+ */
+
+function finalhandler (req, res, options) {
+  var opts = options || {}
+
+  // get environment
+  var env = opts.env || process.env.NODE_ENV || 'development'
+
+  // get error callback
+  var onerror = opts.onerror
+
+  return function (err) {
+    var headers
+    var msg
+    var status
+
+    // ignore 404 on in-flight response
+    if (!err && headersSent(res)) {
+      debug('cannot 404 after headers sent')
+      return
+    }
+
+    // unhandled error
+    if (err) {
+      // respect status code from error
+      status = getErrorStatusCode(err)
+
+      if (status === undefined) {
+        // fallback to status code on response
+        status = getResponseStatusCode(res)
+      } else {
+        // respect headers from error
+        headers = getErrorHeaders(err)
+      }
+
+      // get error message
+      msg = getErrorMessage(err, status, env)
+    } else {
+      // not found
+      status = 404
+      msg = 'Cannot ' + req.method + ' ' + encodeUrl(getResourceName(req))
+    }
+
+    debug('default %s', status)
+
+    // schedule onerror callback
+    if (err && onerror) {
+      defer(onerror, err, req, res)
+    }
+
+    // cannot actually respond
+    if (headersSent(res)) {
+      debug('cannot %d after headers sent', status)
+      req.socket.destroy()
+      return
+    }
+
+    // send response
+    send(req, res, status, headers, msg)
+  }
+}
+
+/**
+ * Get headers from Error object.
+ *
+ * @param {Error} err
+ * @return {object}
+ * @private
+ */
+
+function getErrorHeaders (err) {
+  if (!err.headers || typeof err.headers !== 'object') {
+    return undefined
+  }
+
+  var headers = Object.create(null)
+  var keys = Object.keys(err.headers)
+
+  for (var i = 0; i < keys.length; i++) {
+    var key = keys[i]
+    headers[key] = err.headers[key]
+  }
+
+  return headers
+}
+
+/**
+ * Get message from Error object, fallback to status message.
+ *
+ * @param {Error} err
+ * @param {number} status
+ * @param {string} env
+ * @return {string}
+ * @private
+ */
+
+function getErrorMessage (err, status, env) {
+  var msg
+
+  if (env !== 'production') {
+    // use err.stack, which typically includes err.message
+    msg = err.stack
+
+    // fallback to err.toString() when possible
+    if (!msg && typeof err.toString === 'function') {
+      msg = err.toString()
+    }
+  }
+
+  return msg || statuses[status]
+}
+
+/**
+ * Get status code from Error object.
+ *
+ * @param {Error} err
+ * @return {number}
+ * @private
+ */
+
+function getErrorStatusCode (err) {
+  // check err.status
+  if (typeof err.status === 'number' && err.status >= 400 && err.status < 600) {
+    return err.status
+  }
+
+  // check err.statusCode
+  if (typeof err.statusCode === 'number' && err.statusCode >= 400 && err.statusCode < 600) {
+    return err.statusCode
+  }
+
+  return undefined
+}
+
+/**
+ * Get resource name for the request.
+ *
+ * This is typically just the original pathname of the request
+ * but will fallback to "resource" is that cannot be determined.
+ *
+ * @param {IncomingMessage} req
+ * @return {string}
+ * @private
+ */
+
+function getResourceName (req) {
+  try {
+    return parseUrl.original(req).pathname
+  } catch (e) {
+    return 'resource'
+  }
+}
+
+/**
+ * Get status code from response.
+ *
+ * @param {OutgoingMessage} res
+ * @return {number}
+ * @private
+ */
+
+function getResponseStatusCode (res) {
+  var status = res.statusCode
+
+  // default status code to 500 if outside valid range
+  if (typeof status !== 'number' || status < 400 || status > 599) {
+    status = 500
+  }
+
+  return status
+}
+
+/**
+ * Determine if the response headers have been sent.
+ *
+ * @param {object} res
+ * @returns {boolean}
+ * @private
+ */
+
+function headersSent (res) {
+  return typeof res.headersSent !== 'boolean'
+    ? Boolean(res._header)
+    : res.headersSent
+}
+
+/**
+ * Send response.
+ *
+ * @param {IncomingMessage} req
+ * @param {OutgoingMessage} res
+ * @param {number} status
+ * @param {object} headers
+ * @param {string} message
+ * @private
+ */
+
+function send (req, res, status, headers, message) {
+  function write () {
+    // response body
+    var body = createHtmlDocument(message)
+
+    // response status
+    res.statusCode = status
+    res.statusMessage = statuses[status]
+
+    // response headers
+    setHeaders(res, headers)
+
+    // security headers
+    res.setHeader('Content-Security-Policy', "default-src 'none'")
+    res.setHeader('X-Content-Type-Options', 'nosniff')
+
+    // standard headers
+    res.setHeader('Content-Type', 'text/html; charset=utf-8')
+    res.setHeader('Content-Length', Buffer.byteLength(body, 'utf8'))
+
+    if (req.method === 'HEAD') {
+      res.end()
+      return
+    }
+
+    res.end(body, 'utf8')
+  }
+
+  if (isFinished(req)) {
+    write()
+    return
+  }
+
+  // unpipe everything from the request
+  unpipe(req)
+
+  // flush the request
+  onFinished(req, write)
+  req.resume()
+}
+
+/**
+ * Set response headers from an object.
+ *
+ * @param {OutgoingMessage} res
+ * @param {object} headers
+ * @private
+ */
+
+function setHeaders (res, headers) {
+  if (!headers) {
+    return
+  }
+
+  var keys = Object.keys(headers)
+  for (var i = 0; i < keys.length; i++) {
+    var key = keys[i]
+    res.setHeader(key, headers[key])
+  }
+}

node_modules/karma/node_modules/finalhandler/package.json

@@ -0,0 +1,45 @@
+{
+  "name": "finalhandler",
+  "description": "Node.js final http responder",
+  "version": "1.1.2",
+  "author": "Douglas Christopher Wilson <doug@somethingdoug.com>",
+  "license": "MIT",
+  "repository": "pillarjs/finalhandler",
+  "dependencies": {
+    "debug": "2.6.9",
+    "encodeurl": "~1.0.2",
+    "escape-html": "~1.0.3",
+    "on-finished": "~2.3.0",
+    "parseurl": "~1.3.3",
+    "statuses": "~1.5.0",
+    "unpipe": "~1.0.0"
+  },
+  "devDependencies": {
+    "eslint": "5.16.0",
+    "eslint-config-standard": "12.0.0",
+    "eslint-plugin-import": "2.17.2",
+    "eslint-plugin-markdown": "1.0.0",
+    "eslint-plugin-node": "8.0.1",
+    "eslint-plugin-promise": "4.1.1",
+    "eslint-plugin-standard": "4.0.0",
+    "istanbul": "0.4.5",
+    "mocha": "6.1.4",
+    "readable-stream": "2.3.6",
+    "safe-buffer": "5.1.2",
+    "supertest": "4.0.2"
+  },
+  "files": [
+    "LICENSE",
+    "HISTORY.md",
+    "index.js"
+  ],
+  "engines": {
+    "node": ">= 0.8"
+  },
+  "scripts": {
+    "lint": "eslint --plugin markdown --ext js,md .",
+    "test": "mocha --reporter spec --bail --check-leaks test/",
+    "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+    "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/"
+  }
+}

node_modules/karma/node_modules/ms/index.js

@@ -0,0 +1,152 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ *  - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} [options]
+ * @throws {Error} throw an error if val is not a non-empty string or a number
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options) {
+  options = options || {};
+  var type = typeof val;
+  if (type === 'string' && val.length > 0) {
+    return parse(val);
+  } else if (type === 'number' && isNaN(val) === false) {
+    return options.long ? fmtLong(val) : fmtShort(val);
+  }
+  throw new Error(
+    'val is not a non-empty string or a valid number. val=' +
+      JSON.stringify(val)
+  );
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+  str = String(str);
+  if (str.length > 100) {
+    return;
+  }
+  var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(
+    str
+  );
+  if (!match) {
+    return;
+  }
+  var n = parseFloat(match[1]);
+  var type = (match[2] || 'ms').toLowerCase();
+  switch (type) {
+    case 'years':
+    case 'year':
+    case 'yrs':
+    case 'yr':
+    case 'y':
+      return n * y;
+    case 'days':
+    case 'day':
+    case 'd':
+      return n * d;
+    case 'hours':
+    case 'hour':
+    case 'hrs':
+    case 'hr':
+    case 'h':
+      return n * h;
+    case 'minutes':
+    case 'minute':
+    case 'mins':
+    case 'min':
+    case 'm':
+      return n * m;
+    case 'seconds':
+    case 'second':
+    case 'secs':
+    case 'sec':
+    case 's':
+      return n * s;
+    case 'milliseconds':
+    case 'millisecond':
+    case 'msecs':
+    case 'msec':
+    case 'ms':
+      return n;
+    default:
+      return undefined;
+  }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtShort(ms) {
+  if (ms >= d) {
+    return Math.round(ms / d) + 'd';
+  }
+  if (ms >= h) {
+    return Math.round(ms / h) + 'h';
+  }
+  if (ms >= m) {
+    return Math.round(ms / m) + 'm';
+  }
+  if (ms >= s) {
+    return Math.round(ms / s) + 's';
+  }
+  return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtLong(ms) {
+  return plural(ms, d, 'day') ||
+    plural(ms, h, 'hour') ||
+    plural(ms, m, 'minute') ||
+    plural(ms, s, 'second') ||
+    ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, n, name) {
+  if (ms < n) {
+    return;
+  }
+  if (ms < n * 1.5) {
+    return Math.floor(ms / n) + ' ' + name;
+  }
+  return Math.ceil(ms / n) + ' ' + name + 's';
+}

node_modules/karma/node_modules/ms/license.md

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2016 Zeit, Inc.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

node_modules/karma/node_modules/ms/package.json

@@ -0,0 +1,37 @@
+{
+  "name": "ms",
+  "version": "2.0.0",
+  "description": "Tiny milisecond conversion utility",
+  "repository": "zeit/ms",
+  "main": "./index",
+  "files": [
+    "index.js"
+  ],
+  "scripts": {
+    "precommit": "lint-staged",
+    "lint": "eslint lib/* bin/*",
+    "test": "mocha tests.js"
+  },
+  "eslintConfig": {
+    "extends": "eslint:recommended",
+    "env": {
+      "node": true,
+      "es6": true
+    }
+  },
+  "lint-staged": {
+    "*.js": [
+      "npm run lint",
+      "prettier --single-quote --write",
+      "git add"
+    ]
+  },
+  "license": "MIT",
+  "devDependencies": {
+    "eslint": "3.19.0",
+    "expect.js": "0.3.1",
+    "husky": "0.13.3",
+    "lint-staged": "3.4.1",
+    "mocha": "3.4.1"
+  }
+}

node_modules/karma/node_modules/ms/readme.md

@@ -0,0 +1,51 @@
+# ms
+
+[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms)
+[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/)
+
+Use this package to easily convert various time formats to milliseconds.
+
+## Examples
+
+```js
+ms('2 days')  // 172800000
+ms('1d')      // 86400000
+ms('10h')     // 36000000
+ms('2.5 hrs') // 9000000
+ms('2h')      // 7200000
+ms('1m')      // 60000
+ms('5s')      // 5000
+ms('1y')      // 31557600000
+ms('100')     // 100
+```
+
+### Convert from milliseconds
+
+```js
+ms(60000)             // "1m"
+ms(2 * 60000)         // "2m"
+ms(ms('10 hours'))    // "10h"
+```
+
+### Time format written-out
+
+```js
+ms(60000, { long: true })             // "1 minute"
+ms(2 * 60000, { long: true })         // "2 minutes"
+ms(ms('10 hours'), { long: true })    // "10 hours"
+```
+
+## Features
+
+- Works both in [node](https://nodejs.org) and in the browser.
+- If a number is supplied to `ms`, a string with a unit is returned.
+- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`).
+- If you pass a string with a number and a valid unit, the number of equivalent ms is returned.
+
+## Caught a bug?
+
+1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device
+2. Link the package to the global module directory: `npm link`
+3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms!
+
+As always, you can run the tests using: `npm test`

node_modules/karma/node_modules/on-finished/HISTORY.md

@@ -0,0 +1,88 @@
+2.3.0 / 2015-05-26
+==================
+
+  * Add defined behavior for HTTP `CONNECT` requests
+  * Add defined behavior for HTTP `Upgrade` requests
+  * deps: ee-first@1.1.1
+
+2.2.1 / 2015-04-22
+==================
+
+  * Fix `isFinished(req)` when data buffered
+
+2.2.0 / 2014-12-22
+==================
+
+  * Add message object to callback arguments
+
+2.1.1 / 2014-10-22
+==================
+
+  * Fix handling of pipelined requests
+
+2.1.0 / 2014-08-16
+==================
+
+  * Check if `socket` is detached
+  * Return `undefined` for `isFinished` if state unknown
+
+2.0.0 / 2014-08-16
+==================
+
+  * Add `isFinished` function
+  * Move to `jshttp` organization
+  * Remove support for plain socket argument
+  * Rename to `on-finished`
+  * Support both `req` and `res` as arguments
+  * deps: ee-first@1.0.5
+
+1.2.2 / 2014-06-10
+==================
+
+  * Reduce listeners added to emitters
+    - avoids "event emitter leak" warnings when used multiple times on same request
+
+1.2.1 / 2014-06-08
+==================
+
+  * Fix returned value when already finished
+
+1.2.0 / 2014-06-05
+==================
+
+  * Call callback when called on already-finished socket
+
+1.1.4 / 2014-05-27
+==================
+
+  * Support node.js 0.8
+
+1.1.3 / 2014-04-30
+==================
+
+  * Make sure errors passed as instanceof `Error`
+
+1.1.2 / 2014-04-18
+==================
+
+  * Default the `socket` to passed-in object
+
+1.1.1 / 2014-01-16
+==================
+
+  * Rename module to `finished`
+
+1.1.0 / 2013-12-25
+==================
+
+  * Call callback when called on already-errored socket
+
+1.0.1 / 2013-12-20
+==================
+
+  * Actually pass the error to the callback
+
+1.0.0 / 2013-12-20
+==================
+
+  * Initial release

node_modules/karma/node_modules/on-finished/LICENSE

@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2013 Jonathan Ong <me@jongleberry.com>
+Copyright (c) 2014 Douglas Christopher Wilson <doug@somethingdoug.com>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

node_modules/karma/node_modules/on-finished/README.md

@@ -0,0 +1,154 @@
+# on-finished
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Execute a callback when a HTTP request closes, finishes, or errors.
+
+## Install
+
+```sh
+$ npm install on-finished
+```
+
+## API
+
+```js
+var onFinished = require('on-finished')
+```
+
+### onFinished(res, listener)
+
+Attach a listener to listen for the response to finish. The listener will
+be invoked only once when the response finished. If the response finished
+to an error, the first argument will contain the error. If the response
+has already finished, the listener will be invoked.
+
+Listening to the end of a response would be used to close things associated
+with the response, like open files.
+
+Listener is invoked as `listener(err, res)`.
+
+```js
+onFinished(res, function (err, res) {
+  // clean up open fds, etc.
+  // err contains the error is request error'd
+})
+```
+
+### onFinished(req, listener)
+
+Attach a listener to listen for the request to finish. The listener will
+be invoked only once when the request finished. If the request finished
+to an error, the first argument will contain the error. If the request
+has already finished, the listener will be invoked.
+
+Listening to the end of a request would be used to know when to continue
+after reading the data.
+
+Listener is invoked as `listener(err, req)`.
+
+```js
+var data = ''
+
+req.setEncoding('utf8')
+res.on('data', function (str) {
+  data += str
+})
+
+onFinished(req, function (err, req) {
+  // data is read unless there is err
+})
+```
+
+### onFinished.isFinished(res)
+
+Determine if `res` is already finished. This would be useful to check and
+not even start certain operations if the response has already finished.
+
+### onFinished.isFinished(req)
+
+Determine if `req` is already finished. This would be useful to check and
+not even start certain operations if the request has already finished.
+
+## Special Node.js requests
+
+### HTTP CONNECT method
+
+The meaning of the `CONNECT` method from RFC 7231, section 4.3.6:
+
+> The CONNECT method requests that the recipient establish a tunnel to
+> the destination origin server identified by the request-target and,
+> if successful, thereafter restrict its behavior to blind forwarding
+> of packets, in both directions, until the tunnel is closed.  Tunnels
+> are commonly used to create an end-to-end virtual connection, through
+> one or more proxies, which can then be secured using TLS (Transport
+> Layer Security, [RFC5246]).
+
+In Node.js, these request objects come from the `'connect'` event on
+the HTTP server.
+
+When this module is used on a HTTP `CONNECT` request, the request is
+considered "finished" immediately, **due to limitations in the Node.js
+interface**. This means if the `CONNECT` request contains a request entity,
+the request will be considered "finished" even before it has been read.
+
+There is no such thing as a response object to a `CONNECT` request in
+Node.js, so there is no support for for one.
+
+### HTTP Upgrade request
+
+The meaning of the `Upgrade` header from RFC 7230, section 6.1:
+
+> The "Upgrade" header field is intended to provide a simple mechanism
+> for transitioning from HTTP/1.1 to some other protocol on the same
+> connection.
+
+In Node.js, these request objects come from the `'upgrade'` event on
+the HTTP server.
+
+When this module is used on a HTTP request with an `Upgrade` header, the
+request is considered "finished" immediately, **due to limitations in the
+Node.js interface**. This means if the `Upgrade` request contains a request
+entity, the request will be considered "finished" even before it has been
+read.
+
+There is no such thing as a response object to a `Upgrade` request in
+Node.js, so there is no support for for one.
+
+## Example
+
+The following code ensures that file descriptors are always closed
+once the response finishes.
+
+```js
+var destroy = require('destroy')
+var http = require('http')
+var onFinished = require('on-finished')
+
+http.createServer(function onRequest(req, res) {
+  var stream = fs.createReadStream('package.json')
+  stream.pipe(res)
+  onFinished(res, function (err) {
+    destroy(stream)
+  })
+})
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/on-finished.svg
+[npm-url]: https://npmjs.org/package/on-finished
+[node-version-image]: https://img.shields.io/node/v/on-finished.svg
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/on-finished/master.svg
+[travis-url]: https://travis-ci.org/jshttp/on-finished
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/on-finished/master.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/on-finished?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/on-finished.svg
+[downloads-url]: https://npmjs.org/package/on-finished

node_modules/karma/node_modules/on-finished/index.js

@@ -0,0 +1,196 @@
+/*!
+ * on-finished
+ * Copyright(c) 2013 Jonathan Ong
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = onFinished
+module.exports.isFinished = isFinished
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var first = require('ee-first')
+
+/**
+ * Variables.
+ * @private
+ */
+
+/* istanbul ignore next */
+var defer = typeof setImmediate === 'function'
+  ? setImmediate
+  : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) }
+
+/**
+ * Invoke callback when the response has finished, useful for
+ * cleaning up resources afterwards.
+ *
+ * @param {object} msg
+ * @param {function} listener
+ * @return {object}
+ * @public
+ */
+
+function onFinished(msg, listener) {
+  if (isFinished(msg) !== false) {
+    defer(listener, null, msg)
+    return msg
+  }
+
+  // attach the listener to the message
+  attachListener(msg, listener)
+
+  return msg
+}
+
+/**
+ * Determine if message is already finished.
+ *
+ * @param {object} msg
+ * @return {boolean}
+ * @public
+ */
+
+function isFinished(msg) {
+  var socket = msg.socket
+
+  if (typeof msg.finished === 'boolean') {
+    // OutgoingMessage
+    return Boolean(msg.finished || (socket && !socket.writable))
+  }
+
+  if (typeof msg.complete === 'boolean') {
+    // IncomingMessage
+    return Boolean(msg.upgrade || !socket || !socket.readable || (msg.complete && !msg.readable))
+  }
+
+  // don't know
+  return undefined
+}
+
+/**
+ * Attach a finished listener to the message.
+ *
+ * @param {object} msg
+ * @param {function} callback
+ * @private
+ */
+
+function attachFinishedListener(msg, callback) {
+  var eeMsg
+  var eeSocket
+  var finished = false
+
+  function onFinish(error) {
+    eeMsg.cancel()
+    eeSocket.cancel()
+
+    finished = true
+    callback(error)
+  }
+
+  // finished on first message event
+  eeMsg = eeSocket = first([[msg, 'end', 'finish']], onFinish)
+
+  function onSocket(socket) {
+    // remove listener
+    msg.removeListener('socket', onSocket)
+
+    if (finished) return
+    if (eeMsg !== eeSocket) return
+
+    // finished on first socket event
+    eeSocket = first([[socket, 'error', 'close']], onFinish)
+  }
+
+  if (msg.socket) {
+    // socket already assigned
+    onSocket(msg.socket)
+    return
+  }
+
+  // wait for socket to be assigned
+  msg.on('socket', onSocket)
+
+  if (msg.socket === undefined) {
+    // node.js 0.8 patch
+    patchAssignSocket(msg, onSocket)
+  }
+}
+
+/**
+ * Attach the listener to the message.
+ *
+ * @param {object} msg
+ * @return {function}
+ * @private
+ */
+
+function attachListener(msg, listener) {
+  var attached = msg.__onFinished
+
+  // create a private single listener with queue
+  if (!attached || !attached.queue) {
+    attached = msg.__onFinished = createListener(msg)
+    attachFinishedListener(msg, attached)
+  }
+
+  attached.queue.push(listener)
+}
+
+/**
+ * Create listener on message.
+ *
+ * @param {object} msg
+ * @return {function}
+ * @private
+ */
+
+function createListener(msg) {
+  function listener(err) {
+    if (msg.__onFinished === listener) msg.__onFinished = null
+    if (!listener.queue) return
+
+    var queue = listener.queue
+    listener.queue = null
+
+    for (var i = 0; i < queue.length; i++) {
+      queue[i](err, msg)
+    }
+  }
+
+  listener.queue = []
+
+  return listener
+}
+
+/**
+ * Patch ServerResponse.prototype.assignSocket for node.js 0.8.
+ *
+ * @param {ServerResponse} res
+ * @param {function} callback
+ * @private
+ */
+
+function patchAssignSocket(res, callback) {
+  var assignSocket = res.assignSocket
+
+  if (typeof assignSocket !== 'function') return
+
+  // res.on('socket', callback) is broken in 0.8
+  res.assignSocket = function _assignSocket(socket) {
+    assignSocket.call(this, socket)
+    callback(socket)
+  }
+}

node_modules/karma/node_modules/on-finished/package.json

@@ -0,0 +1,31 @@
+{
+  "name": "on-finished",
+  "description": "Execute a callback when a request closes, finishes, or errors",
+  "version": "2.3.0",
+  "contributors": [
+    "Douglas Christopher Wilson <doug@somethingdoug.com>",
+    "Jonathan Ong <me@jongleberry.com> (http://jongleberry.com)"
+  ],
+  "license": "MIT",
+  "repository": "jshttp/on-finished",
+  "dependencies": {
+    "ee-first": "1.1.1"
+  },
+  "devDependencies": {
+    "istanbul": "0.3.9",
+    "mocha": "2.2.5"
+  },
+  "engines": {
+    "node": ">= 0.8"
+  },
+  "files": [
+    "HISTORY.md",
+    "LICENSE",
+    "index.js"
+  ],
+  "scripts": {
+    "test": "mocha --reporter spec --bail --check-leaks test/",
+    "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+    "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+  }
+}

node_modules/karma/node_modules/source-map/CHANGELOG.md

@@ -0,0 +1,301 @@
+# Change Log
+
+## 0.5.6
+
+* Fix for regression when people were using numbers as names in source maps. See
+  #236.
+
+## 0.5.5
+
+* Fix "regression" of unsupported, implementation behavior that half the world
+  happens to have come to depend on. See #235.
+
+* Fix regression involving function hoisting in SpiderMonkey. See #233.
+
+## 0.5.4
+
+* Large performance improvements to source-map serialization. See #228 and #229.
+
+## 0.5.3
+
+* Do not include unnecessary distribution files. See
+  commit ef7006f8d1647e0a83fdc60f04f5a7ca54886f86.
+
+## 0.5.2
+
+* Include browser distributions of the library in package.json's `files`. See
+  issue #212.
+
+## 0.5.1
+
+* Fix latent bugs in IndexedSourceMapConsumer.prototype._parseMappings. See
+  ff05274becc9e6e1295ed60f3ea090d31d843379.
+
+## 0.5.0
+
+* Node 0.8 is no longer supported.
+
+* Use webpack instead of dryice for bundling.
+
+* Big speedups serializing source maps. See pull request #203.
+
+* Fix a bug with `SourceMapConsumer.prototype.sourceContentFor` and sources that
+  explicitly start with the source root. See issue #199.
+
+## 0.4.4
+
+* Fix an issue where using a `SourceMapGenerator` after having created a
+  `SourceMapConsumer` from it via `SourceMapConsumer.fromSourceMap` failed. See
+  issue #191.
+
+* Fix an issue with where `SourceMapGenerator` would mistakenly consider
+  different mappings as duplicates of each other and avoid generating them. See
+  issue #192.
+
+## 0.4.3
+
+* A very large number of performance improvements, particularly when parsing
+  source maps. Collectively about 75% of time shaved off of the source map
+  parsing benchmark!
+
+* Fix a bug in `SourceMapConsumer.prototype.allGeneratedPositionsFor` and fuzzy
+  searching in the presence of a column option. See issue #177.
+
+* Fix a bug with joining a source and its source root when the source is above
+  the root. See issue #182.
+
+* Add the `SourceMapConsumer.prototype.hasContentsOfAllSources` method to
+  determine when all sources' contents are inlined into the source map. See
+  issue #190.
+
+## 0.4.2
+
+* Add an `.npmignore` file so that the benchmarks aren't pulled down by
+  dependent projects. Issue #169.
+
+* Add an optional `column` argument to
+  `SourceMapConsumer.prototype.allGeneratedPositionsFor` and better handle lines
+  with no mappings. Issues #172 and #173.
+
+## 0.4.1
+
+* Fix accidentally defining a global variable. #170.
+
+## 0.4.0
+
+* The default direction for fuzzy searching was changed back to its original
+  direction. See #164.
+
+* There is now a `bias` option you can supply to `SourceMapConsumer` to control
+  the fuzzy searching direction. See #167.
+
+* About an 8% speed up in parsing source maps. See #159.
+
+* Added a benchmark for parsing and generating source maps.
+
+## 0.3.0
+
+* Change the default direction that searching for positions fuzzes when there is
+  not an exact match. See #154.
+
+* Support for environments using json2.js for JSON serialization. See #156.
+
+## 0.2.0
+
+* Support for consuming "indexed" source maps which do not have any remote
+  sections. See pull request #127. This introduces a minor backwards
+  incompatibility if you are monkey patching `SourceMapConsumer.prototype`
+  methods.
+
+## 0.1.43
+
+* Performance improvements for `SourceMapGenerator` and `SourceNode`. See issue
+  #148 for some discussion and issues #150, #151, and #152 for implementations.
+
+## 0.1.42
+
+* Fix an issue where `SourceNode`s from different versions of the source-map
+  library couldn't be used in conjunction with each other. See issue #142.
+
+## 0.1.41
+
+* Fix a bug with getting the source content of relative sources with a "./"
+  prefix. See issue #145 and [Bug 1090768](bugzil.la/1090768).
+
+* Add the `SourceMapConsumer.prototype.computeColumnSpans` method to compute the
+  column span of each mapping.
+
+* Add the `SourceMapConsumer.prototype.allGeneratedPositionsFor` method to find
+  all generated positions associated with a given original source and line.
+
+## 0.1.40
+
+* Performance improvements for parsing source maps in SourceMapConsumer.
+
+## 0.1.39
+
+* Fix a bug where setting a source's contents to null before any source content
+  had been set before threw a TypeError. See issue #131.
+
+## 0.1.38
+
+* Fix a bug where finding relative paths from an empty path were creating
+  absolute paths. See issue #129.
+
+## 0.1.37
+
+* Fix a bug where if the source root was an empty string, relative source paths
+  would turn into absolute source paths. Issue #124.
+
+## 0.1.36
+
+* Allow the `names` mapping property to be an empty string. Issue #121.
+
+## 0.1.35
+
+* A third optional parameter was added to `SourceNode.fromStringWithSourceMap`
+  to specify a path that relative sources in the second parameter should be
+  relative to. Issue #105.
+
+* If no file property is given to a `SourceMapGenerator`, then the resulting
+  source map will no longer have a `null` file property. The property will
+  simply not exist. Issue #104.
+
+* Fixed a bug where consecutive newlines were ignored in `SourceNode`s.
+  Issue #116.
+
+## 0.1.34
+
+* Make `SourceNode` work with windows style ("\r\n") newlines. Issue #103.
+
+* Fix bug involving source contents and the
+  `SourceMapGenerator.prototype.applySourceMap`. Issue #100.
+
+## 0.1.33
+
+* Fix some edge cases surrounding path joining and URL resolution.
+
+* Add a third parameter for relative path to
+  `SourceMapGenerator.prototype.applySourceMap`.
+
+* Fix issues with mappings and EOLs.
+
+## 0.1.32
+
+* Fixed a bug where SourceMapConsumer couldn't handle negative relative columns
+  (issue 92).
+
+* Fixed test runner to actually report number of failed tests as its process
+  exit code.
+
+* Fixed a typo when reporting bad mappings (issue 87).
+
+## 0.1.31
+
+* Delay parsing the mappings in SourceMapConsumer until queried for a source
+  location.
+
+* Support Sass source maps (which at the time of writing deviate from the spec
+  in small ways) in SourceMapConsumer.
+
+## 0.1.30
+
+* Do not join source root with a source, when the source is a data URI.
+
+* Extend the test runner to allow running single specific test files at a time.
+
+* Performance improvements in `SourceNode.prototype.walk` and
+  `SourceMapConsumer.prototype.eachMapping`.
+
+* Source map browser builds will now work inside Workers.
+
+* Better error messages when attempting to add an invalid mapping to a
+  `SourceMapGenerator`.
+
+## 0.1.29
+
+* Allow duplicate entries in the `names` and `sources` arrays of source maps
+  (usually from TypeScript) we are parsing. Fixes github issue 72.
+
+## 0.1.28
+
+* Skip duplicate mappings when creating source maps from SourceNode; github
+  issue 75.
+
+## 0.1.27
+
+* Don't throw an error when the `file` property is missing in SourceMapConsumer,
+  we don't use it anyway.
+
+## 0.1.26
+
+* Fix SourceNode.fromStringWithSourceMap for empty maps. Fixes github issue 70.
+
+## 0.1.25
+
+* Make compatible with browserify
+
+## 0.1.24
+
+* Fix issue with absolute paths and `file://` URIs. See
+  https://bugzilla.mozilla.org/show_bug.cgi?id=885597
+
+## 0.1.23
+
+* Fix issue with absolute paths and sourcesContent, github issue 64.
+
+## 0.1.22
+
+* Ignore duplicate mappings in SourceMapGenerator. Fixes github issue 21.
+
+## 0.1.21
+
+* Fixed handling of sources that start with a slash so that they are relative to
+  the source root's host.
+
+## 0.1.20
+
+* Fixed github issue #43: absolute URLs aren't joined with the source root
+  anymore.
+
+## 0.1.19
+
+* Using Travis CI to run tests.
+
+## 0.1.18
+
+* Fixed a bug in the handling of sourceRoot.
+
+## 0.1.17
+
+* Added SourceNode.fromStringWithSourceMap.
+
+## 0.1.16
+
+* Added missing documentation.
+
+* Fixed the generating of empty mappings in SourceNode.
+
+## 0.1.15
+
+* Added SourceMapGenerator.applySourceMap.
+
+## 0.1.14
+
+* The sourceRoot is now handled consistently.
+
+## 0.1.13
+
+* Added SourceMapGenerator.fromSourceMap.
+
+## 0.1.12
+
+* SourceNode now generates empty mappings too.
+
+## 0.1.11
+
+* Added name support to SourceNode.
+
+## 0.1.10
+
+* Added sourcesContent support to the customer and generator.

node_modules/karma/node_modules/source-map/LICENSE

@@ -0,0 +1,28 @@
+
+Copyright (c) 2009-2011, Mozilla Foundation and contributors
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above copyright notice, this
+  list of conditions and the following disclaimer.
+
+* Redistributions in binary form must reproduce the above copyright notice,
+  this list of conditions and the following disclaimer in the documentation
+  and/or other materials provided with the distribution.
+
+* Neither the names of the Mozilla Foundation nor the names of project
+  contributors may be used to endorse or promote products derived from this
+  software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
+CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
+OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.

node_modules/karma/node_modules/source-map/README.md

@@ -0,0 +1,742 @@
+# Source Map
+
+[![Build Status](https://travis-ci.org/mozilla/source-map.png?branch=master)](https://travis-ci.org/mozilla/source-map)
+
+[![NPM](https://nodei.co/npm/source-map.png?downloads=true&downloadRank=true)](https://www.npmjs.com/package/source-map)
+
+This is a library to generate and consume the source map format
+[described here][format].
+
+[format]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit
+
+## Use with Node
+
+    $ npm install source-map
+
+## Use on the Web
+
+    <script src="https://raw.githubusercontent.com/mozilla/source-map/master/dist/source-map.min.js" defer></script>
+
+--------------------------------------------------------------------------------
+
+<!-- `npm run toc` to regenerate the Table of Contents -->
+
+<!-- START doctoc generated TOC please keep comment here to allow auto update -->
+<!-- DON'T EDIT THIS SECTION, INSTEAD RE-RUN doctoc TO UPDATE -->
+## Table of Contents
+
+- [Examples](#examples)
+  - [Consuming a source map](#consuming-a-source-map)
+  - [Generating a source map](#generating-a-source-map)
+    - [With SourceNode (high level API)](#with-sourcenode-high-level-api)
+    - [With SourceMapGenerator (low level API)](#with-sourcemapgenerator-low-level-api)
+- [API](#api)
+  - [SourceMapConsumer](#sourcemapconsumer)
+    - [new SourceMapConsumer(rawSourceMap)](#new-sourcemapconsumerrawsourcemap)
+    - [SourceMapConsumer.prototype.computeColumnSpans()](#sourcemapconsumerprototypecomputecolumnspans)
+    - [SourceMapConsumer.prototype.originalPositionFor(generatedPosition)](#sourcemapconsumerprototypeoriginalpositionforgeneratedposition)
+    - [SourceMapConsumer.prototype.generatedPositionFor(originalPosition)](#sourcemapconsumerprototypegeneratedpositionfororiginalposition)
+    - [SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition)](#sourcemapconsumerprototypeallgeneratedpositionsfororiginalposition)
+    - [SourceMapConsumer.prototype.hasContentsOfAllSources()](#sourcemapconsumerprototypehascontentsofallsources)
+    - [SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing])](#sourcemapconsumerprototypesourcecontentforsource-returnnullonmissing)
+    - [SourceMapConsumer.prototype.eachMapping(callback, context, order)](#sourcemapconsumerprototypeeachmappingcallback-context-order)
+  - [SourceMapGenerator](#sourcemapgenerator)
+    - [new SourceMapGenerator([startOfSourceMap])](#new-sourcemapgeneratorstartofsourcemap)
+    - [SourceMapGenerator.fromSourceMap(sourceMapConsumer)](#sourcemapgeneratorfromsourcemapsourcemapconsumer)
+    - [SourceMapGenerator.prototype.addMapping(mapping)](#sourcemapgeneratorprototypeaddmappingmapping)
+    - [SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent)](#sourcemapgeneratorprototypesetsourcecontentsourcefile-sourcecontent)
+    - [SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]])](#sourcemapgeneratorprototypeapplysourcemapsourcemapconsumer-sourcefile-sourcemappath)
+    - [SourceMapGenerator.prototype.toString()](#sourcemapgeneratorprototypetostring)
+  - [SourceNode](#sourcenode)
+    - [new SourceNode([line, column, source[, chunk[, name]]])](#new-sourcenodeline-column-source-chunk-name)
+    - [SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath])](#sourcenodefromstringwithsourcemapcode-sourcemapconsumer-relativepath)
+    - [SourceNode.prototype.add(chunk)](#sourcenodeprototypeaddchunk)
+    - [SourceNode.prototype.prepend(chunk)](#sourcenodeprototypeprependchunk)
+    - [SourceNode.prototype.setSourceContent(sourceFile, sourceContent)](#sourcenodeprototypesetsourcecontentsourcefile-sourcecontent)
+    - [SourceNode.prototype.walk(fn)](#sourcenodeprototypewalkfn)
+    - [SourceNode.prototype.walkSourceContents(fn)](#sourcenodeprototypewalksourcecontentsfn)
+    - [SourceNode.prototype.join(sep)](#sourcenodeprototypejoinsep)
+    - [SourceNode.prototype.replaceRight(pattern, replacement)](#sourcenodeprototypereplacerightpattern-replacement)
+    - [SourceNode.prototype.toString()](#sourcenodeprototypetostring)
+    - [SourceNode.prototype.toStringWithSourceMap([startOfSourceMap])](#sourcenodeprototypetostringwithsourcemapstartofsourcemap)
+
+<!-- END doctoc generated TOC please keep comment here to allow auto update -->
+
+## Examples
+
+### Consuming a source map
+
+```js
+var rawSourceMap = {
+  version: 3,
+  file: 'min.js',
+  names: ['bar', 'baz', 'n'],
+  sources: ['one.js', 'two.js'],
+  sourceRoot: 'http://example.com/www/js/',
+  mappings: 'CAAC,IAAI,IAAM,SAAUA,GAClB,OAAOC,IAAID;CCDb,IAAI,IAAM,SAAUE,GAClB,OAAOA'
+};
+
+var smc = new SourceMapConsumer(rawSourceMap);
+
+console.log(smc.sources);
+// [ 'http://example.com/www/js/one.js',
+//   'http://example.com/www/js/two.js' ]
+
+console.log(smc.originalPositionFor({
+  line: 2,
+  column: 28
+}));
+// { source: 'http://example.com/www/js/two.js',
+//   line: 2,
+//   column: 10,
+//   name: 'n' }
+
+console.log(smc.generatedPositionFor({
+  source: 'http://example.com/www/js/two.js',
+  line: 2,
+  column: 10
+}));
+// { line: 2, column: 28 }
+
+smc.eachMapping(function (m) {
+  // ...
+});
+```
+
+### Generating a source map
+
+In depth guide:
+[**Compiling to JavaScript, and Debugging with Source Maps**](https://hacks.mozilla.org/2013/05/compiling-to-javascript-and-debugging-with-source-maps/)
+
+#### With SourceNode (high level API)
+
+```js
+function compile(ast) {
+  switch (ast.type) {
+  case 'BinaryExpression':
+    return new SourceNode(
+      ast.location.line,
+      ast.location.column,
+      ast.location.source,
+      [compile(ast.left), " + ", compile(ast.right)]
+    );
+  case 'Literal':
+    return new SourceNode(
+      ast.location.line,
+      ast.location.column,
+      ast.location.source,
+      String(ast.value)
+    );
+  // ...
+  default:
+    throw new Error("Bad AST");
+  }
+}
+
+var ast = parse("40 + 2", "add.js");
+console.log(compile(ast).toStringWithSourceMap({
+  file: 'add.js'
+}));
+// { code: '40 + 2',
+//   map: [object SourceMapGenerator] }
+```
+
+#### With SourceMapGenerator (low level API)
+
+```js
+var map = new SourceMapGenerator({
+  file: "source-mapped.js"
+});
+
+map.addMapping({
+  generated: {
+    line: 10,
+    column: 35
+  },
+  source: "foo.js",
+  original: {
+    line: 33,
+    column: 2
+  },
+  name: "christopher"
+});
+
+console.log(map.toString());
+// '{"version":3,"file":"source-mapped.js","sources":["foo.js"],"names":["christopher"],"mappings":";;;;;;;;;mCAgCEA"}'
+```
+
+## API
+
+Get a reference to the module:
+
+```js
+// Node.js
+var sourceMap = require('source-map');
+
+// Browser builds
+var sourceMap = window.sourceMap;
+
+// Inside Firefox
+const sourceMap = require("devtools/toolkit/sourcemap/source-map.js");
+```
+
+### SourceMapConsumer
+
+A SourceMapConsumer instance represents a parsed source map which we can query
+for information about the original file positions by giving it a file position
+in the generated source.
+
+#### new SourceMapConsumer(rawSourceMap)
+
+The only parameter is the raw source map (either as a string which can be
+`JSON.parse`'d, or an object). According to the spec, source maps have the
+following attributes:
+
+* `version`: Which version of the source map spec this map is following.
+
+* `sources`: An array of URLs to the original source files.
+
+* `names`: An array of identifiers which can be referenced by individual
+  mappings.
+
+* `sourceRoot`: Optional. The URL root from which all sources are relative.
+
+* `sourcesContent`: Optional. An array of contents of the original source files.
+
+* `mappings`: A string of base64 VLQs which contain the actual mappings.
+
+* `file`: Optional. The generated filename this source map is associated with.
+
+```js
+var consumer = new sourceMap.SourceMapConsumer(rawSourceMapJsonData);
+```
+
+#### SourceMapConsumer.prototype.computeColumnSpans()
+
+Compute the last column for each generated mapping. The last column is
+inclusive.
+
+```js
+// Before:
+consumer.allGeneratedPositionsFor({ line: 2, source: "foo.coffee" })
+// [ { line: 2,
+//     column: 1 },
+//   { line: 2,
+//     column: 10 },
+//   { line: 2,
+//     column: 20 } ]
+
+consumer.computeColumnSpans();
+
+// After:
+consumer.allGeneratedPositionsFor({ line: 2, source: "foo.coffee" })
+// [ { line: 2,
+//     column: 1,
+//     lastColumn: 9 },
+//   { line: 2,
+//     column: 10,
+//     lastColumn: 19 },
+//   { line: 2,
+//     column: 20,
+//     lastColumn: Infinity } ]
+
+```
+
+#### SourceMapConsumer.prototype.originalPositionFor(generatedPosition)
+
+Returns the original source, line, and column information for the generated
+source's line and column positions provided. The only argument is an object with
+the following properties:
+
+* `line`: The line number in the generated source.  Line numbers in
+  this library are 1-based (note that the underlying source map
+  specification uses 0-based line numbers -- this library handles the
+  translation).
+
+* `column`: The column number in the generated source.  Column numbers
+  in this library are 0-based.
+
+* `bias`: Either `SourceMapConsumer.GREATEST_LOWER_BOUND` or
+  `SourceMapConsumer.LEAST_UPPER_BOUND`. Specifies whether to return the closest
+  element that is smaller than or greater than the one we are searching for,
+  respectively, if the exact element cannot be found.  Defaults to
+  `SourceMapConsumer.GREATEST_LOWER_BOUND`.
+
+and an object is returned with the following properties:
+
+* `source`: The original source file, or null if this information is not
+  available.
+
+* `line`: The line number in the original source, or null if this information is
+  not available.  The line number is 1-based.
+
+* `column`: The column number in the original source, or null if this
+  information is not available.  The column number is 0-based.
+
+* `name`: The original identifier, or null if this information is not available.
+
+```js
+consumer.originalPositionFor({ line: 2, column: 10 })
+// { source: 'foo.coffee',
+//   line: 2,
+//   column: 2,
+//   name: null }
+
+consumer.originalPositionFor({ line: 99999999999999999, column: 999999999999999 })
+// { source: null,
+//   line: null,
+//   column: null,
+//   name: null }
+```
+
+#### SourceMapConsumer.prototype.generatedPositionFor(originalPosition)
+
+Returns the generated line and column information for the original source,
+line, and column positions provided. The only argument is an object with
+the following properties:
+
+* `source`: The filename of the original source.
+
+* `line`: The line number in the original source.  The line number is
+  1-based.
+
+* `column`: The column number in the original source.  The column
+  number is 0-based.
+
+and an object is returned with the following properties:
+
+* `line`: The line number in the generated source, or null.  The line
+  number is 1-based.
+
+* `column`: The column number in the generated source, or null.  The
+  column number is 0-based.
+
+```js
+consumer.generatedPositionFor({ source: "example.js", line: 2, column: 10 })
+// { line: 1,
+//   column: 56 }
+```
+
+#### SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition)
+
+Returns all generated line and column information for the original source, line,
+and column provided. If no column is provided, returns all mappings
+corresponding to a either the line we are searching for or the next closest line
+that has any mappings. Otherwise, returns all mappings corresponding to the
+given line and either the column we are searching for or the next closest column
+that has any offsets.
+
+The only argument is an object with the following properties:
+
+* `source`: The filename of the original source.
+
+* `line`: The line number in the original source.  The line number is
+  1-based.
+
+* `column`: Optional. The column number in the original source.  The
+  column number is 0-based.
+
+and an array of objects is returned, each with the following properties:
+
+* `line`: The line number in the generated source, or null.  The line
+  number is 1-based.
+
+* `column`: The column number in the generated source, or null.  The
+  column number is 0-based.
+
+```js
+consumer.allGeneratedpositionsfor({ line: 2, source: "foo.coffee" })
+// [ { line: 2,
+//     column: 1 },
+//   { line: 2,
+//     column: 10 },
+//   { line: 2,
+//     column: 20 } ]
+```
+
+#### SourceMapConsumer.prototype.hasContentsOfAllSources()
+
+Return true if we have the embedded source content for every source listed in
+the source map, false otherwise.
+
+In other words, if this method returns `true`, then
+`consumer.sourceContentFor(s)` will succeed for every source `s` in
+`consumer.sources`.
+
+```js
+// ...
+if (consumer.hasContentsOfAllSources()) {
+  consumerReadyCallback(consumer);
+} else {
+  fetchSources(consumer, consumerReadyCallback);
+}
+// ...
+```
+
+#### SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing])
+
+Returns the original source content for the source provided. The only
+argument is the URL of the original source file.
+
+If the source content for the given source is not found, then an error is
+thrown. Optionally, pass `true` as the second param to have `null` returned
+instead.
+
+```js
+consumer.sources
+// [ "my-cool-lib.clj" ]
+
+consumer.sourceContentFor("my-cool-lib.clj")
+// "..."
+
+consumer.sourceContentFor("this is not in the source map");
+// Error: "this is not in the source map" is not in the source map
+
+consumer.sourceContentFor("this is not in the source map", true);
+// null
+```
+
+#### SourceMapConsumer.prototype.eachMapping(callback, context, order)
+
+Iterate over each mapping between an original source/line/column and a
+generated line/column in this source map.
+
+* `callback`: The function that is called with each mapping. Mappings have the
+  form `{ source, generatedLine, generatedColumn, originalLine, originalColumn,
+  name }`
+
+* `context`: Optional. If specified, this object will be the value of `this`
+  every time that `callback` is called.
+
+* `order`: Either `SourceMapConsumer.GENERATED_ORDER` or
+  `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to iterate over
+  the mappings sorted by the generated file's line/column order or the
+  original's source/line/column order, respectively. Defaults to
+  `SourceMapConsumer.GENERATED_ORDER`.
+
+```js
+consumer.eachMapping(function (m) { console.log(m); })
+// ...
+// { source: 'illmatic.js',
+//   generatedLine: 1,
+//   generatedColumn: 0,
+//   originalLine: 1,
+//   originalColumn: 0,
+//   name: null }
+// { source: 'illmatic.js',
+//   generatedLine: 2,
+//   generatedColumn: 0,
+//   originalLine: 2,
+//   originalColumn: 0,
+//   name: null }
+// ...
+```
+### SourceMapGenerator
+
+An instance of the SourceMapGenerator represents a source map which is being
+built incrementally.
+
+#### new SourceMapGenerator([startOfSourceMap])
+
+You may pass an object with the following properties:
+
+* `file`: The filename of the generated source that this source map is
+  associated with.
+
+* `sourceRoot`: A root for all relative URLs in this source map.
+
+* `skipValidation`: Optional. When `true`, disables validation of mappings as
+  they are added. This can improve performance but should be used with
+  discretion, as a last resort. Even then, one should avoid using this flag when
+  running tests, if possible.
+
+```js
+var generator = new sourceMap.SourceMapGenerator({
+  file: "my-generated-javascript-file.js",
+  sourceRoot: "http://example.com/app/js/"
+});
+```
+
+#### SourceMapGenerator.fromSourceMap(sourceMapConsumer)
+
+Creates a new `SourceMapGenerator` from an existing `SourceMapConsumer` instance.
+
+* `sourceMapConsumer` The SourceMap.
+
+```js
+var generator = sourceMap.SourceMapGenerator.fromSourceMap(consumer);
+```
+
+#### SourceMapGenerator.prototype.addMapping(mapping)
+
+Add a single mapping from original source line and column to the generated
+source's line and column for this source map being created. The mapping object
+should have the following properties:
+
+* `generated`: An object with the generated line and column positions.
+
+* `original`: An object with the original line and column positions.
+
+* `source`: The original source file (relative to the sourceRoot).
+
+* `name`: An optional original token name for this mapping.
+
+```js
+generator.addMapping({
+  source: "module-one.scm",
+  original: { line: 128, column: 0 },
+  generated: { line: 3, column: 456 }
+})
+```
+
+#### SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent)
+
+Set the source content for an original source file.
+
+* `sourceFile` the URL of the original source file.
+
+* `sourceContent` the content of the source file.
+
+```js
+generator.setSourceContent("module-one.scm",
+                           fs.readFileSync("path/to/module-one.scm"))
+```
+
+#### SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]])
+
+Applies a SourceMap for a source file to the SourceMap.
+Each mapping to the supplied source file is rewritten using the
+supplied SourceMap. Note: The resolution for the resulting mappings
+is the minimum of this map and the supplied map.
+
+* `sourceMapConsumer`: The SourceMap to be applied.
+
+* `sourceFile`: Optional. The filename of the source file.
+  If omitted, sourceMapConsumer.file will be used, if it exists.
+  Otherwise an error will be thrown.
+
+* `sourceMapPath`: Optional. The dirname of the path to the SourceMap
+  to be applied. If relative, it is relative to the SourceMap.
+
+  This parameter is needed when the two SourceMaps aren't in the same
+  directory, and the SourceMap to be applied contains relative source
+  paths. If so, those relative source paths need to be rewritten
+  relative to the SourceMap.
+
+  If omitted, it is assumed that both SourceMaps are in the same directory,
+  thus not needing any rewriting. (Supplying `'.'` has the same effect.)
+
+#### SourceMapGenerator.prototype.toString()
+
+Renders the source map being generated to a string.
+
+```js
+generator.toString()
+// '{"version":3,"sources":["module-one.scm"],"names":[],"mappings":"...snip...","file":"my-generated-javascript-file.js","sourceRoot":"http://example.com/app/js/"}'
+```
+
+### SourceNode
+
+SourceNodes provide a way to abstract over interpolating and/or concatenating
+snippets of generated JavaScript source code, while maintaining the line and
+column information associated between those snippets and the original source
+code. This is useful as the final intermediate representation a compiler might
+use before outputting the generated JS and source map.
+
+#### new SourceNode([line, column, source[, chunk[, name]]])
+
+* `line`: The original line number associated with this source node, or null if
+  it isn't associated with an original line.  The line number is 1-based.
+
+* `column`: The original column number associated with this source node, or null
+  if it isn't associated with an original column.  The column number
+  is 0-based.
+
+* `source`: The original source's filename; null if no filename is provided.
+
+* `chunk`: Optional. Is immediately passed to `SourceNode.prototype.add`, see
+  below.
+
+* `name`: Optional. The original identifier.
+
+```js
+var node = new SourceNode(1, 2, "a.cpp", [
+  new SourceNode(3, 4, "b.cpp", "extern int status;\n"),
+  new SourceNode(5, 6, "c.cpp", "std::string* make_string(size_t n);\n"),
+  new SourceNode(7, 8, "d.cpp", "int main(int argc, char** argv) {}\n"),
+]);
+```
+
+#### SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath])
+
+Creates a SourceNode from generated code and a SourceMapConsumer.
+
+* `code`: The generated code
+
+* `sourceMapConsumer` The SourceMap for the generated code
+
+* `relativePath` The optional path that relative sources in `sourceMapConsumer`
+  should be relative to.
+
+```js
+var consumer = new SourceMapConsumer(fs.readFileSync("path/to/my-file.js.map", "utf8"));
+var node = SourceNode.fromStringWithSourceMap(fs.readFileSync("path/to/my-file.js"),
+                                              consumer);
+```
+
+#### SourceNode.prototype.add(chunk)
+
+Add a chunk of generated JS to this source node.
+
+* `chunk`: A string snippet of generated JS code, another instance of
+   `SourceNode`, or an array where each member is one of those things.
+
+```js
+node.add(" + ");
+node.add(otherNode);
+node.add([leftHandOperandNode, " + ", rightHandOperandNode]);
+```
+
+#### SourceNode.prototype.prepend(chunk)
+
+Prepend a chunk of generated JS to this source node.
+
+* `chunk`: A string snippet of generated JS code, another instance of
+   `SourceNode`, or an array where each member is one of those things.
+
+```js
+node.prepend("/** Build Id: f783haef86324gf **/\n\n");
+```
+
+#### SourceNode.prototype.setSourceContent(sourceFile, sourceContent)
+
+Set the source content for a source file. This will be added to the
+`SourceMap` in the `sourcesContent` field.
+
+* `sourceFile`: The filename of the source file
+
+* `sourceContent`: The content of the source file
+
+```js
+node.setSourceContent("module-one.scm",
+                      fs.readFileSync("path/to/module-one.scm"))
+```
+
+#### SourceNode.prototype.walk(fn)
+
+Walk over the tree of JS snippets in this node and its children. The walking
+function is called once for each snippet of JS and is passed that snippet and
+the its original associated source's line/column location.
+
+* `fn`: The traversal function.
+
+```js
+var node = new SourceNode(1, 2, "a.js", [
+  new SourceNode(3, 4, "b.js", "uno"),
+  "dos",
+  [
+    "tres",
+    new SourceNode(5, 6, "c.js", "quatro")
+  ]
+]);
+
+node.walk(function (code, loc) { console.log("WALK:", code, loc); })
+// WALK: uno { source: 'b.js', line: 3, column: 4, name: null }
+// WALK: dos { source: 'a.js', line: 1, column: 2, name: null }
+// WALK: tres { source: 'a.js', line: 1, column: 2, name: null }
+// WALK: quatro { source: 'c.js', line: 5, column: 6, name: null }
+```
+
+#### SourceNode.prototype.walkSourceContents(fn)
+
+Walk over the tree of SourceNodes. The walking function is called for each
+source file content and is passed the filename and source content.
+
+* `fn`: The traversal function.
+
+```js
+var a = new SourceNode(1, 2, "a.js", "generated from a");
+a.setSourceContent("a.js", "original a");
+var b = new SourceNode(1, 2, "b.js", "generated from b");
+b.setSourceContent("b.js", "original b");
+var c = new SourceNode(1, 2, "c.js", "generated from c");
+c.setSourceContent("c.js", "original c");
+
+var node = new SourceNode(null, null, null, [a, b, c]);
+node.walkSourceContents(function (source, contents) { console.log("WALK:", source, ":", contents); })
+// WALK: a.js : original a
+// WALK: b.js : original b
+// WALK: c.js : original c
+```
+
+#### SourceNode.prototype.join(sep)
+
+Like `Array.prototype.join` except for SourceNodes. Inserts the separator
+between each of this source node's children.
+
+* `sep`: The separator.
+
+```js
+var lhs = new SourceNode(1, 2, "a.rs", "my_copy");
+var operand = new SourceNode(3, 4, "a.rs", "=");
+var rhs = new SourceNode(5, 6, "a.rs", "orig.clone()");
+
+var node = new SourceNode(null, null, null, [ lhs, operand, rhs ]);
+var joinedNode = node.join(" ");
+```
+
+#### SourceNode.prototype.replaceRight(pattern, replacement)
+
+Call `String.prototype.replace` on the very right-most source snippet. Useful
+for trimming white space from the end of a source node, etc.
+
+* `pattern`: The pattern to replace.
+
+* `replacement`: The thing to replace the pattern with.
+
+```js
+// Trim trailing white space.
+node.replaceRight(/\s*$/, "");
+```
+
+#### SourceNode.prototype.toString()
+
+Return the string representation of this source node. Walks over the tree and
+concatenates all the various snippets together to one string.
+
+```js
+var node = new SourceNode(1, 2, "a.js", [
+  new SourceNode(3, 4, "b.js", "uno"),
+  "dos",
+  [
+    "tres",
+    new SourceNode(5, 6, "c.js", "quatro")
+  ]
+]);
+
+node.toString()
+// 'unodostresquatro'
+```
+
+#### SourceNode.prototype.toStringWithSourceMap([startOfSourceMap])
+
+Returns the string representation of this tree of source nodes, plus a
+SourceMapGenerator which contains all the mappings between the generated and
+original sources.
+
+The arguments are the same as those to `new SourceMapGenerator`.
+
+```js
+var node = new SourceNode(1, 2, "a.js", [
+  new SourceNode(3, 4, "b.js", "uno"),
+  "dos",
+  [
+    "tres",
+    new SourceNode(5, 6, "c.js", "quatro")
+  ]
+]);
+
+node.toStringWithSourceMap({ file: "my-output-file.js" })
+// { code: 'unodostresquatro',
+//   map: [object SourceMapGenerator] }
+```

node_modules/karma/node_modules/source-map/lib/array-set.js

@@ -0,0 +1,121 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var util = require('./util');
+var has = Object.prototype.hasOwnProperty;
+var hasNativeMap = typeof Map !== "undefined";
+
+/**
+ * A data structure which is a combination of an array and a set. Adding a new
+ * member is O(1), testing for membership is O(1), and finding the index of an
+ * element is O(1). Removing elements from the set is not supported. Only
+ * strings are supported for membership.
+ */
+function ArraySet() {
+  this._array = [];
+  this._set = hasNativeMap ? new Map() : Object.create(null);
+}
+
+/**
+ * Static method for creating ArraySet instances from an existing array.
+ */
+ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {
+  var set = new ArraySet();
+  for (var i = 0, len = aArray.length; i < len; i++) {
+    set.add(aArray[i], aAllowDuplicates);
+  }
+  return set;
+};
+
+/**
+ * Return how many unique items are in this ArraySet. If duplicates have been
+ * added, than those do not count towards the size.
+ *
+ * @returns Number
+ */
+ArraySet.prototype.size = function ArraySet_size() {
+  return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;
+};
+
+/**
+ * Add the given string to this set.
+ *
+ * @param String aStr
+ */
+ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {
+  var sStr = hasNativeMap ? aStr : util.toSetString(aStr);
+  var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);
+  var idx = this._array.length;
+  if (!isDuplicate || aAllowDuplicates) {
+    this._array.push(aStr);
+  }
+  if (!isDuplicate) {
+    if (hasNativeMap) {
+      this._set.set(aStr, idx);
+    } else {
+      this._set[sStr] = idx;
+    }
+  }
+};
+
+/**
+ * Is the given string a member of this set?
+ *
+ * @param String aStr
+ */
+ArraySet.prototype.has = function ArraySet_has(aStr) {
+  if (hasNativeMap) {
+    return this._set.has(aStr);
+  } else {
+    var sStr = util.toSetString(aStr);
+    return has.call(this._set, sStr);
+  }
+};
+
+/**
+ * What is the index of the given string in the array?
+ *
+ * @param String aStr
+ */
+ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {
+  if (hasNativeMap) {
+    var idx = this._set.get(aStr);
+    if (idx >= 0) {
+        return idx;
+    }
+  } else {
+    var sStr = util.toSetString(aStr);
+    if (has.call(this._set, sStr)) {
+      return this._set[sStr];
+    }
+  }
+
+  throw new Error('"' + aStr + '" is not in the set.');
+};
+
+/**
+ * What is the element at the given index?
+ *
+ * @param Number aIdx
+ */
+ArraySet.prototype.at = function ArraySet_at(aIdx) {
+  if (aIdx >= 0 && aIdx < this._array.length) {
+    return this._array[aIdx];
+  }
+  throw new Error('No element indexed by ' + aIdx);
+};
+
+/**
+ * Returns the array representation of this set (which has the proper indices
+ * indicated by indexOf). Note that this is a copy of the internal array used
+ * for storing the members so that no one can mess with internal state.
+ */
+ArraySet.prototype.toArray = function ArraySet_toArray() {
+  return this._array.slice();
+};
+
+exports.ArraySet = ArraySet;

node_modules/karma/node_modules/source-map/lib/base64-vlq.js

@@ -0,0 +1,140 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ *
+ * Based on the Base 64 VLQ implementation in Closure Compiler:
+ * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java
+ *
+ * Copyright 2011 The Closure Compiler Authors. All rights reserved.
+ * Redistribution and use in source and binary forms, with or without
+ * modification, are permitted provided that the following conditions are
+ * met:
+ *
+ *  * Redistributions of source code must retain the above copyright
+ *    notice, this list of conditions and the following disclaimer.
+ *  * Redistributions in binary form must reproduce the above
+ *    copyright notice, this list of conditions and the following
+ *    disclaimer in the documentation and/or other materials provided
+ *    with the distribution.
+ *  * Neither the name of Google Inc. nor the names of its
+ *    contributors may be used to endorse or promote products derived
+ *    from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+ * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+ * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+ * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+ * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+ * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+ * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+ * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+ * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+ * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ */
+
+var base64 = require('./base64');
+
+// A single base 64 digit can contain 6 bits of data. For the base 64 variable
+// length quantities we use in the source map spec, the first bit is the sign,
+// the next four bits are the actual value, and the 6th bit is the
+// continuation bit. The continuation bit tells us whether there are more
+// digits in this value following this digit.
+//
+//   Continuation
+//   |    Sign
+//   |    |
+//   V    V
+//   101011
+
+var VLQ_BASE_SHIFT = 5;
+
+// binary: 100000
+var VLQ_BASE = 1 << VLQ_BASE_SHIFT;
+
+// binary: 011111
+var VLQ_BASE_MASK = VLQ_BASE - 1;
+
+// binary: 100000
+var VLQ_CONTINUATION_BIT = VLQ_BASE;
+
+/**
+ * Converts from a two-complement value to a value where the sign bit is
+ * placed in the least significant bit.  For example, as decimals:
+ *   1 becomes 2 (10 binary), -1 becomes 3 (11 binary)
+ *   2 becomes 4 (100 binary), -2 becomes 5 (101 binary)
+ */
+function toVLQSigned(aValue) {
+  return aValue < 0
+    ? ((-aValue) << 1) + 1
+    : (aValue << 1) + 0;
+}
+
+/**
+ * Converts to a two-complement value from a value where the sign bit is
+ * placed in the least significant bit.  For example, as decimals:
+ *   2 (10 binary) becomes 1, 3 (11 binary) becomes -1
+ *   4 (100 binary) becomes 2, 5 (101 binary) becomes -2
+ */
+function fromVLQSigned(aValue) {
+  var isNegative = (aValue & 1) === 1;
+  var shifted = aValue >> 1;
+  return isNegative
+    ? -shifted
+    : shifted;
+}
+
+/**
+ * Returns the base 64 VLQ encoded value.
+ */
+exports.encode = function base64VLQ_encode(aValue) {
+  var encoded = "";
+  var digit;
+
+  var vlq = toVLQSigned(aValue);
+
+  do {
+    digit = vlq & VLQ_BASE_MASK;
+    vlq >>>= VLQ_BASE_SHIFT;
+    if (vlq > 0) {
+      // There are still more digits in this value, so we must make sure the
+      // continuation bit is marked.
+      digit |= VLQ_CONTINUATION_BIT;
+    }
+    encoded += base64.encode(digit);
+  } while (vlq > 0);
+
+  return encoded;
+};
+
+/**
+ * Decodes the next base 64 VLQ value from the given string and returns the
+ * value and the rest of the string via the out parameter.
+ */
+exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {
+  var strLen = aStr.length;
+  var result = 0;
+  var shift = 0;
+  var continuation, digit;
+
+  do {
+    if (aIndex >= strLen) {
+      throw new Error("Expected more digits in base 64 VLQ value.");
+    }
+
+    digit = base64.decode(aStr.charCodeAt(aIndex++));
+    if (digit === -1) {
+      throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1));
+    }
+
+    continuation = !!(digit & VLQ_CONTINUATION_BIT);
+    digit &= VLQ_BASE_MASK;
+    result = result + (digit << shift);
+    shift += VLQ_BASE_SHIFT;
+  } while (continuation);
+
+  aOutParam.value = fromVLQSigned(result);
+  aOutParam.rest = aIndex;
+};

node_modules/karma/node_modules/source-map/lib/base64.js

@@ -0,0 +1,67 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');
+
+/**
+ * Encode an integer in the range of 0 to 63 to a single base 64 digit.
+ */
+exports.encode = function (number) {
+  if (0 <= number && number < intToCharMap.length) {
+    return intToCharMap[number];
+  }
+  throw new TypeError("Must be between 0 and 63: " + number);
+};
+
+/**
+ * Decode a single base 64 character code digit to an integer. Returns -1 on
+ * failure.
+ */
+exports.decode = function (charCode) {
+  var bigA = 65;     // 'A'
+  var bigZ = 90;     // 'Z'
+
+  var littleA = 97;  // 'a'
+  var littleZ = 122; // 'z'
+
+  var zero = 48;     // '0'
+  var nine = 57;     // '9'
+
+  var plus = 43;     // '+'
+  var slash = 47;    // '/'
+
+  var littleOffset = 26;
+  var numberOffset = 52;
+
+  // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ
+  if (bigA <= charCode && charCode <= bigZ) {
+    return (charCode - bigA);
+  }
+
+  // 26 - 51: abcdefghijklmnopqrstuvwxyz
+  if (littleA <= charCode && charCode <= littleZ) {
+    return (charCode - littleA + littleOffset);
+  }
+
+  // 52 - 61: 0123456789
+  if (zero <= charCode && charCode <= nine) {
+    return (charCode - zero + numberOffset);
+  }
+
+  // 62: +
+  if (charCode == plus) {
+    return 62;
+  }
+
+  // 63: /
+  if (charCode == slash) {
+    return 63;
+  }
+
+  // Invalid base64 digit.
+  return -1;
+};

node_modules/karma/node_modules/source-map/lib/binary-search.js

@@ -0,0 +1,111 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+exports.GREATEST_LOWER_BOUND = 1;
+exports.LEAST_UPPER_BOUND = 2;
+
+/**
+ * Recursive implementation of binary search.
+ *
+ * @param aLow Indices here and lower do not contain the needle.
+ * @param aHigh Indices here and higher do not contain the needle.
+ * @param aNeedle The element being searched for.
+ * @param aHaystack The non-empty array being searched.
+ * @param aCompare Function which takes two elements and returns -1, 0, or 1.
+ * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
+ *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
+ *     closest element that is smaller than or greater than the one we are
+ *     searching for, respectively, if the exact element cannot be found.
+ */
+function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {
+  // This function terminates when one of the following is true:
+  //
+  //   1. We find the exact element we are looking for.
+  //
+  //   2. We did not find the exact element, but we can return the index of
+  //      the next-closest element.
+  //
+  //   3. We did not find the exact element, and there is no next-closest
+  //      element than the one we are searching for, so we return -1.
+  var mid = Math.floor((aHigh - aLow) / 2) + aLow;
+  var cmp = aCompare(aNeedle, aHaystack[mid], true);
+  if (cmp === 0) {
+    // Found the element we are looking for.
+    return mid;
+  }
+  else if (cmp > 0) {
+    // Our needle is greater than aHaystack[mid].
+    if (aHigh - mid > 1) {
+      // The element is in the upper half.
+      return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);
+    }
+
+    // The exact needle element was not found in this haystack. Determine if
+    // we are in termination case (3) or (2) and return the appropriate thing.
+    if (aBias == exports.LEAST_UPPER_BOUND) {
+      return aHigh < aHaystack.length ? aHigh : -1;
+    } else {
+      return mid;
+    }
+  }
+  else {
+    // Our needle is less than aHaystack[mid].
+    if (mid - aLow > 1) {
+      // The element is in the lower half.
+      return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);
+    }
+
+    // we are in termination case (3) or (2) and return the appropriate thing.
+    if (aBias == exports.LEAST_UPPER_BOUND) {
+      return mid;
+    } else {
+      return aLow < 0 ? -1 : aLow;
+    }
+  }
+}
+
+/**
+ * This is an implementation of binary search which will always try and return
+ * the index of the closest element if there is no exact hit. This is because
+ * mappings between original and generated line/col pairs are single points,
+ * and there is an implicit region between each of them, so a miss just means
+ * that you aren't on the very start of a region.
+ *
+ * @param aNeedle The element you are looking for.
+ * @param aHaystack The array that is being searched.
+ * @param aCompare A function which takes the needle and an element in the
+ *     array and returns -1, 0, or 1 depending on whether the needle is less
+ *     than, equal to, or greater than the element, respectively.
+ * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
+ *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
+ *     closest element that is smaller than or greater than the one we are
+ *     searching for, respectively, if the exact element cannot be found.
+ *     Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.
+ */
+exports.search = function search(aNeedle, aHaystack, aCompare, aBias) {
+  if (aHaystack.length === 0) {
+    return -1;
+  }
+
+  var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,
+                              aCompare, aBias || exports.GREATEST_LOWER_BOUND);
+  if (index < 0) {
+    return -1;
+  }
+
+  // We have found either the exact element, or the next-closest element than
+  // the one we are searching for. However, there may be more than one such
+  // element. Make sure we always return the smallest of these.
+  while (index - 1 >= 0) {
+    if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {
+      break;
+    }
+    --index;
+  }
+
+  return index;
+};

node_modules/karma/node_modules/source-map/lib/mapping-list.js

@@ -0,0 +1,79 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2014 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var util = require('./util');
+
+/**
+ * Determine whether mappingB is after mappingA with respect to generated
+ * position.
+ */
+function generatedPositionAfter(mappingA, mappingB) {
+  // Optimized for most common case
+  var lineA = mappingA.generatedLine;
+  var lineB = mappingB.generatedLine;
+  var columnA = mappingA.generatedColumn;
+  var columnB = mappingB.generatedColumn;
+  return lineB > lineA || lineB == lineA && columnB >= columnA ||
+         util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;
+}
+
+/**
+ * A data structure to provide a sorted view of accumulated mappings in a
+ * performance conscious manner. It trades a neglibable overhead in general
+ * case for a large speedup in case of mappings being added in order.
+ */
+function MappingList() {
+  this._array = [];
+  this._sorted = true;
+  // Serves as infimum
+  this._last = {generatedLine: -1, generatedColumn: 0};
+}
+
+/**
+ * Iterate through internal items. This method takes the same arguments that
+ * `Array.prototype.forEach` takes.
+ *
+ * NOTE: The order of the mappings is NOT guaranteed.
+ */
+MappingList.prototype.unsortedForEach =
+  function MappingList_forEach(aCallback, aThisArg) {
+    this._array.forEach(aCallback, aThisArg);
+  };
+
+/**
+ * Add the given source mapping.
+ *
+ * @param Object aMapping
+ */
+MappingList.prototype.add = function MappingList_add(aMapping) {
+  if (generatedPositionAfter(this._last, aMapping)) {
+    this._last = aMapping;
+    this._array.push(aMapping);
+  } else {
+    this._sorted = false;
+    this._array.push(aMapping);
+  }
+};
+
+/**
+ * Returns the flat, sorted array of mappings. The mappings are sorted by
+ * generated position.
+ *
+ * WARNING: This method returns internal data without copying, for
+ * performance. The return value must NOT be mutated, and should be treated as
+ * an immutable borrow. If you want to take ownership, you must make your own
+ * copy.
+ */
+MappingList.prototype.toArray = function MappingList_toArray() {
+  if (!this._sorted) {
+    this._array.sort(util.compareByGeneratedPositionsInflated);
+    this._sorted = true;
+  }
+  return this._array;
+};
+
+exports.MappingList = MappingList;

node_modules/karma/node_modules/source-map/lib/quick-sort.js

@@ -0,0 +1,114 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+// It turns out that some (most?) JavaScript engines don't self-host
+// `Array.prototype.sort`. This makes sense because C++ will likely remain
+// faster than JS when doing raw CPU-intensive sorting. However, when using a
+// custom comparator function, calling back and forth between the VM's C++ and
+// JIT'd JS is rather slow *and* loses JIT type information, resulting in
+// worse generated code for the comparator function than would be optimal. In
+// fact, when sorting with a comparator, these costs outweigh the benefits of
+// sorting in C++. By using our own JS-implemented Quick Sort (below), we get
+// a ~3500ms mean speed-up in `bench/bench.html`.
+
+/**
+ * Swap the elements indexed by `x` and `y` in the array `ary`.
+ *
+ * @param {Array} ary
+ *        The array.
+ * @param {Number} x
+ *        The index of the first item.
+ * @param {Number} y
+ *        The index of the second item.
+ */
+function swap(ary, x, y) {
+  var temp = ary[x];
+  ary[x] = ary[y];
+  ary[y] = temp;
+}
+
+/**
+ * Returns a random integer within the range `low .. high` inclusive.
+ *
+ * @param {Number} low
+ *        The lower bound on the range.
+ * @param {Number} high
+ *        The upper bound on the range.
+ */
+function randomIntInRange(low, high) {
+  return Math.round(low + (Math.random() * (high - low)));
+}
+
+/**
+ * The Quick Sort algorithm.
+ *
+ * @param {Array} ary
+ *        An array to sort.
+ * @param {function} comparator
+ *        Function to use to compare two items.
+ * @param {Number} p
+ *        Start index of the array
+ * @param {Number} r
+ *        End index of the array
+ */
+function doQuickSort(ary, comparator, p, r) {
+  // If our lower bound is less than our upper bound, we (1) partition the
+  // array into two pieces and (2) recurse on each half. If it is not, this is
+  // the empty array and our base case.
+
+  if (p < r) {
+    // (1) Partitioning.
+    //
+    // The partitioning chooses a pivot between `p` and `r` and moves all
+    // elements that are less than or equal to the pivot to the before it, and
+    // all the elements that are greater than it after it. The effect is that
+    // once partition is done, the pivot is in the exact place it will be when
+    // the array is put in sorted order, and it will not need to be moved
+    // again. This runs in O(n) time.
+
+    // Always choose a random pivot so that an input array which is reverse
+    // sorted does not cause O(n^2) running time.
+    var pivotIndex = randomIntInRange(p, r);
+    var i = p - 1;
+
+    swap(ary, pivotIndex, r);
+    var pivot = ary[r];
+
+    // Immediately after `j` is incremented in this loop, the following hold
+    // true:
+    //
+    //   * Every element in `ary[p .. i]` is less than or equal to the pivot.
+    //
+    //   * Every element in `ary[i+1 .. j-1]` is greater than the pivot.
+    for (var j = p; j < r; j++) {
+      if (comparator(ary[j], pivot) <= 0) {
+        i += 1;
+        swap(ary, i, j);
+      }
+    }
+
+    swap(ary, i + 1, j);
+    var q = i + 1;
+
+    // (2) Recurse on each half.
+
+    doQuickSort(ary, comparator, p, q - 1);
+    doQuickSort(ary, comparator, q + 1, r);
+  }
+}
+
+/**
+ * Sort the given array in-place with the given comparator function.
+ *
+ * @param {Array} ary
+ *        An array to sort.
+ * @param {function} comparator
+ *        Function to use to compare two items.
+ */
+exports.quickSort = function (ary, comparator) {
+  doQuickSort(ary, comparator, 0, ary.length - 1);
+};

node_modules/karma/node_modules/source-map/lib/source-map-generator.js

@@ -0,0 +1,425 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var base64VLQ = require('./base64-vlq');
+var util = require('./util');
+var ArraySet = require('./array-set').ArraySet;
+var MappingList = require('./mapping-list').MappingList;
+
+/**
+ * An instance of the SourceMapGenerator represents a source map which is
+ * being built incrementally. You may pass an object with the following
+ * properties:
+ *
+ *   - file: The filename of the generated source.
+ *   - sourceRoot: A root for all relative URLs in this source map.
+ */
+function SourceMapGenerator(aArgs) {
+  if (!aArgs) {
+    aArgs = {};
+  }
+  this._file = util.getArg(aArgs, 'file', null);
+  this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);
+  this._skipValidation = util.getArg(aArgs, 'skipValidation', false);
+  this._sources = new ArraySet();
+  this._names = new ArraySet();
+  this._mappings = new MappingList();
+  this._sourcesContents = null;
+}
+
+SourceMapGenerator.prototype._version = 3;
+
+/**
+ * Creates a new SourceMapGenerator based on a SourceMapConsumer
+ *
+ * @param aSourceMapConsumer The SourceMap.
+ */
+SourceMapGenerator.fromSourceMap =
+  function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {
+    var sourceRoot = aSourceMapConsumer.sourceRoot;
+    var generator = new SourceMapGenerator({
+      file: aSourceMapConsumer.file,
+      sourceRoot: sourceRoot
+    });
+    aSourceMapConsumer.eachMapping(function (mapping) {
+      var newMapping = {
+        generated: {
+          line: mapping.generatedLine,
+          column: mapping.generatedColumn
+        }
+      };
+
+      if (mapping.source != null) {
+        newMapping.source = mapping.source;
+        if (sourceRoot != null) {
+          newMapping.source = util.relative(sourceRoot, newMapping.source);
+        }
+
+        newMapping.original = {
+          line: mapping.originalLine,
+          column: mapping.originalColumn
+        };
+
+        if (mapping.name != null) {
+          newMapping.name = mapping.name;
+        }
+      }
+
+      generator.addMapping(newMapping);
+    });
+    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+      var sourceRelative = sourceFile;
+      if (sourceRoot !== null) {
+        sourceRelative = util.relative(sourceRoot, sourceFile);
+      }
+
+      if (!generator._sources.has(sourceRelative)) {
+        generator._sources.add(sourceRelative);
+      }
+
+      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+      if (content != null) {
+        generator.setSourceContent(sourceFile, content);
+      }
+    });
+    return generator;
+  };
+
+/**
+ * Add a single mapping from original source line and column to the generated
+ * source's line and column for this source map being created. The mapping
+ * object should have the following properties:
+ *
+ *   - generated: An object with the generated line and column positions.
+ *   - original: An object with the original line and column positions.
+ *   - source: The original source file (relative to the sourceRoot).
+ *   - name: An optional original token name for this mapping.
+ */
+SourceMapGenerator.prototype.addMapping =
+  function SourceMapGenerator_addMapping(aArgs) {
+    var generated = util.getArg(aArgs, 'generated');
+    var original = util.getArg(aArgs, 'original', null);
+    var source = util.getArg(aArgs, 'source', null);
+    var name = util.getArg(aArgs, 'name', null);
+
+    if (!this._skipValidation) {
+      this._validateMapping(generated, original, source, name);
+    }
+
+    if (source != null) {
+      source = String(source);
+      if (!this._sources.has(source)) {
+        this._sources.add(source);
+      }
+    }
+
+    if (name != null) {
+      name = String(name);
+      if (!this._names.has(name)) {
+        this._names.add(name);
+      }
+    }
+
+    this._mappings.add({
+      generatedLine: generated.line,
+      generatedColumn: generated.column,
+      originalLine: original != null && original.line,
+      originalColumn: original != null && original.column,
+      source: source,
+      name: name
+    });
+  };
+
+/**
+ * Set the source content for a source file.
+ */
+SourceMapGenerator.prototype.setSourceContent =
+  function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {
+    var source = aSourceFile;
+    if (this._sourceRoot != null) {
+      source = util.relative(this._sourceRoot, source);
+    }
+
+    if (aSourceContent != null) {
+      // Add the source content to the _sourcesContents map.
+      // Create a new _sourcesContents map if the property is null.
+      if (!this._sourcesContents) {
+        this._sourcesContents = Object.create(null);
+      }
+      this._sourcesContents[util.toSetString(source)] = aSourceContent;
+    } else if (this._sourcesContents) {
+      // Remove the source file from the _sourcesContents map.
+      // If the _sourcesContents map is empty, set the property to null.
+      delete this._sourcesContents[util.toSetString(source)];
+      if (Object.keys(this._sourcesContents).length === 0) {
+        this._sourcesContents = null;
+      }
+    }
+  };
+
+/**
+ * Applies the mappings of a sub-source-map for a specific source file to the
+ * source map being generated. Each mapping to the supplied source file is
+ * rewritten using the supplied source map. Note: The resolution for the
+ * resulting mappings is the minimium of this map and the supplied map.
+ *
+ * @param aSourceMapConsumer The source map to be applied.
+ * @param aSourceFile Optional. The filename of the source file.
+ *        If omitted, SourceMapConsumer's file property will be used.
+ * @param aSourceMapPath Optional. The dirname of the path to the source map
+ *        to be applied. If relative, it is relative to the SourceMapConsumer.
+ *        This parameter is needed when the two source maps aren't in the same
+ *        directory, and the source map to be applied contains relative source
+ *        paths. If so, those relative source paths need to be rewritten
+ *        relative to the SourceMapGenerator.
+ */
+SourceMapGenerator.prototype.applySourceMap =
+  function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {
+    var sourceFile = aSourceFile;
+    // If aSourceFile is omitted, we will use the file property of the SourceMap
+    if (aSourceFile == null) {
+      if (aSourceMapConsumer.file == null) {
+        throw new Error(
+          'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +
+          'or the source map\'s "file" property. Both were omitted.'
+        );
+      }
+      sourceFile = aSourceMapConsumer.file;
+    }
+    var sourceRoot = this._sourceRoot;
+    // Make "sourceFile" relative if an absolute Url is passed.
+    if (sourceRoot != null) {
+      sourceFile = util.relative(sourceRoot, sourceFile);
+    }
+    // Applying the SourceMap can add and remove items from the sources and
+    // the names array.
+    var newSources = new ArraySet();
+    var newNames = new ArraySet();
+
+    // Find mappings for the "sourceFile"
+    this._mappings.unsortedForEach(function (mapping) {
+      if (mapping.source === sourceFile && mapping.originalLine != null) {
+        // Check if it can be mapped by the source map, then update the mapping.
+        var original = aSourceMapConsumer.originalPositionFor({
+          line: mapping.originalLine,
+          column: mapping.originalColumn
+        });
+        if (original.source != null) {
+          // Copy mapping
+          mapping.source = original.source;
+          if (aSourceMapPath != null) {
+            mapping.source = util.join(aSourceMapPath, mapping.source)
+          }
+          if (sourceRoot != null) {
+            mapping.source = util.relative(sourceRoot, mapping.source);
+          }
+          mapping.originalLine = original.line;
+          mapping.originalColumn = original.column;
+          if (original.name != null) {
+            mapping.name = original.name;
+          }
+        }
+      }
+
+      var source = mapping.source;
+      if (source != null && !newSources.has(source)) {
+        newSources.add(source);
+      }
+
+      var name = mapping.name;
+      if (name != null && !newNames.has(name)) {
+        newNames.add(name);
+      }
+
+    }, this);
+    this._sources = newSources;
+    this._names = newNames;
+
+    // Copy sourcesContents of applied map.
+    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+      if (content != null) {
+        if (aSourceMapPath != null) {
+          sourceFile = util.join(aSourceMapPath, sourceFile);
+        }
+        if (sourceRoot != null) {
+          sourceFile = util.relative(sourceRoot, sourceFile);
+        }
+        this.setSourceContent(sourceFile, content);
+      }
+    }, this);
+  };
+
+/**
+ * A mapping can have one of the three levels of data:
+ *
+ *   1. Just the generated position.
+ *   2. The Generated position, original position, and original source.
+ *   3. Generated and original position, original source, as well as a name
+ *      token.
+ *
+ * To maintain consistency, we validate that any new mapping being added falls
+ * in to one of these categories.
+ */
+SourceMapGenerator.prototype._validateMapping =
+  function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,
+                                              aName) {
+    // When aOriginal is truthy but has empty values for .line and .column,
+    // it is most likely a programmer error. In this case we throw a very
+    // specific error message to try to guide them the right way.
+    // For example: https://github.com/Polymer/polymer-bundler/pull/519
+    if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {
+        throw new Error(
+            'original.line and original.column are not numbers -- you probably meant to omit ' +
+            'the original mapping entirely and only map the generated position. If so, pass ' +
+            'null for the original mapping instead of an object with empty or null values.'
+        );
+    }
+
+    if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+        && aGenerated.line > 0 && aGenerated.column >= 0
+        && !aOriginal && !aSource && !aName) {
+      // Case 1.
+      return;
+    }
+    else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+             && aOriginal && 'line' in aOriginal && 'column' in aOriginal
+             && aGenerated.line > 0 && aGenerated.column >= 0
+             && aOriginal.line > 0 && aOriginal.column >= 0
+             && aSource) {
+      // Cases 2 and 3.
+      return;
+    }
+    else {
+      throw new Error('Invalid mapping: ' + JSON.stringify({
+        generated: aGenerated,
+        source: aSource,
+        original: aOriginal,
+        name: aName
+      }));
+    }
+  };
+
+/**
+ * Serialize the accumulated mappings in to the stream of base 64 VLQs
+ * specified by the source map format.
+ */
+SourceMapGenerator.prototype._serializeMappings =
+  function SourceMapGenerator_serializeMappings() {
+    var previousGeneratedColumn = 0;
+    var previousGeneratedLine = 1;
+    var previousOriginalColumn = 0;
+    var previousOriginalLine = 0;
+    var previousName = 0;
+    var previousSource = 0;
+    var result = '';
+    var next;
+    var mapping;
+    var nameIdx;
+    var sourceIdx;
+
+    var mappings = this._mappings.toArray();
+    for (var i = 0, len = mappings.length; i < len; i++) {
+      mapping = mappings[i];
+      next = ''
+
+      if (mapping.generatedLine !== previousGeneratedLine) {
+        previousGeneratedColumn = 0;
+        while (mapping.generatedLine !== previousGeneratedLine) {
+          next += ';';
+          previousGeneratedLine++;
+        }
+      }
+      else {
+        if (i > 0) {
+          if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {
+            continue;
+          }
+          next += ',';
+        }
+      }
+
+      next += base64VLQ.encode(mapping.generatedColumn
+                                 - previousGeneratedColumn);
+      previousGeneratedColumn = mapping.generatedColumn;
+
+      if (mapping.source != null) {
+        sourceIdx = this._sources.indexOf(mapping.source);
+        next += base64VLQ.encode(sourceIdx - previousSource);
+        previousSource = sourceIdx;
+
+        // lines are stored 0-based in SourceMap spec version 3
+        next += base64VLQ.encode(mapping.originalLine - 1
+                                   - previousOriginalLine);
+        previousOriginalLine = mapping.originalLine - 1;
+
+        next += base64VLQ.encode(mapping.originalColumn
+                                   - previousOriginalColumn);
+        previousOriginalColumn = mapping.originalColumn;
+
+        if (mapping.name != null) {
+          nameIdx = this._names.indexOf(mapping.name);
+          next += base64VLQ.encode(nameIdx - previousName);
+          previousName = nameIdx;
+        }
+      }
+
+      result += next;
+    }
+
+    return result;
+  };
+
+SourceMapGenerator.prototype._generateSourcesContent =
+  function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {
+    return aSources.map(function (source) {
+      if (!this._sourcesContents) {
+        return null;
+      }
+      if (aSourceRoot != null) {
+        source = util.relative(aSourceRoot, source);
+      }
+      var key = util.toSetString(source);
+      return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)
+        ? this._sourcesContents[key]
+        : null;
+    }, this);
+  };
+
+/**
+ * Externalize the source map.
+ */
+SourceMapGenerator.prototype.toJSON =
+  function SourceMapGenerator_toJSON() {
+    var map = {
+      version: this._version,
+      sources: this._sources.toArray(),
+      names: this._names.toArray(),
+      mappings: this._serializeMappings()
+    };
+    if (this._file != null) {
+      map.file = this._file;
+    }
+    if (this._sourceRoot != null) {
+      map.sourceRoot = this._sourceRoot;
+    }
+    if (this._sourcesContents) {
+      map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);
+    }
+
+    return map;
+  };
+
+/**
+ * Render the source map being generated to a string.
+ */
+SourceMapGenerator.prototype.toString =
+  function SourceMapGenerator_toString() {
+    return JSON.stringify(this.toJSON());
+  };
+
+exports.SourceMapGenerator = SourceMapGenerator;

node_modules/karma/node_modules/source-map/lib/source-node.js

@@ -0,0 +1,413 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var SourceMapGenerator = require('./source-map-generator').SourceMapGenerator;
+var util = require('./util');
+
+// Matches a Windows-style `\r\n` newline or a `\n` newline used by all other
+// operating systems these days (capturing the result).
+var REGEX_NEWLINE = /(\r?\n)/;
+
+// Newline character code for charCodeAt() comparisons
+var NEWLINE_CODE = 10;
+
+// Private symbol for identifying `SourceNode`s when multiple versions of
+// the source-map library are loaded. This MUST NOT CHANGE across
+// versions!
+var isSourceNode = "$$$isSourceNode$$$";
+
+/**
+ * SourceNodes provide a way to abstract over interpolating/concatenating
+ * snippets of generated JavaScript source code while maintaining the line and
+ * column information associated with the original source code.
+ *
+ * @param aLine The original line number.
+ * @param aColumn The original column number.
+ * @param aSource The original source's filename.
+ * @param aChunks Optional. An array of strings which are snippets of
+ *        generated JS, or other SourceNodes.
+ * @param aName The original identifier.
+ */
+function SourceNode(aLine, aColumn, aSource, aChunks, aName) {
+  this.children = [];
+  this.sourceContents = {};
+  this.line = aLine == null ? null : aLine;
+  this.column = aColumn == null ? null : aColumn;
+  this.source = aSource == null ? null : aSource;
+  this.name = aName == null ? null : aName;
+  this[isSourceNode] = true;
+  if (aChunks != null) this.add(aChunks);
+}
+
+/**
+ * Creates a SourceNode from generated code and a SourceMapConsumer.
+ *
+ * @param aGeneratedCode The generated code
+ * @param aSourceMapConsumer The SourceMap for the generated code
+ * @param aRelativePath Optional. The path that relative sources in the
+ *        SourceMapConsumer should be relative to.
+ */
+SourceNode.fromStringWithSourceMap =
+  function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {
+    // The SourceNode we want to fill with the generated code
+    // and the SourceMap
+    var node = new SourceNode();
+
+    // All even indices of this array are one line of the generated code,
+    // while all odd indices are the newlines between two adjacent lines
+    // (since `REGEX_NEWLINE` captures its match).
+    // Processed fragments are accessed by calling `shiftNextLine`.
+    var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);
+    var remainingLinesIndex = 0;
+    var shiftNextLine = function() {
+      var lineContents = getNextLine();
+      // The last line of a file might not have a newline.
+      var newLine = getNextLine() || "";
+      return lineContents + newLine;
+
+      function getNextLine() {
+        return remainingLinesIndex < remainingLines.length ?
+            remainingLines[remainingLinesIndex++] : undefined;
+      }
+    };
+
+    // We need to remember the position of "remainingLines"
+    var lastGeneratedLine = 1, lastGeneratedColumn = 0;
+
+    // The generate SourceNodes we need a code range.
+    // To extract it current and last mapping is used.
+    // Here we store the last mapping.
+    var lastMapping = null;
+
+    aSourceMapConsumer.eachMapping(function (mapping) {
+      if (lastMapping !== null) {
+        // We add the code from "lastMapping" to "mapping":
+        // First check if there is a new line in between.
+        if (lastGeneratedLine < mapping.generatedLine) {
+          // Associate first line with "lastMapping"
+          addMappingWithCode(lastMapping, shiftNextLine());
+          lastGeneratedLine++;
+          lastGeneratedColumn = 0;
+          // The remaining code is added without mapping
+        } else {
+          // There is no new line in between.
+          // Associate the code between "lastGeneratedColumn" and
+          // "mapping.generatedColumn" with "lastMapping"
+          var nextLine = remainingLines[remainingLinesIndex] || '';
+          var code = nextLine.substr(0, mapping.generatedColumn -
+                                        lastGeneratedColumn);
+          remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -
+                                              lastGeneratedColumn);
+          lastGeneratedColumn = mapping.generatedColumn;
+          addMappingWithCode(lastMapping, code);
+          // No more remaining code, continue
+          lastMapping = mapping;
+          return;
+        }
+      }
+      // We add the generated code until the first mapping
+      // to the SourceNode without any mapping.
+      // Each line is added as separate string.
+      while (lastGeneratedLine < mapping.generatedLine) {
+        node.add(shiftNextLine());
+        lastGeneratedLine++;
+      }
+      if (lastGeneratedColumn < mapping.generatedColumn) {
+        var nextLine = remainingLines[remainingLinesIndex] || '';
+        node.add(nextLine.substr(0, mapping.generatedColumn));
+        remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);
+        lastGeneratedColumn = mapping.generatedColumn;
+      }
+      lastMapping = mapping;
+    }, this);
+    // We have processed all mappings.
+    if (remainingLinesIndex < remainingLines.length) {
+      if (lastMapping) {
+        // Associate the remaining code in the current line with "lastMapping"
+        addMappingWithCode(lastMapping, shiftNextLine());
+      }
+      // and add the remaining lines without any mapping
+      node.add(remainingLines.splice(remainingLinesIndex).join(""));
+    }
+
+    // Copy sourcesContent into SourceNode
+    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+      if (content != null) {
+        if (aRelativePath != null) {
+          sourceFile = util.join(aRelativePath, sourceFile);
+        }
+        node.setSourceContent(sourceFile, content);
+      }
+    });
+
+    return node;
+
+    function addMappingWithCode(mapping, code) {
+      if (mapping === null || mapping.source === undefined) {
+        node.add(code);
+      } else {
+        var source = aRelativePath
+          ? util.join(aRelativePath, mapping.source)
+          : mapping.source;
+        node.add(new SourceNode(mapping.originalLine,
+                                mapping.originalColumn,
+                                source,
+                                code,
+                                mapping.name));
+      }
+    }
+  };
+
+/**
+ * Add a chunk of generated JS to this source node.
+ *
+ * @param aChunk A string snippet of generated JS code, another instance of
+ *        SourceNode, or an array where each member is one of those things.
+ */
+SourceNode.prototype.add = function SourceNode_add(aChunk) {
+  if (Array.isArray(aChunk)) {
+    aChunk.forEach(function (chunk) {
+      this.add(chunk);
+    }, this);
+  }
+  else if (aChunk[isSourceNode] || typeof aChunk === "string") {
+    if (aChunk) {
+      this.children.push(aChunk);
+    }
+  }
+  else {
+    throw new TypeError(
+      "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+    );
+  }
+  return this;
+};
+
+/**
+ * Add a chunk of generated JS to the beginning of this source node.
+ *
+ * @param aChunk A string snippet of generated JS code, another instance of
+ *        SourceNode, or an array where each member is one of those things.
+ */
+SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {
+  if (Array.isArray(aChunk)) {
+    for (var i = aChunk.length-1; i >= 0; i--) {
+      this.prepend(aChunk[i]);
+    }
+  }
+  else if (aChunk[isSourceNode] || typeof aChunk === "string") {
+    this.children.unshift(aChunk);
+  }
+  else {
+    throw new TypeError(
+      "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+    );
+  }
+  return this;
+};
+
+/**
+ * Walk over the tree of JS snippets in this node and its children. The
+ * walking function is called once for each snippet of JS and is passed that
+ * snippet and the its original associated source's line/column location.
+ *
+ * @param aFn The traversal function.
+ */
+SourceNode.prototype.walk = function SourceNode_walk(aFn) {
+  var chunk;
+  for (var i = 0, len = this.children.length; i < len; i++) {
+    chunk = this.children[i];
+    if (chunk[isSourceNode]) {
+      chunk.walk(aFn);
+    }
+    else {
+      if (chunk !== '') {
+        aFn(chunk, { source: this.source,
+                     line: this.line,
+                     column: this.column,
+                     name: this.name });
+      }
+    }
+  }
+};
+
+/**
+ * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between
+ * each of `this.children`.
+ *
+ * @param aSep The separator.
+ */
+SourceNode.prototype.join = function SourceNode_join(aSep) {
+  var newChildren;
+  var i;
+  var len = this.children.length;
+  if (len > 0) {
+    newChildren = [];
+    for (i = 0; i < len-1; i++) {
+      newChildren.push(this.children[i]);
+      newChildren.push(aSep);
+    }
+    newChildren.push(this.children[i]);
+    this.children = newChildren;
+  }
+  return this;
+};
+
+/**
+ * Call String.prototype.replace on the very right-most source snippet. Useful
+ * for trimming whitespace from the end of a source node, etc.
+ *
+ * @param aPattern The pattern to replace.
+ * @param aReplacement The thing to replace the pattern with.
+ */
+SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {
+  var lastChild = this.children[this.children.length - 1];
+  if (lastChild[isSourceNode]) {
+    lastChild.replaceRight(aPattern, aReplacement);
+  }
+  else if (typeof lastChild === 'string') {
+    this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);
+  }
+  else {
+    this.children.push(''.replace(aPattern, aReplacement));
+  }
+  return this;
+};
+
+/**
+ * Set the source content for a source file. This will be added to the SourceMapGenerator
+ * in the sourcesContent field.
+ *
+ * @param aSourceFile The filename of the source file
+ * @param aSourceContent The content of the source file
+ */
+SourceNode.prototype.setSourceContent =
+  function SourceNode_setSourceContent(aSourceFile, aSourceContent) {
+    this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;
+  };
+
+/**
+ * Walk over the tree of SourceNodes. The walking function is called for each
+ * source file content and is passed the filename and source content.
+ *
+ * @param aFn The traversal function.
+ */
+SourceNode.prototype.walkSourceContents =
+  function SourceNode_walkSourceContents(aFn) {
+    for (var i = 0, len = this.children.length; i < len; i++) {
+      if (this.children[i][isSourceNode]) {
+        this.children[i].walkSourceContents(aFn);
+      }
+    }
+
+    var sources = Object.keys(this.sourceContents);
+    for (var i = 0, len = sources.length; i < len; i++) {
+      aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);
+    }
+  };
+
+/**
+ * Return the string representation of this source node. Walks over the tree
+ * and concatenates all the various snippets together to one string.
+ */
+SourceNode.prototype.toString = function SourceNode_toString() {
+  var str = "";
+  this.walk(function (chunk) {
+    str += chunk;
+  });
+  return str;
+};
+
+/**
+ * Returns the string representation of this source node along with a source
+ * map.
+ */
+SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {
+  var generated = {
+    code: "",
+    line: 1,
+    column: 0
+  };
+  var map = new SourceMapGenerator(aArgs);
+  var sourceMappingActive = false;
+  var lastOriginalSource = null;
+  var lastOriginalLine = null;
+  var lastOriginalColumn = null;
+  var lastOriginalName = null;
+  this.walk(function (chunk, original) {
+    generated.code += chunk;
+    if (original.source !== null
+        && original.line !== null
+        && original.column !== null) {
+      if(lastOriginalSource !== original.source
+         || lastOriginalLine !== original.line
+         || lastOriginalColumn !== original.column
+         || lastOriginalName !== original.name) {
+        map.addMapping({
+          source: original.source,
+          original: {
+            line: original.line,
+            column: original.column
+          },
+          generated: {
+            line: generated.line,
+            column: generated.column
+          },
+          name: original.name
+        });
+      }
+      lastOriginalSource = original.source;
+      lastOriginalLine = original.line;
+      lastOriginalColumn = original.column;
+      lastOriginalName = original.name;
+      sourceMappingActive = true;
+    } else if (sourceMappingActive) {
+      map.addMapping({
+        generated: {
+          line: generated.line,
+          column: generated.column
+        }
+      });
+      lastOriginalSource = null;
+      sourceMappingActive = false;
+    }
+    for (var idx = 0, length = chunk.length; idx < length; idx++) {
+      if (chunk.charCodeAt(idx) === NEWLINE_CODE) {
+        generated.line++;
+        generated.column = 0;
+        // Mappings end at eol
+        if (idx + 1 === length) {
+          lastOriginalSource = null;
+          sourceMappingActive = false;
+        } else if (sourceMappingActive) {
+          map.addMapping({
+            source: original.source,
+            original: {
+              line: original.line,
+              column: original.column
+            },
+            generated: {
+              line: generated.line,
+              column: generated.column
+            },
+            name: original.name
+          });
+        }
+      } else {
+        generated.column++;
+      }
+    }
+  });
+  this.walkSourceContents(function (sourceFile, sourceContent) {
+    map.setSourceContent(sourceFile, sourceContent);
+  });
+
+  return { code: generated.code, map: map };
+};
+
+exports.SourceNode = SourceNode;

node_modules/karma/node_modules/source-map/lib/util.js

@@ -0,0 +1,488 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+/**
+ * This is a helper function for getting values from parameter/options
+ * objects.
+ *
+ * @param args The object we are extracting values from
+ * @param name The name of the property we are getting.
+ * @param defaultValue An optional value to return if the property is missing
+ * from the object. If this is not specified and the property is missing, an
+ * error will be thrown.
+ */
+function getArg(aArgs, aName, aDefaultValue) {
+  if (aName in aArgs) {
+    return aArgs[aName];
+  } else if (arguments.length === 3) {
+    return aDefaultValue;
+  } else {
+    throw new Error('"' + aName + '" is a required argument.');
+  }
+}
+exports.getArg = getArg;
+
+var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/;
+var dataUrlRegexp = /^data:.+\,.+$/;
+
+function urlParse(aUrl) {
+  var match = aUrl.match(urlRegexp);
+  if (!match) {
+    return null;
+  }
+  return {
+    scheme: match[1],
+    auth: match[2],
+    host: match[3],
+    port: match[4],
+    path: match[5]
+  };
+}
+exports.urlParse = urlParse;
+
+function urlGenerate(aParsedUrl) {
+  var url = '';
+  if (aParsedUrl.scheme) {
+    url += aParsedUrl.scheme + ':';
+  }
+  url += '//';
+  if (aParsedUrl.auth) {
+    url += aParsedUrl.auth + '@';
+  }
+  if (aParsedUrl.host) {
+    url += aParsedUrl.host;
+  }
+  if (aParsedUrl.port) {
+    url += ":" + aParsedUrl.port
+  }
+  if (aParsedUrl.path) {
+    url += aParsedUrl.path;
+  }
+  return url;
+}
+exports.urlGenerate = urlGenerate;
+
+/**
+ * Normalizes a path, or the path portion of a URL:
+ *
+ * - Replaces consecutive slashes with one slash.
+ * - Removes unnecessary '.' parts.
+ * - Removes unnecessary '<dir>/..' parts.
+ *
+ * Based on code in the Node.js 'path' core module.
+ *
+ * @param aPath The path or url to normalize.
+ */
+function normalize(aPath) {
+  var path = aPath;
+  var url = urlParse(aPath);
+  if (url) {
+    if (!url.path) {
+      return aPath;
+    }
+    path = url.path;
+  }
+  var isAbsolute = exports.isAbsolute(path);
+
+  var parts = path.split(/\/+/);
+  for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {
+    part = parts[i];
+    if (part === '.') {
+      parts.splice(i, 1);
+    } else if (part === '..') {
+      up++;
+    } else if (up > 0) {
+      if (part === '') {
+        // The first part is blank if the path is absolute. Trying to go
+        // above the root is a no-op. Therefore we can remove all '..' parts
+        // directly after the root.
+        parts.splice(i + 1, up);
+        up = 0;
+      } else {
+        parts.splice(i, 2);
+        up--;
+      }
+    }
+  }
+  path = parts.join('/');
+
+  if (path === '') {
+    path = isAbsolute ? '/' : '.';
+  }
+
+  if (url) {
+    url.path = path;
+    return urlGenerate(url);
+  }
+  return path;
+}
+exports.normalize = normalize;
+
+/**
+ * Joins two paths/URLs.
+ *
+ * @param aRoot The root path or URL.
+ * @param aPath The path or URL to be joined with the root.
+ *
+ * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a
+ *   scheme-relative URL: Then the scheme of aRoot, if any, is prepended
+ *   first.
+ * - Otherwise aPath is a path. If aRoot is a URL, then its path portion
+ *   is updated with the result and aRoot is returned. Otherwise the result
+ *   is returned.
+ *   - If aPath is absolute, the result is aPath.
+ *   - Otherwise the two paths are joined with a slash.
+ * - Joining for example 'http://' and 'www.example.com' is also supported.
+ */
+function join(aRoot, aPath) {
+  if (aRoot === "") {
+    aRoot = ".";
+  }
+  if (aPath === "") {
+    aPath = ".";
+  }
+  var aPathUrl = urlParse(aPath);
+  var aRootUrl = urlParse(aRoot);
+  if (aRootUrl) {
+    aRoot = aRootUrl.path || '/';
+  }
+
+  // `join(foo, '//www.example.org')`
+  if (aPathUrl && !aPathUrl.scheme) {
+    if (aRootUrl) {
+      aPathUrl.scheme = aRootUrl.scheme;
+    }
+    return urlGenerate(aPathUrl);
+  }
+
+  if (aPathUrl || aPath.match(dataUrlRegexp)) {
+    return aPath;
+  }
+
+  // `join('http://', 'www.example.com')`
+  if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {
+    aRootUrl.host = aPath;
+    return urlGenerate(aRootUrl);
+  }
+
+  var joined = aPath.charAt(0) === '/'
+    ? aPath
+    : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath);
+
+  if (aRootUrl) {
+    aRootUrl.path = joined;
+    return urlGenerate(aRootUrl);
+  }
+  return joined;
+}
+exports.join = join;
+
+exports.isAbsolute = function (aPath) {
+  return aPath.charAt(0) === '/' || urlRegexp.test(aPath);
+};
+
+/**
+ * Make a path relative to a URL or another path.
+ *
+ * @param aRoot The root path or URL.
+ * @param aPath The path or URL to be made relative to aRoot.
+ */
+function relative(aRoot, aPath) {
+  if (aRoot === "") {
+    aRoot = ".";
+  }
+
+  aRoot = aRoot.replace(/\/$/, '');
+
+  // It is possible for the path to be above the root. In this case, simply
+  // checking whether the root is a prefix of the path won't work. Instead, we
+  // need to remove components from the root one by one, until either we find
+  // a prefix that fits, or we run out of components to remove.
+  var level = 0;
+  while (aPath.indexOf(aRoot + '/') !== 0) {
+    var index = aRoot.lastIndexOf("/");
+    if (index < 0) {
+      return aPath;
+    }
+
+    // If the only part of the root that is left is the scheme (i.e. http://,
+    // file:///, etc.), one or more slashes (/), or simply nothing at all, we
+    // have exhausted all components, so the path is not relative to the root.
+    aRoot = aRoot.slice(0, index);
+    if (aRoot.match(/^([^\/]+:\/)?\/*$/)) {
+      return aPath;
+    }
+
+    ++level;
+  }
+
+  // Make sure we add a "../" for each component we removed from the root.
+  return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1);
+}
+exports.relative = relative;
+
+var supportsNullProto = (function () {
+  var obj = Object.create(null);
+  return !('__proto__' in obj);
+}());
+
+function identity (s) {
+  return s;
+}
+
+/**
+ * Because behavior goes wacky when you set `__proto__` on objects, we
+ * have to prefix all the strings in our set with an arbitrary character.
+ *
+ * See https://github.com/mozilla/source-map/pull/31 and
+ * https://github.com/mozilla/source-map/issues/30
+ *
+ * @param String aStr
+ */
+function toSetString(aStr) {
+  if (isProtoString(aStr)) {
+    return '$' + aStr;
+  }
+
+  return aStr;
+}
+exports.toSetString = supportsNullProto ? identity : toSetString;
+
+function fromSetString(aStr) {
+  if (isProtoString(aStr)) {
+    return aStr.slice(1);
+  }
+
+  return aStr;
+}
+exports.fromSetString = supportsNullProto ? identity : fromSetString;
+
+function isProtoString(s) {
+  if (!s) {
+    return false;
+  }
+
+  var length = s.length;
+
+  if (length < 9 /* "__proto__".length */) {
+    return false;
+  }
+
+  if (s.charCodeAt(length - 1) !== 95  /* '_' */ ||
+      s.charCodeAt(length - 2) !== 95  /* '_' */ ||
+      s.charCodeAt(length - 3) !== 111 /* 'o' */ ||
+      s.charCodeAt(length - 4) !== 116 /* 't' */ ||
+      s.charCodeAt(length - 5) !== 111 /* 'o' */ ||
+      s.charCodeAt(length - 6) !== 114 /* 'r' */ ||
+      s.charCodeAt(length - 7) !== 112 /* 'p' */ ||
+      s.charCodeAt(length - 8) !== 95  /* '_' */ ||
+      s.charCodeAt(length - 9) !== 95  /* '_' */) {
+    return false;
+  }
+
+  for (var i = length - 10; i >= 0; i--) {
+    if (s.charCodeAt(i) !== 36 /* '$' */) {
+      return false;
+    }
+  }
+
+  return true;
+}
+
+/**
+ * Comparator between two mappings where the original positions are compared.
+ *
+ * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+ * mappings with the same original source/line/column, but different generated
+ * line and column the same. Useful when searching for a mapping with a
+ * stubbed out mapping.
+ */
+function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {
+  var cmp = strcmp(mappingA.source, mappingB.source);
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalLine - mappingB.originalLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalColumn - mappingB.originalColumn;
+  if (cmp !== 0 || onlyCompareOriginal) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedLine - mappingB.generatedLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  return strcmp(mappingA.name, mappingB.name);
+}
+exports.compareByOriginalPositions = compareByOriginalPositions;
+
+/**
+ * Comparator between two mappings with deflated source and name indices where
+ * the generated positions are compared.
+ *
+ * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+ * mappings with the same generated line and column, but different
+ * source/name/original line and column the same. Useful when searching for a
+ * mapping with a stubbed out mapping.
+ */
+function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {
+  var cmp = mappingA.generatedLine - mappingB.generatedLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+  if (cmp !== 0 || onlyCompareGenerated) {
+    return cmp;
+  }
+
+  cmp = strcmp(mappingA.source, mappingB.source);
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalLine - mappingB.originalLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalColumn - mappingB.originalColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  return strcmp(mappingA.name, mappingB.name);
+}
+exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;
+
+function strcmp(aStr1, aStr2) {
+  if (aStr1 === aStr2) {
+    return 0;
+  }
+
+  if (aStr1 === null) {
+    return 1; // aStr2 !== null
+  }
+
+  if (aStr2 === null) {
+    return -1; // aStr1 !== null
+  }
+
+  if (aStr1 > aStr2) {
+    return 1;
+  }
+
+  return -1;
+}
+
+/**
+ * Comparator between two mappings with inflated source and name strings where
+ * the generated positions are compared.
+ */
+function compareByGeneratedPositionsInflated(mappingA, mappingB) {
+  var cmp = mappingA.generatedLine - mappingB.generatedLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = strcmp(mappingA.source, mappingB.source);
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalLine - mappingB.originalLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalColumn - mappingB.originalColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  return strcmp(mappingA.name, mappingB.name);
+}
+exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;
+
+/**
+ * Strip any JSON XSSI avoidance prefix from the string (as documented
+ * in the source maps specification), and then parse the string as
+ * JSON.
+ */
+function parseSourceMapInput(str) {
+  return JSON.parse(str.replace(/^\)]}'[^\n]*\n/, ''));
+}
+exports.parseSourceMapInput = parseSourceMapInput;
+
+/**
+ * Compute the URL of a source given the the source root, the source's
+ * URL, and the source map's URL.
+ */
+function computeSourceURL(sourceRoot, sourceURL, sourceMapURL) {
+  sourceURL = sourceURL || '';
+
+  if (sourceRoot) {
+    // This follows what Chrome does.
+    if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') {
+      sourceRoot += '/';
+    }
+    // The spec says:
+    //   Line 4: An optional source root, useful for relocating source
+    //   files on a server or removing repeated values in the
+    //   “sources” entry.  This value is prepended to the individual
+    //   entries in the “source” field.
+    sourceURL = sourceRoot + sourceURL;
+  }
+
+  // Historically, SourceMapConsumer did not take the sourceMapURL as
+  // a parameter.  This mode is still somewhat supported, which is why
+  // this code block is conditional.  However, it's preferable to pass
+  // the source map URL to SourceMapConsumer, so that this function
+  // can implement the source URL resolution algorithm as outlined in
+  // the spec.  This block is basically the equivalent of:
+  //    new URL(sourceURL, sourceMapURL).toString()
+  // ... except it avoids using URL, which wasn't available in the
+  // older releases of node still supported by this library.
+  //
+  // The spec says:
+  //   If the sources are not absolute URLs after prepending of the
+  //   “sourceRoot”, the sources are resolved relative to the
+  //   SourceMap (like resolving script src in a html document).
+  if (sourceMapURL) {
+    var parsed = urlParse(sourceMapURL);
+    if (!parsed) {
+      throw new Error("sourceMapURL could not be parsed");
+    }
+    if (parsed.path) {
+      // Strip the last path component, but keep the "/".
+      var index = parsed.path.lastIndexOf('/');
+      if (index >= 0) {
+        parsed.path = parsed.path.substring(0, index + 1);
+      }
+    }
+    sourceURL = join(urlGenerate(parsed), sourceURL);
+  }
+
+  return normalize(sourceURL);
+}
+exports.computeSourceURL = computeSourceURL;

node_modules/karma/node_modules/source-map/package.json

@@ -0,0 +1,73 @@
+{
+  "name": "source-map",
+  "description": "Generates and consumes source maps",
+  "version": "0.6.1",
+  "homepage": "https://github.com/mozilla/source-map",
+  "author": "Nick Fitzgerald <nfitzgerald@mozilla.com>",
+  "contributors": [
+    "Tobias Koppers <tobias.koppers@googlemail.com>",
+    "Duncan Beevers <duncan@dweebd.com>",
+    "Stephen Crane <scrane@mozilla.com>",
+    "Ryan Seddon <seddon.ryan@gmail.com>",
+    "Miles Elam <miles.elam@deem.com>",
+    "Mihai Bazon <mihai.bazon@gmail.com>",
+    "Michael Ficarra <github.public.email@michael.ficarra.me>",
+    "Todd Wolfson <todd@twolfson.com>",
+    "Alexander Solovyov <alexander@solovyov.net>",
+    "Felix Gnass <fgnass@gmail.com>",
+    "Conrad Irwin <conrad.irwin@gmail.com>",
+    "usrbincc <usrbincc@yahoo.com>",
+    "David Glasser <glasser@davidglasser.net>",
+    "Chase Douglas <chase@newrelic.com>",
+    "Evan Wallace <evan.exe@gmail.com>",
+    "Heather Arthur <fayearthur@gmail.com>",
+    "Hugh Kennedy <hughskennedy@gmail.com>",
+    "David Glasser <glasser@davidglasser.net>",
+    "Simon Lydell <simon.lydell@gmail.com>",
+    "Jmeas Smith <jellyes2@gmail.com>",
+    "Michael Z Goddard <mzgoddard@gmail.com>",
+    "azu <azu@users.noreply.github.com>",
+    "John Gozde <john@gozde.ca>",
+    "Adam Kirkton <akirkton@truefitinnovation.com>",
+    "Chris Montgomery <christopher.montgomery@dowjones.com>",
+    "J. Ryan Stinnett <jryans@gmail.com>",
+    "Jack Herrington <jherrington@walmartlabs.com>",
+    "Chris Truter <jeffpalentine@gmail.com>",
+    "Daniel Espeset <daniel@danielespeset.com>",
+    "Jamie Wong <jamie.lf.wong@gmail.com>",
+    "Eddy Bruël <ejpbruel@mozilla.com>",
+    "Hawken Rives <hawkrives@gmail.com>",
+    "Gilad Peleg <giladp007@gmail.com>",
+    "djchie <djchie.dev@gmail.com>",
+    "Gary Ye <garysye@gmail.com>",
+    "Nicolas Lalevée <nicolas.lalevee@hibnet.org>"
+  ],
+  "repository": {
+    "type": "git",
+    "url": "http://github.com/mozilla/source-map.git"
+  },
+  "main": "./source-map.js",
+  "files": [
+    "source-map.js",
+    "source-map.d.ts",
+    "lib/",
+    "dist/source-map.debug.js",
+    "dist/source-map.js",
+    "dist/source-map.min.js",
+    "dist/source-map.min.js.map"
+  ],
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "license": "BSD-3-Clause",
+  "scripts": {
+    "test": "npm run build && node test/run-tests.js",
+    "build": "webpack --color",
+    "toc": "doctoc --title '## Table of Contents' README.md && doctoc --title '## Table of Contents' CONTRIBUTING.md"
+  },
+  "devDependencies": {
+    "doctoc": "^0.15.0",
+    "webpack": "^1.12.0"
+  },
+  "typings": "source-map"
+}

node_modules/karma/node_modules/source-map/source-map.d.ts

@@ -0,0 +1,98 @@
+export interface StartOfSourceMap {
+    file?: string;
+    sourceRoot?: string;
+}
+
+export interface RawSourceMap extends StartOfSourceMap {
+    version: string;
+    sources: string[];
+    names: string[];
+    sourcesContent?: string[];
+    mappings: string;
+}
+
+export interface Position {
+    line: number;
+    column: number;
+}
+
+export interface LineRange extends Position {
+    lastColumn: number;
+}
+
+export interface FindPosition extends Position {
+    // SourceMapConsumer.GREATEST_LOWER_BOUND or SourceMapConsumer.LEAST_UPPER_BOUND
+    bias?: number;
+}
+
+export interface SourceFindPosition extends FindPosition {
+    source: string;
+}
+
+export interface MappedPosition extends Position {
+    source: string;
+    name?: string;
+}
+
+export interface MappingItem {
+    source: string;
+    generatedLine: number;
+    generatedColumn: number;
+    originalLine: number;
+    originalColumn: number;
+    name: string;
+}
+
+export class SourceMapConsumer {
+    static GENERATED_ORDER: number;
+    static ORIGINAL_ORDER: number;
+
+    static GREATEST_LOWER_BOUND: number;
+    static LEAST_UPPER_BOUND: number;
+
+    constructor(rawSourceMap: RawSourceMap);
+    computeColumnSpans(): void;
+    originalPositionFor(generatedPosition: FindPosition): MappedPosition;
+    generatedPositionFor(originalPosition: SourceFindPosition): LineRange;
+    allGeneratedPositionsFor(originalPosition: MappedPosition): Position[];
+    hasContentsOfAllSources(): boolean;
+    sourceContentFor(source: string, returnNullOnMissing?: boolean): string;
+    eachMapping(callback: (mapping: MappingItem) => void, context?: any, order?: number): void;
+}
+
+export interface Mapping {
+    generated: Position;
+    original: Position;
+    source: string;
+    name?: string;
+}
+
+export class SourceMapGenerator {
+    constructor(startOfSourceMap?: StartOfSourceMap);
+    static fromSourceMap(sourceMapConsumer: SourceMapConsumer): SourceMapGenerator;
+    addMapping(mapping: Mapping): void;
+    setSourceContent(sourceFile: string, sourceContent: string): void;
+    applySourceMap(sourceMapConsumer: SourceMapConsumer, sourceFile?: string, sourceMapPath?: string): void;
+    toString(): string;
+}
+
+export interface CodeWithSourceMap {
+    code: string;
+    map: SourceMapGenerator;
+}
+
+export class SourceNode {
+    constructor();
+    constructor(line: number, column: number, source: string);
+    constructor(line: number, column: number, source: string, chunk?: string, name?: string);
+    static fromStringWithSourceMap(code: string, sourceMapConsumer: SourceMapConsumer, relativePath?: string): SourceNode;
+    add(chunk: string): void;
+    prepend(chunk: string): void;
+    setSourceContent(sourceFile: string, sourceContent: string): void;
+    walk(fn: (chunk: string, mapping: MappedPosition) => void): void;
+    walkSourceContents(fn: (file: string, content: string) => void): void;
+    join(sep: string): SourceNode;
+    replaceRight(pattern: string, replacement: string): SourceNode;
+    toString(): string;
+    toStringWithSourceMap(startOfSourceMap?: StartOfSourceMap): CodeWithSourceMap;
+}

node_modules/karma/node_modules/source-map/source-map.js

@@ -0,0 +1,8 @@
+/*
+ * Copyright 2009-2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE.txt or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+exports.SourceMapGenerator = require('./lib/source-map-generator').SourceMapGenerator;
+exports.SourceMapConsumer = require('./lib/source-map-consumer').SourceMapConsumer;
+exports.SourceNode = require('./lib/source-node').SourceNode;

node_modules/karma/node_modules/statuses/HISTORY.md

@@ -0,0 +1,65 @@
+1.5.0 / 2018-03-27
+==================
+
+  * Add `103 Early Hints`
+
+1.4.0 / 2017-10-20
+==================
+
+  * Add `STATUS_CODES` export
+
+1.3.1 / 2016-11-11
+==================
+
+  * Fix return type in JSDoc
+
+1.3.0 / 2016-05-17
+==================
+
+  * Add `421 Misdirected Request`
+  * perf: enable strict mode
+
+1.2.1 / 2015-02-01
+==================
+
+  * Fix message for status 451
+    - `451 Unavailable For Legal Reasons`
+
+1.2.0 / 2014-09-28
+==================
+
+  * Add `208 Already Repored`
+  * Add `226 IM Used`
+  * Add `306 (Unused)`
+  * Add `415 Unable For Legal Reasons`
+  * Add `508 Loop Detected`
+
+1.1.1 / 2014-09-24
+==================
+
+  * Add missing 308 to `codes.json`
+
+1.1.0 / 2014-09-21
+==================
+
+  * Add `codes.json` for universal support
+
+1.0.4 / 2014-08-20
+==================
+
+  * Package cleanup
+
+1.0.3 / 2014-06-08
+==================
+
+  * Add 308 to `.redirect` category
+
+1.0.2 / 2014-03-13
+==================
+
+  * Add `.retry` category
+
+1.0.1 / 2014-03-12
+==================
+
+  * Initial release

node_modules/karma/node_modules/statuses/LICENSE

@@ -0,0 +1,23 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong <me@jongleberry.com>
+Copyright (c) 2016 Douglas Christopher Wilson <doug@somethingdoug.com>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

node_modules/karma/node_modules/statuses/README.md

@@ -0,0 +1,127 @@
+# Statuses
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+HTTP status utility for node.
+
+This module provides a list of status codes and messages sourced from
+a few different projects:
+
+  * The [IANA Status Code Registry](https://www.iana.org/assignments/http-status-codes/http-status-codes.xhtml)
+  * The [Node.js project](https://nodejs.org/)
+  * The [NGINX project](https://www.nginx.com/)
+  * The [Apache HTTP Server project](https://httpd.apache.org/)
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install statuses
+```
+
+## API
+
+<!-- eslint-disable no-unused-vars -->
+
+```js
+var status = require('statuses')
+```
+
+### var code = status(Integer || String)
+
+If `Integer` or `String` is a valid HTTP code or status message, then the
+appropriate `code` will be returned. Otherwise, an error will be thrown.
+
+<!-- eslint-disable no-undef -->
+
+```js
+status(403) // => 403
+status('403') // => 403
+status('forbidden') // => 403
+status('Forbidden') // => 403
+status(306) // throws, as it's not supported by node.js
+```
+
+### status.STATUS_CODES
+
+Returns an object which maps status codes to status messages, in
+the same format as the
+[Node.js http module](https://nodejs.org/dist/latest/docs/api/http.html#http_http_status_codes).
+
+### status.codes
+
+Returns an array of all the status codes as `Integer`s.
+
+### var msg = status[code]
+
+Map of `code` to `status message`. `undefined` for invalid `code`s.
+
+<!-- eslint-disable no-undef, no-unused-expressions -->
+
+```js
+status[404] // => 'Not Found'
+```
+
+### var code = status[msg]
+
+Map of `status message` to `code`. `msg` can either be title-cased or
+lower-cased. `undefined` for invalid `status message`s.
+
+<!-- eslint-disable no-undef, no-unused-expressions -->
+
+```js
+status['not found'] // => 404
+status['Not Found'] // => 404
+```
+
+### status.redirect[code]
+
+Returns `true` if a status code is a valid redirect status.
+
+<!-- eslint-disable no-undef, no-unused-expressions -->
+
+```js
+status.redirect[200] // => undefined
+status.redirect[301] // => true
+```
+
+### status.empty[code]
+
+Returns `true` if a status code expects an empty body.
+
+<!-- eslint-disable no-undef, no-unused-expressions -->
+
+```js
+status.empty[200] // => undefined
+status.empty[204] // => true
+status.empty[304] // => true
+```
+
+### status.retry[code]
+
+Returns `true` if you should retry the rest.
+
+<!-- eslint-disable no-undef, no-unused-expressions -->
+
+```js
+status.retry[501] // => undefined
+status.retry[503] // => true
+```
+
+[npm-image]: https://img.shields.io/npm/v/statuses.svg
+[npm-url]: https://npmjs.org/package/statuses
+[node-version-image]: https://img.shields.io/node/v/statuses.svg
+[node-version-url]: https://nodejs.org/en/download
+[travis-image]: https://img.shields.io/travis/jshttp/statuses.svg
+[travis-url]: https://travis-ci.org/jshttp/statuses
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/statuses.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/statuses?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/statuses.svg
+[downloads-url]: https://npmjs.org/package/statuses

node_modules/karma/node_modules/statuses/codes.json

@@ -0,0 +1,66 @@
+{
+  "100": "Continue",
+  "101": "Switching Protocols",
+  "102": "Processing",
+  "103": "Early Hints",
+  "200": "OK",
+  "201": "Created",
+  "202": "Accepted",
+  "203": "Non-Authoritative Information",
+  "204": "No Content",
+  "205": "Reset Content",
+  "206": "Partial Content",
+  "207": "Multi-Status",
+  "208": "Already Reported",
+  "226": "IM Used",
+  "300": "Multiple Choices",
+  "301": "Moved Permanently",
+  "302": "Found",
+  "303": "See Other",
+  "304": "Not Modified",
+  "305": "Use Proxy",
+  "306": "(Unused)",
+  "307": "Temporary Redirect",
+  "308": "Permanent Redirect",
+  "400": "Bad Request",
+  "401": "Unauthorized",
+  "402": "Payment Required",
+  "403": "Forbidden",
+  "404": "Not Found",
+  "405": "Method Not Allowed",
+  "406": "Not Acceptable",
+  "407": "Proxy Authentication Required",
+  "408": "Request Timeout",
+  "409": "Conflict",
+  "410": "Gone",
+  "411": "Length Required",
+  "412": "Precondition Failed",
+  "413": "Payload Too Large",
+  "414": "URI Too Long",
+  "415": "Unsupported Media Type",
+  "416": "Range Not Satisfiable",
+  "417": "Expectation Failed",
+  "418": "I'm a teapot",
+  "421": "Misdirected Request",
+  "422": "Unprocessable Entity",
+  "423": "Locked",
+  "424": "Failed Dependency",
+  "425": "Unordered Collection",
+  "426": "Upgrade Required",
+  "428": "Precondition Required",
+  "429": "Too Many Requests",
+  "431": "Request Header Fields Too Large",
+  "451": "Unavailable For Legal Reasons",
+  "500": "Internal Server Error",
+  "501": "Not Implemented",
+  "502": "Bad Gateway",
+  "503": "Service Unavailable",
+  "504": "Gateway Timeout",
+  "505": "HTTP Version Not Supported",
+  "506": "Variant Also Negotiates",
+  "507": "Insufficient Storage",
+  "508": "Loop Detected",
+  "509": "Bandwidth Limit Exceeded",
+  "510": "Not Extended",
+  "511": "Network Authentication Required"
+}

node_modules/karma/node_modules/statuses/index.js

@@ -0,0 +1,113 @@
+/*!
+ * statuses
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var codes = require('./codes.json')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = status
+
+// status code to message map
+status.STATUS_CODES = codes
+
+// array of status codes
+status.codes = populateStatusesMap(status, codes)
+
+// status codes for redirects
+status.redirect = {
+  300: true,
+  301: true,
+  302: true,
+  303: true,
+  305: true,
+  307: true,
+  308: true
+}
+
+// status codes for empty bodies
+status.empty = {
+  204: true,
+  205: true,
+  304: true
+}
+
+// status codes for when you should retry the request
+status.retry = {
+  502: true,
+  503: true,
+  504: true
+}
+
+/**
+ * Populate the statuses map for given codes.
+ * @private
+ */
+
+function populateStatusesMap (statuses, codes) {
+  var arr = []
+
+  Object.keys(codes).forEach(function forEachCode (code) {
+    var message = codes[code]
+    var status = Number(code)
+
+    // Populate properties
+    statuses[status] = message
+    statuses[message] = status
+    statuses[message.toLowerCase()] = status
+
+    // Add to array
+    arr.push(status)
+  })
+
+  return arr
+}
+
+/**
+ * Get the status code.
+ *
+ * Given a number, this will throw if it is not a known status
+ * code, otherwise the code will be returned. Given a string,
+ * the string will be parsed for a number and return the code
+ * if valid, otherwise will lookup the code assuming this is
+ * the status message.
+ *
+ * @param {string|number} code
+ * @returns {number}
+ * @public
+ */
+
+function status (code) {
+  if (typeof code === 'number') {
+    if (!status[code]) throw new Error('invalid status code: ' + code)
+    return code
+  }
+
+  if (typeof code !== 'string') {
+    throw new TypeError('code must be a number or string')
+  }
+
+  // '403'
+  var n = parseInt(code, 10)
+  if (!isNaN(n)) {
+    if (!status[n]) throw new Error('invalid status code: ' + n)
+    return n
+  }
+
+  n = status[code.toLowerCase()]
+  if (!n) throw new Error('invalid status message: "' + code + '"')
+  return n
+}

node_modules/karma/node_modules/statuses/package.json

@@ -0,0 +1,48 @@
+{
+  "name": "statuses",
+  "description": "HTTP status utility",
+  "version": "1.5.0",
+  "contributors": [
+    "Douglas Christopher Wilson <doug@somethingdoug.com>",
+    "Jonathan Ong <me@jongleberry.com> (http://jongleberry.com)"
+  ],
+  "repository": "jshttp/statuses",
+  "license": "MIT",
+  "keywords": [
+    "http",
+    "status",
+    "code"
+  ],
+  "files": [
+    "HISTORY.md",
+    "index.js",
+    "codes.json",
+    "LICENSE"
+  ],
+  "devDependencies": {
+    "csv-parse": "1.2.4",
+    "eslint": "4.19.1",
+    "eslint-config-standard": "11.0.0",
+    "eslint-plugin-import": "2.9.0",
+    "eslint-plugin-markdown": "1.0.0-beta.6",
+    "eslint-plugin-node": "6.0.1",
+    "eslint-plugin-promise": "3.7.0",
+    "eslint-plugin-standard": "3.0.1",
+    "istanbul": "0.4.5",
+    "mocha": "1.21.5",
+    "raw-body": "2.3.2",
+    "stream-to-array": "2.3.0"
+  },
+  "engines": {
+    "node": ">= 0.6"
+  },
+  "scripts": {
+    "build": "node scripts/build.js",
+    "fetch": "node scripts/fetch-apache.js && node scripts/fetch-iana.js && node scripts/fetch-nginx.js && node scripts/fetch-node.js",
+    "lint": "eslint --plugin markdown --ext js,md .",
+    "test": "mocha --reporter spec --check-leaks --bail test/",
+    "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+    "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+    "update": "npm run fetch && npm run build"
+  }
+}

node_modules/karma/node_modules/tmp/CHANGELOG.md

@@ -0,0 +1,288 @@
+
+
+## v0.2.1 (2020-04-28)
+
+#### :rocket: Enhancement
+* [#252](https://github.com/raszi/node-tmp/pull/252) Closes [#250](https://github.com/raszi/node-tmp/issues/250): introduce tmpdir option for overriding the system tmp dir ([@silkentrance](https://github.com/silkentrance))
+
+#### :house: Internal
+* [#253](https://github.com/raszi/node-tmp/pull/253) Closes [#191](https://github.com/raszi/node-tmp/issues/191): generate changelog from pull requests using lerna-changelog ([@silkentrance](https://github.com/silkentrance))
+
+#### Committers: 1
+- Carsten Klein ([@silkentrance](https://github.com/silkentrance))
+
+
+## v0.2.0 (2020-04-25)
+
+#### :rocket: Enhancement
+* [#234](https://github.com/raszi/node-tmp/pull/234) feat: stabilize tmp for v0.2.0 release ([@silkentrance](https://github.com/silkentrance))
+
+#### :bug: Bug Fix
+* [#231](https://github.com/raszi/node-tmp/pull/231) Closes [#230](https://github.com/raszi/node-tmp/issues/230): regression after fix for #197 ([@silkentrance](https://github.com/silkentrance))
+* [#220](https://github.com/raszi/node-tmp/pull/220) Closes [#197](https://github.com/raszi/node-tmp/issues/197): return sync callback when using the sync interface, otherwise return the async callback ([@silkentrance](https://github.com/silkentrance))
+* [#193](https://github.com/raszi/node-tmp/pull/193) Closes [#192](https://github.com/raszi/node-tmp/issues/192): tmp must not exit the process on its own ([@silkentrance](https://github.com/silkentrance))
+
+#### :memo: Documentation
+* [#221](https://github.com/raszi/node-tmp/pull/221) Gh 206 document name option ([@silkentrance](https://github.com/silkentrance))
+
+#### :house: Internal
+* [#226](https://github.com/raszi/node-tmp/pull/226) Closes [#212](https://github.com/raszi/node-tmp/issues/212): enable direct name option test ([@silkentrance](https://github.com/silkentrance))
+* [#225](https://github.com/raszi/node-tmp/pull/225) Closes [#211](https://github.com/raszi/node-tmp/issues/211): existing tests must clean up after themselves ([@silkentrance](https://github.com/silkentrance))
+* [#224](https://github.com/raszi/node-tmp/pull/224) Closes [#217](https://github.com/raszi/node-tmp/issues/217): name tests must use tmpName ([@silkentrance](https://github.com/silkentrance))
+* [#223](https://github.com/raszi/node-tmp/pull/223) Closes [#214](https://github.com/raszi/node-tmp/issues/214): refactor tests and lib ([@silkentrance](https://github.com/silkentrance))
+* [#198](https://github.com/raszi/node-tmp/pull/198) Update dependencies to latest versions ([@matsev](https://github.com/matsev))
+
+#### Committers: 2
+- Carsten Klein ([@silkentrance](https://github.com/silkentrance))
+- Mattias Severson ([@matsev](https://github.com/matsev))
+
+
+## v0.1.0 (2019-03-20)
+
+#### :rocket: Enhancement
+* [#177](https://github.com/raszi/node-tmp/pull/177) fix: fail early if there is no tmp dir specified ([@silkentrance](https://github.com/silkentrance))
+* [#159](https://github.com/raszi/node-tmp/pull/159) Closes [#121](https://github.com/raszi/node-tmp/issues/121) ([@silkentrance](https://github.com/silkentrance))
+* [#161](https://github.com/raszi/node-tmp/pull/161) Closes [#155](https://github.com/raszi/node-tmp/issues/155) ([@silkentrance](https://github.com/silkentrance))
+* [#166](https://github.com/raszi/node-tmp/pull/166) fix: avoid relying on Node’s internals ([@addaleax](https://github.com/addaleax))
+* [#144](https://github.com/raszi/node-tmp/pull/144) prepend opts.dir || tmpDir to template if no path is given ([@silkentrance](https://github.com/silkentrance))
+
+#### :bug: Bug Fix
+* [#183](https://github.com/raszi/node-tmp/pull/183) Closes [#182](https://github.com/raszi/node-tmp/issues/182) fileSync takes empty string postfix option ([@gutte](https://github.com/gutte))
+* [#130](https://github.com/raszi/node-tmp/pull/130) Closes [#129](https://github.com/raszi/node-tmp/issues/129) install process listeners safely ([@silkentrance](https://github.com/silkentrance))
+
+#### :memo: Documentation
+* [#188](https://github.com/raszi/node-tmp/pull/188) HOTCloses [#187](https://github.com/raszi/node-tmp/issues/187): restore behaviour for #182 ([@silkentrance](https://github.com/silkentrance))
+* [#180](https://github.com/raszi/node-tmp/pull/180) fix gh-179: template no longer accepts arbitrary paths ([@silkentrance](https://github.com/silkentrance))
+* [#175](https://github.com/raszi/node-tmp/pull/175) docs: add `unsafeCleanup` option to jsdoc ([@kerimdzhanov](https://github.com/kerimdzhanov))
+* [#151](https://github.com/raszi/node-tmp/pull/151) docs: fix link to tmp-promise ([@silkentrance](https://github.com/silkentrance))
+
+#### :house: Internal
+* [#184](https://github.com/raszi/node-tmp/pull/184) test: add missing tests for #182 ([@silkentrance](https://github.com/silkentrance))
+* [#171](https://github.com/raszi/node-tmp/pull/171) chore: drop old NodeJS support ([@poppinlp](https://github.com/poppinlp))
+* [#170](https://github.com/raszi/node-tmp/pull/170) chore: update dependencies ([@raszi](https://github.com/raszi))
+* [#165](https://github.com/raszi/node-tmp/pull/165) test: add missing tests ([@raszi](https://github.com/raszi))
+* [#163](https://github.com/raszi/node-tmp/pull/163) chore: add lint npm task ([@raszi](https://github.com/raszi))
+* [#107](https://github.com/raszi/node-tmp/pull/107) chore: add coverage report ([@raszi](https://github.com/raszi))
+* [#141](https://github.com/raszi/node-tmp/pull/141) test: refactor tests for mocha ([@silkentrance](https://github.com/silkentrance))
+* [#154](https://github.com/raszi/node-tmp/pull/154) chore: change Travis configuration ([@raszi](https://github.com/raszi))
+* [#152](https://github.com/raszi/node-tmp/pull/152) fix: drop Node v0.6.0 ([@raszi](https://github.com/raszi))
+
+#### Committers: 6
+- Anna Henningsen ([@addaleax](https://github.com/addaleax))
+- Carsten Klein ([@silkentrance](https://github.com/silkentrance))
+- Dan Kerimdzhanov ([@kerimdzhanov](https://github.com/kerimdzhanov))
+- Gustav Klingstedt ([@gutte](https://github.com/gutte))
+- KARASZI István ([@raszi](https://github.com/raszi))
+- PoppinL ([@poppinlp](https://github.com/poppinlp))
+
+
+## v0.0.33 (2017-08-12)
+
+#### :rocket: Enhancement
+* [#147](https://github.com/raszi/node-tmp/pull/147) fix: with name option try at most once to get a unique tmp name ([@silkentrance](https://github.com/silkentrance))
+
+#### :bug: Bug Fix
+* [#149](https://github.com/raszi/node-tmp/pull/149) fix(fileSync): must honor detachDescriptor and discardDescriptor options ([@silkentrance](https://github.com/silkentrance))
+* [#119](https://github.com/raszi/node-tmp/pull/119) Closes [#115](https://github.com/raszi/node-tmp/issues/115) ([@silkentrance](https://github.com/silkentrance))
+
+#### :memo: Documentation
+* [#128](https://github.com/raszi/node-tmp/pull/128) Closes [#127](https://github.com/raszi/node-tmp/issues/127) add reference to tmp-promise ([@silkentrance](https://github.com/silkentrance))
+
+#### :house: Internal
+* [#135](https://github.com/raszi/node-tmp/pull/135) Closes [#133](https://github.com/raszi/node-tmp/issues/133), #134 ([@silkentrance](https://github.com/silkentrance))
+* [#123](https://github.com/raszi/node-tmp/pull/123) docs: update tmp.js MIT license header to 2017 ([@madnight](https://github.com/madnight))
+* [#122](https://github.com/raszi/node-tmp/pull/122) chore: add issue template ([@silkentrance](https://github.com/silkentrance))
+
+#### Committers: 2
+- Carsten Klein ([@silkentrance](https://github.com/silkentrance))
+- Fabian Beuke ([@madnight](https://github.com/madnight))
+
+
+## v0.0.32 (2017-03-24)
+
+#### :memo: Documentation
+* [#106](https://github.com/raszi/node-tmp/pull/106) doc: add proper JSDoc documentation ([@raszi](https://github.com/raszi))
+
+#### :house: Internal
+* [#111](https://github.com/raszi/node-tmp/pull/111) test: add Windows tests ([@binki](https://github.com/binki))
+* [#110](https://github.com/raszi/node-tmp/pull/110) chore: add AppVeyor ([@binki](https://github.com/binki))
+* [#105](https://github.com/raszi/node-tmp/pull/105) chore: use const where possible ([@raszi](https://github.com/raszi))
+* [#104](https://github.com/raszi/node-tmp/pull/104) style: fix various style issues ([@raszi](https://github.com/raszi))
+
+#### Committers: 2
+- KARASZI István ([@raszi](https://github.com/raszi))
+- Nathan Phillip Brink ([@binki](https://github.com/binki))
+
+
+## v0.0.31 (2016-11-21)
+
+#### :rocket: Enhancement
+* [#99](https://github.com/raszi/node-tmp/pull/99) feat: add next callback functionality ([@silkentrance](https://github.com/silkentrance))
+* [#94](https://github.com/raszi/node-tmp/pull/94) feat: add options to control descriptor management ([@pabigot](https://github.com/pabigot))
+
+#### :house: Internal
+* [#101](https://github.com/raszi/node-tmp/pull/101) fix: Include files in the package.json ([@raszi](https://github.com/raszi))
+
+#### Committers: 3
+- Carsten Klein ([@silkentrance](https://github.com/silkentrance))
+- KARASZI István ([@raszi](https://github.com/raszi))
+- Peter A. Bigot ([@pabigot](https://github.com/pabigot))
+
+
+## v0.0.30 (2016-11-01)
+
+#### :bug: Bug Fix
+* [#96](https://github.com/raszi/node-tmp/pull/96) fix: constants for Node 6 ([@jnj16180340](https://github.com/jnj16180340))
+* [#98](https://github.com/raszi/node-tmp/pull/98) fix: garbage collector ([@Ari-H](https://github.com/Ari-H))
+
+#### Committers: 2
+- Nate Johnson ([@jnj16180340](https://github.com/jnj16180340))
+- [@Ari-H](https://github.com/Ari-H)
+
+
+## v0.0.29 (2016-09-18)
+
+#### :rocket: Enhancement
+* [#87](https://github.com/raszi/node-tmp/pull/87) fix: replace calls to deprecated fs API functions ([@OlliV](https://github.com/OlliV))
+
+#### :bug: Bug Fix
+* [#70](https://github.com/raszi/node-tmp/pull/70) fix: prune `_removeObjects` correctly ([@joliss](https://github.com/joliss))
+* [#71](https://github.com/raszi/node-tmp/pull/71) Fix typo ([@gcampax](https://github.com/gcampax))
+
+#### :memo: Documentation
+* [#77](https://github.com/raszi/node-tmp/pull/77) docs: change mkstemps to mkstemp ([@thefourtheye](https://github.com/thefourtheye))
+
+#### :house: Internal
+* [#92](https://github.com/raszi/node-tmp/pull/92) chore: add Travis CI support for Node 6 ([@amilajack](https://github.com/amilajack))
+* [#79](https://github.com/raszi/node-tmp/pull/79) fix: remove unneeded require statement ([@whmountains](https://github.com/whmountains))
+
+#### Committers: 6
+- Amila Welihinda ([@amilajack](https://github.com/amilajack))
+- Caleb Whiting ([@whmountains](https://github.com/whmountains))
+- Giovanni Campagna ([@gcampax](https://github.com/gcampax))
+- Jo Liss ([@joliss](https://github.com/joliss))
+- Olli Vanhoja ([@OlliV](https://github.com/OlliV))
+- Sakthipriyan Vairamani ([@thefourtheye](https://github.com/thefourtheye))
+
+
+## v0.0.28 (2015-09-27)
+
+#### :bug: Bug Fix
+* [#63](https://github.com/raszi/node-tmp/pull/63) fix: delete for _rmdirRecursiveSync ([@voltrevo](https://github.com/voltrevo))
+
+#### :memo: Documentation
+* [#64](https://github.com/raszi/node-tmp/pull/64) docs: fix typo in the README ([@JTKnox91](https://github.com/JTKnox91))
+
+#### :house: Internal
+* [#67](https://github.com/raszi/node-tmp/pull/67) test: add node v4.0 v4.1 to travis config ([@raszi](https://github.com/raszi))
+* [#66](https://github.com/raszi/node-tmp/pull/66) chore(deps): update deps ([@raszi](https://github.com/raszi))
+
+#### Committers: 3
+- Andrew Morris ([@voltrevo](https://github.com/voltrevo))
+- John T. Knox ([@JTKnox91](https://github.com/JTKnox91))
+- KARASZI István ([@raszi](https://github.com/raszi))
+
+
+## v0.0.27 (2015-08-15)
+
+#### :bug: Bug Fix
+* [#60](https://github.com/raszi/node-tmp/pull/60) fix: unlinking when the file has been already removed ([@silkentrance](https://github.com/silkentrance))
+
+#### :memo: Documentation
+* [#55](https://github.com/raszi/node-tmp/pull/55) docs(README): update README ([@raszi](https://github.com/raszi))
+
+#### :house: Internal
+* [#56](https://github.com/raszi/node-tmp/pull/56) style(jshint): fix JSHint error ([@raszi](https://github.com/raszi))
+* [#53](https://github.com/raszi/node-tmp/pull/53) chore: update license attribute ([@pdehaan](https://github.com/pdehaan))
+
+#### Committers: 3
+- Carsten Klein ([@silkentrance](https://github.com/silkentrance))
+- KARASZI István ([@raszi](https://github.com/raszi))
+- Peter deHaan ([@pdehaan](https://github.com/pdehaan))
+
+
+## v0.0.26 (2015-05-12)
+
+#### :rocket: Enhancement
+* [#40](https://github.com/raszi/node-tmp/pull/40) Fix for #39 ([@silkentrance](https://github.com/silkentrance))
+* [#42](https://github.com/raszi/node-tmp/pull/42) Fix for #17 ([@silkentrance](https://github.com/silkentrance))
+* [#41](https://github.com/raszi/node-tmp/pull/41) Fix for #37 ([@silkentrance](https://github.com/silkentrance))
+* [#32](https://github.com/raszi/node-tmp/pull/32) add ability to customize file/dir names ([@shime](https://github.com/shime))
+* [#29](https://github.com/raszi/node-tmp/pull/29) tmp.file have responsibility to close file, not only unlink file ([@vhain](https://github.com/vhain))
+
+#### :bug: Bug Fix
+* [#51](https://github.com/raszi/node-tmp/pull/51) fix(windows): fix tempDir on windows ([@raszi](https://github.com/raszi))
+* [#49](https://github.com/raszi/node-tmp/pull/49) remove object from _removeObjects if cleanup fn is called Closes [#48](https://github.com/raszi/node-tmp/issues/48) ([@bmeck](https://github.com/bmeck))
+
+#### :memo: Documentation
+* [#45](https://github.com/raszi/node-tmp/pull/45) Fix for #44 ([@silkentrance](https://github.com/silkentrance))
+
+#### :house: Internal
+* [#34](https://github.com/raszi/node-tmp/pull/34) Create LICENSE ([@ScottWeinstein](https://github.com/ScottWeinstein))
+
+#### Committers: 6
+- Bradley Farias ([@bmeck](https://github.com/bmeck))
+- Carsten Klein ([@silkentrance](https://github.com/silkentrance))
+- Hrvoje Šimić ([@shime](https://github.com/shime))
+- Juwan Yoo ([@vhain](https://github.com/vhain))
+- KARASZI István ([@raszi](https://github.com/raszi))
+- Scott Weinstein ([@ScottWeinstein](https://github.com/ScottWeinstein))
+
+
+## v0.0.24 (2014-07-11)
+
+#### :rocket: Enhancement
+* [#25](https://github.com/raszi/node-tmp/pull/25) Added removeCallback passing ([@foxel](https://github.com/foxel))
+
+#### Committers: 1
+- Andrey Kupreychik ([@foxel](https://github.com/foxel))
+
+
+## v0.0.23 (2013-12-03)
+
+#### :rocket: Enhancement
+* [#21](https://github.com/raszi/node-tmp/pull/21) If we are not on node 0.8, don't register an uncaughtException handler ([@wibblymat](https://github.com/wibblymat))
+
+#### Committers: 1
+- Mat Scales ([@wibblymat](https://github.com/wibblymat))
+
+
+## v0.0.22 (2013-11-29)
+
+#### :rocket: Enhancement
+* [#19](https://github.com/raszi/node-tmp/pull/19) Rethrow only on node v0.8. ([@mcollina](https://github.com/mcollina))
+
+#### Committers: 1
+- Matteo Collina ([@mcollina](https://github.com/mcollina))
+
+
+## v0.0.21 (2013-08-07)
+
+#### :bug: Bug Fix
+* [#16](https://github.com/raszi/node-tmp/pull/16) Fix bug where we delete contents of symlinks ([@lightsofapollo](https://github.com/lightsofapollo))
+
+#### Committers: 1
+- James Lal ([@lightsofapollo](https://github.com/lightsofapollo))
+
+
+## v0.0.17 (2013-04-09)
+
+#### :rocket: Enhancement
+* [#9](https://github.com/raszi/node-tmp/pull/9) add recursive remove option ([@oscar-broman](https://github.com/oscar-broman))
+
+#### Committers: 1
+- [@oscar-broman](https://github.com/oscar-broman)
+
+
+## v0.0.14 (2012-08-26)
+
+#### :rocket: Enhancement
+* [#5](https://github.com/raszi/node-tmp/pull/5) Export _getTmpName for temporary file name creation ([@joscha](https://github.com/joscha))
+
+#### Committers: 1
+- Joscha Feth ([@joscha](https://github.com/joscha))
+
+
+## Previous Releases < v0.0.14
+
+- no information available

node_modules/karma/node_modules/tmp/LICENSE

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 KARASZI István
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

node_modules/karma/node_modules/tmp/README.md

@@ -0,0 +1,365 @@
+# Tmp
+
+A simple temporary file and directory creator for [node.js.][1]
+
+[![Build Status](https://travis-ci.org/raszi/node-tmp.svg?branch=master)](https://travis-ci.org/raszi/node-tmp)
+[![Dependencies](https://david-dm.org/raszi/node-tmp.svg)](https://david-dm.org/raszi/node-tmp)
+[![npm version](https://badge.fury.io/js/tmp.svg)](https://badge.fury.io/js/tmp)
+[![API documented](https://img.shields.io/badge/API-documented-brightgreen.svg)](https://raszi.github.io/node-tmp/)
+[![Known Vulnerabilities](https://snyk.io/test/npm/tmp/badge.svg)](https://snyk.io/test/npm/tmp)
+
+## About
+
+This is a [widely used library][2] to create temporary files and directories
+in a [node.js][1] environment.
+
+Tmp offers both an asynchronous and a synchronous API. For all API calls, all
+the parameters are optional. There also exists a promisified version of the
+API, see [tmp-promise][5].
+
+Tmp uses crypto for determining random file names, or, when using templates,
+a six letter random identifier. And just in case that you do not have that much
+entropy left on your system, Tmp will fall back to pseudo random numbers.
+
+You can set whether you want to remove the temporary file on process exit or
+not.
+
+If you do not want to store your temporary directories and files in the
+standard OS temporary directory, then you are free to override that as well.
+
+## An Important Note on Compatibility
+
+See the [CHANGELOG](./CHANGELOG.md) for more information.
+
+### Version 0.1.0
+
+Since version 0.1.0, all support for node versions < 0.10.0 has been dropped.
+
+Most importantly, any support for earlier versions of node-tmp was also dropped.
+
+If you still require node versions < 0.10.0, then you must limit your node-tmp
+dependency to versions below 0.1.0.
+
+### Version 0.0.33
+
+Since version 0.0.33, all support for node versions < 0.8 has been dropped.
+
+If you still require node version 0.8, then you must limit your node-tmp
+dependency to version 0.0.33.
+
+For node versions < 0.8 you must limit your node-tmp dependency to
+versions < 0.0.33.
+
+## How to install
+
+```bash
+npm install tmp
+```
+
+## Usage
+
+Please also check [API docs][4].
+
+### Asynchronous file creation
+
+Simple temporary file creation, the file will be closed and unlinked on process exit.
+
+```javascript
+const tmp = require('tmp');
+
+tmp.file(function _tempFileCreated(err, path, fd, cleanupCallback) {
+  if (err) throw err;
+
+  console.log('File: ', path);
+  console.log('Filedescriptor: ', fd);
+  
+  // If we don't need the file anymore we could manually call the cleanupCallback
+  // But that is not necessary if we didn't pass the keep option because the library
+  // will clean after itself.
+  cleanupCallback();
+});
+```
+
+### Synchronous file creation
+
+A synchronous version of the above.
+
+```javascript
+const tmp = require('tmp');
+
+const tmpobj = tmp.fileSync();
+console.log('File: ', tmpobj.name);
+console.log('Filedescriptor: ', tmpobj.fd);
+  
+// If we don't need the file anymore we could manually call the removeCallback
+// But that is not necessary if we didn't pass the keep option because the library
+// will clean after itself.
+tmpobj.removeCallback();
+```
+
+Note that this might throw an exception if either the maximum limit of retries
+for creating a temporary name fails, or, in case that you do not have the permission
+to write to the directory where the temporary file should be created in.
+
+### Asynchronous directory creation
+
+Simple temporary directory creation, it will be removed on process exit.
+
+If the directory still contains items on process exit, then it won't be removed.
+
+```javascript
+const tmp = require('tmp');
+
+tmp.dir(function _tempDirCreated(err, path, cleanupCallback) {
+  if (err) throw err;
+
+  console.log('Dir: ', path);
+  
+  // Manual cleanup
+  cleanupCallback();
+});
+```
+
+If you want to cleanup the directory even when there are entries in it, then
+you can pass the `unsafeCleanup` option when creating it.
+
+### Synchronous directory creation
+
+A synchronous version of the above.
+
+```javascript
+const tmp = require('tmp');
+
+const tmpobj = tmp.dirSync();
+console.log('Dir: ', tmpobj.name);
+// Manual cleanup
+tmpobj.removeCallback();
+```
+
+Note that this might throw an exception if either the maximum limit of retries
+for creating a temporary name fails, or, in case that you do not have the permission
+to write to the directory where the temporary directory should be created in.
+
+### Asynchronous filename generation
+
+It is possible with this library to generate a unique filename in the specified
+directory.
+
+```javascript
+const tmp = require('tmp');
+
+tmp.tmpName(function _tempNameGenerated(err, path) {
+    if (err) throw err;
+
+    console.log('Created temporary filename: ', path);
+});
+```
+
+### Synchronous filename generation
+
+A synchronous version of the above.
+
+```javascript
+const tmp = require('tmp');
+
+const name = tmp.tmpNameSync();
+console.log('Created temporary filename: ', name);
+```
+
+## Advanced usage
+
+### Asynchronous file creation
+
+Creates a file with mode `0644`, prefix will be `prefix-` and postfix will be `.txt`.
+
+```javascript
+const tmp = require('tmp');
+
+tmp.file({ mode: 0o644, prefix: 'prefix-', postfix: '.txt' }, function _tempFileCreated(err, path, fd) {
+  if (err) throw err;
+
+  console.log('File: ', path);
+  console.log('Filedescriptor: ', fd);
+});
+```
+
+### Synchronous file creation
+
+A synchronous version of the above.
+
+```javascript
+const tmp = require('tmp');
+
+const tmpobj = tmp.fileSync({ mode: 0o644, prefix: 'prefix-', postfix: '.txt' });
+console.log('File: ', tmpobj.name);
+console.log('Filedescriptor: ', tmpobj.fd);
+```
+
+### Controlling the Descriptor
+
+As a side effect of creating a unique file `tmp` gets a file descriptor that is
+returned to the user as the `fd` parameter.  The descriptor may be used by the
+application and is closed when the `removeCallback` is invoked.
+
+In some use cases the application does not need the descriptor, needs to close it
+without removing the file, or needs to remove the file without closing the
+descriptor.  Two options control how the descriptor is managed:
+
+* `discardDescriptor` - if `true` causes `tmp` to close the descriptor after the file
+  is created.  In this case the `fd` parameter is undefined.
+* `detachDescriptor` - if `true` causes `tmp` to return the descriptor in the `fd`
+  parameter, but it is the application's responsibility to close it when it is no
+  longer needed.
+
+```javascript
+const tmp = require('tmp');
+
+tmp.file({ discardDescriptor: true }, function _tempFileCreated(err, path, fd, cleanupCallback) {
+  if (err) throw err;
+  // fd will be undefined, allowing application to use fs.createReadStream(path)
+  // without holding an unused descriptor open.
+});
+```
+
+```javascript
+const tmp = require('tmp');
+
+tmp.file({ detachDescriptor: true }, function _tempFileCreated(err, path, fd, cleanupCallback) {
+  if (err) throw err;
+
+  cleanupCallback();
+  // Application can store data through fd here; the space used will automatically
+  // be reclaimed by the operating system when the descriptor is closed or program
+  // terminates.
+});
+```
+
+### Asynchronous directory creation
+
+Creates a directory with mode `0755`, prefix will be `myTmpDir_`.
+
+```javascript
+const tmp = require('tmp');
+
+tmp.dir({ mode: 0o750, prefix: 'myTmpDir_' }, function _tempDirCreated(err, path) {
+  if (err) throw err;
+
+  console.log('Dir: ', path);
+});
+```
+
+### Synchronous directory creation
+
+Again, a synchronous version of the above.
+
+```javascript
+const tmp = require('tmp');
+
+const tmpobj = tmp.dirSync({ mode: 0750, prefix: 'myTmpDir_' });
+console.log('Dir: ', tmpobj.name);
+```
+
+### mkstemp like, asynchronously
+
+Creates a new temporary directory with mode `0700` and filename like `/tmp/tmp-nk2J1u`.
+
+IMPORTANT NOTE: template no longer accepts a path. Use the dir option instead if you
+require tmp to create your temporary filesystem object in a different place than the
+default `tmp.tmpdir`.
+
+```javascript
+const tmp = require('tmp');
+
+tmp.dir({ template: 'tmp-XXXXXX' }, function _tempDirCreated(err, path) {
+  if (err) throw err;
+
+  console.log('Dir: ', path);
+});
+```
+
+### mkstemp like, synchronously
+
+This will behave similarly to the asynchronous version.
+
+```javascript
+const tmp = require('tmp');
+
+const tmpobj = tmp.dirSync({ template: 'tmp-XXXXXX' });
+console.log('Dir: ', tmpobj.name);
+```
+
+### Asynchronous filename generation
+
+Using `tmpName()` you can create temporary file names asynchronously.
+The function accepts all standard options, e.g. `prefix`, `postfix`, `dir`, and so on.
+
+You can also leave out the options altogether and just call the function with a callback as first parameter.
+
+```javascript
+const tmp = require('tmp');
+
+const options = {};
+
+tmp.tmpName(options, function _tempNameGenerated(err, path) {
+    if (err) throw err;
+
+    console.log('Created temporary filename: ', path);
+});
+```
+
+### Synchronous filename generation
+
+The `tmpNameSync()` function works similarly to `tmpName()`.
+Again, you can leave out the options altogether and just invoke the function without any parameters.
+
+```javascript
+const tmp = require('tmp');
+const options = {};
+const tmpname = tmp.tmpNameSync(options);
+console.log('Created temporary filename: ', tmpname);
+```
+
+## Graceful cleanup
+
+If graceful cleanup is set, tmp will remove all controlled temporary objects on process exit, otherwise the
+temporary objects will remain in place, waiting to be cleaned up on system restart or otherwise scheduled temporary
+object removal.
+
+To enforce this, you can call the `setGracefulCleanup()` method:
+
+```javascript
+const tmp = require('tmp');
+
+tmp.setGracefulCleanup();
+```
+
+## Options
+
+All options are optional :)
+
+  * `name`: a fixed name that overrides random name generation, the name must be relative and must not contain path segments
+  * `mode`: the file mode to create with, falls back to `0o600` on file creation and `0o700` on directory creation
+  * `prefix`: the optional prefix, defaults to `tmp`
+  * `postfix`: the optional postfix
+  * `template`: [`mkstemp`][3] like filename template, no default, can be either an absolute or a relative path that resolves 
+     to a relative path of the system's default temporary directory, must include `XXXXXX` once for random name generation, e.g.
+     'foo/bar/XXXXXX'. Absolute paths are also fine as long as they are relative to os.tmpdir().
+     Any directories along the so specified path must exist, otherwise a ENOENT error will be thrown upon access, 
+     as tmp will not check the availability of the path, nor will it establish the requested path for you. 
+  * `dir`: the optional temporary directory that must be relative to the system's default temporary directory.
+     absolute paths are fine as long as they point to a location under the system's default temporary directory.
+     Any directories along the so specified path must exist, otherwise a ENOENT error will be thrown upon access, 
+     as tmp will not check the availability of the path, nor will it establish the requested path for you.
+  * `tmpdir`: allows you to override the system's root tmp directory
+  * `tries`: how many times should the function try to get a unique filename before giving up, default `3`
+  * `keep`: signals that the temporary file or directory should not be deleted on exit, default is `false`
+    * In order to clean up, you will have to call the provided `cleanupCallback` function manually.
+  * `unsafeCleanup`: recursively removes the created temporary directory, even when it's not empty. default is `false`
+  * `detachDescriptor`: detaches the file descriptor, caller is responsible for closing the file, tmp will no longer try closing the file during garbage collection
+  * `discardDescriptor`: discards the file descriptor (closes file, fd is -1), tmp will no longer try closing the file during garbage collection
+
+[1]: http://nodejs.org/
+[2]: https://www.npmjs.com/browse/depended/tmp
+[3]: http://www.kernel.org/doc/man-pages/online/pages/man3/mkstemp.3.html
+[4]: https://raszi.github.io/node-tmp/
+[5]: https://github.com/benjamingr/tmp-promise

node_modules/karma/node_modules/tmp/lib/tmp.js

@@ -0,0 +1,780 @@
+/*!
+ * Tmp
+ *
+ * Copyright (c) 2011-2017 KARASZI Istvan <github@spam.raszi.hu>
+ *
+ * MIT Licensed
+ */
+
+/*
+ * Module dependencies.
+ */
+const fs = require('fs');
+const os = require('os');
+const path = require('path');
+const crypto = require('crypto');
+const _c = { fs: fs.constants, os: os.constants };
+const rimraf = require('rimraf');
+
+/*
+ * The working inner variables.
+ */
+const
+  // the random characters to choose from
+  RANDOM_CHARS = '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz',
+
+  TEMPLATE_PATTERN = /XXXXXX/,
+
+  DEFAULT_TRIES = 3,
+
+  CREATE_FLAGS = (_c.O_CREAT || _c.fs.O_CREAT) | (_c.O_EXCL || _c.fs.O_EXCL) | (_c.O_RDWR || _c.fs.O_RDWR),
+
+  // constants are off on the windows platform and will not match the actual errno codes
+  IS_WIN32 = os.platform() === 'win32',
+  EBADF = _c.EBADF || _c.os.errno.EBADF,
+  ENOENT = _c.ENOENT || _c.os.errno.ENOENT,
+
+  DIR_MODE = 0o700 /* 448 */,
+  FILE_MODE = 0o600 /* 384 */,
+
+  EXIT = 'exit',
+
+  // this will hold the objects need to be removed on exit
+  _removeObjects = [],
+
+  // API change in fs.rmdirSync leads to error when passing in a second parameter, e.g. the callback
+  FN_RMDIR_SYNC = fs.rmdirSync.bind(fs),
+  FN_RIMRAF_SYNC = rimraf.sync;
+
+let
+  _gracefulCleanup = false;
+
+/**
+ * Gets a temporary file name.
+ *
+ * @param {(Options|tmpNameCallback)} options options or callback
+ * @param {?tmpNameCallback} callback the callback function
+ */
+function tmpName(options, callback) {
+  const
+    args = _parseArguments(options, callback),
+    opts = args[0],
+    cb = args[1];
+
+  try {
+    _assertAndSanitizeOptions(opts);
+  } catch (err) {
+    return cb(err);
+  }
+
+  let tries = opts.tries;
+  (function _getUniqueName() {
+    try {
+      const name = _generateTmpName(opts);
+
+      // check whether the path exists then retry if needed
+      fs.stat(name, function (err) {
+        /* istanbul ignore else */
+        if (!err) {
+          /* istanbul ignore else */
+          if (tries-- > 0) return _getUniqueName();
+
+          return cb(new Error('Could not get a unique tmp filename, max tries reached ' + name));
+        }
+
+        cb(null, name);
+      });
+    } catch (err) {
+      cb(err);
+    }
+  }());
+}
+
+/**
+ * Synchronous version of tmpName.
+ *
+ * @param {Object} options
+ * @returns {string} the generated random name
+ * @throws {Error} if the options are invalid or could not generate a filename
+ */
+function tmpNameSync(options) {
+  const
+    args = _parseArguments(options),
+    opts = args[0];
+
+  _assertAndSanitizeOptions(opts);
+
+  let tries = opts.tries;
+  do {
+    const name = _generateTmpName(opts);
+    try {
+      fs.statSync(name);
+    } catch (e) {
+      return name;
+    }
+  } while (tries-- > 0);
+
+  throw new Error('Could not get a unique tmp filename, max tries reached');
+}
+
+/**
+ * Creates and opens a temporary file.
+ *
+ * @param {(Options|null|undefined|fileCallback)} options the config options or the callback function or null or undefined
+ * @param {?fileCallback} callback
+ */
+function file(options, callback) {
+  const
+    args = _parseArguments(options, callback),
+    opts = args[0],
+    cb = args[1];
+
+  // gets a temporary filename
+  tmpName(opts, function _tmpNameCreated(err, name) {
+    /* istanbul ignore else */
+    if (err) return cb(err);
+
+    // create and open the file
+    fs.open(name, CREATE_FLAGS, opts.mode || FILE_MODE, function _fileCreated(err, fd) {
+      /* istanbu ignore else */
+      if (err) return cb(err);
+
+      if (opts.discardDescriptor) {
+        return fs.close(fd, function _discardCallback(possibleErr) {
+          // the chance of getting an error on close here is rather low and might occur in the most edgiest cases only
+          return cb(possibleErr, name, undefined, _prepareTmpFileRemoveCallback(name, -1, opts, false));
+        });
+      } else {
+        // detachDescriptor passes the descriptor whereas discardDescriptor closes it, either way, we no longer care
+        // about the descriptor
+        const discardOrDetachDescriptor = opts.discardDescriptor || opts.detachDescriptor;
+        cb(null, name, fd, _prepareTmpFileRemoveCallback(name, discardOrDetachDescriptor ? -1 : fd, opts, false));
+      }
+    });
+  });
+}
+
+/**
+ * Synchronous version of file.
+ *
+ * @param {Options} options
+ * @returns {FileSyncObject} object consists of name, fd and removeCallback
+ * @throws {Error} if cannot create a file
+ */
+function fileSync(options) {
+  const
+    args = _parseArguments(options),
+    opts = args[0];
+
+  const discardOrDetachDescriptor = opts.discardDescriptor || opts.detachDescriptor;
+  const name = tmpNameSync(opts);
+  var fd = fs.openSync(name, CREATE_FLAGS, opts.mode || FILE_MODE);
+  /* istanbul ignore else */
+  if (opts.discardDescriptor) {
+    fs.closeSync(fd);
+    fd = undefined;
+  }
+
+  return {
+    name: name,
+    fd: fd,
+    removeCallback: _prepareTmpFileRemoveCallback(name, discardOrDetachDescriptor ? -1 : fd, opts, true)
+  };
+}
+
+/**
+ * Creates a temporary directory.
+ *
+ * @param {(Options|dirCallback)} options the options or the callback function
+ * @param {?dirCallback} callback
+ */
+function dir(options, callback) {
+  const
+    args = _parseArguments(options, callback),
+    opts = args[0],
+    cb = args[1];
+
+  // gets a temporary filename
+  tmpName(opts, function _tmpNameCreated(err, name) {
+    /* istanbul ignore else */
+    if (err) return cb(err);
+
+    // create the directory
+    fs.mkdir(name, opts.mode || DIR_MODE, function _dirCreated(err) {
+      /* istanbul ignore else */
+      if (err) return cb(err);
+
+      cb(null, name, _prepareTmpDirRemoveCallback(name, opts, false));
+    });
+  });
+}
+
+/**
+ * Synchronous version of dir.
+ *
+ * @param {Options} options
+ * @returns {DirSyncObject} object consists of name and removeCallback
+ * @throws {Error} if it cannot create a directory
+ */
+function dirSync(options) {
+  const
+    args = _parseArguments(options),
+    opts = args[0];
+
+  const name = tmpNameSync(opts);
+  fs.mkdirSync(name, opts.mode || DIR_MODE);
+
+  return {
+    name: name,
+    removeCallback: _prepareTmpDirRemoveCallback(name, opts, true)
+  };
+}
+
+/**
+ * Removes files asynchronously.
+ *
+ * @param {Object} fdPath
+ * @param {Function} next
+ * @private
+ */
+function _removeFileAsync(fdPath, next) {
+  const _handler = function (err) {
+    if (err && !_isENOENT(err)) {
+      // reraise any unanticipated error
+      return next(err);
+    }
+    next();
+  };
+
+  if (0 <= fdPath[0])
+    fs.close(fdPath[0], function () {
+      fs.unlink(fdPath[1], _handler);
+    });
+  else fs.unlink(fdPath[1], _handler);
+}
+
+/**
+ * Removes files synchronously.
+ *
+ * @param {Object} fdPath
+ * @private
+ */
+function _removeFileSync(fdPath) {
+  let rethrownException = null;
+  try {
+    if (0 <= fdPath[0]) fs.closeSync(fdPath[0]);
+  } catch (e) {
+    // reraise any unanticipated error
+    if (!_isEBADF(e) && !_isENOENT(e)) throw e;
+  } finally {
+    try {
+      fs.unlinkSync(fdPath[1]);
+    }
+    catch (e) {
+      // reraise any unanticipated error
+      if (!_isENOENT(e)) rethrownException = e;
+    }
+  }
+  if (rethrownException !== null) {
+    throw rethrownException;
+  }
+}
+
+/**
+ * Prepares the callback for removal of the temporary file.
+ *
+ * Returns either a sync callback or a async callback depending on whether
+ * fileSync or file was called, which is expressed by the sync parameter.
+ *
+ * @param {string} name the path of the file
+ * @param {number} fd file descriptor
+ * @param {Object} opts
+ * @param {boolean} sync
+ * @returns {fileCallback | fileCallbackSync}
+ * @private
+ */
+function _prepareTmpFileRemoveCallback(name, fd, opts, sync) {
+  const removeCallbackSync = _prepareRemoveCallback(_removeFileSync, [fd, name], sync);
+  const removeCallback = _prepareRemoveCallback(_removeFileAsync, [fd, name], sync, removeCallbackSync);
+
+  if (!opts.keep) _removeObjects.unshift(removeCallbackSync);
+
+  return sync ? removeCallbackSync : removeCallback;
+}
+
+/**
+ * Prepares the callback for removal of the temporary directory.
+ *
+ * Returns either a sync callback or a async callback depending on whether
+ * tmpFileSync or tmpFile was called, which is expressed by the sync parameter.
+ *
+ * @param {string} name
+ * @param {Object} opts
+ * @param {boolean} sync
+ * @returns {Function} the callback
+ * @private
+ */
+function _prepareTmpDirRemoveCallback(name, opts, sync) {
+  const removeFunction = opts.unsafeCleanup ? rimraf : fs.rmdir.bind(fs);
+  const removeFunctionSync = opts.unsafeCleanup ? FN_RIMRAF_SYNC : FN_RMDIR_SYNC;
+  const removeCallbackSync = _prepareRemoveCallback(removeFunctionSync, name, sync);
+  const removeCallback = _prepareRemoveCallback(removeFunction, name, sync, removeCallbackSync);
+  if (!opts.keep) _removeObjects.unshift(removeCallbackSync);
+
+  return sync ? removeCallbackSync : removeCallback;
+}
+
+/**
+ * Creates a guarded function wrapping the removeFunction call.
+ *
+ * The cleanup callback is save to be called multiple times.
+ * Subsequent invocations will be ignored.
+ *
+ * @param {Function} removeFunction
+ * @param {string} fileOrDirName
+ * @param {boolean} sync
+ * @param {cleanupCallbackSync?} cleanupCallbackSync
+ * @returns {cleanupCallback | cleanupCallbackSync}
+ * @private
+ */
+function _prepareRemoveCallback(removeFunction, fileOrDirName, sync, cleanupCallbackSync) {
+  let called = false;
+
+  // if sync is true, the next parameter will be ignored
+  return function _cleanupCallback(next) {
+
+    /* istanbul ignore else */
+    if (!called) {
+      // remove cleanupCallback from cache
+      const toRemove = cleanupCallbackSync || _cleanupCallback;
+      const index = _removeObjects.indexOf(toRemove);
+      /* istanbul ignore else */
+      if (index >= 0) _removeObjects.splice(index, 1);
+
+      called = true;
+      if (sync || removeFunction === FN_RMDIR_SYNC || removeFunction === FN_RIMRAF_SYNC) {
+        return removeFunction(fileOrDirName);
+      } else {
+        return removeFunction(fileOrDirName, next || function() {});
+      }
+    }
+  };
+}
+
+/**
+ * The garbage collector.
+ *
+ * @private
+ */
+function _garbageCollector() {
+  /* istanbul ignore else */
+  if (!_gracefulCleanup) return;
+
+  // the function being called removes itself from _removeObjects,
+  // loop until _removeObjects is empty
+  while (_removeObjects.length) {
+    try {
+      _removeObjects[0]();
+    } catch (e) {
+      // already removed?
+    }
+  }
+}
+
+/**
+ * Random name generator based on crypto.
+ * Adapted from http://blog.tompawlak.org/how-to-generate-random-values-nodejs-javascript
+ *
+ * @param {number} howMany
+ * @returns {string} the generated random name
+ * @private
+ */
+function _randomChars(howMany) {
+  let
+    value = [],
+    rnd = null;
+
+  // make sure that we do not fail because we ran out of entropy
+  try {
+    rnd = crypto.randomBytes(howMany);
+  } catch (e) {
+    rnd = crypto.pseudoRandomBytes(howMany);
+  }
+
+  for (var i = 0; i < howMany; i++) {
+    value.push(RANDOM_CHARS[rnd[i] % RANDOM_CHARS.length]);
+  }
+
+  return value.join('');
+}
+
+/**
+ * Helper which determines whether a string s is blank, that is undefined, or empty or null.
+ *
+ * @private
+ * @param {string} s
+ * @returns {Boolean} true whether the string s is blank, false otherwise
+ */
+function _isBlank(s) {
+  return s === null || _isUndefined(s) || !s.trim();
+}
+
+/**
+ * Checks whether the `obj` parameter is defined or not.
+ *
+ * @param {Object} obj
+ * @returns {boolean} true if the object is undefined
+ * @private
+ */
+function _isUndefined(obj) {
+  return typeof obj === 'undefined';
+}
+
+/**
+ * Parses the function arguments.
+ *
+ * This function helps to have optional arguments.
+ *
+ * @param {(Options|null|undefined|Function)} options
+ * @param {?Function} callback
+ * @returns {Array} parsed arguments
+ * @private
+ */
+function _parseArguments(options, callback) {
+  /* istanbul ignore else */
+  if (typeof options === 'function') {
+    return [{}, options];
+  }
+
+  /* istanbul ignore else */
+  if (_isUndefined(options)) {
+    return [{}, callback];
+  }
+
+  // copy options so we do not leak the changes we make internally
+  const actualOptions = {};
+  for (const key of Object.getOwnPropertyNames(options)) {
+    actualOptions[key] = options[key];
+  }
+
+  return [actualOptions, callback];
+}
+
+/**
+ * Generates a new temporary name.
+ *
+ * @param {Object} opts
+ * @returns {string} the new random name according to opts
+ * @private
+ */
+function _generateTmpName(opts) {
+
+  const tmpDir = opts.tmpdir;
+
+  /* istanbul ignore else */
+  if (!_isUndefined(opts.name))
+    return path.join(tmpDir, opts.dir, opts.name);
+
+  /* istanbul ignore else */
+  if (!_isUndefined(opts.template))
+    return path.join(tmpDir, opts.dir, opts.template).replace(TEMPLATE_PATTERN, _randomChars(6));
+
+  // prefix and postfix
+  const name = [
+    opts.prefix ? opts.prefix : 'tmp',
+    '-',
+    process.pid,
+    '-',
+    _randomChars(12),
+    opts.postfix ? '-' + opts.postfix : ''
+  ].join('');
+
+  return path.join(tmpDir, opts.dir, name);
+}
+
+/**
+ * Asserts whether the specified options are valid, also sanitizes options and provides sane defaults for missing
+ * options.
+ *
+ * @param {Options} options
+ * @private
+ */
+function _assertAndSanitizeOptions(options) {
+
+  options.tmpdir = _getTmpDir(options);
+
+  const tmpDir = options.tmpdir;
+
+  /* istanbul ignore else */
+  if (!_isUndefined(options.name))
+    _assertIsRelative(options.name, 'name', tmpDir);
+  /* istanbul ignore else */
+  if (!_isUndefined(options.dir))
+    _assertIsRelative(options.dir, 'dir', tmpDir);
+  /* istanbul ignore else */
+  if (!_isUndefined(options.template)) {
+    _assertIsRelative(options.template, 'template', tmpDir);
+    if (!options.template.match(TEMPLATE_PATTERN))
+      throw new Error(`Invalid template, found "${options.template}".`);
+  }
+  /* istanbul ignore else */
+  if (!_isUndefined(options.tries) && isNaN(options.tries) || options.tries < 0)
+    throw new Error(`Invalid tries, found "${options.tries}".`);
+
+  // if a name was specified we will try once
+  options.tries = _isUndefined(options.name) ? options.tries || DEFAULT_TRIES : 1;
+  options.keep = !!options.keep;
+  options.detachDescriptor = !!options.detachDescriptor;
+  options.discardDescriptor = !!options.discardDescriptor;
+  options.unsafeCleanup = !!options.unsafeCleanup;
+
+  // sanitize dir, also keep (multiple) blanks if the user, purportedly sane, requests us to
+  options.dir = _isUndefined(options.dir) ? '' : path.relative(tmpDir, _resolvePath(options.dir, tmpDir));
+  options.template = _isUndefined(options.template) ? undefined : path.relative(tmpDir, _resolvePath(options.template, tmpDir));
+  // sanitize further if template is relative to options.dir
+  options.template = _isBlank(options.template) ? undefined : path.relative(options.dir, options.template);
+
+  // for completeness' sake only, also keep (multiple) blanks if the user, purportedly sane, requests us to
+  options.name = _isUndefined(options.name) ? undefined : _sanitizeName(options.name);
+  options.prefix = _isUndefined(options.prefix) ? '' : options.prefix;
+  options.postfix = _isUndefined(options.postfix) ? '' : options.postfix;
+}
+
+/**
+ * Resolve the specified path name in respect to tmpDir.
+ *
+ * The specified name might include relative path components, e.g. ../
+ * so we need to resolve in order to be sure that is is located inside tmpDir
+ *
+ * @param name
+ * @param tmpDir
+ * @returns {string}
+ * @private
+ */
+function _resolvePath(name, tmpDir) {
+  const sanitizedName = _sanitizeName(name);
+  if (sanitizedName.startsWith(tmpDir)) {
+    return path.resolve(sanitizedName);
+  } else {
+    return path.resolve(path.join(tmpDir, sanitizedName));
+  }
+}
+
+/**
+ * Sanitize the specified path name by removing all quote characters.
+ *
+ * @param name
+ * @returns {string}
+ * @private
+ */
+function _sanitizeName(name) {
+  if (_isBlank(name)) {
+    return name;
+  }
+  return name.replace(/["']/g, '');
+}
+
+/**
+ * Asserts whether specified name is relative to the specified tmpDir.
+ *
+ * @param {string} name
+ * @param {string} option
+ * @param {string} tmpDir
+ * @throws {Error}
+ * @private
+ */
+function _assertIsRelative(name, option, tmpDir) {
+  if (option === 'name') {
+    // assert that name is not absolute and does not contain a path
+    if (path.isAbsolute(name))
+      throw new Error(`${option} option must not contain an absolute path, found "${name}".`);
+    // must not fail on valid .<name> or ..<name> or similar such constructs
+    let basename = path.basename(name);
+    if (basename === '..' || basename === '.' || basename !== name)
+      throw new Error(`${option} option must not contain a path, found "${name}".`);
+  }
+  else { // if (option === 'dir' || option === 'template') {
+    // assert that dir or template are relative to tmpDir
+    if (path.isAbsolute(name) && !name.startsWith(tmpDir)) {
+      throw new Error(`${option} option must be relative to "${tmpDir}", found "${name}".`);
+    }
+    let resolvedPath = _resolvePath(name, tmpDir);
+    if (!resolvedPath.startsWith(tmpDir))
+      throw new Error(`${option} option must be relative to "${tmpDir}", found "${resolvedPath}".`);
+  }
+}
+
+/**
+ * Helper for testing against EBADF to compensate changes made to Node 7.x under Windows.
+ *
+ * @private
+ */
+function _isEBADF(error) {
+  return _isExpectedError(error, -EBADF, 'EBADF');
+}
+
+/**
+ * Helper for testing against ENOENT to compensate changes made to Node 7.x under Windows.
+ *
+ * @private
+ */
+function _isENOENT(error) {
+  return _isExpectedError(error, -ENOENT, 'ENOENT');
+}
+
+/**
+ * Helper to determine whether the expected error code matches the actual code and errno,
+ * which will differ between the supported node versions.
+ *
+ * - Node >= 7.0:
+ *   error.code {string}
+ *   error.errno {number} any numerical value will be negated
+ *
+ * CAVEAT
+ *
+ * On windows, the errno for EBADF is -4083 but os.constants.errno.EBADF is different and we must assume that ENOENT
+ * is no different here.
+ *
+ * @param {SystemError} error
+ * @param {number} errno
+ * @param {string} code
+ * @private
+ */
+function _isExpectedError(error, errno, code) {
+  return IS_WIN32 ? error.code === code : error.code === code && error.errno === errno;
+}
+
+/**
+ * Sets the graceful cleanup.
+ *
+ * If graceful cleanup is set, tmp will remove all controlled temporary objects on process exit, otherwise the
+ * temporary objects will remain in place, waiting to be cleaned up on system restart or otherwise scheduled temporary
+ * object removals.
+ */
+function setGracefulCleanup() {
+  _gracefulCleanup = true;
+}
+
+/**
+ * Returns the currently configured tmp dir from os.tmpdir().
+ *
+ * @private
+ * @param {?Options} options
+ * @returns {string} the currently configured tmp dir
+ */
+function _getTmpDir(options) {
+  return path.resolve(_sanitizeName(options && options.tmpdir || os.tmpdir()));
+}
+
+// Install process exit listener
+process.addListener(EXIT, _garbageCollector);
+
+/**
+ * Configuration options.
+ *
+ * @typedef {Object} Options
+ * @property {?boolean} keep the temporary object (file or dir) will not be garbage collected
+ * @property {?number} tries the number of tries before give up the name generation
+ * @property (?int) mode the access mode, defaults are 0o700 for directories and 0o600 for files
+ * @property {?string} template the "mkstemp" like filename template
+ * @property {?string} name fixed name relative to tmpdir or the specified dir option
+ * @property {?string} dir tmp directory relative to the root tmp directory in use
+ * @property {?string} prefix prefix for the generated name
+ * @property {?string} postfix postfix for the generated name
+ * @property {?string} tmpdir the root tmp directory which overrides the os tmpdir
+ * @property {?boolean} unsafeCleanup recursively removes the created temporary directory, even when it's not empty
+ * @property {?boolean} detachDescriptor detaches the file descriptor, caller is responsible for closing the file, tmp will no longer try closing the file during garbage collection
+ * @property {?boolean} discardDescriptor discards the file descriptor (closes file, fd is -1), tmp will no longer try closing the file during garbage collection
+ */
+
+/**
+ * @typedef {Object} FileSyncObject
+ * @property {string} name the name of the file
+ * @property {string} fd the file descriptor or -1 if the fd has been discarded
+ * @property {fileCallback} removeCallback the callback function to remove the file
+ */
+
+/**
+ * @typedef {Object} DirSyncObject
+ * @property {string} name the name of the directory
+ * @property {fileCallback} removeCallback the callback function to remove the directory
+ */
+
+/**
+ * @callback tmpNameCallback
+ * @param {?Error} err the error object if anything goes wrong
+ * @param {string} name the temporary file name
+ */
+
+/**
+ * @callback fileCallback
+ * @param {?Error} err the error object if anything goes wrong
+ * @param {string} name the temporary file name
+ * @param {number} fd the file descriptor or -1 if the fd had been discarded
+ * @param {cleanupCallback} fn the cleanup callback function
+ */
+
+/**
+ * @callback fileCallbackSync
+ * @param {?Error} err the error object if anything goes wrong
+ * @param {string} name the temporary file name
+ * @param {number} fd the file descriptor or -1 if the fd had been discarded
+ * @param {cleanupCallbackSync} fn the cleanup callback function
+ */
+
+/**
+ * @callback dirCallback
+ * @param {?Error} err the error object if anything goes wrong
+ * @param {string} name the temporary file name
+ * @param {cleanupCallback} fn the cleanup callback function
+ */
+
+/**
+ * @callback dirCallbackSync
+ * @param {?Error} err the error object if anything goes wrong
+ * @param {string} name the temporary file name
+ * @param {cleanupCallbackSync} fn the cleanup callback function
+ */
+
+/**
+ * Removes the temporary created file or directory.
+ *
+ * @callback cleanupCallback
+ * @param {simpleCallback} [next] function to call whenever the tmp object needs to be removed
+ */
+
+/**
+ * Removes the temporary created file or directory.
+ *
+ * @callback cleanupCallbackSync
+ */
+
+/**
+ * Callback function for function composition.
+ * @see {@link https://github.com/raszi/node-tmp/issues/57|raszi/node-tmp#57}
+ *
+ * @callback simpleCallback
+ */
+
+// exporting all the needed methods
+
+// evaluate _getTmpDir() lazily, mainly for simplifying testing but it also will
+// allow users to reconfigure the temporary directory
+Object.defineProperty(module.exports, 'tmpdir', {
+  enumerable: true,
+  configurable: false,
+  get: function () {
+    return _getTmpDir();
+  }
+});
+
+module.exports.dir = dir;
+module.exports.dirSync = dirSync;
+
+module.exports.file = file;
+module.exports.fileSync = fileSync;
+
+module.exports.tmpName = tmpName;
+module.exports.tmpNameSync = tmpNameSync;
+
+module.exports.setGracefulCleanup = setGracefulCleanup;

node_modules/karma/node_modules/tmp/package.json

@@ -0,0 +1,58 @@
+{
+  "name": "tmp",
+  "version": "0.2.1",
+  "description": "Temporary file and directory creator",
+  "author": "KARASZI István <github@spam.raszi.hu> (http://raszi.hu/)",
+  "contributors": [
+    "Carsten Klein <trancesilken@gmail.com> (https://github.com/silkentrance)"
+  ],
+  "keywords": [
+    "temporary",
+    "tmp",
+    "temp",
+    "tempdir",
+    "tempfile",
+    "tmpdir",
+    "tmpfile"
+  ],
+  "license": "MIT",
+  "repository": "https://github.com/raszi/node-tmp.git",
+  "homepage": "http://github.com/raszi/node-tmp",
+  "bugs": {
+    "url": "http://github.com/raszi/node-tmp/issues"
+  },
+  "engines": {
+    "node": ">=8.17.0"
+  },
+  "dependencies": {
+    "rimraf": "^3.0.0"
+  },
+  "devDependencies": {
+    "eslint": "^6.3.0",
+    "eslint-plugin-mocha": "^6.1.1",
+    "istanbul": "^0.4.5",
+    "lerna-changelog": "^1.0.1",
+    "mocha": "^6.2.0"
+  },
+  "main": "lib/tmp.js",
+  "files": [
+    "lib/"
+  ],
+  "changelog": {
+    "labels": {
+      "breaking": ":boom: Breaking Change",
+      "enhancement": ":rocket: Enhancement",
+      "bug": ":bug: Bug Fix",
+      "documentation": ":memo: Documentation",
+      "internal": ":house: Internal"
+    },
+    "cacheDir": ".changelog"
+  },
+  "scripts": {
+    "changelog": "lerna-changelog",
+    "lint": "eslint lib --env mocha test",
+    "clean": "rm -Rf ./coverage",
+    "test": "npm run clean && istanbul cover ./node_modules/mocha/bin/_mocha --report none --print none --dir ./coverage/json -u exports -R test/*-test.js && istanbul report --root ./coverage/json html && istanbul report text-summary",
+    "doc": "jsdoc -c .jsdoc.json"
+  }
+}

node_modules/karma/node_modules/ua-parser-js/dist/ua-parser.html

@@ -0,0 +1 @@
+<script src="./ua-parser.min.js"></script>

node_modules/karma/node_modules/ua-parser-js/license.md

@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2012-2023 Faisal Salman <<f@faisalman.com>>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

node_modules/karma/node_modules/ua-parser-js/package.json

@@ -0,0 +1,214 @@
+{
+  "title": "UAParser.js",
+  "name": "ua-parser-js",
+  "version": "0.7.37",
+  "author": "Faisal Salman <f@faisalman.com> (http://faisalman.com)",
+  "description": "Detect Browser, Engine, OS, CPU, and Device type/model from User-Agent data. Supports browser & node.js environment",
+  "keywords": [
+    "user-agent",
+    "parser",
+    "browser",
+    "engine",
+    "os",
+    "device",
+    "cpu",
+    "jquery-plugin",
+    "ecosystem:jquery",
+    "ua-parser-js",
+    "client-hints",
+    "user-agent-detection",
+    "device-detection",
+    "platform-detection",
+    "mobile-detection",
+    "browser-detection",
+    "architecture-detection"
+  ],
+  "homepage": "https://github.com/faisalman/ua-parser-js",
+  "contributors": [
+    "Aamir Poonawalla <aamir@urx.com>",
+    "Admas <mollases@users.noreply.github.com>",
+    "algenon <m@antonz.ru>",
+    "Alvin Portillo <alvin@8thwall.com>",
+    "Amumu <yoyo837@hotmail.com>",
+    "Andrea Vaghi <andrea.vaghi@jobrapido.com>",
+    "Anton Zhiyanov <m@antonz.ru>",
+    "Arturo Mejia <amejia@blim.com>",
+    "Arun Rama Reddy <arunramareddy@gmail.com>",
+    "Austin Pray <austin@austinpray.com>",
+    "Bendeguz <symunona@gmail.com>",
+    "Benjamin Bertrand <bertrand.design@gmail.com>",
+    "Benjamin Urban <benjamin.urban@sueddeutsche.de>",
+    "boneyao <admin@boneyao.com>",
+    "Carl C Von Lewin <carlchristianlewin@gmail.com>",
+    "CESAR RAMOS <c@imagenproactiva.com>",
+    "Chad Killingsworth <ckillingsworth@jackhenry.com>",
+    "Christopher De Cairos <chris.decairos@gmail.com>",
+    "Cyrille David <cyrille@qonto.eu>",
+    "Dario Vladovic <d.vladimyr@gmail.com>",
+    "David Annez <david.annez@gmail.com>",
+    "Davit Barbakadze <jayarjo@gmail.com>",
+    "ddivernois <david-emmanuel.divernois@amadeus.com>",
+    "Deliaz <D3liaz@gmail.com>",
+    "Demis Palma <demis.palma@gmail.com>",
+    "dhoko <aurelien@protonmail.com>",
+    "dianhe <dianhe@webank.com>",
+    "dineshks1 <dineshks1@d.kumar44@outlook.com>",
+    "Dmitry Tyschenko <dtyschenko@gmail.com>",
+    "Douglas Li <doug@knotch.it>",
+    "Dumitru Uzun <contact@duzun.me>",
+    "Dustin <duburns@fanatics.com>",
+    "Elchin Valiyev <elchin.valiyev@autodesk.com>",
+    "Emil Hesslow <hesslow@gmail.com>",
+    "Eric Redon <eric.redon@coox.org>",
+    "Eric Schrenker <eric.schrenker@gmail.com>",
+    "Erik Hesselink <hesselink@gmail.com>",
+    "Fabian Becker <halfdan@xnorfz.de>",
+    "Faisal Salman <f@faisalman.com>",
+    "Frédéric Camblor <fcamblor@gmail.com>",
+    "Frederik Ring <frederik.ring@gmail.com>",
+    "Gerald Host <me@jacobford.co.uk>",
+    "Germán M. Bravo <german.mb@gmail.com>",
+    "Grigory Dmitrenko <grigory@snsk.ru>",
+    "gulpin <gulping.gulpin@gmail.com>",
+    "Hendrik Helwich <h.helwich@iplabs.de>",
+    "Hermann Ebert <ebbmo@HE.local>",
+    "hr6r <hedian@gmail.com>",
+    "Igor Topal <i.topal@smartweb.com.ua>",
+    "Ildar Kamalov <i.kamalov@adguard.com>",
+    "insanehong <insane.hong@navercorp.com>",
+    "jackpoll <jackpoll123456@gmail.com>",
+    "Jake Mc <startswithaj@users.noreply.github.com>",
+    "JBYoshi <12983479+JBYoshi@users.noreply.github.com>",
+    "Joey Parrish <joeyparrish@google.com>",
+    "John Tantalo <john.tantalo@gmail.com>",
+    "John Yanarella <jmy@codecatalyst.com>",
+    "Jon Buckley <jon@jbuckley.ca>",
+    "Josh Goldberg <joshuakgoldberg@outlook.com>",
+    "Junki-Ishida <junki_ishida@dwango.co.jp>",
+    "Kendall Buchanan <kendall@kendagriff.com>",
+    "Lee Treveil <leetreveil@gmail.com>",
+    "leonardo <leofiore@libero.it>",
+    "Levente Balogh <balogh.levente.hu@gmail.com>",
+    "Liam Quinn <lquinn@blackberry.com>",
+    "Lithin <lithin@webklipper.com>",
+    "ll-syber <670159357@qq.com>",
+    "Loris Guignard <loris.guignard@gmail.com>",
+    "Lukas Drgon <lukas.drgon@gmail.com>",
+    "Lukas Eipert <leipert@users.noreply.github.com>",
+    "Malash <i@malash.me>",
+    "Martynas <martynas@firmfirm.co>",
+    "Masahiko Sato <masasato@yahoo-corp.jp>",
+    "Matt Brophy <matt@brophy.org>",
+    "Matthew Origer <karatecowboy@gmail.com>",
+    "Maximilian Haupt <mail@maximilianhaupt.com>",
+    "Max Maurer <maxemanuel.maurer@gmail.com>",
+    "Max Nordlund <max.nordlund@gmail.com>",
+    "Michael Hess <mhess@connectify.me>",
+    "MimyyK <michele.marais@hakisa.com>",
+    "naoh <naoh.cs03g@nctu.edu.tw>",
+    "Nicholas Ionata <nionata@ufl.edu>",
+    "Nikhil Motiani <nikhil.motiani@outlook.com>",
+    "Nik Rolls <nik@rolls.cc>",
+    "nionata <n.ionata129@gmail.com>",
+    "niris <nirisix@gmail.com>",
+    "Nobuo Okada <nookada@yahoo-corp.jp>",
+    "o.drapeza <o.drapeza@tinkoff.ru>",
+    "otakuSiD <otakusid@gmail.com>",
+    "patrick-nurt <github@pereira.dk>",
+    "Pavel Studeny <studeny@avast.com>",
+    "Peter Dave Hello <PeterDaveHello@users.noreply.github.com>",
+    "philippsimon <github@philippsimon.de>",
+    "Pieter Hendrickx <pieter.hendrickx@belfius.be>",
+    "Piper Chester <piperchester@gmail.com>",
+    "Queen Vinyl Darkscratch <vinyldarkscratch@gmail.com>",
+    "Raine Makelainen <raine.makelainen@jolla.com>",
+    "Raman Savaryn <homeneartheocean@gmail.com>",
+    "Robert Tod <robert@qubit.com>",
+    "roman.savarin <roman.savarin@skywindgroup.com>",
+    "Ron Korland <ron@testim.io>",
+    "Ross Noble <rosshnoble@gmail.com>",
+    "ruicong <466403866@qq.com>",
+    "Sandro Sonntag <sandro.sonntag@adorsys.de>",
+    "sgautrea <shanegautreau@gmail.com>",
+    "Shane Gautreau <sgautrea@opentext.com>",
+    "Shane Thacker <shane@steadymade.com>",
+    "Shreedhar <shreedhar@uber.com>",
+    "Simon Eisenmann <simon@longsleep.org>",
+    "Simon Lang <me@simonlang.org>",
+    "Stiekel <histkc@gmail.com>",
+    "sUP <dani3l@gmail.com>",
+    "Sylvain Gizard <sylvain.gizard@gmail.com>",
+    "szchenghuang <szchenghuang@gmail.com>",
+    "Tanguy Krotoff <tkrotoff@gmail.com>",
+    "Tony Tomarchio <tony@tomarchio.cc>",
+    "Ulrich Schmidt <u.schmidt@velian.de>",
+    "Vadim Kurachevsky <vadim@hmvs.org>",
+    "Yılmaz <yilmazdemir36@gmail.com>",
+    "yuanyang <work_yuanyang@163.com>",
+    "Yun Young-jin <yupmin@yupmin-office-macmini.local>",
+    "Zach Bjornson <zbbjornson@gmail.com>"
+  ],
+  "main": "src/ua-parser.js",
+  "files": [
+    "dist",
+    "src"
+  ],
+  "scripts": {
+    "build": "uglifyjs src/ua-parser.js -o dist/ua-parser.min.js --comments '/^ UA/' && uglifyjs src/ua-parser.js -o dist/ua-parser.pack.js --comments '/^ UA/' --compress --mangle",
+    "test": "jshint src/ua-parser.js && mocha -R nyan test/test.js",
+    "test-ci": "jshint src/ua-parser.js && mocha -R spec test/test.js",
+    "verup": "node ./node_modules/verup",
+    "version": "node ./node_modules/verup 0"
+  },
+  "verup": {
+    "files": [
+      "bower.json",
+      "package.js",
+      "src/ua-parser.js"
+    ],
+    "regs": [
+      "^((?:\\$|(\\s*\\*\\s*@)|(\\s*(?:var|,)?\\s+))(?:LIBVERSION|version)[\\s\\:='\"]+)([0-9]+(?:\\.[0-9]+){2,2})",
+      "^(\\/?\\s?\\*.*v)([0-9]+(?:\\.[0-9]+){2,2})"
+    ]
+  },
+  "devDependencies": {
+    "@babel/parser": "7.15.8",
+    "@babel/traverse": "7.15.4",
+    "jshint": "~2.12.0",
+    "mocha": "~8.2.0",
+    "requirejs": "^2.3.2",
+    "safe-regex": "^2.1.1",
+    "uglify-js": "~3.12.0",
+    "verup": "^1.3.x"
+  },
+  "repository": {
+    "type": "git",
+    "url": "https://github.com/faisalman/ua-parser-js.git"
+  },
+  "license": "MIT",
+  "engines": {
+    "node": "*"
+  },
+  "directories": {
+    "dist": "dist",
+    "src": "src",
+    "test": "test"
+  },
+  "bugs": "https://github.com/faisalman/ua-parser-js/issues",
+  "demo": "https://faisalman.github.io/ua-parser-js",
+  "download": "https://raw.github.com/faisalman/ua-parser-js/master/dist/ua-parser.min.js",
+  "funding": [
+    {
+      "type": "opencollective",
+      "url": "https://opencollective.com/ua-parser-js"
+    },
+    {
+      "type": "paypal",
+      "url": "https://paypal.me/faisalman"
+    },
+    {
+        "type": "github",
+        "url": "https://github.com/sponsors/faisalman"
+    }
+  ]
+}

node_modules/karma/node_modules/ua-parser-js/readme.md

@@ -0,0 +1,385 @@
+<p align="center">
+    <img src="https://raw.githubusercontent.com/faisalman/ua-parser-js/gh-pages/images/logo.png" width="256" height="256"> 
+</p>
+
+<p align="center">
+<a href="https://travis-ci.org/faisalman/ua-parser-js"><img src="https://travis-ci.org/faisalman/ua-parser-js.svg?branch=master"></a>
+<a href="https://www.npmjs.com/package/ua-parser-js"><img src="https://img.shields.io/npm/v/ua-parser-js.svg"></a>
+<a href="https://www.npmjs.com/package/ua-parser-js"><img src="https://img.shields.io/npm/dw/ua-parser-js.svg"></a>
+<a href="https://www.jsdelivr.com/package/npm/ua-parser-js"><img src="https://data.jsdelivr.com/v1/package/npm/ua-parser-js/badge"></a>
+<a href="https://cdnjs.com/libraries/UAParser.js"><img src="https://img.shields.io/cdnjs/v/UAParser.js.svg"></a>
+</p>
+
+# UAParser.js
+
+JavaScript library to detect Browser, Engine, OS, CPU, and Device type/model from User-Agent data with relatively small footprint (~17KB minified, ~6KB gzipped) that can be used either in browser (client-side) or node.js (server-side).
+
+* Author    : Faisal Salman <<f@faisalman.com>>
+* Demo      : https://faisalman.github.io/ua-parser-js
+* Source    : https://github.com/faisalman/ua-parser-js
+* Documentation : 
+  * v1 : https://github.com/faisalman/ua-parser-js/tree/1.0.35#documentation
+  * v2 : https://faisalman.github.io/ua-parser-js-docs/v2
+
+***
+
+### From Our Sponsors:
+<table>
+<thead>
+</thead>
+<tbody>
+<tr>
+<td colspan="2">
+<a href="https://opencollective.com/ua-parser-js">↗ Become a sponsor</a>
+</td>
+</tr>
+</tbody>
+</table>
+
+---
+
+# Documentation
+### UAParser([user-agent][,extensions])
+typeof `user-agent` "string".
+
+typeof `extensions` "array".
+
+In The Browser environment you dont need to pass the user-agent string to the function, you can just call the funtion and it should automatically get the string from the `window.navigator.userAgent`, but that is not the case in nodejs. The user-agent string must be passed in nodejs for the function to work.
+Usually you can find the user agent in:
+`request.headers["user-agent"]`.
+
+
+## Constructor
+When you call `UAParser` with the `new` keyword `UAParser` will return a new instance with an empty result object, you have to call one of the available methods to get the information from the user-agent string.
+Like so:
+* `new UAParser([uastring][,extensions])`
+```js
+let parser = new UAParser("user-agent"); // you need to pass the user-agent for nodejs
+console.log(parser); // {}
+let parserResults = parser.getResult();
+console.log(parserResults);
+/** {
+  "ua": "",
+  "browser": {},
+  "engine": {},
+  "os": {},
+  "device": {},
+  "cpu": {}
+} */
+```
+
+When you call UAParser without the `new` keyword, it will automatically call `getResult()` function and return the parsed results.
+* `UAParser([uastring][,extensions])`
+    * returns result object `{ ua: '', browser: {}, cpu: {}, device: {}, engine: {}, os: {} }`
+
+## Methods
+
+#### Methods table
+The methods are self explanatory, here's a small overview on all the available methods:
+*  `getResult()` - returns all function object calls, user-agent string, browser info, cpu, device, engine, os:
+`{ ua: '', browser: {}, cpu: {}, device: {}, engine: {}, os: {} }`.
+
+ *  `getBrowser()`      - returns the browser name and version.
+ *  `getDevice()`       - returns the device model, type, vendor.
+ *  `getEngine()`       - returns the current browser engine name and version.
+ *  `getOS()`           - returns the running operating system name and version.
+ *  `getCPU()`          - returns CPU architectural design name.
+ *  `getUA()`           - returns the user-agent string.
+ *  `setUA(user-agent)` - set a custom user-agent to be parsed.
+
+
+---
+
+* `getResult()`
+    * returns `{ ua: '', browser: {}, cpu: {}, device: {}, engine: {}, os: {} }`
+
+* `getBrowser()`
+    * returns `{ name: '', version: '' }`
+
+```sh
+# Possible 'browser.name':
+2345Explorer, 360 Browser, Alipay, Amaya, Android Browser, Arora, Avant, Avast, 
+AVG, Baidu, Basilisk, Blazer, Bolt, Brave, Bowser, Camino, Chimera,
+Chrome Headless, Chrome WebView, Chrome, Chromium, Cobalt, Comodo Dragon, Dillo,
+Dolphin, Doris, DuckDuckGo, Edge, Electron, Epiphany, Facebook, Falkon, Fennec, 
+Firebird, Firefox [Focus/Reality], Flock, Flow, GSA, GoBrowser, Heytap, 
+Huawei Browser, iCab, ICE Browser, IE, IEMobile, IceApe, IceCat, IceDragon, 
+Iceweasel, Instagram, Iridium, Iron, Jasmine, Kakao[Story/Talk], K-Meleon, 
+Kindle, Klar, Klarna, Konqueror, LBBROWSER, Line, LinkedIn, Links, Lunascape, 
+Lynx, MIUI Browser, Maemo, Maxthon, Midori, Minimo, Mobile Safari, Mosaic, 
+Mozilla, NetFront, NetSurf, Netfront, Netscape, NokiaBrowser, Obigo, 
+Oculus Browser, OmniWeb, Opera Coast, Opera [Mini/Mobi/Tablet], PaleMoon, 
+PhantomJS, Phoenix, Polaris, Puffin, QQ, QQBrowser, QQBrowserLite, Quark, 
+QupZilla, RockMelt, Safari, Sailfish Browser, Samsung Internet, SeaMonkey, Silk, 
+Skyfire, Sleipnir, Slim, SlimBrowser, Smart Lenovo Browser, Snapchat, 
+Sogou [Explorer/Mobile], Swiftfox, Tesla, TikTok, Tizen Browser, UCBrowser, 
+UP.Browser, Viera, Vivaldi, Vivo Browser, Waterfox, WeChat, Weibo, Yandex, w3m, 
+Whale Browser, ...
+
+# 'browser.version' determined dynamically
+```
+
+* `getDevice()`
+    * returns `{ model: '', type: '', vendor: '' }`
+
+```sh
+# Possible 'device.type':
+console, mobile, tablet, smarttv, wearable, embedded
+
+##########
+# NOTE: 'desktop' is not a possible device type. 
+# UAParser only reports info directly available from the UA string, which is not the case for 'desktop' device type.
+# If you wish to detect desktop devices, you must handle the needed logic yourself.
+# You can read more about it in this issue: https://github.com/faisalman/ua-parser-js/issues/182
+##########
+
+# Possible 'device.vendor':
+Acer, Alcatel, Amazon, Apple, Archos, ASUS, AT&T, BenQ, BlackBerry, Dell,
+Essential, Facebook, Fairphone, GeeksPhone, Google, HP, HTC, Huawei, Infinix, 
+Jolla, Kobo, Lenovo, LG, Meizu, Microsoft, Motorola, Nexian, Nintendo, Nokia, 
+Nvidia, OnePlus, OPPO, Ouya, Palm, Panasonic, Pebble, Polytron, Realme, RIM, 
+Roku, Samsung, Sharp, Siemens, Sony[Ericsson], Sprint, Tecno, Tesla, Ulefone, 
+Vivo, Vodafone, Xbox, Xiaomi, Zebra, ZTE, ...
+
+# 'device.model' determined dynamically
+```
+
+* `getEngine()`
+    * returns `{ name: '', version: '' }`
+
+```sh
+# Possible 'engine.name'
+Amaya, Blink, EdgeHTML, Flow, Gecko, Goanna, iCab, KHTML, LibWeb, Links, Lynx, 
+NetFront, NetSurf, Presto, Tasman, Trident, w3m, WebKit
+
+# 'engine.version' determined dynamically
+```
+
+* `getOS()`
+    * returns `{ name: '', version: '' }`
+
+```sh
+# Possible 'os.name'
+AIX, Amiga OS, Android[-x86], Arch, Bada, BeOS, BlackBerry, CentOS, Chromium OS,
+Contiki, Fedora, Firefox OS, FreeBSD, Debian, Deepin, DragonFly, elementary OS, 
+Fuchsia, Gentoo, GhostBSD, GNU, Haiku, HarmonyOS, HP-UX, Hurd, iOS, Joli, KaiOS, 
+Linpus, Linspire,Linux, Mac OS, Maemo, Mageia, Mandriva, Manjaro, MeeGo, Minix, 
+Mint, Morph OS, NetBSD, NetRange, NetTV, Nintendo, OpenBSD, OpenVMS, OS/2, Palm, 
+PC-BSD, PCLinuxOS, Plan9, PlayStation, QNX, Raspbian, RedHat, RIM Tablet OS, 
+RISC OS, Sabayon, Sailfish, SerenityOS, Series40, Slackware, Solaris, SUSE, 
+Symbian, Tizen, Ubuntu, Unix, VectorLinux, Viera, watchOS, WebOS, 
+Windows [Phone/Mobile], Zenwalk, ...
+
+# 'os.version' determined dynamically
+```
+
+* `getCPU()`
+    * returns `{ architecture: '' }`
+
+```sh
+# Possible 'cpu.architecture'
+68k, amd64, arm[64/hf], avr, ia[32/64], irix[64], mips[64], pa-risc, ppc, 
+sparc[64]
+```
+
+* `getUA()`
+    * returns UA string of current instance
+
+* `setUA(uastring)`
+    * set UA string to be parsed
+    * returns current instance
+
+# Usage
+
+## Using HTML
+
+```html
+<!doctype html>
+<html>
+<head>
+<script src="ua-parser.min.js"></script>
+<script>
+
+    var parser = new UAParser();
+    console.log(parser.getResult());
+    /*
+        /// This will print an object structured like this:
+        {
+            ua: "",
+            browser: {
+                name: "",
+                version: "",
+                major: "" //@deprecated
+            },
+            engine: {
+                name: "",
+                version: ""
+            },
+            os: {
+                name: "",
+                version: ""
+            },
+            device: {
+                model: "",
+                type: "",
+                vendor: ""
+            },
+            cpu: {
+                architecture: ""
+            }
+        }
+    */
+    // Default result depends on current window.navigator.userAgent value
+
+    // Now let's try a custom user-agent string as an example
+    var uastring1 = "Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/535.2 (KHTML, like Gecko) Ubuntu/11.10 Chromium/15.0.874.106 Chrome/15.0.874.106 Safari/535.2";
+    parser.setUA(uastring1);
+    var result = parser.getResult();
+    // You can also use UAParser constructor directly without having to create an instance:
+    // var result = UAParser(uastring1);
+
+    console.log(result.browser);        // {name: "Chromium", version: "15.0.874.106"}
+    console.log(result.device);         // {model: undefined, type: undefined, vendor: undefined}
+    console.log(result.os);             // {name: "Ubuntu", version: "11.10"}
+    console.log(result.os.version);     // "11.10"
+    console.log(result.engine.name);    // "WebKit"
+    console.log(result.cpu.architecture);   // "amd64"
+
+    // Do some other tests
+    var uastring2 = "Mozilla/5.0 (compatible; Konqueror/4.1; OpenBSD) KHTML/4.1.4 (like Gecko)";
+    console.log(parser.setUA(uastring2).getBrowser().name); // "Konqueror"
+    console.log(parser.getOS());                            // {name: "OpenBSD", version: undefined}
+    console.log(parser.getEngine());                        // {name: "KHTML", version: "4.1.4"}
+
+    var uastring3 = 'Mozilla/5.0 (PlayBook; U; RIM Tablet OS 1.0.0; en-US) AppleWebKit/534.11 (KHTML, like Gecko) Version/7.1.0.7 Safari/534.11';
+    console.log(parser.setUA(uastring3).getDevice().model); // "PlayBook"
+    console.log(parser.getOS())                             // {name: "RIM Tablet OS", version: "1.0.0"}
+    console.log(parser.getBrowser().name);                  // "Safari"
+
+</script>
+</head>
+<body>
+</body>
+</html>
+```
+
+## Using node.js
+
+Note: Device information is not available in the NodeJS environment.
+
+```sh
+$ npm install ua-parser-js
+```
+
+```js
+var http = require('http');
+var parser = require('ua-parser-js');
+
+http.createServer(function (req, res) {
+    // get user-agent header
+    var ua = parser(req.headers['user-agent']);
+    // write the result as response
+    res.end(JSON.stringify(ua, null, '  '));
+})
+.listen(1337, '127.0.0.1');
+
+console.log('Server running at http://127.0.0.1:1337/');
+```
+
+## Using TypeScript
+
+```sh
+$ npm install --save @types/ua-parser-js
+# Download TS type definition from DefinitelyTyped repository:
+# https://github.com/DefinitelyTyped/DefinitelyTyped/tree/master/types/ua-parser-js
+```
+
+## Using jQuery/Zepto ($.ua)
+
+Although written in vanilla js, this library will automatically detect if jQuery/Zepto is present and create `$.ua` object (with values based on its User-Agent) along with `window.UAParser` constructor. To get/set user-agent you can use: `$.ua.get()` / `$.ua.set(uastring)`.
+
+```js
+// Say we are in a browser with default user-agent: 'Mozilla/5.0 (Linux; U; Android 2.3.4; en-us; Sprint APA7373KT Build/GRJ22) AppleWebKit/533.1 (KHTML, like Gecko) Version/4.0':
+
+// Get the details
+console.log($.ua.device);           // {vendor: "HTC", model: "Evo Shift 4G", type: "mobile"}
+console.log($.ua.os);               // {name: "Android", version: "2.3.4"}
+console.log($.ua.os.name);          // "Android"
+console.log($.ua.get());            // "Mozilla/5.0 (Linux; U; Android 2.3.4; en-us; Sprint APA7373KT Build/GRJ22) AppleWebKit/533.1 (KHTML, like Gecko) Version/4.0"
+
+// Now lets try to reset to another custom user-agent
+$.ua.set('Mozilla/5.0 (Linux; U; Android 3.0.1; en-us; Xoom Build/HWI69) AppleWebKit/534.13 (KHTML, like Gecko) Version/4.0 Safari/534.13');
+
+// Test again
+console.log($.ua.browser.name);     // "Safari"
+console.log($.ua.engine.name);      // "Webkit"
+console.log($.ua.device);           // {vendor: "Motorola", model: "Xoom", type: "tablet"}
+console.log(parseInt($.ua.browser.version.split('.')[0], 10));  // 4
+
+// Add class to <body> tag
+// <body class="ua-browser-safari ua-devicetype-tablet">
+$('body').addClass('ua-browser-' + $.ua.browser.name + ' ua-devicetype-' + $.ua.device.type);
+```
+
+## Using Extension
+
+* `UAParser([uastring,] extensions)`
+
+```js
+// Example:
+var myOwnListOfBrowsers = [
+    [/(mybrowser)\/([\w\.]+)/i], [UAParser.BROWSER.NAME, UAParser.BROWSER.VERSION]
+];
+var myParser = new UAParser({ browser: myOwnListOfBrowsers });
+var myUA = 'Mozilla/5.0 MyBrowser/1.3';
+console.log(myParser.setUA(myUA).getBrowser());  // {name: "MyBrowser", version: "1.3"}
+```
+
+# Development
+
+## Backers & Sponsors
+
+<a href="https://opencollective.com/ua-parser-js"><img src="https://opencollective.com/ua-parser-js/organizations.svg?avatarHeight=64"></a>
+<a href="https://opencollective.com/ua-parser-js"><img src="https://opencollective.com/ua-parser-js/individuals.svg?avatarHeight=64"></a>
+
+<a href="https://www.paypal.me/faisalman/"><img src="https://cdn.rawgit.com/twolfson/paypal-github-button/1.0.0/dist/button.svg" height="40"></a>
+
+## Contributors
+
+<a href="https://github.com/faisalman/ua-parser-js/graphs/contributors">
+  <img src="https://contrib.rocks/image?repo=faisalman/ua-parser-js" />
+</a>
+
+Made with [contributors-img](https://contrib.rocks).
+
+## How To Contribute
+
+* Fork and clone this repository
+* Make some changes as required
+* Write unit test to showcase its functionality
+* Run the test suites to make sure it's not breaking anything `$ npm test`
+* Submit a pull request under `develop` branch
+
+# License
+
+MIT License
+
+Copyright (c) 2012-2021 Faisal Salman <<f@faisalman.com>>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

node_modules/karma/node_modules/ua-parser-js/src/ua-parser.js

@@ -0,0 +1,946 @@
+/////////////////////////////////////////////////////////////////////////////////
+/* UAParser.js v0.7.37
+   Copyright © 2012-2021 Faisal Salman <f@faisalman.com>
+   MIT License *//*
+   Detect Browser, Engine, OS, CPU, and Device type/model from User-Agent data.
+   Supports browser & node.js environment. 
+   Demo   : https://faisalman.github.io/ua-parser-js
+   Source : https://github.com/faisalman/ua-parser-js */
+/////////////////////////////////////////////////////////////////////////////////
+
+(function (window, undefined) {
+
+    'use strict';
+
+    //////////////
+    // Constants
+    /////////////
+
+
+    var LIBVERSION  = '0.7.37',
+        EMPTY       = '',
+        UNKNOWN     = '?',
+        FUNC_TYPE   = 'function',
+        UNDEF_TYPE  = 'undefined',
+        OBJ_TYPE    = 'object',
+        STR_TYPE    = 'string',
+        MAJOR       = 'major',
+        MODEL       = 'model',
+        NAME        = 'name',
+        TYPE        = 'type',
+        VENDOR      = 'vendor',
+        VERSION     = 'version',
+        ARCHITECTURE= 'architecture',
+        CONSOLE     = 'console',
+        MOBILE      = 'mobile',
+        TABLET      = 'tablet',
+        SMARTTV     = 'smarttv',
+        WEARABLE    = 'wearable',
+        EMBEDDED    = 'embedded',
+        UA_MAX_LENGTH = 500;
+
+    var AMAZON  = 'Amazon',
+        APPLE   = 'Apple',
+        ASUS    = 'ASUS',
+        BLACKBERRY = 'BlackBerry',
+        BROWSER = 'Browser',
+        CHROME  = 'Chrome',
+        EDGE    = 'Edge',
+        FIREFOX = 'Firefox',
+        GOOGLE  = 'Google',
+        HUAWEI  = 'Huawei',
+        LG      = 'LG',
+        MICROSOFT = 'Microsoft',
+        MOTOROLA  = 'Motorola',
+        OPERA   = 'Opera',
+        SAMSUNG = 'Samsung',
+        SHARP   = 'Sharp',
+        SONY    = 'Sony',
+        XIAOMI  = 'Xiaomi',
+        ZEBRA   = 'Zebra',
+        FACEBOOK    = 'Facebook',
+        CHROMIUM_OS = 'Chromium OS',
+        MAC_OS  = 'Mac OS';
+
+    ///////////
+    // Helper
+    //////////
+
+    var extend = function (regexes, extensions) {
+            var mergedRegexes = {};
+            for (var i in regexes) {
+                if (extensions[i] && extensions[i].length % 2 === 0) {
+                    mergedRegexes[i] = extensions[i].concat(regexes[i]);
+                } else {
+                    mergedRegexes[i] = regexes[i];
+                }
+            }
+            return mergedRegexes;
+        },
+        enumerize = function (arr) {
+            var enums = {};
+            for (var i=0; i<arr.length; i++) {
+                enums[arr[i].toUpperCase()] = arr[i];
+            }
+            return enums;
+        },
+        has = function (str1, str2) {
+            return typeof str1 === STR_TYPE ? lowerize(str2).indexOf(lowerize(str1)) !== -1 : false;
+        },
+        lowerize = function (str) {
+            return str.toLowerCase();
+        },
+        majorize = function (version) {
+            return typeof(version) === STR_TYPE ? version.replace(/[^\d\.]/g, EMPTY).split('.')[0] : undefined;
+        },
+        trim = function (str, len) {
+            if (typeof(str) === STR_TYPE) {
+                str = str.replace(/^\s\s*/, EMPTY);
+                return typeof(len) === UNDEF_TYPE ? str : str.substring(0, UA_MAX_LENGTH);
+            }
+    };
+
+    ///////////////
+    // Map helper
+    //////////////
+
+    var rgxMapper = function (ua, arrays) {
+
+            var i = 0, j, k, p, q, matches, match;
+
+            // loop through all regexes maps
+            while (i < arrays.length && !matches) {
+
+                var regex = arrays[i],       // even sequence (0,2,4,..)
+                    props = arrays[i + 1];   // odd sequence (1,3,5,..)
+                j = k = 0;
+
+                // try matching uastring with regexes
+                while (j < regex.length && !matches) {
+
+                    if (!regex[j]) { break; }
+                    matches = regex[j++].exec(ua);
+
+                    if (!!matches) {
+                        for (p = 0; p < props.length; p++) {
+                            match = matches[++k];
+                            q = props[p];
+                            // check if given property is actually array
+                            if (typeof q === OBJ_TYPE && q.length > 0) {
+                                if (q.length === 2) {
+                                    if (typeof q[1] == FUNC_TYPE) {
+                                        // assign modified match
+                                        this[q[0]] = q[1].call(this, match);
+                                    } else {
+                                        // assign given value, ignore regex match
+                                        this[q[0]] = q[1];
+                                    }
+                                } else if (q.length === 3) {
+                                    // check whether function or regex
+                                    if (typeof q[1] === FUNC_TYPE && !(q[1].exec && q[1].test)) {
+                                        // call function (usually string mapper)
+                                        this[q[0]] = match ? q[1].call(this, match, q[2]) : undefined;
+                                    } else {
+                                        // sanitize match using given regex
+                                        this[q[0]] = match ? match.replace(q[1], q[2]) : undefined;
+                                    }
+                                } else if (q.length === 4) {
+                                        this[q[0]] = match ? q[3].call(this, match.replace(q[1], q[2])) : undefined;
+                                }
+                            } else {
+                                this[q] = match ? match : undefined;
+                            }
+                        }
+                    }
+                }
+                i += 2;
+            }
+        },
+
+        strMapper = function (str, map) {
+
+            for (var i in map) {
+                // check if current value is array
+                if (typeof map[i] === OBJ_TYPE && map[i].length > 0) {
+                    for (var j = 0; j < map[i].length; j++) {
+                        if (has(map[i][j], str)) {
+                            return (i === UNKNOWN) ? undefined : i;
+                        }
+                    }
+                } else if (has(map[i], str)) {
+                    return (i === UNKNOWN) ? undefined : i;
+                }
+            }
+            return str;
+    };
+
+    ///////////////
+    // String map
+    //////////////
+
+    // Safari < 3.0
+    var oldSafariMap = {
+            '1.0'   : '/8',
+            '1.2'   : '/1',
+            '1.3'   : '/3',
+            '2.0'   : '/412',
+            '2.0.2' : '/416',
+            '2.0.3' : '/417',
+            '2.0.4' : '/419',
+            '?'     : '/'
+        },
+        windowsVersionMap = {
+            'ME'        : '4.90',
+            'NT 3.11'   : 'NT3.51',
+            'NT 4.0'    : 'NT4.0',
+            '2000'      : 'NT 5.0',
+            'XP'        : ['NT 5.1', 'NT 5.2'],
+            'Vista'     : 'NT 6.0',
+            '7'         : 'NT 6.1',
+            '8'         : 'NT 6.2',
+            '8.1'       : 'NT 6.3',
+            '10'        : ['NT 6.4', 'NT 10.0'],
+            'RT'        : 'ARM'
+    };
+
+    //////////////
+    // Regex map
+    /////////////
+
+    var regexes = {
+
+        browser : [[
+
+            /\b(?:crmo|crios)\/([\w\.]+)/i                                      // Chrome for Android/iOS
+            ], [VERSION, [NAME, 'Chrome']], [
+            /edg(?:e|ios|a)?\/([\w\.]+)/i                                       // Microsoft Edge
+            ], [VERSION, [NAME, 'Edge']], [
+
+            // Presto based
+            /(opera mini)\/([-\w\.]+)/i,                                        // Opera Mini
+            /(opera [mobiletab]{3,6})\b.+version\/([-\w\.]+)/i,                 // Opera Mobi/Tablet
+            /(opera)(?:.+version\/|[\/ ]+)([\w\.]+)/i                           // Opera
+            ], [NAME, VERSION], [
+            /opios[\/ ]+([\w\.]+)/i                                             // Opera mini on iphone >= 8.0
+            ], [VERSION, [NAME, OPERA+' Mini']], [
+            /\bopr\/([\w\.]+)/i                                                 // Opera Webkit
+            ], [VERSION, [NAME, OPERA]], [
+
+            // Mixed
+            /\bb[ai]*d(?:uhd|[ub]*[aekoprswx]{5,6})[\/ ]?([\w\.]+)/i            // Baidu
+            ], [VERSION, [NAME, 'Baidu']], [
+            /(kindle)\/([\w\.]+)/i,                                             // Kindle
+            /(lunascape|maxthon|netfront|jasmine|blazer)[\/ ]?([\w\.]*)/i,      // Lunascape/Maxthon/Netfront/Jasmine/Blazer
+            // Trident based
+            /(avant|iemobile|slim)\s?(?:browser)?[\/ ]?([\w\.]*)/i,             // Avant/IEMobile/SlimBrowser
+            /(?:ms|\()(ie) ([\w\.]+)/i,                                         // Internet Explorer
+
+            // Webkit/KHTML based                                               // Flock/RockMelt/Midori/Epiphany/Silk/Skyfire/Bolt/Iron/Iridium/PhantomJS/Bowser/QupZilla/Falkon
+            /(flock|rockmelt|midori|epiphany|silk|skyfire|bolt|iron|vivaldi|iridium|phantomjs|bowser|quark|qupzilla|falkon|rekonq|puffin|brave|whale(?!.+naver)|qqbrowserlite|qq|duckduckgo)\/([-\w\.]+)/i,
+                                                                                // Rekonq/Puffin/Brave/Whale/QQBrowserLite/QQ, aka ShouQ
+            /(heytap|ovi)browser\/([\d\.]+)/i,                                  // Heytap/Ovi
+            /(weibo)__([\d\.]+)/i                                               // Weibo
+            ], [NAME, VERSION], [
+            /(?:\buc? ?browser|(?:juc.+)ucweb)[\/ ]?([\w\.]+)/i                 // UCBrowser
+            ], [VERSION, [NAME, 'UC'+BROWSER]], [
+            /microm.+\bqbcore\/([\w\.]+)/i,                                     // WeChat Desktop for Windows Built-in Browser
+            /\bqbcore\/([\w\.]+).+microm/i,
+            /micromessenger\/([\w\.]+)/i                                        // WeChat
+            ], [VERSION, [NAME, 'WeChat']], [
+            /konqueror\/([\w\.]+)/i                                             // Konqueror
+            ], [VERSION, [NAME, 'Konqueror']], [
+            /trident.+rv[: ]([\w\.]{1,9})\b.+like gecko/i                       // IE11
+            ], [VERSION, [NAME, 'IE']], [
+            /ya(?:search)?browser\/([\w\.]+)/i                                  // Yandex
+            ], [VERSION, [NAME, 'Yandex']], [
+            /slbrowser\/([\w\.]+)/i                                             // Smart Lenovo Browser
+            ], [VERSION, [NAME, 'Smart Lenovo '+BROWSER]], [
+            /(avast|avg)\/([\w\.]+)/i                                           // Avast/AVG Secure Browser
+            ], [[NAME, /(.+)/, '$1 Secure '+BROWSER], VERSION], [
+            /\bfocus\/([\w\.]+)/i                                               // Firefox Focus
+            ], [VERSION, [NAME, FIREFOX+' Focus']], [
+            /\bopt\/([\w\.]+)/i                                                 // Opera Touch
+            ], [VERSION, [NAME, OPERA+' Touch']], [
+            /coc_coc\w+\/([\w\.]+)/i                                            // Coc Coc Browser
+            ], [VERSION, [NAME, 'Coc Coc']], [
+            /dolfin\/([\w\.]+)/i                                                // Dolphin
+            ], [VERSION, [NAME, 'Dolphin']], [
+            /coast\/([\w\.]+)/i                                                 // Opera Coast
+            ], [VERSION, [NAME, OPERA+' Coast']], [
+            /miuibrowser\/([\w\.]+)/i                                           // MIUI Browser
+            ], [VERSION, [NAME, 'MIUI '+BROWSER]], [
+            /fxios\/([-\w\.]+)/i                                                // Firefox for iOS
+            ], [VERSION, [NAME, FIREFOX]], [
+            /\bqihu|(qi?ho?o?|360)browser/i                                     // 360
+            ], [[NAME, '360 ' + BROWSER]], [
+            /(oculus|sailfish|huawei|vivo)browser\/([\w\.]+)/i
+            ], [[NAME, /(.+)/, '$1 ' + BROWSER], VERSION], [                    // Oculus/Sailfish/HuaweiBrowser/VivoBrowser
+            /samsungbrowser\/([\w\.]+)/i                                        // Samsung Internet
+            ], [VERSION, [NAME, SAMSUNG + ' Internet']], [
+            /(comodo_dragon)\/([\w\.]+)/i                                       // Comodo Dragon
+            ], [[NAME, /_/g, ' '], VERSION], [
+            /metasr[\/ ]?([\d\.]+)/i                                            // Sogou Explorer
+            ], [VERSION, [NAME, 'Sogou Explorer']], [
+            /(sogou)mo\w+\/([\d\.]+)/i                                          // Sogou Mobile
+            ], [[NAME, 'Sogou Mobile'], VERSION], [
+            /(electron)\/([\w\.]+) safari/i,                                    // Electron-based App
+            /(tesla)(?: qtcarbrowser|\/(20\d\d\.[-\w\.]+))/i,                   // Tesla
+            /m?(qqbrowser|2345Explorer)[\/ ]?([\w\.]+)/i                        // QQBrowser/2345 Browser
+            ], [NAME, VERSION], [
+            /(lbbrowser)/i,                                                     // LieBao Browser
+            /\[(linkedin)app\]/i                                                // LinkedIn App for iOS & Android
+            ], [NAME], [
+
+            // WebView
+            /((?:fban\/fbios|fb_iab\/fb4a)(?!.+fbav)|;fbav\/([\w\.]+);)/i       // Facebook App for iOS & Android
+            ], [[NAME, FACEBOOK], VERSION], [
+            /(Klarna)\/([\w\.]+)/i,                                             // Klarna Shopping Browser for iOS & Android
+            /(kakao(?:talk|story))[\/ ]([\w\.]+)/i,                             // Kakao App
+            /(naver)\(.*?(\d+\.[\w\.]+).*\)/i,                                  // Naver InApp
+            /safari (line)\/([\w\.]+)/i,                                        // Line App for iOS
+            /\b(line)\/([\w\.]+)\/iab/i,                                        // Line App for Android
+            /(alipay)client\/([\w\.]+)/i,                                       // Alipay
+            /(chromium|instagram|snapchat)[\/ ]([-\w\.]+)/i                     // Chromium/Instagram/Snapchat
+            ], [NAME, VERSION], [
+            /\bgsa\/([\w\.]+) .*safari\//i                                      // Google Search Appliance on iOS
+            ], [VERSION, [NAME, 'GSA']], [
+            /musical_ly(?:.+app_?version\/|_)([\w\.]+)/i                        // TikTok
+            ], [VERSION, [NAME, 'TikTok']], [
+
+            /headlesschrome(?:\/([\w\.]+)| )/i                                  // Chrome Headless
+            ], [VERSION, [NAME, CHROME+' Headless']], [
+
+            / wv\).+(chrome)\/([\w\.]+)/i                                       // Chrome WebView
+            ], [[NAME, CHROME+' WebView'], VERSION], [
+
+            /droid.+ version\/([\w\.]+)\b.+(?:mobile safari|safari)/i           // Android Browser
+            ], [VERSION, [NAME, 'Android '+BROWSER]], [
+
+            /(chrome|omniweb|arora|[tizenoka]{5} ?browser)\/v?([\w\.]+)/i       // Chrome/OmniWeb/Arora/Tizen/Nokia
+            ], [NAME, VERSION], [
+
+            /version\/([\w\.\,]+) .*mobile\/\w+ (safari)/i                      // Mobile Safari
+            ], [VERSION, [NAME, 'Mobile Safari']], [
+            /version\/([\w(\.|\,)]+) .*(mobile ?safari|safari)/i                // Safari & Safari Mobile
+            ], [VERSION, NAME], [
+            /webkit.+?(mobile ?safari|safari)(\/[\w\.]+)/i                      // Safari < 3.0
+            ], [NAME, [VERSION, strMapper, oldSafariMap]], [
+
+            /(webkit|khtml)\/([\w\.]+)/i
+            ], [NAME, VERSION], [
+
+            // Gecko based
+            /(navigator|netscape\d?)\/([-\w\.]+)/i                              // Netscape
+            ], [[NAME, 'Netscape'], VERSION], [
+            /mobile vr; rv:([\w\.]+)\).+firefox/i                               // Firefox Reality
+            ], [VERSION, [NAME, FIREFOX+' Reality']], [
+            /ekiohf.+(flow)\/([\w\.]+)/i,                                       // Flow
+            /(swiftfox)/i,                                                      // Swiftfox
+            /(icedragon|iceweasel|camino|chimera|fennec|maemo browser|minimo|conkeror|klar)[\/ ]?([\w\.\+]+)/i,
+                                                                                // IceDragon/Iceweasel/Camino/Chimera/Fennec/Maemo/Minimo/Conkeror/Klar
+            /(seamonkey|k-meleon|icecat|iceape|firebird|phoenix|palemoon|basilisk|waterfox)\/([-\w\.]+)$/i,
+                                                                                // Firefox/SeaMonkey/K-Meleon/IceCat/IceApe/Firebird/Phoenix
+            /(firefox)\/([\w\.]+)/i,                                            // Other Firefox-based
+            /(mozilla)\/([\w\.]+) .+rv\:.+gecko\/\d+/i,                         // Mozilla
+
+            // Other
+            /(polaris|lynx|dillo|icab|doris|amaya|w3m|netsurf|sleipnir|obigo|mosaic|(?:go|ice|up)[\. ]?browser)[-\/ ]?v?([\w\.]+)/i,
+                                                                                // Polaris/Lynx/Dillo/iCab/Doris/Amaya/w3m/NetSurf/Sleipnir/Obigo/Mosaic/Go/ICE/UP.Browser
+            /(links) \(([\w\.]+)/i,                                             // Links
+            /panasonic;(viera)/i                                                // Panasonic Viera
+            ], [NAME, VERSION], [
+            
+            /(cobalt)\/([\w\.]+)/i                                              // Cobalt
+            ], [NAME, [VERSION, /master.|lts./, ""]]
+        ],
+
+        cpu : [[
+
+            /(?:(amd|x(?:(?:86|64)[-_])?|wow|win)64)[;\)]/i                     // AMD64 (x64)
+            ], [[ARCHITECTURE, 'amd64']], [
+
+            /(ia32(?=;))/i                                                      // IA32 (quicktime)
+            ], [[ARCHITECTURE, lowerize]], [
+
+            /((?:i[346]|x)86)[;\)]/i                                            // IA32 (x86)
+            ], [[ARCHITECTURE, 'ia32']], [
+
+            /\b(aarch64|arm(v?8e?l?|_?64))\b/i                                 // ARM64
+            ], [[ARCHITECTURE, 'arm64']], [
+
+            /\b(arm(?:v[67])?ht?n?[fl]p?)\b/i                                   // ARMHF
+            ], [[ARCHITECTURE, 'armhf']], [
+
+            // PocketPC mistakenly identified as PowerPC
+            /windows (ce|mobile); ppc;/i
+            ], [[ARCHITECTURE, 'arm']], [
+
+            /((?:ppc|powerpc)(?:64)?)(?: mac|;|\))/i                            // PowerPC
+            ], [[ARCHITECTURE, /ower/, EMPTY, lowerize]], [
+
+            /(sun4\w)[;\)]/i                                                    // SPARC
+            ], [[ARCHITECTURE, 'sparc']], [
+
+            /((?:avr32|ia64(?=;))|68k(?=\))|\barm(?=v(?:[1-7]|[5-7]1)l?|;|eabi)|(?=atmel )avr|(?:irix|mips|sparc)(?:64)?\b|pa-risc)/i
+                                                                                // IA64, 68K, ARM/64, AVR/32, IRIX/64, MIPS/64, SPARC/64, PA-RISC
+            ], [[ARCHITECTURE, lowerize]]
+        ],
+
+        device : [[
+
+            //////////////////////////
+            // MOBILES & TABLETS
+            /////////////////////////
+
+            // Samsung
+            /\b(sch-i[89]0\d|shw-m380s|sm-[ptx]\w{2,4}|gt-[pn]\d{2,4}|sgh-t8[56]9|nexus 10)/i
+            ], [MODEL, [VENDOR, SAMSUNG], [TYPE, TABLET]], [
+            /\b((?:s[cgp]h|gt|sm)-\w+|sc[g-]?[\d]+a?|galaxy nexus)/i,
+            /samsung[- ]([-\w]+)/i,
+            /sec-(sgh\w+)/i
+            ], [MODEL, [VENDOR, SAMSUNG], [TYPE, MOBILE]], [
+
+            // Apple
+            /(?:\/|\()(ip(?:hone|od)[\w, ]*)(?:\/|;)/i                          // iPod/iPhone
+            ], [MODEL, [VENDOR, APPLE], [TYPE, MOBILE]], [
+            /\((ipad);[-\w\),; ]+apple/i,                                       // iPad
+            /applecoremedia\/[\w\.]+ \((ipad)/i,
+            /\b(ipad)\d\d?,\d\d?[;\]].+ios/i
+            ], [MODEL, [VENDOR, APPLE], [TYPE, TABLET]], [
+            /(macintosh);/i
+            ], [MODEL, [VENDOR, APPLE]], [
+
+            // Sharp
+            /\b(sh-?[altvz]?\d\d[a-ekm]?)/i
+            ], [MODEL, [VENDOR, SHARP], [TYPE, MOBILE]], [
+
+            // Huawei
+            /\b((?:ag[rs][23]?|bah2?|sht?|btv)-a?[lw]\d{2})\b(?!.+d\/s)/i
+            ], [MODEL, [VENDOR, HUAWEI], [TYPE, TABLET]], [
+            /(?:huawei|honor)([-\w ]+)[;\)]/i,
+            /\b(nexus 6p|\w{2,4}e?-[atu]?[ln][\dx][012359c][adn]?)\b(?!.+d\/s)/i
+            ], [MODEL, [VENDOR, HUAWEI], [TYPE, MOBILE]], [
+
+            // Xiaomi
+            /\b(poco[\w ]+|m2\d{3}j\d\d[a-z]{2})(?: bui|\))/i,                  // Xiaomi POCO
+            /\b; (\w+) build\/hm\1/i,                                           // Xiaomi Hongmi 'numeric' models
+            /\b(hm[-_ ]?note?[_ ]?(?:\d\w)?) bui/i,                             // Xiaomi Hongmi
+            /\b(redmi[\-_ ]?(?:note|k)?[\w_ ]+)(?: bui|\))/i,                   // Xiaomi Redmi
+            /oid[^\)]+; (m?[12][0-389][01]\w{3,6}[c-y])( bui|; wv|\))/i,        // Xiaomi Redmi 'numeric' models
+            /\b(mi[-_ ]?(?:a\d|one|one[_ ]plus|note lte|max|cc)?[_ ]?(?:\d?\w?)[_ ]?(?:plus|se|lite)?)(?: bui|\))/i // Xiaomi Mi
+            ], [[MODEL, /_/g, ' '], [VENDOR, XIAOMI], [TYPE, MOBILE]], [
+            /oid[^\)]+; (2\d{4}(283|rpbf)[cgl])( bui|\))/i,                     // Redmi Pad
+            /\b(mi[-_ ]?(?:pad)(?:[\w_ ]+))(?: bui|\))/i                        // Mi Pad tablets
+            ],[[MODEL, /_/g, ' '], [VENDOR, XIAOMI], [TYPE, TABLET]], [
+
+            // OPPO
+            /; (\w+) bui.+ oppo/i,
+            /\b(cph[12]\d{3}|p(?:af|c[al]|d\w|e[ar])[mt]\d0|x9007|a101op)\b/i
+            ], [MODEL, [VENDOR, 'OPPO'], [TYPE, MOBILE]], [
+
+            // Vivo
+            /vivo (\w+)(?: bui|\))/i,
+            /\b(v[12]\d{3}\w?[at])(?: bui|;)/i
+            ], [MODEL, [VENDOR, 'Vivo'], [TYPE, MOBILE]], [
+
+            // Realme
+            /\b(rmx[1-3]\d{3})(?: bui|;|\))/i
+            ], [MODEL, [VENDOR, 'Realme'], [TYPE, MOBILE]], [
+
+            // Motorola
+            /\b(milestone|droid(?:[2-4x]| (?:bionic|x2|pro|razr))?:?( 4g)?)\b[\w ]+build\//i,
+            /\bmot(?:orola)?[- ](\w*)/i,
+            /((?:moto[\w\(\) ]+|xt\d{3,4}|nexus 6)(?= bui|\)))/i
+            ], [MODEL, [VENDOR, MOTOROLA], [TYPE, MOBILE]], [
+            /\b(mz60\d|xoom[2 ]{0,2}) build\//i
+            ], [MODEL, [VENDOR, MOTOROLA], [TYPE, TABLET]], [
+
+            // LG
+            /((?=lg)?[vl]k\-?\d{3}) bui| 3\.[-\w; ]{10}lg?-([06cv9]{3,4})/i
+            ], [MODEL, [VENDOR, LG], [TYPE, TABLET]], [
+            /(lm(?:-?f100[nv]?|-[\w\.]+)(?= bui|\))|nexus [45])/i,
+            /\blg[-e;\/ ]+((?!browser|netcast|android tv)\w+)/i,
+            /\blg-?([\d\w]+) bui/i
+            ], [MODEL, [VENDOR, LG], [TYPE, MOBILE]], [
+
+            // Lenovo
+            /(ideatab[-\w ]+)/i,
+            /lenovo ?(s[56]000[-\w]+|tab(?:[\w ]+)|yt[-\d\w]{6}|tb[-\d\w]{6})/i
+            ], [MODEL, [VENDOR, 'Lenovo'], [TYPE, TABLET]], [
+
+            // Nokia
+            /(?:maemo|nokia).*(n900|lumia \d+)/i,
+            /nokia[-_ ]?([-\w\.]*)/i
+            ], [[MODEL, /_/g, ' '], [VENDOR, 'Nokia'], [TYPE, MOBILE]], [
+
+            // Google
+            /(pixel c)\b/i                                                      // Google Pixel C
+            ], [MODEL, [VENDOR, GOOGLE], [TYPE, TABLET]], [
+            /droid.+; (pixel[\daxl ]{0,6})(?: bui|\))/i                         // Google Pixel
+            ], [MODEL, [VENDOR, GOOGLE], [TYPE, MOBILE]], [
+
+            // Sony
+            /droid.+ (a?\d[0-2]{2}so|[c-g]\d{4}|so[-gl]\w+|xq-a\w[4-7][12])(?= bui|\).+chrome\/(?![1-6]{0,1}\d\.))/i
+            ], [MODEL, [VENDOR, SONY], [TYPE, MOBILE]], [
+            /sony tablet [ps]/i,
+            /\b(?:sony)?sgp\w+(?: bui|\))/i
+            ], [[MODEL, 'Xperia Tablet'], [VENDOR, SONY], [TYPE, TABLET]], [
+
+            // OnePlus
+            / (kb2005|in20[12]5|be20[12][59])\b/i,
+            /(?:one)?(?:plus)? (a\d0\d\d)(?: b|\))/i
+            ], [MODEL, [VENDOR, 'OnePlus'], [TYPE, MOBILE]], [
+
+            // Amazon
+            /(alexa)webm/i,
+            /(kf[a-z]{2}wi|aeo[c-r]{2})( bui|\))/i,                             // Kindle Fire without Silk / Echo Show
+            /(kf[a-z]+)( bui|\)).+silk\//i                                      // Kindle Fire HD
+            ], [MODEL, [VENDOR, AMAZON], [TYPE, TABLET]], [
+            /((?:sd|kf)[0349hijorstuw]+)( bui|\)).+silk\//i                     // Fire Phone
+            ], [[MODEL, /(.+)/g, 'Fire Phone $1'], [VENDOR, AMAZON], [TYPE, MOBILE]], [
+
+            // BlackBerry
+            /(playbook);[-\w\),; ]+(rim)/i                                      // BlackBerry PlayBook
+            ], [MODEL, VENDOR, [TYPE, TABLET]], [
+            /\b((?:bb[a-f]|st[hv])100-\d)/i,
+            /\(bb10; (\w+)/i                                                    // BlackBerry 10
+            ], [MODEL, [VENDOR, BLACKBERRY], [TYPE, MOBILE]], [
+
+            // Asus
+            /(?:\b|asus_)(transfo[prime ]{4,10} \w+|eeepc|slider \w+|nexus 7|padfone|p00[cj])/i
+            ], [MODEL, [VENDOR, ASUS], [TYPE, TABLET]], [
+            / (z[bes]6[027][012][km][ls]|zenfone \d\w?)\b/i
+            ], [MODEL, [VENDOR, ASUS], [TYPE, MOBILE]], [
+
+            // HTC
+            /(nexus 9)/i                                                        // HTC Nexus 9
+            ], [MODEL, [VENDOR, 'HTC'], [TYPE, TABLET]], [
+            /(htc)[-;_ ]{1,2}([\w ]+(?=\)| bui)|\w+)/i,                         // HTC
+
+            // ZTE
+            /(zte)[- ]([\w ]+?)(?: bui|\/|\))/i,
+            /(alcatel|geeksphone|nexian|panasonic(?!(?:;|\.))|sony(?!-bra))[-_ ]?([-\w]*)/i         // Alcatel/GeeksPhone/Nexian/Panasonic/Sony
+            ], [VENDOR, [MODEL, /_/g, ' '], [TYPE, MOBILE]], [
+
+            // Acer
+            /droid.+; ([ab][1-7]-?[0178a]\d\d?)/i
+            ], [MODEL, [VENDOR, 'Acer'], [TYPE, TABLET]], [
+
+            // Meizu
+            /droid.+; (m[1-5] note) bui/i,
+            /\bmz-([-\w]{2,})/i
+            ], [MODEL, [VENDOR, 'Meizu'], [TYPE, MOBILE]], [
+                
+            // Ulefone
+            /; ((?:power )?armor(?:[\w ]{0,8}))(?: bui|\))/i
+            ], [MODEL, [VENDOR, 'Ulefone'], [TYPE, MOBILE]], [
+
+            // MIXED
+            /(blackberry|benq|palm(?=\-)|sonyericsson|acer|asus|dell|meizu|motorola|polytron|infinix|tecno)[-_ ]?([-\w]*)/i,
+                                                                                // BlackBerry/BenQ/Palm/Sony-Ericsson/Acer/Asus/Dell/Meizu/Motorola/Polytron
+            /(hp) ([\w ]+\w)/i,                                                 // HP iPAQ
+            /(asus)-?(\w+)/i,                                                   // Asus
+            /(microsoft); (lumia[\w ]+)/i,                                      // Microsoft Lumia
+            /(lenovo)[-_ ]?([-\w]+)/i,                                          // Lenovo
+            /(jolla)/i,                                                         // Jolla
+            /(oppo) ?([\w ]+) bui/i                                             // OPPO
+            ], [VENDOR, MODEL, [TYPE, MOBILE]], [
+
+            /(kobo)\s(ereader|touch)/i,                                         // Kobo
+            /(archos) (gamepad2?)/i,                                            // Archos
+            /(hp).+(touchpad(?!.+tablet)|tablet)/i,                             // HP TouchPad
+            /(kindle)\/([\w\.]+)/i,                                             // Kindle
+            /(nook)[\w ]+build\/(\w+)/i,                                        // Nook
+            /(dell) (strea[kpr\d ]*[\dko])/i,                                   // Dell Streak
+            /(le[- ]+pan)[- ]+(\w{1,9}) bui/i,                                  // Le Pan Tablets
+            /(trinity)[- ]*(t\d{3}) bui/i,                                      // Trinity Tablets
+            /(gigaset)[- ]+(q\w{1,9}) bui/i,                                    // Gigaset Tablets
+            /(vodafone) ([\w ]+)(?:\)| bui)/i                                   // Vodafone
+            ], [VENDOR, MODEL, [TYPE, TABLET]], [
+
+            /(surface duo)/i                                                    // Surface Duo
+            ], [MODEL, [VENDOR, MICROSOFT], [TYPE, TABLET]], [
+            /droid [\d\.]+; (fp\du?)(?: b|\))/i                                 // Fairphone
+            ], [MODEL, [VENDOR, 'Fairphone'], [TYPE, MOBILE]], [
+            /(u304aa)/i                                                         // AT&T
+            ], [MODEL, [VENDOR, 'AT&T'], [TYPE, MOBILE]], [
+            /\bsie-(\w*)/i                                                      // Siemens
+            ], [MODEL, [VENDOR, 'Siemens'], [TYPE, MOBILE]], [
+            /\b(rct\w+) b/i                                                     // RCA Tablets
+            ], [MODEL, [VENDOR, 'RCA'], [TYPE, TABLET]], [
+            /\b(venue[\d ]{2,7}) b/i                                            // Dell Venue Tablets
+            ], [MODEL, [VENDOR, 'Dell'], [TYPE, TABLET]], [
+            /\b(q(?:mv|ta)\w+) b/i                                              // Verizon Tablet
+            ], [MODEL, [VENDOR, 'Verizon'], [TYPE, TABLET]], [
+            /\b(?:barnes[& ]+noble |bn[rt])([\w\+ ]*) b/i                       // Barnes & Noble Tablet
+            ], [MODEL, [VENDOR, 'Barnes & Noble'], [TYPE, TABLET]], [
+            /\b(tm\d{3}\w+) b/i
+            ], [MODEL, [VENDOR, 'NuVision'], [TYPE, TABLET]], [
+            /\b(k88) b/i                                                        // ZTE K Series Tablet
+            ], [MODEL, [VENDOR, 'ZTE'], [TYPE, TABLET]], [
+            /\b(nx\d{3}j) b/i                                                   // ZTE Nubia
+            ], [MODEL, [VENDOR, 'ZTE'], [TYPE, MOBILE]], [
+            /\b(gen\d{3}) b.+49h/i                                              // Swiss GEN Mobile
+            ], [MODEL, [VENDOR, 'Swiss'], [TYPE, MOBILE]], [
+            /\b(zur\d{3}) b/i                                                   // Swiss ZUR Tablet
+            ], [MODEL, [VENDOR, 'Swiss'], [TYPE, TABLET]], [
+            /\b((zeki)?tb.*\b) b/i                                              // Zeki Tablets
+            ], [MODEL, [VENDOR, 'Zeki'], [TYPE, TABLET]], [
+            /\b([yr]\d{2}) b/i,
+            /\b(dragon[- ]+touch |dt)(\w{5}) b/i                                // Dragon Touch Tablet
+            ], [[VENDOR, 'Dragon Touch'], MODEL, [TYPE, TABLET]], [
+            /\b(ns-?\w{0,9}) b/i                                                // Insignia Tablets
+            ], [MODEL, [VENDOR, 'Insignia'], [TYPE, TABLET]], [
+            /\b((nxa|next)-?\w{0,9}) b/i                                        // NextBook Tablets
+            ], [MODEL, [VENDOR, 'NextBook'], [TYPE, TABLET]], [
+            /\b(xtreme\_)?(v(1[045]|2[015]|[3469]0|7[05])) b/i                  // Voice Xtreme Phones
+            ], [[VENDOR, 'Voice'], MODEL, [TYPE, MOBILE]], [
+            /\b(lvtel\-)?(v1[12]) b/i                                           // LvTel Phones
+            ], [[VENDOR, 'LvTel'], MODEL, [TYPE, MOBILE]], [
+            /\b(ph-1) /i                                                        // Essential PH-1
+            ], [MODEL, [VENDOR, 'Essential'], [TYPE, MOBILE]], [
+            /\b(v(100md|700na|7011|917g).*\b) b/i                               // Envizen Tablets
+            ], [MODEL, [VENDOR, 'Envizen'], [TYPE, TABLET]], [
+            /\b(trio[-\w\. ]+) b/i                                              // MachSpeed Tablets
+            ], [MODEL, [VENDOR, 'MachSpeed'], [TYPE, TABLET]], [
+            /\btu_(1491) b/i                                                    // Rotor Tablets
+            ], [MODEL, [VENDOR, 'Rotor'], [TYPE, TABLET]], [
+            /(shield[\w ]+) b/i                                                 // Nvidia Shield Tablets
+            ], [MODEL, [VENDOR, 'Nvidia'], [TYPE, TABLET]], [
+            /(sprint) (\w+)/i                                                   // Sprint Phones
+            ], [VENDOR, MODEL, [TYPE, MOBILE]], [
+            /(kin\.[onetw]{3})/i                                                // Microsoft Kin
+            ], [[MODEL, /\./g, ' '], [VENDOR, MICROSOFT], [TYPE, MOBILE]], [
+            /droid.+; (cc6666?|et5[16]|mc[239][23]x?|vc8[03]x?)\)/i             // Zebra
+            ], [MODEL, [VENDOR, ZEBRA], [TYPE, TABLET]], [
+            /droid.+; (ec30|ps20|tc[2-8]\d[kx])\)/i
+            ], [MODEL, [VENDOR, ZEBRA], [TYPE, MOBILE]], [
+
+            ///////////////////
+            // SMARTTVS
+            ///////////////////
+
+            /smart-tv.+(samsung)/i                                              // Samsung
+            ], [VENDOR, [TYPE, SMARTTV]], [
+            /hbbtv.+maple;(\d+)/i
+            ], [[MODEL, /^/, 'SmartTV'], [VENDOR, SAMSUNG], [TYPE, SMARTTV]], [
+            /(nux; netcast.+smarttv|lg (netcast\.tv-201\d|android tv))/i        // LG SmartTV
+            ], [[VENDOR, LG], [TYPE, SMARTTV]], [
+            /(apple) ?tv/i                                                      // Apple TV
+            ], [VENDOR, [MODEL, APPLE+' TV'], [TYPE, SMARTTV]], [
+            /crkey/i                                                            // Google Chromecast
+            ], [[MODEL, CHROME+'cast'], [VENDOR, GOOGLE], [TYPE, SMARTTV]], [
+            /droid.+aft(\w+)( bui|\))/i                                         // Fire TV
+            ], [MODEL, [VENDOR, AMAZON], [TYPE, SMARTTV]], [
+            /\(dtv[\);].+(aquos)/i,
+            /(aquos-tv[\w ]+)\)/i                                               // Sharp
+            ], [MODEL, [VENDOR, SHARP], [TYPE, SMARTTV]],[
+            /(bravia[\w ]+)( bui|\))/i                                              // Sony
+            ], [MODEL, [VENDOR, SONY], [TYPE, SMARTTV]], [
+            /(mitv-\w{5}) bui/i                                                 // Xiaomi
+            ], [MODEL, [VENDOR, XIAOMI], [TYPE, SMARTTV]], [
+            /Hbbtv.*(technisat) (.*);/i                                         // TechniSAT
+            ], [VENDOR, MODEL, [TYPE, SMARTTV]], [
+            /\b(roku)[\dx]*[\)\/]((?:dvp-)?[\d\.]*)/i,                          // Roku
+            /hbbtv\/\d+\.\d+\.\d+ +\([\w\+ ]*; *([\w\d][^;]*);([^;]*)/i         // HbbTV devices
+            ], [[VENDOR, trim], [MODEL, trim], [TYPE, SMARTTV]], [
+            /\b(android tv|smart[- ]?tv|opera tv|tv; rv:)\b/i                   // SmartTV from Unidentified Vendors
+            ], [[TYPE, SMARTTV]], [
+
+            ///////////////////
+            // CONSOLES
+            ///////////////////
+
+            /(ouya)/i,                                                          // Ouya
+            /(nintendo) ([wids3utch]+)/i                                        // Nintendo
+            ], [VENDOR, MODEL, [TYPE, CONSOLE]], [
+            /droid.+; (shield) bui/i                                            // Nvidia
+            ], [MODEL, [VENDOR, 'Nvidia'], [TYPE, CONSOLE]], [
+            /(playstation [345portablevi]+)/i                                   // Playstation
+            ], [MODEL, [VENDOR, SONY], [TYPE, CONSOLE]], [
+            /\b(xbox(?: one)?(?!; xbox))[\); ]/i                                // Microsoft Xbox
+            ], [MODEL, [VENDOR, MICROSOFT], [TYPE, CONSOLE]], [
+
+            ///////////////////
+            // WEARABLES
+            ///////////////////
+
+            /((pebble))app/i                                                    // Pebble
+            ], [VENDOR, MODEL, [TYPE, WEARABLE]], [
+            /(watch)(?: ?os[,\/]|\d,\d\/)[\d\.]+/i                              // Apple Watch
+            ], [MODEL, [VENDOR, APPLE], [TYPE, WEARABLE]], [
+            /droid.+; (glass) \d/i                                              // Google Glass
+            ], [MODEL, [VENDOR, GOOGLE], [TYPE, WEARABLE]], [
+            /droid.+; (wt63?0{2,3})\)/i
+            ], [MODEL, [VENDOR, ZEBRA], [TYPE, WEARABLE]], [
+            /(quest( 2| pro)?)/i                                                // Oculus Quest
+            ], [MODEL, [VENDOR, FACEBOOK], [TYPE, WEARABLE]], [
+
+            ///////////////////
+            // EMBEDDED
+            ///////////////////
+
+            /(tesla)(?: qtcarbrowser|\/[-\w\.]+)/i                              // Tesla
+            ], [VENDOR, [TYPE, EMBEDDED]], [
+            /(aeobc)\b/i                                                        // Echo Dot
+            ], [MODEL, [VENDOR, AMAZON], [TYPE, EMBEDDED]], [
+
+            ////////////////////
+            // MIXED (GENERIC)
+            ///////////////////
+
+            /droid .+?; ([^;]+?)(?: bui|; wv\)|\) applew).+? mobile safari/i    // Android Phones from Unidentified Vendors
+            ], [MODEL, [TYPE, MOBILE]], [
+            /droid .+?; ([^;]+?)(?: bui|\) applew).+?(?! mobile) safari/i       // Android Tablets from Unidentified Vendors
+            ], [MODEL, [TYPE, TABLET]], [
+            /\b((tablet|tab)[;\/]|focus\/\d(?!.+mobile))/i                      // Unidentifiable Tablet
+            ], [[TYPE, TABLET]], [
+            /(phone|mobile(?:[;\/]| [ \w\/\.]*safari)|pda(?=.+windows ce))/i    // Unidentifiable Mobile
+            ], [[TYPE, MOBILE]], [
+            /(android[-\w\. ]{0,9});.+buil/i                                    // Generic Android Device
+            ], [MODEL, [VENDOR, 'Generic']]
+        ],
+
+        engine : [[
+
+            /windows.+ edge\/([\w\.]+)/i                                       // EdgeHTML
+            ], [VERSION, [NAME, EDGE+'HTML']], [
+
+            /webkit\/537\.36.+chrome\/(?!27)([\w\.]+)/i                         // Blink
+            ], [VERSION, [NAME, 'Blink']], [
+
+            /(presto)\/([\w\.]+)/i,                                             // Presto
+            /(webkit|trident|netfront|netsurf|amaya|lynx|w3m|goanna)\/([\w\.]+)/i, // WebKit/Trident/NetFront/NetSurf/Amaya/Lynx/w3m/Goanna
+            /ekioh(flow)\/([\w\.]+)/i,                                          // Flow
+            /(khtml|tasman|links)[\/ ]\(?([\w\.]+)/i,                           // KHTML/Tasman/Links
+            /(icab)[\/ ]([23]\.[\d\.]+)/i,                                      // iCab
+            /\b(libweb)/i
+            ], [NAME, VERSION], [
+
+            /rv\:([\w\.]{1,9})\b.+(gecko)/i                                     // Gecko
+            ], [VERSION, NAME]
+        ],
+
+        os : [[
+
+            // Windows
+            /microsoft (windows) (vista|xp)/i                                   // Windows (iTunes)
+            ], [NAME, VERSION], [
+            /(windows (?:phone(?: os)?|mobile))[\/ ]?([\d\.\w ]*)/i             // Windows Phone
+            ], [NAME, [VERSION, strMapper, windowsVersionMap]], [
+            /windows nt 6\.2; (arm)/i,                                        // Windows RT
+            /windows[\/ ]?([ntce\d\. ]+\w)(?!.+xbox)/i,
+            /(?:win(?=3|9|n)|win 9x )([nt\d\.]+)/i
+            ], [[VERSION, strMapper, windowsVersionMap], [NAME, 'Windows']], [
+
+            // iOS/macOS
+            /ip[honead]{2,4}\b(?:.*os ([\w]+) like mac|; opera)/i,              // iOS
+            /(?:ios;fbsv\/|iphone.+ios[\/ ])([\d\.]+)/i,
+            /cfnetwork\/.+darwin/i
+            ], [[VERSION, /_/g, '.'], [NAME, 'iOS']], [
+            /(mac os x) ?([\w\. ]*)/i,
+            /(macintosh|mac_powerpc\b)(?!.+haiku)/i                             // Mac OS
+            ], [[NAME, MAC_OS], [VERSION, /_/g, '.']], [
+
+            // Mobile OSes
+            /droid ([\w\.]+)\b.+(android[- ]x86|harmonyos)/i                    // Android-x86/HarmonyOS
+            ], [VERSION, NAME], [                                               // Android/WebOS/QNX/Bada/RIM/Maemo/MeeGo/Sailfish OS
+            /(android|webos|qnx|bada|rim tablet os|maemo|meego|sailfish)[-\/ ]?([\w\.]*)/i,
+            /(blackberry)\w*\/([\w\.]*)/i,                                      // Blackberry
+            /(tizen|kaios)[\/ ]([\w\.]+)/i,                                     // Tizen/KaiOS
+            /\((series40);/i                                                    // Series 40
+            ], [NAME, VERSION], [
+            /\(bb(10);/i                                                        // BlackBerry 10
+            ], [VERSION, [NAME, BLACKBERRY]], [
+            /(?:symbian ?os|symbos|s60(?=;)|series60)[-\/ ]?([\w\.]*)/i         // Symbian
+            ], [VERSION, [NAME, 'Symbian']], [
+            /mozilla\/[\d\.]+ \((?:mobile|tablet|tv|mobile; [\w ]+); rv:.+ gecko\/([\w\.]+)/i // Firefox OS
+            ], [VERSION, [NAME, FIREFOX+' OS']], [
+            /web0s;.+rt(tv)/i,
+            /\b(?:hp)?wos(?:browser)?\/([\w\.]+)/i                              // WebOS
+            ], [VERSION, [NAME, 'webOS']], [
+            /watch(?: ?os[,\/]|\d,\d\/)([\d\.]+)/i                              // watchOS
+            ], [VERSION, [NAME, 'watchOS']], [
+
+            // Google Chromecast
+            /crkey\/([\d\.]+)/i                                                 // Google Chromecast
+            ], [VERSION, [NAME, CHROME+'cast']], [
+            /(cros) [\w]+(?:\)| ([\w\.]+)\b)/i                                  // Chromium OS
+            ], [[NAME, CHROMIUM_OS], VERSION],[
+
+            // Smart TVs
+            /panasonic;(viera)/i,                                               // Panasonic Viera
+            /(netrange)mmh/i,                                                   // Netrange
+            /(nettv)\/(\d+\.[\w\.]+)/i,                                         // NetTV
+
+            // Console
+            /(nintendo|playstation) ([wids345portablevuch]+)/i,                 // Nintendo/Playstation
+            /(xbox); +xbox ([^\);]+)/i,                                         // Microsoft Xbox (360, One, X, S, Series X, Series S)
+
+            // Other
+            /\b(joli|palm)\b ?(?:os)?\/?([\w\.]*)/i,                            // Joli/Palm
+            /(mint)[\/\(\) ]?(\w*)/i,                                           // Mint
+            /(mageia|vectorlinux)[; ]/i,                                        // Mageia/VectorLinux
+            /([kxln]?ubuntu|debian|suse|opensuse|gentoo|arch(?= linux)|slackware|fedora|mandriva|centos|pclinuxos|red ?hat|zenwalk|linpus|raspbian|plan 9|minix|risc os|contiki|deepin|manjaro|elementary os|sabayon|linspire)(?: gnu\/linux)?(?: enterprise)?(?:[- ]linux)?(?:-gnu)?[-\/ ]?(?!chrom|package)([-\w\.]*)/i,
+                                                                                // Ubuntu/Debian/SUSE/Gentoo/Arch/Slackware/Fedora/Mandriva/CentOS/PCLinuxOS/RedHat/Zenwalk/Linpus/Raspbian/Plan9/Minix/RISCOS/Contiki/Deepin/Manjaro/elementary/Sabayon/Linspire
+            /(hurd|linux) ?([\w\.]*)/i,                                         // Hurd/Linux
+            /(gnu) ?([\w\.]*)/i,                                                // GNU
+            /\b([-frentopcghs]{0,5}bsd|dragonfly)[\/ ]?(?!amd|[ix346]{1,2}86)([\w\.]*)/i, // FreeBSD/NetBSD/OpenBSD/PC-BSD/GhostBSD/DragonFly
+            /(haiku) (\w+)/i                                                    // Haiku
+            ], [NAME, VERSION], [
+            /(sunos) ?([\w\.\d]*)/i                                             // Solaris
+            ], [[NAME, 'Solaris'], VERSION], [
+            /((?:open)?solaris)[-\/ ]?([\w\.]*)/i,                              // Solaris
+            /(aix) ((\d)(?=\.|\)| )[\w\.])*/i,                                  // AIX
+            /\b(beos|os\/2|amigaos|morphos|openvms|fuchsia|hp-ux|serenityos)/i, // BeOS/OS2/AmigaOS/MorphOS/OpenVMS/Fuchsia/HP-UX/SerenityOS
+            /(unix) ?([\w\.]*)/i                                                // UNIX
+            ], [NAME, VERSION]
+        ]
+    };
+
+    /////////////////
+    // Constructor
+    ////////////////
+
+    var UAParser = function (ua, extensions) {
+
+        if (typeof ua === OBJ_TYPE) {
+            extensions = ua;
+            ua = undefined;
+        }
+
+        if (!(this instanceof UAParser)) {
+            return new UAParser(ua, extensions).getResult();
+        }
+
+        var _navigator = (typeof window !== UNDEF_TYPE && window.navigator) ? window.navigator : undefined;
+        var _ua = ua || ((_navigator && _navigator.userAgent) ? _navigator.userAgent : EMPTY);
+        var _uach = (_navigator && _navigator.userAgentData) ? _navigator.userAgentData : undefined;
+        var _rgxmap = extensions ? extend(regexes, extensions) : regexes;
+        var _isSelfNav = _navigator && _navigator.userAgent == _ua;
+
+        this.getBrowser = function () {
+            var _browser = {};
+            _browser[NAME] = undefined;
+            _browser[VERSION] = undefined;
+            rgxMapper.call(_browser, _ua, _rgxmap.browser);
+            _browser[MAJOR] = majorize(_browser[VERSION]);
+            // Brave-specific detection
+            if (_isSelfNav && _navigator && _navigator.brave && typeof _navigator.brave.isBrave == FUNC_TYPE) {
+                _browser[NAME] = 'Brave';
+            }
+            return _browser;
+        };
+        this.getCPU = function () {
+            var _cpu = {};
+            _cpu[ARCHITECTURE] = undefined;
+            rgxMapper.call(_cpu, _ua, _rgxmap.cpu);
+            return _cpu;
+        };
+        this.getDevice = function () {
+            var _device = {};
+            _device[VENDOR] = undefined;
+            _device[MODEL] = undefined;
+            _device[TYPE] = undefined;
+            rgxMapper.call(_device, _ua, _rgxmap.device);
+            if (_isSelfNav && !_device[TYPE] && _uach && _uach.mobile) {
+                _device[TYPE] = MOBILE;
+            }
+            // iPadOS-specific detection: identified as Mac, but has some iOS-only properties
+            if (_isSelfNav && _device[MODEL] == 'Macintosh' && _navigator && typeof _navigator.standalone !== UNDEF_TYPE && _navigator.maxTouchPoints && _navigator.maxTouchPoints > 2) {
+                _device[MODEL] = 'iPad';
+                _device[TYPE] = TABLET;
+            }
+            return _device;
+        };
+        this.getEngine = function () {
+            var _engine = {};
+            _engine[NAME] = undefined;
+            _engine[VERSION] = undefined;
+            rgxMapper.call(_engine, _ua, _rgxmap.engine);
+            return _engine;
+        };
+        this.getOS = function () {
+            var _os = {};
+            _os[NAME] = undefined;
+            _os[VERSION] = undefined;
+            rgxMapper.call(_os, _ua, _rgxmap.os);
+            if (_isSelfNav && !_os[NAME] && _uach && _uach.platform != 'Unknown') {
+                _os[NAME] = _uach.platform  
+                                    .replace(/chrome os/i, CHROMIUM_OS)
+                                    .replace(/macos/i, MAC_OS);           // backward compatibility
+            }
+            return _os;
+        };
+        this.getResult = function () {
+            return {
+                ua      : this.getUA(),
+                browser : this.getBrowser(),
+                engine  : this.getEngine(),
+                os      : this.getOS(),
+                device  : this.getDevice(),
+                cpu     : this.getCPU()
+            };
+        };
+        this.getUA = function () {
+            return _ua;
+        };
+        this.setUA = function (ua) {
+            _ua = (typeof ua === STR_TYPE && ua.length > UA_MAX_LENGTH) ? trim(ua, UA_MAX_LENGTH) : ua;
+            return this;
+        };
+        this.setUA(_ua);
+        return this;
+    };
+
+    UAParser.VERSION = LIBVERSION;
+    UAParser.BROWSER =  enumerize([NAME, VERSION, MAJOR]);
+    UAParser.CPU = enumerize([ARCHITECTURE]);
+    UAParser.DEVICE = enumerize([MODEL, VENDOR, TYPE, CONSOLE, MOBILE, SMARTTV, TABLET, WEARABLE, EMBEDDED]);
+    UAParser.ENGINE = UAParser.OS = enumerize([NAME, VERSION]);
+
+    ///////////
+    // Export
+    //////////
+
+    // check js environment
+    if (typeof(exports) !== UNDEF_TYPE) {
+        // nodejs env
+        if (typeof module !== UNDEF_TYPE && module.exports) {
+            exports = module.exports = UAParser;
+        }
+        exports.UAParser = UAParser;
+    } else {
+        // requirejs env (optional)
+        if (typeof(define) === FUNC_TYPE && define.amd) {
+            define(function () {
+                return UAParser;
+            });
+        } else if (typeof window !== UNDEF_TYPE) {
+            // browser env
+            window.UAParser = UAParser;
+        }
+    }
+
+    // jQuery/Zepto specific (optional)
+    // Note:
+    //   In AMD env the global scope should be kept clean, but jQuery is an exception.
+    //   jQuery always exports to global scope, unless jQuery.noConflict(true) is used,
+    //   and we should catch that.
+    var $ = typeof window !== UNDEF_TYPE && (window.jQuery || window.Zepto);
+    if ($ && !$.ua) {
+        var parser = new UAParser();
+        $.ua = parser.getResult();
+        $.ua.get = function () {
+            return parser.getUA();
+        };
+        $.ua.set = function (ua) {
+            parser.setUA(ua);
+            var result = parser.getResult();
+            for (var prop in result) {
+                $.ua[prop] = result[prop];
+            }
+        };
+    }
+
+})(typeof window === 'object' ? window : this);

node_modules/karma/node_modules/wrap-ansi/index.js

@@ -0,0 +1,216 @@
+'use strict';
+const stringWidth = require('string-width');
+const stripAnsi = require('strip-ansi');
+const ansiStyles = require('ansi-styles');
+
+const ESCAPES = new Set([
+	'\u001B',
+	'\u009B'
+]);
+
+const END_CODE = 39;
+
+const ANSI_ESCAPE_BELL = '\u0007';
+const ANSI_CSI = '[';
+const ANSI_OSC = ']';
+const ANSI_SGR_TERMINATOR = 'm';
+const ANSI_ESCAPE_LINK = `${ANSI_OSC}8;;`;
+
+const wrapAnsi = code => `${ESCAPES.values().next().value}${ANSI_CSI}${code}${ANSI_SGR_TERMINATOR}`;
+const wrapAnsiHyperlink = uri => `${ESCAPES.values().next().value}${ANSI_ESCAPE_LINK}${uri}${ANSI_ESCAPE_BELL}`;
+
+// Calculate the length of words split on ' ', ignoring
+// the extra characters added by ansi escape codes
+const wordLengths = string => string.split(' ').map(character => stringWidth(character));
+
+// Wrap a long word across multiple rows
+// Ansi escape codes do not count towards length
+const wrapWord = (rows, word, columns) => {
+	const characters = [...word];
+
+	let isInsideEscape = false;
+	let isInsideLinkEscape = false;
+	let visible = stringWidth(stripAnsi(rows[rows.length - 1]));
+
+	for (const [index, character] of characters.entries()) {
+		const characterLength = stringWidth(character);
+
+		if (visible + characterLength <= columns) {
+			rows[rows.length - 1] += character;
+		} else {
+			rows.push(character);
+			visible = 0;
+		}
+
+		if (ESCAPES.has(character)) {
+			isInsideEscape = true;
+			isInsideLinkEscape = characters.slice(index + 1).join('').startsWith(ANSI_ESCAPE_LINK);
+		}
+
+		if (isInsideEscape) {
+			if (isInsideLinkEscape) {
+				if (character === ANSI_ESCAPE_BELL) {
+					isInsideEscape = false;
+					isInsideLinkEscape = false;
+				}
+			} else if (character === ANSI_SGR_TERMINATOR) {
+				isInsideEscape = false;
+			}
+
+			continue;
+		}
+
+		visible += characterLength;
+
+		if (visible === columns && index < characters.length - 1) {
+			rows.push('');
+			visible = 0;
+		}
+	}
+
+	// It's possible that the last row we copy over is only
+	// ansi escape characters, handle this edge-case
+	if (!visible && rows[rows.length - 1].length > 0 && rows.length > 1) {
+		rows[rows.length - 2] += rows.pop();
+	}
+};
+
+// Trims spaces from a string ignoring invisible sequences
+const stringVisibleTrimSpacesRight = string => {
+	const words = string.split(' ');
+	let last = words.length;
+
+	while (last > 0) {
+		if (stringWidth(words[last - 1]) > 0) {
+			break;
+		}
+
+		last--;
+	}
+
+	if (last === words.length) {
+		return string;
+	}
+
+	return words.slice(0, last).join(' ') + words.slice(last).join('');
+};
+
+// The wrap-ansi module can be invoked in either 'hard' or 'soft' wrap mode
+//
+// 'hard' will never allow a string to take up more than columns characters
+//
+// 'soft' allows long words to expand past the column length
+const exec = (string, columns, options = {}) => {
+	if (options.trim !== false && string.trim() === '') {
+		return '';
+	}
+
+	let returnValue = '';
+	let escapeCode;
+	let escapeUrl;
+
+	const lengths = wordLengths(string);
+	let rows = [''];
+
+	for (const [index, word] of string.split(' ').entries()) {
+		if (options.trim !== false) {
+			rows[rows.length - 1] = rows[rows.length - 1].trimStart();
+		}
+
+		let rowLength = stringWidth(rows[rows.length - 1]);
+
+		if (index !== 0) {
+			if (rowLength >= columns && (options.wordWrap === false || options.trim === false)) {
+				// If we start with a new word but the current row length equals the length of the columns, add a new row
+				rows.push('');
+				rowLength = 0;
+			}
+
+			if (rowLength > 0 || options.trim === false) {
+				rows[rows.length - 1] += ' ';
+				rowLength++;
+			}
+		}
+
+		// In 'hard' wrap mode, the length of a line is never allowed to extend past 'columns'
+		if (options.hard && lengths[index] > columns) {
+			const remainingColumns = (columns - rowLength);
+			const breaksStartingThisLine = 1 + Math.floor((lengths[index] - remainingColumns - 1) / columns);
+			const breaksStartingNextLine = Math.floor((lengths[index] - 1) / columns);
+			if (breaksStartingNextLine < breaksStartingThisLine) {
+				rows.push('');
+			}
+
+			wrapWord(rows, word, columns);
+			continue;
+		}
+
+		if (rowLength + lengths[index] > columns && rowLength > 0 && lengths[index] > 0) {
+			if (options.wordWrap === false && rowLength < columns) {
+				wrapWord(rows, word, columns);
+				continue;
+			}
+
+			rows.push('');
+		}
+
+		if (rowLength + lengths[index] > columns && options.wordWrap === false) {
+			wrapWord(rows, word, columns);
+			continue;
+		}
+
+		rows[rows.length - 1] += word;
+	}
+
+	if (options.trim !== false) {
+		rows = rows.map(stringVisibleTrimSpacesRight);
+	}
+
+	const pre = [...rows.join('\n')];
+
+	for (const [index, character] of pre.entries()) {
+		returnValue += character;
+
+		if (ESCAPES.has(character)) {
+			const {groups} = new RegExp(`(?:\\${ANSI_CSI}(?<code>\\d+)m|\\${ANSI_ESCAPE_LINK}(?<uri>.*)${ANSI_ESCAPE_BELL})`).exec(pre.slice(index).join('')) || {groups: {}};
+			if (groups.code !== undefined) {
+				const code = Number.parseFloat(groups.code);
+				escapeCode = code === END_CODE ? undefined : code;
+			} else if (groups.uri !== undefined) {
+				escapeUrl = groups.uri.length === 0 ? undefined : groups.uri;
+			}
+		}
+
+		const code = ansiStyles.codes.get(Number(escapeCode));
+
+		if (pre[index + 1] === '\n') {
+			if (escapeUrl) {
+				returnValue += wrapAnsiHyperlink('');
+			}
+
+			if (escapeCode && code) {
+				returnValue += wrapAnsi(code);
+			}
+		} else if (character === '\n') {
+			if (escapeCode && code) {
+				returnValue += wrapAnsi(escapeCode);
+			}
+
+			if (escapeUrl) {
+				returnValue += wrapAnsiHyperlink(escapeUrl);
+			}
+		}
+	}
+
+	return returnValue;
+};
+
+// For each newline, invoke the method separately
+module.exports = (string, columns, options) => {
+	return String(string)
+		.normalize()
+		.replace(/\r\n/g, '\n')
+		.split('\n')
+		.map(line => exec(line, columns, options))
+		.join('\n');
+};